{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9c3a1859-d006-4787-a27f-653d578f7fba", "code": "870653-45-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=870653-45-5", "code_system": "CAS", "references": [ "ed27283d-c6a9-4163-b597-876ecdee8649", "6f9af809-6c65-4fc6-82c9-565009067335" ] }, { "uuid": "f6db322d-30f8-4406-9025-cd06009cc236", "code": "11302540", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11302540", "code_system": "PUBCHEM", "references": [ "ed27283d-c6a9-4163-b597-876ecdee8649" ] }, { "uuid": "ef01564a-e372-4164-ea66-7a9d47ba639a", "code": "DTXSID80461776", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80461776", "code_system": "EPA CompTox", "references": [ "f295f50a-c0fb-91c5-7a1d-d97e83e2a7ea" ] }, { "uuid": "704a4ea4-b221-434f-968c-145aabcafa51", "code": "A62C114Q0Q", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2b34c21d-ab76-536c-3a0f-6972513ec13f", "code": "300000042330", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "272ef074-0b90-6bf8-d2e0-df987910d515" ] } ], "relationships": [ { "uuid": "2808dd88-c7ee-4885-96ff-de5c3bbd24f4", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "5a8b36a5-c4f3-4fad-a0af-4139adff1192", "refuuid": "3927b5f6-1133-4580-a74e-0ed4d9a6b79f", "name": "PAP-1", "unii": "A62C114Q0Q", "linking_id": "A62C114Q0Q", "ref_pname": "PAP-1", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "204bcd8b-be47-4386-a764-070eea767efb", "name": "5-(4-PHENOXYBUTOXY)PSORALEN", "stdName": "5-(4-PHENOXYBUTOXY)PSORALEN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "749792f7-55a2-4aea-926d-f0f1b14e0d62", "126f67aa-efed-4c2b-a0ff-0419444e2a6c" ], "display_name": false }, { "uuid": "18c7867c-081e-4a82-beb8-c074d0626af7", "name": "7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE, 4-(4-PHENOXYBUTOXY)-", "stdName": "7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE, 4-(4-PHENOXYBUTOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "749792f7-55a2-4aea-926d-f0f1b14e0d62", "126f67aa-efed-4c2b-a0ff-0419444e2a6c" ], "display_name": false }, { "uuid": "d1e58992-af0f-4bff-b1a4-af9bca29ab35", "name": "PAP-1", "stdName": "PAP-1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "749792f7-55a2-4aea-926d-f0f1b14e0d62", "126f67aa-efed-4c2b-a0ff-0419444e2a6c" ], "display_name": true } ], "references": [ { "uuid": "126f67aa-efed-4c2b-a0ff-0419444e2a6c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "749792f7-55a2-4aea-926d-f0f1b14e0d62", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ed27283d-c6a9-4163-b597-876ecdee8649", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392570000, "tags": [ "NOMEN" ] }, { "uuid": "79750470-19d0-4ced-8a76-47a374d0c477", "citation": "SRS import [A62C114Q0Q]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A62C114Q0Q", "doc_type": "SRS", "public_domain": true, "document_date": 1493392570000, "tags": [ "NOMEN" ] }, { "uuid": "f295f50a-c0fb-91c5-7a1d-d97e83e2a7ea", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=870653-45-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6f9af809-6c65-4fc6-82c9-565009067335", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "272ef074-0b90-6bf8-d2e0-df987910d515", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "edf585c7-76ea-4fc0-aa94-059be25b6554", "id": "edf585c7-76ea-4fc0-aa94-059be25b6554", "molfile": "\n Marvin 01132112192D \n\n 26 29 0 0 0 0 999 V2000\n -2.8579 3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4991 2.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9840 3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4991 3.7612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 2 3 1 0 0 0 0\n 2 26 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 25 2 0 0 0 0\n 6 7 1 0 0 0 0\n 19 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 23 19 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)OCCCCOc2c3ccc(=O)oc3cc4c2cco4", "formula": "C21H18O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d66c3963-61ce-4481-92ea-1f8581e7c5c9" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "350.3654", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3927b5f6-1133-4580-a74e-0ed4d9a6b79f", "version": "4", "structure": { "id": "bf0d246a-fe3d-4822-8ae5-ed4518cbf642", "molfile": "\n Marvin 01132109532D \n\n 26 29 0 0 0 0 999 V2000\n -2.1434 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4991 3.7612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4991 2.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9840 3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 4 2 0 0 0 0\n 7 5 2 0 0 0 0\n 12 13 2 0 0 0 0\n 11 13 1 0 0 0 0\n 12 9 1 0 0 0 0\n 11 8 1 0 0 0 0\n 1 14 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 15 16 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 21 26 2 0 0 0 0\n 20 21 1 0 0 0 0\n 19 20 1 0 0 0 0\n 10 15 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)OCCCCOc2c3ccc(=O)oc3cc4c2cco4", "formula": "C21H18O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "350.3654", "optical_activity": "NONE", "references": [ "79750470-19d0-4ced-8a76-47a374d0c477", "126f67aa-efed-4c2b-a0ff-0419444e2a6c" ], "stereo_centers": 0 }, "unii": "A62C114Q0Q" } ] }