{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0384836d-fa46-465a-80bd-b82e1f401104",
          "code": "1197186-61-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1197186-61-0",
          "code_system": "CAS",
          "references": [
            "1dfedd6f-aa64-44a4-834d-7bf0b8347de9",
            "265f9beb-c43f-4116-9384-e987dc7a46a9"
          ]
        },
        {
          "uuid": "ee4cce85-fd1f-294c-fa24-780b037782a8",
          "code": "DTXSID00152558",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00152558",
          "code_system": "EPA CompTox",
          "references": [
            "f8fe26a2-c3ce-8e98-6bcc-3ec87c54eb50"
          ]
        },
        {
          "uuid": "b41b23f1-505d-e50d-b9ba-764d8332377c",
          "code": "12969087",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12969087",
          "code_system": "PUBCHEM",
          "references": [
            "82998b16-239b-e569-6df5-e5b61b2e9ad6"
          ]
        },
        {
          "uuid": "770c8732-183e-4c71-855e-4d54eea49f58",
          "code": "A54X5E4519",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "7ada968d-ce6c-41b9-b5d1-5a64ed309681",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "1632a6f0-f076-4142-9169-c73c09f2ecd1",
            "refuuid": "c473fb6b-b69d-46bf-829b-08d21cba0753",
            "name": "Cysteine",
            "unii": "K848JZ4886",
            "linking_id": "K848JZ4886",
            "ref_pname": "Cysteine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "20f45e84-b196-43f5-a926-5652df1d8dda",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "47e17d13-78af-4a4f-8d4b-8f2a372be481",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3aa335b8-7830-455b-acaf-7dce8edfeceb",
          "amount": {
            "uuid": "c03a53d7-72ae-494b-b4e1-2e7f21c3fca2"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "cb5ad52f-47ad-48f3-bbf5-219056a755f1",
            "refuuid": "c473fb6b-b69d-46bf-829b-08d21cba0753",
            "name": "Cysteine",
            "unii": "K848JZ4886",
            "linking_id": "K848JZ4886",
            "ref_pname": "Cysteine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8e9977cd-3289-4e62-9ef5-7925ed3ffd0a",
          "name": "(-)-CYSTEINE, ZINC SALT",
          "stdName": "(-)-CYSTEINE, ZINC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95581999-3f2e-4daa-b055-fe28ef84f821",
            "2ab59677-f70c-4406-9910-efbb32f5b55b"
          ],
          "display_name": false
        },
        {
          "uuid": "a12cee0e-64e7-4c1b-94ab-6617f31d8e6f",
          "name": "L-CYSTEINE, ZINC SALT",
          "stdName": "L-CYSTEINE, ZINC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95581999-3f2e-4daa-b055-fe28ef84f821",
            "2ab59677-f70c-4406-9910-efbb32f5b55b"
          ],
          "display_name": false
        },
        {
          "uuid": "3af17066-a30b-493f-aa6b-8724ed9f3b23",
          "name": "ZINC CYSTEATE",
          "stdName": "ZINC CYSTEATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe4544e8-179f-470a-bb59-8eb024aea681",
            "2ab59677-f70c-4406-9910-efbb32f5b55b"
          ],
          "display_name": false
        },
        {
          "uuid": "75435ab5-b5c9-4e43-ab63-6e4edbf76bc7",
          "name": "ZINC CYSTEINATE",
          "stdName": "ZINC CYSTEINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe4544e8-179f-470a-bb59-8eb024aea681",
            "95581999-3f2e-4daa-b055-fe28ef84f821",
            "2ccb8ed3-a935-4dc5-b666-91b0dea36db8",
            "2ab59677-f70c-4406-9910-efbb32f5b55b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "124fe48c-6849-4ff2-be3b-dbbe5fac314c",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "fe4544e8-179f-470a-bb59-8eb024aea681",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1dfedd6f-aa64-44a4-834d-7bf0b8347de9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f293f44-cdd6-45f0-b7ae-71a9b8b68092",
          "citation": "SRS import [A54X5E4519]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A54X5E4519",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfb8a4c1-017e-4393-aa23-ef1622e0f3bf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ccb8ed3-a935-4dc5-b666-91b0dea36db8",
          "citation": "ZINC CYSTEINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "95581999-3f2e-4daa-b055-fe28ef84f821",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2ab59677-f70c-4406-9910-efbb32f5b55b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8fe26a2-c3ce-8e98-6bcc-3ec87c54eb50",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1197186-61-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "265f9beb-c43f-4116-9384-e987dc7a46a9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "82998b16-239b-e569-6df5-e5b61b2e9ad6",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6d16dc60-31f1-4b92-bb57-dec2bcf74dad",
          "id": "6d16dc60-31f1-4b92-bb57-dec2bcf74dad",
          "molfile": "\n  Marvin  01132105402D          \n\n  1  0  0  0  1  0            999 V2000\n   13.1122   -6.2044    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b0c8f48d-bb76-4635-af41-0664b66a4d0b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "3c9b2282-4a87-422b-bea4-00495114f113",
          "id": "3c9b2282-4a87-422b-bea4-00495114f113",
          "molfile": "\n  Marvin  01132103132D          \n\n  7  6  0  0  1  0            999 V2000\n    8.0464   -5.4793    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.7615   -5.8912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0464   -4.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7615   -4.2437    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3316   -5.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3316   -6.7196    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.6213   -5.4793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\nM  CHG  1   6  -1\nM  END",
          "smiles": "C([C@@H](C(=O)[O-])N)S",
          "formula": "C3H6NO2S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "361aa587-10d8-42c8-a374-09790239f535"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "120.1515",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cc95be97-e9a3-4ea3-ab00-812f75c03974",
      "version": "8",
      "structure": {
        "id": "203b8d63-9fa1-4600-ab01-af777f43c36d",
        "molfile": "\n  Marvin  01132101502D          \n\n 15 12  0  0  1  0            999 V2000\n   13.1122   -6.2044    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    8.7615   -4.2437    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0464   -4.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0464   -5.4793    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3316   -5.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3316   -6.7196    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.6213   -5.4793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7615   -5.8912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7615   -4.2437    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0464   -4.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0464   -5.4793    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3316   -5.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3316   -6.7196    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.6213   -5.4793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7615   -5.8912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  4  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 15  1  6  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  CHG  3   1   2   6  -1  13  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 14   2   3   4   5   6   7   8   9  10  11  12  13  14  15\nM  SPA   1  7   2   3   4   5   6   7   8\nM  SDI   1  4    6.2013   -7.1396    6.2013   -3.8237\nM  SDI   1  4    9.1815   -3.8237    9.1815   -7.1396\nM  SMT   1 2\nM  END",
        "smiles": "C([C@@H](C(=O)[O-])N)S.C([C@@H](C(=O)[O-])N)S.[Zn+2]",
        "formula": "2C3H6NO2S.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "305.6985",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "dfb8a4c1-017e-4393-aa23-ef1622e0f3bf",
          "3f293f44-cdd6-45f0-b7ae-71a9b8b68092"
        ],
        "stereo_centers": 2
      },
      "unii": "A54X5E4519"
    }
  ]
}