{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "252c60b8-5a61-4eba-9adf-4c1fe8653931",
          "code": "592-09-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=592-09-6",
          "code_system": "CAS",
          "references": [
            "ea4a39bf-9497-420b-9044-7ebe7dafa2bd",
            "d630d0c4-7624-4d05-b7db-37c6dab6c7a0"
          ]
        },
        {
          "uuid": "b2ca421a-6ad4-440e-a1bf-53f3616c74f2",
          "code": "68963",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68963",
          "code_system": "PUBCHEM",
          "references": [
            "ea4a39bf-9497-420b-9044-7ebe7dafa2bd"
          ]
        },
        {
          "uuid": "dd18a80d-129f-43c6-9d19-1a540ab52e77",
          "code": "209-744-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.860",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ea4a39bf-9497-420b-9044-7ebe7dafa2bd"
          ]
        },
        {
          "uuid": "94526f7b-74be-0ae3-8749-7c425eb5f6e1",
          "code": "DTXSID8060458",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8060458",
          "code_system": "EPA CompTox",
          "references": [
            "887b6b33-a624-8380-f4fa-18736559cb43"
          ]
        },
        {
          "uuid": "7b72edcc-e443-44a9-a0c3-f0cd9c5f90c2",
          "code": "A2MIV9WA9Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ef9acccf-d8f1-47a6-8a76-b197bfc8d628",
          "name": "(3,3,3-TRIFLUOROPROPYL)TRICHLOROSILANE",
          "stdName": "(3,3,3-TRIFLUOROPROPYL)TRICHLOROSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d630d0c4-7624-4d05-b7db-37c6dab6c7a0"
          ],
          "display_name": true
        },
        {
          "uuid": "acd284d2-9391-419e-9a04-bedf1c036b53",
          "name": "SILANE, TRICHLORO(3,3,3-TRIFLUOROPROPYL)-",
          "stdName": "SILANE, TRICHLORO(3,3,3-TRIFLUOROPROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5f2ef8a-3853-4218-a9d6-aff6c2909453",
            "341882d1-d7a6-4d62-a610-42fff5a3a39e"
          ],
          "display_name": false
        },
        {
          "uuid": "4de86e1c-0397-4380-aa53-9b44f58c8465",
          "name": "TRICHLORO(3,3,3-TRIFLUOROPROPYL)SILANE",
          "stdName": "TRICHLORO(3,3,3-TRIFLUOROPROPYL)SILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d630d0c4-7624-4d05-b7db-37c6dab6c7a0"
          ],
          "display_name": false
        },
        {
          "uuid": "557e1ff4-10fe-49ea-ad16-bc7c050f422d",
          "name": "TSL-8261",
          "stdName": "TSL-8261",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d630d0c4-7624-4d05-b7db-37c6dab6c7a0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "341882d1-d7a6-4d62-a610-42fff5a3a39e",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5f2ef8a-3853-4218-a9d6-aff6c2909453",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea4a39bf-9497-420b-9044-7ebe7dafa2bd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393833000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "887b6b33-a624-8380-f4fa-18736559cb43",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=592-09-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d630d0c4-7624-4d05-b7db-37c6dab6c7a0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d756b18c-0d2b-4c59-be8f-5189c247eee2",
          "id": "d756b18c-0d2b-4c59-be8f-5189c247eee2",
          "molfile": "\n  Marvin  01132111102D          \n\n 10  9  0  0  0  0            999 V2000\n    3.5724    0.2063    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8546   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3834   -0.8395    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3226   -0.8368    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1451    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7178    0.2063    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.2063    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.1889    0.8395    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.2497    0.8368    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\nM  END",
          "smiles": "C(C[Si](Cl)(Cl)Cl)C(F)(F)F",
          "formula": "C3H4Cl3F3Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "be856e98-56e3-4934-9bf7-fcbaf83d0048"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "231.5034",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "16e7749f-c00e-4376-a5fb-dbf2f999e062",
      "version": "6",
      "structure": {
        "id": "89292277-467a-4ce9-b659-b728985c0750",
        "molfile": "\n  Marvin  01132107072D          \n\n 10  9  0  0  0  0            999 V2000\n    0.0000   -0.2063    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7178    0.2063    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    0.1889    0.8395    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.2497    0.8368    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1451    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8546   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    0.2063    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3834   -0.8395    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3226   -0.8368    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\nM  END",
        "smiles": "C(C[Si](Cl)(Cl)Cl)C(F)(F)F",
        "formula": "C3H4Cl3F3Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "231.5034",
        "optical_activity": "NONE",
        "references": [
          "341882d1-d7a6-4d62-a610-42fff5a3a39e",
          "d630d0c4-7624-4d05-b7db-37c6dab6c7a0"
        ],
        "stereo_centers": 0
      },
      "unii": "A2MIV9WA9Z"
    }
  ]
}