{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c769f4ca-0706-4155-904c-943a2fd2c62a",
          "code": "79-76-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79-76-5",
          "code_system": "CAS",
          "references": [
            "fb21f33b-8366-4371-b937-02f2c0728144",
            "7d7ee88d-8c5f-42f3-8497-454120b7e239"
          ]
        },
        {
          "uuid": "40266480-55aa-4f8a-9412-094c2719eee1",
          "code": "49816-69-5",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=49816-69-5",
          "code_system": "CAS",
          "references": [
            "fb21f33b-8366-4371-b937-02f2c0728144",
            "2e6181e6-1be7-47e8-91c8-54bc34c6b956"
          ]
        },
        {
          "uuid": "5d8c60cf-509f-45f9-8c0d-b8ac7f88c4ce",
          "code": "IONONE",
          "comments": "The ionones are a series of closely related chemical substances that are part of a group of compounds known as rose ketones, which also includes damascones and damascenones.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ionone",
          "code_system": "WIKIPEDIA",
          "references": [
            "fb21f33b-8366-4371-b937-02f2c0728144"
          ]
        },
        {
          "uuid": "83665877-b599-4e3f-89e7-ee727cdcf2ef",
          "code": "201-223-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.113",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fb21f33b-8366-4371-b937-02f2c0728144"
          ]
        },
        {
          "uuid": "c1d68a51-53e0-45c3-9a1e-de3a5cb23a7a",
          "code": "5363741",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5363741",
          "code_system": "PUBCHEM",
          "references": [
            "fb21f33b-8366-4371-b937-02f2c0728144"
          ]
        },
        {
          "uuid": "0b808345-3374-89df-10ff-29f279ad2b45",
          "code": "DTXSID5052543",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5052543",
          "code_system": "EPA CompTox",
          "references": [
            "8d50ef70-683a-a8ff-e2ff-fec6b518bd06"
          ]
        },
        {
          "uuid": "d980784b-bd0c-48fe-850a-4057ba7e3026",
          "code": "A1LVV75YWS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9034cb0a-9518-2927-7f25-52b77773d643",
          "code": "1095",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1095/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "ef0ffb87-fb90-3760-8a41-022055c65e1b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b0ca8643-82fd-4310-b0e1-2e196b9cf59a",
          "name": "(±)-.GAMMA.-IONONE",
          "stdName": "(+/-)-.GAMMA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "469cb2fb-ca1b-415c-9a5f-50fa6f2f3459"
          ],
          "display_name": false
        },
        {
          "uuid": "79e04992-8dc4-49f4-9cae-5c04e0d56689",
          "name": ".GAMMA.-IONONE",
          "stdName": ".GAMMA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "848edab2-4a81-4d3a-8b8e-ac14cf44b072"
          ],
          "display_name": true
        },
        {
          "uuid": "7d280244-6c9f-4595-8606-473d53cb75c6",
          "name": "3-BUTEN-2-ONE, 4-(2,2-DIMETHYL-6-METHYLENECYCLOHEXYL)-",
          "stdName": "3-BUTEN-2-ONE, 4-(2,2-DIMETHYL-6-METHYLENECYCLOHEXYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "469cb2fb-ca1b-415c-9a5f-50fa6f2f3459"
          ],
          "display_name": false
        },
        {
          "uuid": "b75a6b41-0695-4112-907c-7fbffa89072d",
          "name": "3-BUTEN-2-ONE, 4-(2,2-DIMETHYL-6-METHYLENECYCLOHEXYL)-, (3E)-",
          "stdName": "3-BUTEN-2-ONE, 4-(2,2-DIMETHYL-6-METHYLENECYCLOHEXYL)-, (3E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "469cb2fb-ca1b-415c-9a5f-50fa6f2f3459"
          ],
          "display_name": false
        },
        {
          "uuid": "6287a897-9fcd-4d5b-9c23-283c734e09fa",
          "name": "3-BUTEN-2-ONE, 4-(2,2-DIMETHYL-6-METHYLENECYCLOHEXYL)-, (E)-",
          "stdName": "3-BUTEN-2-ONE, 4-(2,2-DIMETHYL-6-METHYLENECYCLOHEXYL)-, (E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "469cb2fb-ca1b-415c-9a5f-50fa6f2f3459"
          ],
          "display_name": false
        },
        {
          "uuid": "dab9d250-2489-48b8-b5ba-8ab9a3f28031",
          "name": "3-BUTEN-2-ONE, 4-(2,2-DIMETHYL-6-METHYLENECYCLOHEXYL)-, (E)-(±)-",
          "stdName": "3-BUTEN-2-ONE, 4-(2,2-DIMETHYL-6-METHYLENECYCLOHEXYL)-, (E)-(+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "469cb2fb-ca1b-415c-9a5f-50fa6f2f3459"
          ],
          "display_name": false
        },
        {
          "uuid": "106e1940-b2ed-41d4-88d1-9ce475a02111",
          "name": "IONONE, .GAMMA.-",
          "stdName": "IONONE, .GAMMA.-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1753dc3-09c2-4f76-8939-98826bf2a866"
          ],
          "display_name": false
        },
        {
          "uuid": "337ca3d0-cd52-44d1-a573-83177603c79c",
          "name": "IONONE, GAMMA-",
          "stdName": "IONONE, GAMMA-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec3e5190-cb75-4209-b158-8157d78db59c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e1753dc3-09c2-4f76-8939-98826bf2a866",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "469cb2fb-ca1b-415c-9a5f-50fa6f2f3459",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "848edab2-4a81-4d3a-8b8e-ac14cf44b072",
          "citation": "EC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec3e5190-cb75-4209-b158-8157d78db59c",
          "citation": "cfsan",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb21f33b-8366-4371-b937-02f2c0728144",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392324000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2398f927-5984-4465-b5f6-39cab0cb3be9",
          "citation": "SRS import [A1LVV75YWS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A1LVV75YWS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392324000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d50ef70-683a-a8ff-e2ff-fec6b518bd06",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79-76-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d7ee88d-8c5f-42f3-8497-454120b7e239",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2e6181e6-1be7-47e8-91c8-54bc34c6b956",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ef0ffb87-fb90-3760-8a41-022055c65e1b",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fb580831-831c-4b7c-aa27-6b5b42dfe012",
          "id": "fb580831-831c-4b7c-aa27-6b5b42dfe012",
          "molfile": "\n  Marvin  01132113012D          \n\n 14 14  0  0  0  0            999 V2000\n    2.1434    0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.3885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -1.4289    0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    1.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434    0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -1.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3020   -1.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1105   -0.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
          "smiles": "C=C1CCCC(C)(C)C1/C=C/C(=O)C",
          "formula": "C13H20O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad52fb06-2ac6-4309-997e-4584b2b81e9b"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "192.2978",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9b62580d-d873-4400-b5fc-86d927a5b470",
      "version": "4",
      "structure": {
        "id": "8ec7beed-df26-4022-8a40-a5e11a9150ae",
        "molfile": "\n  Marvin  01132107242D          \n\n 14 14  0  0  0  0            999 V2000\n    2.1434    0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.3885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -1.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434    0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    1.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3020   -1.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1105   -0.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  2  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n  7 13  1  0  0  0  0\n  7 14  1  0  0  0  0\n  4  6  1  0  0  0  0\nM  END",
        "smiles": "C=C1CCCC(C)(C)C1/C=C/C(=O)C",
        "formula": "C13H20O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "192.2978",
        "optical_activity": "( + / - )",
        "references": [
          "848edab2-4a81-4d3a-8b8e-ac14cf44b072",
          "2398f927-5984-4465-b5f6-39cab0cb3be9"
        ],
        "stereo_centers": 1
      },
      "unii": "A1LVV75YWS"
    }
  ]
}