{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "36c4b709-e6a8-4538-bf02-746cdb0d008a",
          "code": "2144-53-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2144-53-8",
          "code_system": "CAS",
          "references": [
            "20c16c59-8465-4074-a389-f4490f52d39b",
            "379ae478-affd-44ac-9827-5ff296507876"
          ]
        },
        {
          "uuid": "2f7859ec-1741-4546-84fe-76cbcb65f17b",
          "code": "75066",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/75066",
          "code_system": "PUBCHEM",
          "references": [
            "20c16c59-8465-4074-a389-f4490f52d39b"
          ]
        },
        {
          "uuid": "4ec60a0f-2891-4c17-9a03-9eeeface2239",
          "code": "218-407-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.735",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "20c16c59-8465-4074-a389-f4490f52d39b"
          ]
        },
        {
          "uuid": "c5d2526f-a350-ad14-d374-ca717cce4c8b",
          "code": "DTXSID3047558",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3047558",
          "code_system": "EPA CompTox",
          "references": [
            "1ed4b967-5645-21e2-7a33-782420e677c3"
          ]
        },
        {
          "uuid": "18b8cdae-b44b-4ce2-8ef6-8564a417716a",
          "code": "A3INR94K4A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "875e3d25-68ab-4273-b396-0318f07ace34",
          "name": "(PERFLUOROHEXYL)ETHYL METHACRYLATE",
          "stdName": "(PERFLUOROHEXYL)ETHYL METHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "4990ab85-fa1e-4a26-a9cf-d7a3174e619b",
          "name": "2-PROPENOIC ACID, 2-METHYL-, 3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL ESTER",
          "stdName": "2-PROPENOIC ACID, 2-METHYL-, 3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "9f8cfb0b-4f6a-4c18-b56a-0597ae5c56f4",
          "name": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYLMETHACRYLATE-",
          "stdName": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYLMETHACRYLATE-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c86fe9f-de5c-46c8-b191-9ed569d7aae6"
          ],
          "display_name": false
        },
        {
          "uuid": "37bc0033-00ce-4f68-9201-05222f23d163",
          "name": "ACTYFLON G 06B",
          "stdName": "ACTYFLON G 06B",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "394ca739-83e7-43d6-89c8-a3e8647b37b3",
          "name": "CAPSTONE 62MA",
          "stdName": "CAPSTONE 62MA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "bce55f04-de81-48c4-9637-8b4df204a37e",
          "name": "CHEMINOX FAMAC 6",
          "stdName": "CHEMINOX FAMAC 6",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "e302d47a-9ce8-4d1d-95bb-2f1803451355",
          "name": "FAMAC 6",
          "stdName": "FAMAC 6",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "f39a4452-900b-4769-8c43-5bd34081ed24",
          "name": "FLUOWET MA 600",
          "stdName": "FLUOWET MA 600",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "1ad17393-3cb2-4d59-9bc4-62c7c1260649",
          "name": "M 1620",
          "stdName": "M 1620",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "aa2cb932-6e6a-488a-b1f4-13bc73292c2a",
          "name": "MA 600",
          "stdName": "MA 600",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": false
        },
        {
          "uuid": "e5238854-5e74-425e-8682-3f584c5de8c8",
          "name": "PERFLUOROHEXYLETHYL METHACRYLATE",
          "stdName": "PERFLUOROHEXYLETHYL METHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c86fe9f-de5c-46c8-b191-9ed569d7aae6"
          ],
          "display_name": false
        },
        {
          "uuid": "a5da1207-8da1-44da-948e-058efb6e3c54",
          "name": "TRIDECAFLUOROHEXYLETHYL METHACRYLATE",
          "stdName": "TRIDECAFLUOROHEXYLETHYL METHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c4e471-d998-43f0-acbf-4eaf5ecf4d14"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "4c86fe9f-de5c-46c8-b191-9ed569d7aae6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "25c4e471-d998-43f0-acbf-4eaf5ecf4d14",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20c16c59-8465-4074-a389-f4490f52d39b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391658000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "251eb7da-a4f3-460b-a655-eba2d645e9f9",
          "citation": "SRS import [A3INR94K4A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A3INR94K4A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391658000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56b9554f-b55d-463b-9d66-9c27b74fa0fb",
          "citation": "CHEMID RECORD 2144-53-8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ed4b967-5645-21e2-7a33-782420e677c3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2144-53-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "379ae478-affd-44ac-9827-5ff296507876",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e012a617-f805-4852-84ed-7ea05b44bf2a",
          "id": "e012a617-f805-4852-84ed-7ea05b44bf2a",
          "molfile": "\n  Marvin  01132111362D          \n\n 27 26  0  0  0  0            999 V2000\n    9.2617    1.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2597    0.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9667   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5444   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5444   -1.0011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8291    0.2322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1220   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4067    0.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6997   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2299   -0.8073    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1727   -0.8100    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8418    0.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3138    0.9443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3699    0.9443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6989   -0.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2259   -0.9739    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1687   -0.9711    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7075    0.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1805    0.8647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2376    0.8620    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5645   -0.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0915   -1.0543    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0344   -1.0517    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7153    0.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.3406    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1883    0.7015    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2454    0.6988    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\nM  END",
          "smiles": "C=C(C)C(=O)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F",
          "formula": "C12H9F13O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2b84f75c-b70f-4d5a-9172-5c9bb26857b8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "432.1783",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9f567bb1-6ffc-486e-a0c9-67ec2615a575",
      "version": "4",
      "structure": {
        "id": "92ed009d-7148-400d-bc56-b6b12dc59f14",
        "molfile": "\n  Marvin  01132107372D          \n\n 27 26  0  0  0  0            999 V2000\n    8.5444   -1.0011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5444   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8291    0.2322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1220   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4067    0.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6997   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2299   -0.8073    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1727   -0.8100    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8418    0.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3138    0.9443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3699    0.9443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6989   -0.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2259   -0.9739    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1687   -0.9711    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7075    0.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1805    0.8647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2376    0.8620    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5645   -0.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0915   -1.0543    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0344   -1.0517    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7153    0.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.3406    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1883    0.7015    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2454    0.6988    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2597    0.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9667   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2617    1.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n  2 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)C(=O)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F",
        "formula": "C12H9F13O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "432.1783",
        "optical_activity": "NONE",
        "references": [
          "56b9554f-b55d-463b-9d66-9c27b74fa0fb",
          "251eb7da-a4f3-460b-a655-eba2d645e9f9"
        ],
        "stereo_centers": 0
      },
      "unii": "A3INR94K4A"
    }
  ]
}