{
"meta": {
"disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
"terms": "https://open.fda.gov/terms/",
"license": "https://open.fda.gov/license/",
"last_updated": "2026-09-09",
"results": {
"skip": 0,
"limit": 1,
"total": 1
}
},
"results": [
{
"codes": [
{
"uuid": "0b50c47d-2b4f-ccca-71b6-eb9aad9efd84",
"code": "134350025",
"type": "PRIMARY",
"url": "https://pubchem.ncbi.nlm.nih.gov/compound/134350025",
"code_system": "PUBCHEM",
"references": [
"9464dac7-099a-b83f-9a92-f535bce20e17"
]
},
{
"uuid": "7de67a13-f070-4807-aa96-1a1a77e2396f",
"code": "A5CR4WJQ6X",
"type": "PRIMARY",
"code_system": "FDA UNII"
},
{
"uuid": "0f2abf67-e3d0-4506-9e3b-0fdb6cebd9de",
"code": "1894171-12-0",
"type": "NON-SPECIFIC STEREOCHEMISTRY",
"url": "https://commonchemistry.cas.org/detail?cas_rn=1894171-12-0",
"code_system": "CAS",
"references": [
"6ff2a3a2-c3bb-40fa-b003-bb3314dbc439"
]
},
{
"uuid": "7529fac2-6e97-42c7-a4f6-3a543247e9c9",
"code": "1414380-75-8",
"type": "PRIMARY",
"url": "https://commonchemistry.cas.org/detail?cas_rn=1414380-75-8",
"code_system": "CAS",
"references": [
"6ff2a3a2-c3bb-40fa-b003-bb3314dbc439"
]
}
],
"relationships": [
{
"uuid": "9b21e7c4-23cc-4bdf-9a0e-5c5f14b8da0d",
"amount": {
"uuid": "14b641c0-995d-4955-ad7e-e98a11ea22c2"
},
"type": "SALT/SOLVATE->PARENT",
"references": [
"f8a4ca1d-3145-4dba-91ab-eda375149bfc"
],
"related_substance": {
"uuid": "66903914-f45e-46a2-9de2-538775db935c",
"refuuid": "b961e150-5827-4d73-ab5b-792c684136a1",
"name": "Heptasodium Hexacarboxymethyl Dipeptide-12",
"unii": "D7956W29BM",
"linking_id": "D7956W29BM",
"ref_pname": "Heptasodium Hexacarboxymethyl Dipeptide-12",
"substance_class": "reference"
}
}
],
"substance_class": "chemical",
"names": [
{
"uuid": "0daa4a07-7084-4ce6-9d46-5e61f90c45d4",
"name": "(2S)-2-[[(2S)-2,6-bis[bis(carboxymethyl)amino]hexanoyl]amino]-6-[bis(carboxymethyl)amino]hexanoic acid",
"stdName": "(2S)-2-(((2S)-2,6-BIS(BIS(CARBOXYMETHYL)AMINO)HEXANOYL)AMINO)-6-(BIS(CARBOXYMETHYL)AMINO)HEXANOIC ACID",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"9464dac7-099a-b83f-9a92-f535bce20e17"
],
"display_name": false
},
{
"uuid": "5281ff92-c8fc-41bc-85d3-c65bb30fde6e",
"name": "Hexacarboxymethyl Dipeptide-12",
"stdName": "HEXACARBOXYMETHYL DIPEPTIDE-12",
"type": "of",
"languages": [
"en"
],
"preferred": false,
"references": [
"98b7afe9-5053-4f8c-8e0d-674dbefa8b90"
],
"display_name": true,
"domains": [
"cosmetic"
],
"name_orgs": [
{
"uuid": "7315e32e-61a3-4229-8a34-914e090624cb",
"name_org": "INCI"
}
]
},
{
"uuid": "4809f21f-4fbc-4fc9-ba3a-cd659ea31dbf",
"name": "L-Lysine, N2,N2,N6,N6-tetrakis(carboxymethyl)-L-lysyl-N6,N6-bis(carboxymethyl)-",
"stdName": "L-LYSINE, N2,N2,N6,N6-TETRAKIS(CARBOXYMETHYL)-L-LYSYL-N6,N6-BIS(CARBOXYMETHYL)-",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"6ff2a3a2-c3bb-40fa-b003-bb3314dbc439"
],
"display_name": false
},
{
"uuid": "ad776349-c7b1-4929-bb21-cd5a37502301",
"name": "N2,N2,N6,N6-Tetrakis(carboxymethyl)-L-lysyl-N6,N6-bis(carboxymethyl)-L-lysine",
"stdName": "N2,N2,N6,N6-TETRAKIS(CARBOXYMETHYL)-L-LYSYL-N6,N6-BIS(CARBOXYMETHYL)-L-LYSINE",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"6ff2a3a2-c3bb-40fa-b003-bb3314dbc439"
],
"display_name": false
}
],
"references": [
{
"uuid": "9464dac7-099a-b83f-9a92-f535bce20e17",
"citation": "PUBCHEM",
"doc_type": "PUBCHEM",
"public_domain": true
},
{
"uuid": "6ff2a3a2-c3bb-40fa-b003-bb3314dbc439",
"citation": "STN (SCIFINDER)",
"doc_type": "STN (SCIFINDER)",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "98b7afe9-5053-4f8c-8e0d-674dbefa8b90",
"citation": "PERSONAL CARE PRODUCTS COUNCIL",
"doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "f8a4ca1d-3145-4dba-91ab-eda375149bfc",
"citation": "STN (SCIFINDER)",
"doc_type": "STN (SCIFINDER)",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
}
],
"definition_type": "PRIMARY",
"moieties": [
{
"uuid": "26f832e6-dfcd-476e-b39a-e57f2298f3b7",
"id": "26f832e6-dfcd-476e-b39a-e57f2298f3b7",
"molfile": "N2,N2,N6,N6-Tetrakis(carboxymethyl)-L-lysyl-N6,N6-bis(carboxymethyl)-L-lysine\n CDK 08082416482D\n1414380-75-8 Copyright (C) 2024 ACS\n 43 42 0 0 1 0 0 0 0 0999 V2000\n 9.2400 9.3356 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.0100 10.6694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0100 8.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7000 9.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5500 10.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2400 12.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5500 8.0020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2400 6.6684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9300 8.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3200 12.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7000 12.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3200 6.6684 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.3900 8.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8600 12.0031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5500 13.3367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9300 13.3367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9300 10.6694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8600 6.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5500 5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6200 6.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6300 5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0100 5.3347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3200 4.0009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0800 6.6684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1700 5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3100 8.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3100 5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9400 4.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7700 8.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0800 4.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4800 4.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 9.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 6.6684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6200 4.0009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3100 2.6673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2500 2.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2500 5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4800 1.3336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7900 5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2500 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9400 1.3336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5600 6.6684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5600 4.0009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 9 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 11 1 0 0 0 0\n 7 12 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 16 1 0 0 0 0\n 11 17 2 0 0 0 0\n 12 18 1 1 0 0 0\n 12 19 1 0 0 0 0\n 13 20 1 0 0 0 0\n 18 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 19 23 2 0 0 0 0\n 20 24 1 0 0 0 0\n 21 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 26 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 28 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 29 33 2 0 0 0 0\n 30 34 1 0 0 0 0\n 30 35 2 0 0 0 0\n 31 36 1 0 0 0 0\n 31 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 37 39 1 0 0 0 0\n 38 40 1 0 0 0 0\n 38 41 2 0 0 0 0\n 39 42 1 0 0 0 0\n 39 43 2 0 0 0 0\nM END",
"smiles": "C(CCN(CC(=O)O)CC(=O)O)C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O",
"formula": "C24H38N4O15",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "ABSOLUTE",
"count_amount": {
"type": "MOL RATIO",
"average": 1,
"units": "MOL RATIO",
"uuid": "76b8d440-dd3a-43a6-bf5a-5a66565e4ac7"
},
"defined_stereo": 2,
"ez_centers": 0,
"molecular_weight": "622.5773",
"optical_activity": "UNSPECIFIED",
"stereo_centers": 2
}
],
"definition_level": "COMPLETE",
"uuid": "02ce612d-6d09-48dc-9ba8-9ca44d1609b6",
"version": "6",
"structure": {
"id": "e792aeda-92ee-4df6-929d-9f331601e399",
"molfile": "N2,N2,N6,N6-Tetrakis(carboxymethyl)-L-lysyl-N6,N6-bis(carboxymethyl)-L-lysine\n JSDraw208082416482D\n\n 43 42 0 0 1 0 0 V2000\n 25.6319 -5.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4119 -4.2619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4119 -6.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0719 -5.6128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9719 -4.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6319 -2.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9719 -6.9639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6319 -8.3148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2919 -6.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7519 -2.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0719 -2.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7519 -8.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7319 -6.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3118 -2.9109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9719 -1.5600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2919 -1.5600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2919 -4.2619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3118 -8.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9719 -9.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9520 -8.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0918 -9.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4119 -9.6658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7519 -11.0169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3920 -8.3148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6518 -9.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6120 -6.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6120 -9.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4318 -11.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0520 -6.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3920 -11.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9918 -11.0169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2720 -5.6128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2720 -8.3148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9520 -11.0169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6120 -12.3678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.7718 -12.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.7718 -9.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9918 -13.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3318 -9.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.7718 -15.0697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4318 -13.7188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.1118 -8.3148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.1118 -11.0169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 9 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 11 1 0 0 0 0\n 7 12 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 16 1 0 0 0 0\n 11 17 2 0 0 0 0\n 12 18 1 1 0 0 0\n 12 19 1 0 0 0 0\n 13 20 1 0 0 0 0\n 18 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 19 23 2 0 0 0 0\n 20 24 1 0 0 0 0\n 21 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 26 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 28 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 29 33 2 0 0 0 0\n 30 34 1 0 0 0 0\n 30 35 2 0 0 0 0\n 31 36 1 0 0 0 0\n 31 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 37 39 1 0 0 0 0\n 38 40 1 0 0 0 0\n 38 41 2 0 0 0 0\n 39 42 1 0 0 0 0\n 39 43 2 0 0 0 0\nM END",
"smiles": "C(CCN(CC(=O)O)CC(=O)O)C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O",
"formula": "C24H38N4O15",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "ABSOLUTE",
"defined_stereo": 2,
"ez_centers": 0,
"molecular_weight": "622.5773",
"optical_activity": "UNSPECIFIED",
"references": [
"98b7afe9-5053-4f8c-8e0d-674dbefa8b90"
],
"stereo_centers": 2
},
"unii": "A5CR4WJQ6X"
}
]
}