{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6ba7a739-f4fa-4a7b-8214-0e6dd78ddcd2",
          "code": "130120-57-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=130120-57-9",
          "code_system": "CAS",
          "references": [
            "a172c407-77a9-46fd-a0c0-c7874a838948",
            "aa306c1c-385c-4fb7-aa97-294821e9c3f0"
          ]
        },
        {
          "uuid": "751e3ebf-9f19-44a5-8fa5-161ff74f3b75",
          "code": "6955",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6955",
          "code_system": "INN",
          "references": [
            "a172c407-77a9-46fd-a0c0-c7874a838948"
          ]
        },
        {
          "uuid": "50e908c1-ab60-4034-af6e-f22f70eb318f",
          "code": "1314596",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314596/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a172c407-77a9-46fd-a0c0-c7874a838948"
          ]
        },
        {
          "uuid": "28bcaad4-a1ca-4f2b-bedb-3ce8d74d7fc2",
          "code": "m5722",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5722?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a172c407-77a9-46fd-a0c0-c7874a838948"
          ]
        },
        {
          "uuid": "8e81cb19-3ef2-4c63-a9b8-f2abb7acd715",
          "code": "SUB10033MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a172c407-77a9-46fd-a0c0-c7874a838948"
          ]
        },
        {
          "uuid": "e1d1277c-b644-bdd2-557a-fe827a5fd7f7",
          "code": "9876021",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9876021",
          "code_system": "PUBCHEM",
          "references": [
            "67ba2557-aaf5-908b-ae01-b664b5283387"
          ]
        },
        {
          "uuid": "c2f60828-6800-21d2-6dee-7de1f527c5be",
          "code": "DTXSID00156359",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00156359",
          "code_system": "EPA CompTox",
          "references": [
            "ac7a3c7f-4bfc-3670-4d7a-a9f806439102"
          ]
        },
        {
          "uuid": "cee22908-c28c-5299-d725-23d2c07de2aa",
          "code": "C171726",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C171726",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6d6b7cbc-eaf5-4b1d-14fb-5f487cc927df"
          ]
        },
        {
          "uuid": "b1c11a56-a1a7-4401-a64d-5529947bac2a",
          "code": "A3LEI4P1NB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "18201394-eeee-4582-87ba-ff374bca901c",
          "code": "DBSALT002420",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002420",
          "code_system": "DRUG BANK",
          "references": [
            "19f75438-b817-a771-aa11-fa99c28659d2"
          ]
        },
        {
          "uuid": "23f94cdd-51b0-c82e-fff1-ef26333ad6d3",
          "code": "CC-72",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/CC-72/relevant/1/",
          "code_system": "USAN",
          "references": [
            "90c8e544-14d2-9c66-87c4-b56c15f3ca85"
          ]
        },
        {
          "uuid": "667ca376-e6c0-5e53-45cf-f96a383116dd",
          "code": "A3LEI4P1NB",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=A3LEI4P1NB",
          "code_system": "DAILYMED",
          "references": [
            "05ac2b0a-0025-42b3-121b-a0681973e29e"
          ]
        },
        {
          "uuid": "04ce0916-0174-f918-d7e5-2d933bad0c8d",
          "code": "100000081611",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9e8e1da8-45f8-6c3a-00a5-144499cf2a0b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "15a58e0c-bb8b-489f-878c-267d77e265bb",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "1d4febcd-89a6-440c-a683-f1da53468d66",
            "refuuid": "fb2b9b51-d768-4c6f-99e7-99071d83a4fb",
            "name": "CUPRIC CATION",
            "unii": "8CBV67279L",
            "linking_id": "8CBV67279L",
            "ref_pname": "CUPRIC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ecae95ee-bd18-4020-8586-3507dc19ef84",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "cf0718e6-8d3b-4810-a0ee-24e5f34c5304",
            "refuuid": "6cc2dc36-e77a-4034-9483-3e4387a9ac4d",
            "name": "PREZATIDE",
            "unii": "39TG2H631E",
            "linking_id": "39TG2H631E",
            "ref_pname": "PREZATIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "98631766-c790-47ce-8a3e-9b69733b67d0",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ad67cd02-eb2b-4b00-874a-50a8a99f0457",
            "refuuid": "6cc2dc36-e77a-4034-9483-3e4387a9ac4d",
            "name": "PREZATIDE",
            "unii": "39TG2H631E",
            "linking_id": "39TG2H631E",
            "ref_pname": "PREZATIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "97b4c5e0-3405-4d38-88e1-206ca635447e",
          "name": "BIS(TRIPEPTIDE-1) COPPER ACETATE",
          "stdName": "BIS(TRIPEPTIDE-1) COPPER ACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "febc587a-cef7-45e5-8ae8-5ac0a1b630d0",
            "37a96392-7a18-4824-9bbf-cc05e1fbef3d",
            "83417d56-a8e8-4290-b78a-20bf83eb03eb"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "df99dd31-0d0a-4b53-baed-6fb00d0b94c1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8fe6064e-9134-477a-a872-c1ccc3c9ac2b",
          "name": "CUPRATE (1-), (N(SUP 2)-(N-GLYCYL-L-HISTIDYL)-L-LYSINATO)(N(SUP 2)-(N-GLYCYL-L-HISTIDYL)-L-LYSINATO(2-))-, HYDROGEN, DIACETATE",
          "stdName": "CUPRATE (1-), (N(SUP 2)-(N-GLYCYL-L-HISTIDYL)-L-LYSINATO)(N(SUP 2)-(N-GLYCYL-L-HISTIDYL)-L-LYSINATO(2-))-, HYDROGEN, DIACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a56e37a8-4420-49e4-8902-c3fe9abc2d9e"
          ],
          "display_name": false
        },
        {
          "uuid": "9e5cdb22-721a-45ce-bb2a-9a21305b0e6c",
          "name": "CUPRATE(1-), (GLYCYL-L-HISTIDYL-.KAPPA.N1-L-LYSINATO)(GLYCYL-.KAPPA.N-L-HISTIDYL-.KAPPA.N,.KAPPA.N3-L-LYSINATO(2-))-, HYDROGEN, ACETATE (1:1:2)",
          "stdName": "CUPRATE(1-), (GLYCYL-L-HISTIDYL-.KAPPA.N1-L-LYSINATO)(GLYCYL-.KAPPA.N-L-HISTIDYL-.KAPPA.N,.KAPPA.N3-L-LYSINATO(2-))-, HYDROGEN, ACETATE (1:1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5ae5009-6b1e-45b5-91f7-1c5f6b681b24"
          ],
          "display_name": false
        },
        {
          "uuid": "2876a26c-a66c-458f-8e41-fed7178ef5f8",
          "name": "GHK BIS COMPLEX WITH COPPER DIACETATE",
          "stdName": "GHK BIS COMPLEX WITH COPPER DIACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "971d8a74-654d-461b-b9be-24cfbb2adc49",
            "6a752d37-978f-42af-8322-6b2ea69b3848"
          ],
          "display_name": false
        },
        {
          "uuid": "3889879b-dfcd-4521-990e-925b6256b640",
          "name": "GHK BIS COMPLEX WITH COPPER DIACETATE [MI]",
          "stdName": "GHK BIS COMPLEX WITH COPPER DIACETATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "971d8a74-654d-461b-b9be-24cfbb2adc49"
          ],
          "display_name": false
        },
        {
          "uuid": "31bc31d7-fee7-4f94-a697-46aa106af351",
          "name": "IAMIN",
          "stdName": "IAMIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a56e37a8-4420-49e4-8902-c3fe9abc2d9e"
          ],
          "display_name": false
        },
        {
          "uuid": "9c4d30b1-1267-41d0-916c-2fc704a9293b",
          "name": "PC-1020",
          "stdName": "PC-1020",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bad80b27-99d2-46b3-8b17-c2a3d4293fd6"
          ],
          "display_name": false
        },
        {
          "uuid": "baea3d69-720f-4ce9-894c-dcaa9ff0669a",
          "name": "PC-1020 ACETATE",
          "stdName": "PC-1020 ACETATE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a56e37a8-4420-49e4-8902-c3fe9abc2d9e"
          ],
          "display_name": false
        },
        {
          "uuid": "5ddb380e-6095-42a0-b599-f9dc0a42315b",
          "name": "PC1020 ACETATE",
          "stdName": "PC1020 ACETATE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a56e37a8-4420-49e4-8902-c3fe9abc2d9e"
          ],
          "display_name": false
        },
        {
          "uuid": "2d898445-7e30-4d7f-bd5b-c5b143a73fcf",
          "name": "PREZATIDE COPPER ACETATE",
          "stdName": "PREZATIDE COPPER ACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40265755-fa88-48a8-8839-929904d44d64",
            "b9b7b0c0-9a94-45cd-b56a-b49bd890fe77",
            "56d72a37-e6a1-4ce4-90a2-f9ffb464c0ae",
            "1ed9b2bc-f4e1-4adc-a594-091ea0f9eef7",
            "9c655ce3-d64c-43bc-939e-b053d17728ed",
            "fecb1414-57a1-4e4d-bd62-08af1223a527",
            "c2c90ac3-0eec-48bd-a4ba-f81f254563d8",
            "98318276-b434-4810-a364-9151b43241d0",
            "1e924934-1430-420a-bebc-63904cab958e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "fd1bd647-18a2-4997-9bf0-7e6c3981966d",
              "name_org": "INN"
            },
            {
              "uuid": "5678d6e1-9ae9-4665-82af-3990af0a55a6",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "5077a09e-af5b-46a3-b7cd-2fb73c37cd6b",
          "name": "PREZATIDE COPPER ACETATE [MART.]",
          "stdName": "PREZATIDE COPPER ACETATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40265755-fa88-48a8-8839-929904d44d64"
          ],
          "display_name": false
        },
        {
          "uuid": "6ceb9cec-5a00-455f-b472-08c2a19bc266",
          "name": "PREZATIDE COPPER ACETATE [USAN]",
          "stdName": "PREZATIDE COPPER ACETATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2c90ac3-0eec-48bd-a4ba-f81f254563d8"
          ],
          "display_name": false
        },
        {
          "uuid": "e88eed3d-c645-bd1c-2430-843a043855f3",
          "name": "Prezatide copper acetate [WHO-DD]",
          "stdName": "PREZATIDE COPPER ACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9dc8abdb-a70b-d06e-3cf1-04c679c29cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "eb529dd5-48c8-4671-995c-b3a72a3fb328",
          "name": "TRIPEPTIDE-1 COPPER ACETATE",
          "stdName": "TRIPEPTIDE-1 COPPER ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a19272d-3fe8-4352-89fb-2d229d667a3e"
          ],
          "display_name": false
        },
        {
          "uuid": "bf8bd7ec-00bd-4e70-a66d-717a27e5a50c",
          "name": "prezatide copper acetate [INN]",
          "stdName": "PREZATIDE COPPER ACETATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98318276-b434-4810-a364-9151b43241d0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bad80b27-99d2-46b3-8b17-c2a3d4293fd6",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a56e37a8-4420-49e4-8902-c3fe9abc2d9e",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a19272d-3fe8-4352-89fb-2d229d667a3e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9b7b0c0-9a94-45cd-b56a-b49bd890fe77",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98318276-b434-4810-a364-9151b43241d0",
          "citation": "INN Proposed List 67",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL67.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c2c90ac3-0eec-48bd-a4ba-f81f254563d8",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40265755-fa88-48a8-8839-929904d44d64",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "febc587a-cef7-45e5-8ae8-5ac0a1b630d0",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fecb1414-57a1-4e4d-bd62-08af1223a527",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83417d56-a8e8-4290-b78a-20bf83eb03eb",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "971d8a74-654d-461b-b9be-24cfbb2adc49",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5ae5009-6b1e-45b5-91f7-1c5f6b681b24",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a172c407-77a9-46fd-a0c0-c7874a838948",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389843000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "488ba2d8-6b6c-403b-b612-64ce8b7b23a1",
          "citation": "SRS import [A3LEI4P1NB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A3LEI4P1NB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389843000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c655ce3-d64c-43bc-939e-b053d17728ed",
          "citation": "PREZATIDE COPPER ACETATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56d72a37-e6a1-4ce4-90a2-f9ffb464c0ae",
          "citation": "PREZATIDE COPPER ACETATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e924934-1430-420a-bebc-63904cab958e",
          "citation": "PREZATIDE COPPER ACETATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37a96392-7a18-4824-9bbf-cc05e1fbef3d",
          "citation": "BIS(TRIPEPTIDE-1) COPPER ACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ed9b2bc-f4e1-4adc-a594-091ea0f9eef7",
          "citation": "PREZATIDE COPPER ACETATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a752d37-978f-42af-8322-6b2ea69b3848",
          "citation": "GHK BIS COMPLEX WITH COPPER DIACETATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "158bd722-90cf-71be-40df-32a5aecf92a2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=130120-57-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6d6b7cbc-eaf5-4b1d-14fb-5f487cc927df",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "aa306c1c-385c-4fb7-aa97-294821e9c3f0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "90c8e544-14d2-9c66-87c4-b56c15f3ca85",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "19f75438-b817-a771-aa11-fa99c28659d2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "67ba2557-aaf5-908b-ae01-b664b5283387",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "9dc8abdb-a70b-d06e-3cf1-04c679c29cfd",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "05ac2b0a-0025-42b3-121b-a0681973e29e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ac7a3c7f-4bfc-3670-4d7a-a9f806439102",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "9e8e1da8-45f8-6c3a-00a5-144499cf2a0b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b03b3bb8-6111-0227-3e3f-489704a37c02",
          "id": "b03b3bb8-6111-0227-3e3f-489704a37c02",
          "molfile": "\n  Marvin  01132109082D          \n\n 24 24  0  0  1  0            999 V2000\n   16.2938   -2.9981    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   18.4372   -2.5855    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2938   -3.8231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -4.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -5.0605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -3.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4372   -4.2355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -1.7605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4372   -1.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -1.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1516   -1.3481    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   19.1516   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8661   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5806   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2950   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0095   -2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5794   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8648   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1111   -2.6625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5592   -3.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9717   -3.9901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7786   -3.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  8  1  0  0  0  0\n  1 19  1  0  0  0  0\n  1  3  1  1  0  0  0\n 10  2  1  0  0  0  0\n  2 11  1  6  0  0  0\n  2 14  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 24  2  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  CHG  1  13  -1\nM  END",
          "smiles": "C(CCN)C[C@@H](C(=O)[O-])NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CN",
          "formula": "C14H23N6O4",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "effd60ad-2b1c-4590-ac92-2c4280b47e71"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "339.3708",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        },
        {
          "uuid": "3e4e9f51-713b-6757-73e0-e96bf9cfe988",
          "id": "3e4e9f51-713b-6757-73e0-e96bf9cfe988",
          "molfile": "\n  Marvin  01132103182D          \n\n  4  3  0  0  1  0            999 V2000\n   17.7736   -7.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7736   -7.1536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0592   -8.3911    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   18.4881   -8.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\nM  CHG  1   3  -1\nM  END",
          "smiles": "CC(=O)[O-]",
          "formula": "C2H3O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "4e78ac9e-4d4d-4271-8bf7-97582f4e7576"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "59.0441",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2a5d6572-2fc2-af4d-7ff1-81f12f827fc2",
          "id": "2a5d6572-2fc2-af4d-7ff1-81f12f827fc2",
          "molfile": "\n  Marvin  01132102182D          \n\n  1  0  0  0  1  0            999 V2000\n   11.4541   -5.1892    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Cu+2]",
          "formula": "Cu",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bc1e970a-3529-444a-9c02-7b22ff94ce31"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "63.5456",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "00e8c670-95ba-41fa-82c7-fda008ff8128",
      "version": "20",
      "structure": {
        "id": "4626ff14-2849-4e53-a458-1e77dceb06ce",
        "molfile": "\n  Marvin  01132103412D          \n\n 57 54  0  0  1  0            999 V2000\n   16.2938   -2.9981    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   18.4372   -2.5855    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2938   -3.8231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -4.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -5.0605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -3.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4372   -4.2355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -1.7605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4372   -1.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -1.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1516   -1.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1516   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8661   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5806   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2950   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0095   -2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5794   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8648   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1111   -2.6625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5592   -3.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9717   -3.9901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7786   -3.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7736   -7.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7736   -7.1536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0592   -8.3911    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   18.4881   -8.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4541   -5.1892    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\n   16.2938   -2.9981    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   18.4372   -2.5855    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2938   -3.8231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -4.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -5.0605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -3.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4372   -4.2355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0082   -1.7605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4372   -1.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7227   -1.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1516   -1.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1516   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8661   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5806   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2950   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0095   -2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5794   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8648   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1111   -2.6625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5592   -3.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9717   -3.9901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7786   -3.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7736   -7.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7736   -7.1536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0592   -8.3911    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   18.4881   -8.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  2  1  0  0  0  0\n  8 10  1  0  0  0  0\n  2 11  1  6  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n  1 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 20 24  2  0  0  0  0\n  1  3  1  1  0  0  0\n  3  4  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\n 25 28  1  0  0  0  0\n 30 37  1  0  0  0  0\n 30 48  1  0  0  0  0\n 30 32  1  1  0  0  0\n 39 31  1  0  0  0  0\n 31 40  1  6  0  0  0\n 31 43  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  2  0  0  0  0\n 33 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 37 38  2  0  0  0  0\n 37 39  1  0  0  0  0\n 40 41  2  0  0  0  0\n 40 42  1  0  0  0  0\n 43 44  1  0  0  0  0\n 44 45  1  0  0  0  0\n 45 46  1  0  0  0  0\n 46 47  1  0  0  0  0\n 48 49  1  0  0  0  0\n 49 50  1  0  0  0  0\n 49 53  2  0  0  0  0\n 50 51  2  0  0  0  0\n 52 51  1  0  0  0  0\n 53 52  1  0  0  0  0\n 54 55  2  0  0  0  0\n 54 56  1  0  0  0  0\n 54 57  1  0  0  0  0\nM  CHG  3  27  -1  29   2  56  -1\nM  STY  2   1 MUL   2 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   1   2   3   4   5   6   7   8   9  10  11  12  13  14  15\nM  SAL   1 15  16  17  18  19  20  21  22  23  24  30  31  32  33  34  35\nM  SAL   1 15  36  37  38  39  40  41  42  43  44  45  46  47  48  49  50\nM  SAL   1  3  51  52  53\nM  SPA   1 15   1   2   3   4   5   6   7   8   9  10  11  12  13  14  15\nM  SPA   1  9  16  17  18  19  20  21  22  23  24\nM  SDI   1  4   13.1392   -5.4805   13.1392   -0.9281\nM  SDI   1  4   22.4295   -0.9281   22.4295   -5.4805\nM  SMT   1 2\nM  SCN  1   2 HT \nM  SAL   2  8  25  26  27  28  54  55  56  57\nM  SPA   2  4  25  26  27  28\nM  SDI   2  4   16.6392   -8.8111   16.6392   -6.7336\nM  SDI   2  4   18.9081   -6.7336   18.9081   -8.8111\nM  SMT   2 2\nM  END",
        "smiles": "C(CCN)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CN.C(CCN)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CN.CC(=O)[O-].CC(=O)[O-].[Cu+2]",
        "formula": "2C14H24N6O4.2C2H3O2.Cu",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "862.3913",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a56e37a8-4420-49e4-8902-c3fe9abc2d9e",
          "488ba2d8-6b6c-403b-b612-64ce8b7b23a1",
          "98318276-b434-4810-a364-9151b43241d0"
        ],
        "stereo_centers": 4
      },
      "unii": "A3LEI4P1NB"
    }
  ]
}