{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "702cc959-27ee-4c00-b248-28ed89340888",
          "code": "C84206",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84206",
          "code_system": "NCI_THESAURUS",
          "references": [
            "540c37b6-c129-4531-ba4e-5b51a08b3e0d"
          ]
        },
        {
          "uuid": "bd63368d-6ed3-4ddb-8885-e237132ffd91",
          "code": "552-22-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=552-22-7",
          "code_system": "CAS",
          "references": [
            "540c37b6-c129-4531-ba4e-5b51a08b3e0d",
            "cc2839f6-1e66-4b45-aa2e-98716bf529fe"
          ]
        },
        {
          "uuid": "9536c9c7-6f7f-45cd-9385-b74d7ea702d7",
          "code": "209-007-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.189",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "540c37b6-c129-4531-ba4e-5b51a08b3e0d"
          ]
        },
        {
          "uuid": "ff013065-c31f-47fd-b00e-7e916869ba4b",
          "code": "89717",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/89717/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "540c37b6-c129-4531-ba4e-5b51a08b3e0d"
          ]
        },
        {
          "uuid": "ab553024-0644-4a1c-b61b-13c954f1ff5f",
          "code": "SUB15556MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "540c37b6-c129-4531-ba4e-5b51a08b3e0d"
          ]
        },
        {
          "uuid": "12e1bac9-8cc2-4c6e-9655-73d74e763254",
          "code": "CHEMBL1482931",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1482931",
          "code_system": "ChEMBL",
          "references": [
            "540c37b6-c129-4531-ba4e-5b51a08b3e0d"
          ]
        },
        {
          "uuid": "1109f3c3-c01b-439b-8ca8-7f0bbcd28a9f",
          "code": "11088",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11088",
          "code_system": "PUBCHEM",
          "references": [
            "540c37b6-c129-4531-ba4e-5b51a08b3e0d"
          ]
        },
        {
          "uuid": "3fdcedd2-b206-9ac0-f649-c930e4216595",
          "code": "867",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/867",
          "code_system": "HSDB",
          "references": [
            "2642a21c-d949-7f8e-401e-d3f319874317"
          ]
        },
        {
          "uuid": "4732d390-03be-bbb4-d406-deee30e2dbd8",
          "code": "DTXSID3046081",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3046081",
          "code_system": "EPA CompTox",
          "references": [
            "dead3bf5-4964-ba10-842d-82fdb89dba86"
          ]
        },
        {
          "uuid": "7eee90c4-e86d-3841-cd7a-de0b5bfb0d92",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1ecfb289-09eb-05d6-1473-8b2b1b034109"
          ]
        },
        {
          "uuid": "35459288-0428-40f8-a1f1-4d9fdeab3cce",
          "code": "A51HJM3XSU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d4666bcc-2898-b7ef-28ad-058c43190520",
          "code": "A51HJM3XSU",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=A51HJM3XSU",
          "code_system": "DAILYMED",
          "references": [
            "2c514b35-d73b-f8f3-0dfa-63ae2587928e"
          ]
        },
        {
          "uuid": "69b62cd2-6d69-9881-e5a8-60827a5b48e3",
          "code": "100000077005",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5ad24f1a-4f70-90f2-6fb6-e6abd04302e0"
          ]
        },
        {
          "uuid": "c786aa71-1f4e-c64b-a057-d4fcd7fdd412",
          "code": "2222",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2222",
          "code_system": "NSC",
          "references": [
            "93982361-2eac-10f7-5174-465bc65230f9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fddb37cf-1946-48af-b500-2e8596cf14c2",
          "name": "1,1'-BIPHENYL, 4,4'-BIS(IODOOXY)-2,2'-DIMETHYL-5, 5'-BIS(1-METHYLETHYL)-",
          "stdName": "1,1'-BIPHENYL, 4,4'-BIS(IODOOXY)-2,2'-DIMETHYL-5, 5'-BIS(1-METHYLETHYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ca7368e-8e77-4ec5-bfcc-0a8fa5282aa1",
            "b5e7bc92-d47f-40e8-973d-7b4d8fbd079f"
          ],
          "display_name": false
        },
        {
          "uuid": "0258b063-c8c7-4890-afe7-ce93b247c43d",
          "name": "4,4'-BIS(IODOOXY)-2,2'-DIMETHYL-5,5'-BIS(1-METHYLETHYL-1,1'-BIPHENYL",
          "stdName": "4,4'-BIS(IODOOXY)-2,2'-DIMETHYL-5,5'-BIS(1-METHYLETHYL-1,1'-BIPHENYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ca7368e-8e77-4ec5-bfcc-0a8fa5282aa1",
            "b5e7bc92-d47f-40e8-973d-7b4d8fbd079f"
          ],
          "display_name": false
        },
        {
          "uuid": "de83c83f-44f1-4c8d-a520-ff4dd8199584",
          "name": "IODOTHYMOL",
          "stdName": "IODOTHYMOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ca7368e-8e77-4ec5-bfcc-0a8fa5282aa1",
            "b5e7bc92-d47f-40e8-973d-7b4d8fbd079f"
          ],
          "display_name": false
        },
        {
          "uuid": "56b140c7-72de-411b-9497-70812404c910",
          "name": "NSC-2222",
          "stdName": "NSC-2222",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5e7bc92-d47f-40e8-973d-7b4d8fbd079f",
            "a1e4e2b8-c43b-41de-a3f3-8cce79a7e280"
          ],
          "display_name": false
        },
        {
          "uuid": "e103db99-9a88-49e6-b0fd-16d913d97ee9",
          "name": "THYMOL IODIDE",
          "stdName": "THYMOL IODIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3459f491-153b-4b9d-89e2-9fa230043e63",
            "47b7f736-4c4a-46a1-b804-97efef25263d",
            "b5e7bc92-d47f-40e8-973d-7b4d8fbd079f",
            "7e2a69b8-47d2-481f-a1d3-2567f9d452df",
            "aebb073c-b5fa-49fd-8e38-4e1354a7e1cc",
            "bbd04086-e37a-42a9-bf8a-fea4b764783d",
            "0a58f3e0-fb2c-4f1a-abff-5cc85e709c73",
            "9edd3970-73e0-451d-9211-8d476ca8e19a"
          ],
          "display_name": true
        },
        {
          "uuid": "27f62ef3-744f-470a-a4e2-4de9c38157b0",
          "name": "THYMOL IODIDE [HSDB]",
          "stdName": "THYMOL IODIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a58f3e0-fb2c-4f1a-abff-5cc85e709c73",
            "b5e7bc92-d47f-40e8-973d-7b4d8fbd079f"
          ],
          "display_name": false
        },
        {
          "uuid": "48e0d0ec-38a6-41e8-88a3-2f557e17df52",
          "name": "THYMOL IODIDE [VANDF]",
          "stdName": "THYMOL IODIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e2a69b8-47d2-481f-a1d3-2567f9d452df",
            "b5e7bc92-d47f-40e8-973d-7b4d8fbd079f"
          ],
          "display_name": false
        },
        {
          "uuid": "4b876403-82bd-5932-87d1-5ef0b20d27be",
          "name": "Thymol iodide [WHO-DD]",
          "stdName": "THYMOL IODIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ee5b610-73f3-a738-bcf2-4aaaae24de5e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aebb073c-b5fa-49fd-8e38-4e1354a7e1cc",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7ca7368e-8e77-4ec5-bfcc-0a8fa5282aa1",
          "citation": "http://environmentalchemistry.com/yogi/chemicals/cn/Thymol%A0Iodide.html",
          "url": "http://environmentalchemistry.com/yogi/chemicals/cn/Thymol%A0Iodide.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5e7bc92-d47f-40e8-973d-7b4d8fbd079f",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a58f3e0-fb2c-4f1a-abff-5cc85e709c73",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3459f491-153b-4b9d-89e2-9fa230043e63",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e2a69b8-47d2-481f-a1d3-2567f9d452df",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1e4e2b8-c43b-41de-a3f3-8cce79a7e280",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "540c37b6-c129-4531-ba4e-5b51a08b3e0d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389697000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1908a70a-90c2-4e24-a345-37ba52f4028e",
          "citation": "SRS import [A51HJM3XSU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A51HJM3XSU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389697000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a89d6990-4fb4-4101-aa89-09665020cf1d",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbd04086-e37a-42a9-bf8a-fea4b764783d",
          "citation": "THYMOL IODIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "47b7f736-4c4a-46a1-b804-97efef25263d",
          "citation": "THYMOL IODIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9edd3970-73e0-451d-9211-8d476ca8e19a",
          "citation": "THYMOL IODIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2642a21c-d949-7f8e-401e-d3f319874317",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+552-22-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dead3bf5-4964-ba10-842d-82fdb89dba86",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=552-22-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1ecfb289-09eb-05d6-1473-8b2b1b034109",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4ee5b610-73f3-a738-bcf2-4aaaae24de5e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cc2839f6-1e66-4b45-aa2e-98716bf529fe",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "93982361-2eac-10f7-5174-465bc65230f9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2c514b35-d73b-f8f3-0dfa-63ae2587928e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5ad24f1a-4f70-90f2-6fb6-e6abd04302e0",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "23ea7c5d-ef2d-4e52-b2b9-93778cd54961",
          "id": "23ea7c5d-ef2d-4e52-b2b9-93778cd54961",
          "molfile": "\n  Marvin  01132102002D          \n\n 24 25  0  0  0  0            999 V2000\n    8.9917   -3.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4091   -3.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2348   -3.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9917   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1659   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7575   -5.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1659   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9980   -6.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9917   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4091   -5.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2348   -5.3379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9744   -5.3379    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1672   -5.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7452   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9240   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5156   -3.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9240   -3.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6853   -3.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5156   -5.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6853   -5.3379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8505   -5.3379    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9240   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7452   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9993   -6.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6 13  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 23 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 19 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 22  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "CC(C)c1cc(c(C)cc1OI)-c2cc(C(C)C)c(cc2C)OI",
          "formula": "C20H24I2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9f9db24c-b66f-41fc-91a3-413bebcd63af"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "550.2131",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "98299811-be25-4d24-887f-202c2964ff4e",
      "version": "10",
      "structure": {
        "id": "451a1570-afb8-4c67-abf2-8829daaf0153",
        "molfile": "\n  Marvin  01132103382D          \n\n 24 25  0  0  0  0            999 V2000\n    6.1672   -5.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7575   -5.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1659   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9917   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4091   -3.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9917   -3.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2348   -3.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4091   -5.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9917   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1659   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9980   -6.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2348   -5.3379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9744   -5.3379    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7452   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9240   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5156   -3.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9240   -3.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6853   -3.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5156   -5.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9240   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7452   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9993   -6.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6853   -5.3379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8505   -5.3379    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  4  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14  1  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 15  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21  1  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 19  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
        "smiles": "CC(C)c1cc(c(C)cc1OI)-c2cc(C(C)C)c(cc2C)OI",
        "formula": "C20H24I2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "550.2131",
        "optical_activity": "NONE",
        "references": [
          "1908a70a-90c2-4e24-a345-37ba52f4028e",
          "a89d6990-4fb4-4101-aa89-09665020cf1d"
        ],
        "stereo_centers": 0
      },
      "unii": "A51HJM3XSU"
    }
  ]
}