{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7ccc8449-a349-45f2-b1b0-da5106e206f7",
          "code": "R06AC05",
          "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Substituted ethylene diamines|methapyrilene",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R06AC05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "6d529edb-7a7a-494a-9152-e5ecab7f2893",
          "code": "C81143",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81143",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "9f3c4659-7072-4591-81ed-5709b18e1a4c",
          "code": "QR06AC05",
          "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Substituted ethylene diamines|methapyrilene",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AC05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "2efde71b-e572-46da-87f6-ed3bdbdfeefb",
          "code": "91-80-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=91-80-5",
          "code_system": "CAS",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f",
            "6681f683-1c89-4c85-b230-9b2471853cf7"
          ]
        },
        {
          "uuid": "ed2649c7-738e-4a8e-81d7-88732443ac2f",
          "code": "D008701",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008701",
          "code_system": "MESH",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "7b94f2e3-32e7-4119-a97e-7d88a7f4c29a",
          "code": "SUB08839MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "4ac84e95-30e0-4aab-a1bd-a03b4e295d81",
          "code": "1883",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1883",
          "code_system": "INN",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "cedd97e5-38fc-47a3-9c5b-19b2f3add2e4",
          "code": "202-099-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.909",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "08e2458d-d3c2-45f9-9d9d-ae32f76df29b",
          "code": "6822",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6822/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "58e205a2-e158-498c-9777-e4e791da8627",
          "code": "m7301",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7301?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "06fdbfda-5a3c-4993-b32f-26549b38a489",
          "code": "CHEMBL1411979",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1411979",
          "code_system": "ChEMBL",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "6864a039-87af-424a-a77c-c063ff804507",
          "code": "4098",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4098",
          "code_system": "PUBCHEM",
          "references": [
            "7f3b3d0d-1e68-497f-91cf-d414b7ae028f"
          ]
        },
        {
          "uuid": "79e8651f-a24a-a6e2-0761-be455de7eaa4",
          "code": "Methapyrilene",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methapyrilene",
          "code_system": "WIKIPEDIA",
          "references": [
            "4dce8222-7ebf-a2b8-f018-f262e53ba0ae"
          ]
        },
        {
          "uuid": "339b3d3f-1f1a-6b31-b77d-251ef268b9bf",
          "code": "4163",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4163",
          "code_system": "HSDB",
          "references": [
            "6aac4858-d4d6-ce2c-fcce-f9d4b7abb6d6"
          ]
        },
        {
          "uuid": "08d74bef-d572-fec7-a6de-8d73ee51bfde",
          "code": "DTXSID2023278",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023278",
          "code_system": "EPA CompTox",
          "references": [
            "ba48edab-653f-c0ef-e3f5-002e988515ec"
          ]
        },
        {
          "uuid": "0a1f1909-462a-8bfa-1988-c9010e70cdf0",
          "code": "C29578",
          "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7a17543f-1786-0dd0-a7a1-47f782b47aee"
          ]
        },
        {
          "uuid": "c829780d-ca63-4a0c-8148-9175553cae43",
          "code": "A01LX40298",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "45ae1da4-6682-0aed-07b4-d645f2de6431",
          "code": "1738",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1738",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7a17543f-1786-0dd0-a7a1-47f782b47aee"
          ]
        },
        {
          "uuid": "2e09471d-a5b9-f6f8-a191-d113d23bb1bc",
          "code": "DB04819",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04819",
          "code_system": "DRUG BANK",
          "references": [
            "7a17543f-1786-0dd0-a7a1-47f782b47aee"
          ]
        },
        {
          "uuid": "17a9b5f1-9e2c-5768-933e-51cb258ad494",
          "code": "6820",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6820",
          "code_system": "CHEBI",
          "references": [
            "7a17543f-1786-0dd0-a7a1-47f782b47aee"
          ]
        },
        {
          "uuid": "b006f53b-ef2f-a826-3e40-f1caba3325a8",
          "code": "100000081208",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "72107842-6424-ef5e-52c2-89f579d2ebb2"
          ]
        },
        {
          "uuid": "a8688aad-9d52-b8a8-4462-7733b049bb55",
          "code": "21 CFR 216.24",
          "comments": "PART 216 -- HUMAN DRUG COMPOUNDING|Subpart B--Compounded Drug Products|Sec. 216.24 Drug products withdrawn or removed from the market for reasons of safety or effectiveness.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=216.24",
          "code_system": "CFR",
          "references": [
            "948d7c2b-080e-5a35-99d0-97cbafd910ae"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "69265041-2d17-4e40-98b0-501763646762",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "dc9ccfec-babb-43ee-aca2-883cc5d7bf2d",
            "refuuid": "06623c54-e9ee-42b3-b56e-f1effd35301b",
            "name": "METHAPYRILENE",
            "unii": "A01LX40298",
            "linking_id": "A01LX40298",
            "ref_pname": "METHAPYRILENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e8b849e9-a3e8-4c43-a133-9869421650c7",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "cdcd18b8-bb07-4413-8ef3-4b54c5e976f4",
            "refuuid": "f5896d83-eb5b-4473-9637-b868e9c64ec1",
            "name": "METHAPYRILENE FUMARATE",
            "unii": "KJ5I25TXYL",
            "linking_id": "KJ5I25TXYL",
            "ref_pname": "METHAPYRILENE FUMARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3c8ed814-e501-4da0-bf58-3afe78242e45",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "be19bc15-282f-4755-9b6b-0b4e208074e6",
            "refuuid": "3623e35f-f2c3-43ce-8ae2-6ba60133d924",
            "name": "METHAPYRILENE HYDROCHLORIDE",
            "unii": "00S42N58OM",
            "linking_id": "00S42N58OM",
            "ref_pname": "METHAPYRILENE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eec815ea-058f-48ba-aca4-7920a275a564",
          "name": "1,2-ETHANEDIAMINE, N,N-DIMETHYL-N'-2-PYRIDINYL-N'-(2-THIENYLMETHYL)-",
          "stdName": "1,2-ETHANEDIAMINE, N,N-DIMETHYL-N'-2-PYRIDINYL-N'-(2-THIENYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7373fe6c-e27a-4e7d-8a02-21fd03b50bf4"
          ],
          "display_name": false
        },
        {
          "uuid": "9da697dc-e9c1-4365-8e79-81dde6be28d1",
          "name": "2-((2-(DIMETHYLAMINO)ETHYL)-2-THENYLAMINO)PYRIDINE",
          "stdName": "2-((2-(DIMETHYLAMINO)ETHYL)-2-THENYLAMINO)PYRIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7373fe6c-e27a-4e7d-8a02-21fd03b50bf4"
          ],
          "display_name": false
        },
        {
          "uuid": "dbbe311b-ce99-4ee9-a97f-77eca80f4938",
          "name": "A 3322",
          "stdName": "A 3322",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "d6c916ee-a855-47a3-9d4a-c81b12b17e34"
          ],
          "display_name": false
        },
        {
          "uuid": "71e398b6-e69e-40aa-abcc-8e387ae02ce0",
          "name": "A-3322",
          "stdName": "A-3322",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "d6c916ee-a855-47a3-9d4a-c81b12b17e34"
          ],
          "display_name": false
        },
        {
          "uuid": "ca2fe5dc-93ac-46ba-8176-ffc7dcdbd17d",
          "name": "METAPYRILENE",
          "stdName": "METAPYRILENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66493cb6-bd7a-4915-b527-bd5ffe86c0d5",
            "237ad388-b31e-4838-86df-45c1895ee89f"
          ],
          "display_name": false
        },
        {
          "uuid": "67778400-c3b7-4882-9b22-920f69933ccb",
          "name": "METHAPYRILENE",
          "stdName": "METHAPYRILENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6940a142-fabc-4dd9-af54-85560dba2dac",
            "4074a277-80a9-4e2d-95e9-9cf43c108703",
            "f14b9071-9438-4fdd-b74c-8f6f426e4d16",
            "07136bb6-8e1c-4722-9bce-5a4451c79203",
            "36f83e44-3086-49e6-97b1-feccf8a547cd",
            "576e6d9b-7c53-4af6-898c-961dbc23ad0d",
            "379f38f6-065c-483c-8fcb-a91d8cb520e5",
            "419f53dd-dbeb-4167-8849-e5d36d275054",
            "5a343787-467c-470b-9758-41f35f43119a",
            "f4f3d477-9bcf-4e21-b441-d5eb44ef553d",
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "e12bb262-be62-423c-9752-04706eee8fcf",
            "efa19de3-108b-446d-844a-a01dbcacb712",
            "07242d3d-aad2-49a1-9385-7860d0c6c18b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "928420d1-18ff-4fbe-9638-251968532143",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "22de1511-61a9-4546-9ede-8ee6d1fae0ce",
          "name": "METHAPYRILENE [HSDB]",
          "stdName": "METHAPYRILENE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "379f38f6-065c-483c-8fcb-a91d8cb520e5"
          ],
          "display_name": false
        },
        {
          "uuid": "93823ddb-d7d0-43f9-b916-cd5827bf9d69",
          "name": "METHAPYRILENE [MART.]",
          "stdName": "METHAPYRILENE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4074a277-80a9-4e2d-95e9-9cf43c108703"
          ],
          "display_name": false
        },
        {
          "uuid": "7eb31818-c80c-4677-9c22-e263353dfe10",
          "name": "METHAPYRILENE [MI]",
          "stdName": "METHAPYRILENE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "419f53dd-dbeb-4167-8849-e5d36d275054"
          ],
          "display_name": false
        },
        {
          "uuid": "ed3a1e57-2917-4789-ae37-98ecd867fad5",
          "name": "METHAPYRILENE [VANDF]",
          "stdName": "METHAPYRILENE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "07242d3d-aad2-49a1-9385-7860d0c6c18b"
          ],
          "display_name": false
        },
        {
          "uuid": "6d8cb492-46c2-462d-48e9-f0e9e53de2eb",
          "name": "Methapyrilene [WHO-DD]",
          "stdName": "METHAPYRILENE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab60a623-f172-26dc-ecf4-4e66bfb7e1a2"
          ],
          "display_name": false
        },
        {
          "uuid": "e6c0744f-7955-4e68-aeb1-fb884d8ba709",
          "name": "PYRINISTOL",
          "stdName": "PYRINISTOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66493cb6-bd7a-4915-b527-bd5ffe86c0d5",
            "237ad388-b31e-4838-86df-45c1895ee89f"
          ],
          "display_name": false
        },
        {
          "uuid": "54e8694c-d593-41e5-a71f-134f05524a80",
          "name": "RESTRYL",
          "stdName": "RESTRYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66493cb6-bd7a-4915-b527-bd5ffe86c0d5",
            "237ad388-b31e-4838-86df-45c1895ee89f"
          ],
          "display_name": false
        },
        {
          "uuid": "c5738677-58a4-48ca-ac7e-ce46edaaf01c",
          "name": "SEMIKON",
          "stdName": "SEMIKON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66493cb6-bd7a-4915-b527-bd5ffe86c0d5",
            "237ad388-b31e-4838-86df-45c1895ee89f"
          ],
          "display_name": false
        },
        {
          "uuid": "2bb6c1da-8274-450a-898a-1183b7dcf1bc",
          "name": "SLEEPWELL",
          "stdName": "SLEEPWELL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66493cb6-bd7a-4915-b527-bd5ffe86c0d5",
            "237ad388-b31e-4838-86df-45c1895ee89f"
          ],
          "display_name": false
        },
        {
          "uuid": "83ed6530-3657-40c2-a4de-a230602174bc",
          "name": "TENALIN",
          "stdName": "TENALIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "d6c916ee-a855-47a3-9d4a-c81b12b17e34"
          ],
          "display_name": false
        },
        {
          "uuid": "f57e906e-3ee7-4c66-908c-d9e73a5661f9",
          "name": "THENYLPYRAMINE",
          "stdName": "THENYLPYRAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "d6c916ee-a855-47a3-9d4a-c81b12b17e34"
          ],
          "display_name": false
        },
        {
          "uuid": "2ec4ee25-3188-4d03-995f-52507e009a3c",
          "name": "THIONYLAN",
          "stdName": "THIONYLAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "237ad388-b31e-4838-86df-45c1895ee89f",
            "d6c916ee-a855-47a3-9d4a-c81b12b17e34"
          ],
          "display_name": false
        },
        {
          "uuid": "8b3ff6b2-c83f-447b-9a00-a70197fa821b",
          "name": "methapyrilene [INN]",
          "stdName": "METHAPYRILENE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f14b9071-9438-4fdd-b74c-8f6f426e4d16"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e12bb262-be62-423c-9752-04706eee8fcf",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7373fe6c-e27a-4e7d-8a02-21fd03b50bf4",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f14b9071-9438-4fdd-b74c-8f6f426e4d16",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4074a277-80a9-4e2d-95e9-9cf43c108703",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "419f53dd-dbeb-4167-8849-e5d36d275054",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "237ad388-b31e-4838-86df-45c1895ee89f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "379f38f6-065c-483c-8fcb-a91d8cb520e5",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6c916ee-a855-47a3-9d4a-c81b12b17e34",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66493cb6-bd7a-4915-b527-bd5ffe86c0d5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36f83e44-3086-49e6-97b1-feccf8a547cd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07242d3d-aad2-49a1-9385-7860d0c6c18b",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f3b3d0d-1e68-497f-91cf-d414b7ae028f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "046db9ce-e553-4420-b2da-46cce4cbfc14",
          "citation": "SRS import [A01LX40298]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A01LX40298",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07136bb6-8e1c-4722-9bce-5a4451c79203",
          "citation": "METHAPYRILENE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "576e6d9b-7c53-4af6-898c-961dbc23ad0d",
          "citation": "METHAPYRILENE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a343787-467c-470b-9758-41f35f43119a",
          "citation": "METHAPYRILENE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6940a142-fabc-4dd9-af54-85560dba2dac",
          "citation": "METHAPYRILENE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "efa19de3-108b-446d-844a-a01dbcacb712",
          "citation": "METHAPYRILENE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f4f3d477-9bcf-4e21-b441-d5eb44ef553d",
          "citation": "METHAPYRILENE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4dce8222-7ebf-a2b8-f018-f262e53ba0ae",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Metapyrilene",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6aac4858-d4d6-ce2c-fcce-f9d4b7abb6d6",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+91-80-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ba48edab-653f-c0ef-e3f5-002e988515ec",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=91-80-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7a17543f-1786-0dd0-a7a1-47f782b47aee",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6681f683-1c89-4c85-b230-9b2471853cf7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ab60a623-f172-26dc-ecf4-4e66bfb7e1a2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "72107842-6424-ef5e-52c2-89f579d2ebb2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "948d7c2b-080e-5a35-99d0-97cbafd910ae",
          "citation": "21 CFR 216.24",
          "doc_type": "CFR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8fcd9d9c-4d43-430e-9a8e-e34a608bade3",
          "id": "8fcd9d9c-4d43-430e-9a8e-e34a608bade3",
          "molfile": "\n  Marvin  01132107272D          \n\n 18 19  0  0  0  0            999 V2000\n    5.0007   -1.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2800   -1.2424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2800   -0.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5671   -1.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8516   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1491   -1.6531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1491   -2.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9162   -2.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1616   -3.5284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9907   -3.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2619   -2.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5981   -2.2731    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4336   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4336   -0.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7155    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7155   -1.6531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n 13  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 12  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CN(C)CCN(Cc1cccs1)c2ccccn2",
          "formula": "C14H19N3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "01867ca9-71f3-481e-9606-8025feaab5a0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "261.3874",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "06623c54-e9ee-42b3-b56e-f1effd35301b",
      "version": "18",
      "structure": {
        "id": "8639c84a-6796-4164-b791-047fcbb5d9f3",
        "molfile": "\n  Marvin  01132106582D          \n\n 18 19  0  0  0  0            999 V2000\n    2.1491   -1.6531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4336   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9162   -2.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5981   -2.2731    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1491   -2.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7155   -1.6531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2619   -2.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1616   -3.5284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8516   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9907   -3.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2800   -1.2424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5671   -1.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4336   -0.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0007   -1.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2800   -0.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7155    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13  2  2  0  0  0  0\n 14  6  2  0  0  0  0\n 15 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 17  2  0  0  0  0\n 10  7  2  0  0  0  0\n 18 14  1  0  0  0  0\nM  END",
        "smiles": "CN(C)CCN(Cc1cccs1)c2ccccn2",
        "formula": "C14H19N3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "261.3874",
        "optical_activity": "NONE",
        "references": [
          "046db9ce-e553-4420-b2da-46cce4cbfc14",
          "e12bb262-be62-423c-9752-04706eee8fcf",
          "f14b9071-9438-4fdd-b74c-8f6f426e4d16"
        ],
        "stereo_centers": 0
      },
      "unii": "A01LX40298"
    }
  ]
}