{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dc536227-9b40-462b-a8c4-80dc1ebb3247",
          "code": "C80865",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80865",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "86fb995a-050e-4607-bba9-8f75df6a9283",
          "code": "88-89-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=88-89-1",
          "code_system": "CAS",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1",
            "a38ada2b-48de-415a-8161-3c47bb320b5f"
          ]
        },
        {
          "uuid": "7a070a44-f647-4d6a-a748-2b8bb6aaa9b4",
          "code": "C005858",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005858",
          "code_system": "MESH",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "2c599d17-a706-487e-9505-cdd9ee4dcd7f",
          "code": "PICRIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Picric_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "a06f9ab7-ad7f-4ed4-8ac8-0c43ccc8f5c4",
          "code": "1320642",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1320642/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "6515773a-92d3-4ece-84a7-116d5bad7fa2",
          "code": "m8792",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8792?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "17e9af70-07c7-479f-bec1-49cf57cd92ee",
          "code": "SUB14869MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "18156a3d-905b-413d-98a6-e8d5ec310343",
          "code": "CHEMBL108541",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL108541",
          "code_system": "ChEMBL",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "bad8f410-7694-4912-bf46-3d749edf4403",
          "code": "201-865-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.696",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "201b0711-798c-49fc-9b46-8d3d39db3861",
          "code": "6954",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6954",
          "code_system": "PUBCHEM",
          "references": [
            "4e073489-bcef-4f19-9336-8e24084f96d1"
          ]
        },
        {
          "uuid": "b132726e-b824-b56a-bd63-f4127e03869f",
          "code": "2040",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2040",
          "code_system": "HSDB",
          "references": [
            "4165d368-d2a7-2805-4f67-b988884c43c3"
          ]
        },
        {
          "uuid": "d3c5fadf-803b-daef-793c-95b6f461e41f",
          "code": "DTXSID4025909",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4025909",
          "code_system": "EPA CompTox",
          "references": [
            "75cd46d2-aa3c-1999-cc45-44c8f0710eec"
          ]
        },
        {
          "uuid": "4a86dc88-d48e-2fe4-d160-e8ad838e9776",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e7741878-66e0-6ee3-17a3-681d92323f51"
          ]
        },
        {
          "uuid": "88af5811-103f-4498-9f9a-2b5fd5099524",
          "code": "1443000",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1443000/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "eccfd4f8-5ed0-cd11-edae-3a8051a8f44f"
          ]
        },
        {
          "uuid": "b8bdd70c-304d-3de3-10ea-7e5ca82688a5",
          "code": "4626",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4626",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e7741878-66e0-6ee3-17a3-681d92323f51"
          ]
        },
        {
          "uuid": "9e4fb2cd-729f-5c50-75ee-f949a2186ab1",
          "code": "DB03651",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03651",
          "code_system": "DRUG BANK",
          "references": [
            "e7741878-66e0-6ee3-17a3-681d92323f51"
          ]
        },
        {
          "uuid": "00938789-9913-48ca-9d57-bc7cff37fec5",
          "code": "A49OS0F91S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "91640224-226c-93df-22e3-e0f032d1478a",
          "code": "86297",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:86297",
          "code_system": "CHEBI",
          "references": [
            "e7741878-66e0-6ee3-17a3-681d92323f51"
          ]
        },
        {
          "uuid": "2189bda5-ce58-69fe-46c4-c1b01a24c856",
          "code": "46149",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:46149",
          "code_system": "CHEBI",
          "references": [
            "e7741878-66e0-6ee3-17a3-681d92323f51"
          ]
        },
        {
          "uuid": "e6cd7633-f869-b507-777a-11d16e305c05",
          "code": "A49OS0F91S",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=A49OS0F91S",
          "code_system": "DAILYMED",
          "references": [
            "f1059fab-c0cf-8c2a-4bb4-fe7de36f5c3b"
          ]
        },
        {
          "uuid": "74f0b905-33b2-6f3a-84d3-9fe81f1cc047",
          "code": "100000079446",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "fd68fb67-a200-2b36-d093-233efc2a9a52"
          ]
        },
        {
          "uuid": "2e5f0de8-92a1-4665-92ba-dcb54c12829b",
          "code": "36947",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=36947",
          "code_system": "NSC",
          "references": [
            "235ce6b4-20e5-603b-f183-ca7d04932403"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "adefea7a-c0dc-4264-b35c-eb69c84c4269",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4bfb30e7-1c66-408b-9989-8b3693df37dc",
            "refuuid": "dc83adac-e42b-40a9-9690-ec53a8b376ab",
            "name": "PICRIC ACID",
            "unii": "A49OS0F91S",
            "linking_id": "A49OS0F91S",
            "ref_pname": "PICRIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "16cb9802-87d3-4272-a3c8-4357ac99cedd",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "07434e69-5c04-4cd0-9186-c35538c3bf55",
            "refuuid": "61db05a5-e7b6-43ce-a86f-2c50d4df0dad",
            "name": "BUTAMBEN PICRATE",
            "unii": "D4ZFB7ZH5Y",
            "linking_id": "D4ZFB7ZH5Y",
            "ref_pname": "BUTAMBEN PICRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4cdb8369-541c-4de2-bf08-54d972731de4",
          "amount": {
            "uuid": "9ffe768b-b311-4c70-97ca-af44d8a44a77"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "24ff2a53-95c0-4081-a94d-defaa9ef9370"
          ],
          "related_substance": {
            "uuid": "8cc4186b-f396-4d6b-bc38-997fac0b5c24",
            "refuuid": "a9bb732e-dd86-4e3e-bd24-d8802516291c",
            "name": "2-Methylpentylamine picrate",
            "unii": "T93NK28EEE",
            "linking_id": "T93NK28EEE",
            "ref_pname": "2-Methylpentylamine picrate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0d8e5a39-b0e7-4c9d-b1c2-23eb7d15d1e2",
          "name": "NSC-36947",
          "stdName": "NSC-36947",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ff50f40-4e81-4a2c-a944-a221ac348028"
          ],
          "display_name": false
        },
        {
          "uuid": "7f07522b-7465-43c1-8242-b29f1b1b2335",
          "name": "PICRIC ACID",
          "stdName": "PICRIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "060636d0-37fe-48e3-817e-07aad7eaf224",
            "0c2eea89-07c3-4435-a94f-41c18435ca7e",
            "6801b3af-b60b-45ab-be31-59a3c5f37e6a",
            "523e5581-2f47-4091-a658-d2351ccbc7bf",
            "36668a93-3693-4493-9a84-01082d077ea3",
            "0b715e31-2d99-4929-9352-0a54969a9617",
            "46781f6f-8013-4118-b0d5-e00b457506c6"
          ],
          "display_name": true
        },
        {
          "uuid": "c0bf0d9f-599a-43df-afc8-54f47bf3bd65",
          "name": "PICRIC ACID [HSDB]",
          "stdName": "PICRIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36668a93-3693-4493-9a84-01082d077ea3"
          ],
          "display_name": false
        },
        {
          "uuid": "8c8edce0-2241-4b0b-b5e1-7dbde3bf0e5d",
          "name": "PICRIC ACID [MI]",
          "stdName": "PICRIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b715e31-2d99-4929-9352-0a54969a9617"
          ],
          "display_name": false
        },
        {
          "uuid": "300dad4c-6e45-4c55-9cb2-2390ae60ee17",
          "name": "PICRICUM ACIDUM",
          "stdName": "PICRICUM ACIDUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38ebf0f8-2f02-4572-bd3c-14c408bcc76e",
            "c09a3254-0ffc-43f2-b46d-81a60dc96d94",
            "14d3e41d-d505-41c2-a9c1-3a6da57beef5"
          ],
          "display_name": false
        },
        {
          "uuid": "fccbfa49-e84e-4e3a-8ddd-f870484d1b15",
          "name": "PICRICUM ACIDUM [HPUS]",
          "stdName": "PICRICUM ACIDUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38ebf0f8-2f02-4572-bd3c-14c408bcc76e",
            "14d3e41d-d505-41c2-a9c1-3a6da57beef5"
          ],
          "display_name": false
        },
        {
          "uuid": "51836f05-bebe-f78b-960f-3fbfb58d2c5c",
          "name": "Picric acid [WHO-DD]",
          "stdName": "PICRIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02689a21-1d6a-5451-4037-8d0771cbacf8"
          ],
          "display_name": false
        },
        {
          "uuid": "bfa41cec-5c09-4bc5-8787-0e6520d150df",
          "name": "TRINITROPHENOL",
          "stdName": "TRINITROPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b35049fb-d4e8-4680-93a4-cd7271617b73",
            "e1c9c2b4-b69b-4389-b162-6266d0d320b2",
            "7600aea0-2a5d-4c00-95e6-f7069dfd4a5d"
          ],
          "display_name": false
        },
        {
          "uuid": "97e140c8-a553-4348-b527-bb90b8fb1887",
          "name": "TRINITROPHENOL [MART.]",
          "stdName": "TRINITROPHENOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7600aea0-2a5d-4c00-95e6-f7069dfd4a5d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6801b3af-b60b-45ab-be31-59a3c5f37e6a",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b35049fb-d4e8-4680-93a4-cd7271617b73",
          "citation": "NF 9",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38ebf0f8-2f02-4572-bd3c-14c408bcc76e",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14d3e41d-d505-41c2-a9c1-3a6da57beef5",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7600aea0-2a5d-4c00-95e6-f7069dfd4a5d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b715e31-2d99-4929-9352-0a54969a9617",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36668a93-3693-4493-9a84-01082d077ea3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c2eea89-07c3-4435-a94f-41c18435ca7e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ff50f40-4e81-4a2c-a944-a221ac348028",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e073489-bcef-4f19-9336-8e24084f96d1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390845000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e690827b-cd5a-4e68-9473-e3f30a54d09c",
          "citation": "SRS import [A49OS0F91S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A49OS0F91S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390845000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd197373-3f2c-486d-bf0a-f39b72599bc7",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c09a3254-0ffc-43f2-b46d-81a60dc96d94",
          "citation": "PICRICUM ACIDUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1c9c2b4-b69b-4389-b162-6266d0d320b2",
          "citation": "TRINITROPHENOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "060636d0-37fe-48e3-817e-07aad7eaf224",
          "citation": "PICRIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46781f6f-8013-4118-b0d5-e00b457506c6",
          "citation": "PICRIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "523e5581-2f47-4091-a658-d2351ccbc7bf",
          "citation": "PICRIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4165d368-d2a7-2805-4f67-b988884c43c3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+88-89-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "75cd46d2-aa3c-1999-cc45-44c8f0710eec",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=88-89-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7741878-66e0-6ee3-17a3-681d92323f51",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "eccfd4f8-5ed0-cd11-edae-3a8051a8f44f",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "a38ada2b-48de-415a-8161-3c47bb320b5f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "02689a21-1d6a-5451-4037-8d0771cbacf8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "235ce6b4-20e5-603b-f183-ca7d04932403",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f1059fab-c0cf-8c2a-4bb4-fe7de36f5c3b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "fd68fb67-a200-2b36-d093-233efc2a9a52",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "24ff2a53-95c0-4081-a94d-defaa9ef9370",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c98485cd-fa17-410c-a672-54a4e4351f90",
          "id": "c98485cd-fa17-410c-a672-54a4e4351f90",
          "molfile": "\n  Marvin  01132110242D          \n\n 16 16  0  0  0  0            999 V2000\n    0.0000   -2.1360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8301   -2.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2439   -2.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0585   -2.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4696   -2.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0585   -1.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2439   -1.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8301   -0.7137    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7137    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.2439    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2997   -2.1360    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.7187   -2.8549    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.7187   -1.4223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8301   -3.5635    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5635    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.2439   -4.2772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n 14  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n 11  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\nM  CHG  6   8   1   9  -1  11   1  12  -1  14   1  15  -1\nM  END",
          "smiles": "c1c(cc(c(c1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-]",
          "formula": "C6H3N3O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a19a5149-79fb-4c15-808b-e3df584f69fa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "229.1042",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dc83adac-e42b-40a9-9690-ec53a8b376ab",
      "version": "16",
      "structure": {
        "id": "50fbfc55-8539-4cf5-a4fc-b38ec9c2ca35",
        "molfile": "\n  Marvin  01132104132D          \n\n 16 16  0  0  0  0            999 V2000\n    1.2439   -1.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2439   -2.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8301   -2.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8301   -3.5635    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.8301   -0.7137    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.2997   -2.1360    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.4696   -2.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0585   -2.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0585   -1.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5635    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7137    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.7187   -2.8549    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.2439   -4.2772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2439    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7187   -1.4223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.1360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  1  2  0  0  0  0\n 10  4  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  4  2  0  0  0  0\n 14  5  2  0  0  0  0\n 15  6  2  0  0  0  0\n 16  3  1  0  0  0  0\n  8  2  1  0  0  0  0\nM  CHG  6   4   1   5   1   6   1  10  -1  11  -1  12  -1\nM  END",
        "smiles": "c1c(cc(c(c1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-]",
        "formula": "C6H3N3O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "229.1042",
        "optical_activity": "NONE",
        "references": [
          "e690827b-cd5a-4e68-9473-e3f30a54d09c",
          "bd197373-3f2c-486d-bf0a-f39b72599bc7"
        ],
        "stereo_centers": 0
      },
      "unii": "A49OS0F91S"
    }
  ]
}