{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "06fc0d6b-6992-45ff-b426-90d5c3229b57", "code": "6415-98-1", "type": "MAJOR COMPONENT STRUCTURE/SEQUENCE", "url": "https://commonchemistry.cas.org/detail?cas_rn=6415-98-1", "code_system": "CAS", "references": [ "8893128a-7a51-441e-b594-df47aea981ae", "000bb53b-2476-4808-aa56-a98c4b644dc9" ] }, { "uuid": "c4a33859-8321-4837-9248-a0e4832e18a3", "code": "28983-56-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=28983-56-4", "code_system": "CAS", "references": [ "8893128a-7a51-441e-b594-df47aea981ae", "7bd1e144-a5a5-44da-ad2e-294f28b1c57b" ] }, { "uuid": "29bec112-8cad-487e-ae2a-3af43882376f", "code": "METHYL BLUE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Methyl_blue", "code_system": "WIKIPEDIA", "references": [ "8893128a-7a51-441e-b594-df47aea981ae" ] }, { "uuid": "361952d0-b344-4ce4-b79d-b2d20c10d581", "code": "229-121-9", "type": "ALTERNATIVE", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.474", "code_system": "ECHA (EC/EINECS)", "references": [ "8893128a-7a51-441e-b594-df47aea981ae" ] }, { "uuid": "46fa0769-bb41-40cb-a693-ba81a2ab506c", "code": "m7372", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m7372?q=authorize", "code_system": "MERCK INDEX", "references": [ "8893128a-7a51-441e-b594-df47aea981ae" ] }, { "uuid": "bad3e7d5-0240-4b10-bc22-d85b3d3ac335", "code": "249-352-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.852", "code_system": "ECHA (EC/EINECS)", "references": [ "8893128a-7a51-441e-b594-df47aea981ae" ] }, { "uuid": "3112228b-f900-4c60-a590-196c07100b44", "code": "76956083", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76956083", "code_system": "PUBCHEM", "references": [ "8893128a-7a51-441e-b594-df47aea981ae" ] }, { "uuid": "6ca8df97-e16c-9ebd-ffa3-891fc1b727b2", "code": "DTXSID90889705", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90889705", "code_system": "EPA CompTox", "references": [ "768b12b3-27b1-74e5-96d2-aafb95047f8d" ] }, { "uuid": "03c2ec04-9326-e8da-772c-6d4a01902457", "code": "2176448", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2176448/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "9b7ac914-1ee0-b64e-b2b0-14239a9058e2" ] }, { "uuid": "b484b644-1237-4fd3-9218-3e9c412e8b76", "code": "9ZI2A1BMBB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "46fb5041-2747-cdcf-04e5-d1d34830acb9", "code": "87472", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:87472", "code_system": "CHEBI", "references": [ "537cb293-fc02-2a99-2e0e-e379a602d953" ] } ], "substance_class": "chemical", "names": [ { "uuid": "a13f2c70-7fc4-4025-96d5-d032f19fe9a7", "name": "((4-(BIS(4-((SULFOPHENYL)AMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)AMINO)BENZENESULFONIC ACID SODIUM SALT (1:2)", "stdName": "((4-(BIS(4-((SULFOPHENYL)AMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)AMINO)BENZENESULFONIC ACID SODIUM SALT (1:2)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a15f83b1-59bf-44ac-963f-774700e0439f", "09771f81-4fa6-4a8e-a5ed-4ce410573eb5" ], "display_name": false }, { "uuid": "0cdfb81f-c0dd-4e31-a4bf-e1f29c38501b", "name": "BENZENESULFONIC ACID, ((4-(BIS(4-((SULFOPHENYL)AMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)AMINO)-, SODIUM SALT (1:2)", "stdName": "BENZENESULFONIC ACID, ((4-(BIS(4-((SULFOPHENYL)AMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)AMINO)-, SODIUM SALT (1:2)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a15f83b1-59bf-44ac-963f-774700e0439f", "9319739a-7d4d-4f65-bcd5-35cbc9002662" ], "display_name": false }, { "uuid": "29d2a413-2b7c-4a71-b3e0-05b7c4848d8f", "name": "BRILLIANT COTTON BLUE", "stdName": "BRILLIANT COTTON BLUE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a15f83b1-59bf-44ac-963f-774700e0439f", "09771f81-4fa6-4a8e-a5ed-4ce410573eb5" ], "display_name": false }, { "uuid": "446dbcbb-5f2b-436a-9ee1-b33c6bd1439a", "name": "C.I. 42780", "stdName": "C.I. 42780", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a15f83b1-59bf-44ac-963f-774700e0439f", "09771f81-4fa6-4a8e-a5ed-4ce410573eb5" ], "display_name": false }, { "uuid": "5c5b54a1-ebae-4bd4-837e-cc74d42fd2a0", "name": "C.I. ACID BLUE 93", "stdName": "C.I. ACID BLUE 93", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a15f83b1-59bf-44ac-963f-774700e0439f", "09771f81-4fa6-4a8e-a5ed-4ce410573eb5" ], "display_name": false }, { "uuid": "9d973d71-29df-4ab9-ab59-8713748cf9f6", "name": "CI 42780", "stdName": "CI 42780", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d4d63d85-078f-4e66-92e9-99d6944f6407", "a15f83b1-59bf-44ac-963f-774700e0439f" ], "display_name": false }, { "uuid": "d01242dd-023f-42ff-937f-03a6b8fc3bcd", "name": "HELVETIA BLUE", "stdName": "HELVETIA BLUE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a15f83b1-59bf-44ac-963f-774700e0439f", "09771f81-4fa6-4a8e-a5ed-4ce410573eb5" ], "display_name": false }, { "uuid": "3af6ff39-8d3b-417f-b257-59958ebb3531", "name": "METHYL BLUE", "stdName": "METHYL BLUE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "667d5615-cab1-4a4c-bc47-65fad95e0bc6", "c2727a75-967b-404d-a907-ca839983d5b5", "a15f83b1-59bf-44ac-963f-774700e0439f", "0aa2edb9-2d43-4225-803c-738821f5123c" ], "display_name": true }, { "uuid": "f5b55aca-9978-46cb-82e0-666abe3da2e0", "name": "METHYL BLUE [MI]", "stdName": "METHYL BLUE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c2727a75-967b-404d-a907-ca839983d5b5", "a15f83b1-59bf-44ac-963f-774700e0439f" ], "display_name": false }, { "uuid": "ccc71e7f-1994-4fbd-a495-458add590e49", "name": "SODIUM TRIPHENYL-P-ROSANILINETRISULFATE", "stdName": "SODIUM TRIPHENYL-P-ROSANILINETRISULFATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a15f83b1-59bf-44ac-963f-774700e0439f", "09771f81-4fa6-4a8e-a5ed-4ce410573eb5" ], "display_name": false } ], "references": [ { "uuid": "0aa2edb9-2d43-4225-803c-738821f5123c", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c2727a75-967b-404d-a907-ca839983d5b5", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a15f83b1-59bf-44ac-963f-774700e0439f", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "09771f81-4fa6-4a8e-a5ed-4ce410573eb5", "citation": "Merck", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9319739a-7d4d-4f65-bcd5-35cbc9002662", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d4d63d85-078f-4e66-92e9-99d6944f6407", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8893128a-7a51-441e-b594-df47aea981ae", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390959000, "tags": [ "NOMEN" ] }, { "uuid": "5586d118-7ab1-4dbb-8c88-12c3a225370e", "citation": "SRS import [9ZI2A1BMBB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9ZI2A1BMBB", "doc_type": "SRS", "public_domain": true, "document_date": 1493390959000, "tags": [ "NOMEN" ] }, { "uuid": "434c782f-881e-4ded-9152-b742145fbf68", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "667d5615-cab1-4a4c-bc47-65fad95e0bc6", "citation": "METHYL BLUE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0887bbce-5401-2a41-d5fc-524af1c51893", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6415-98-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9b7ac914-1ee0-b64e-b2b0-14239a9058e2", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "7bd1e144-a5a5-44da-ad2e-294f28b1c57b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "000bb53b-2476-4808-aa56-a98c4b644dc9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "537cb293-fc02-2a99-2e0e-e379a602d953", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "6c375561-8b66-4c25-172f-0f0003faed28", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "768b12b3-27b1-74e5-96d2-aafb95047f8d", "citation": "EPA", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5602b52a-c62a-4876-b9a0-51775f93def8", "id": "5602b52a-c62a-4876-b9a0-51775f93def8", "molfile": "\n Marvin 01132104282D \n\n 1 0 0 0 0 0 999 V2000\n -4.3369 -0.6938 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "607f7a93-e79d-4a58-8686-458676968fbf" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "54a14829-d768-4702-86ce-71be7ca3dd9e", "id": "54a14829-d768-4702-86ce-71be7ca3dd9e", "molfile": "\n Marvin 01132104242D \n\n 52 57 0 0 0 0 999 V2000\n -5.7197 -4.2315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8946 -4.2315 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8946 -5.0565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8946 -3.4065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0697 -4.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6572 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8322 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4197 -4.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8322 -4.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6572 -4.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5947 -4.2315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 -2.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5947 -2.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 -1.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5947 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5946 1.4842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 2.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 2.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 2.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 3.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 3.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5946 2.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 4.3421 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4679 5.0565 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.7698 3.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6591 4.7546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8803 -1.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2928 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1178 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5302 -1.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3553 -1.3737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7678 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5927 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0052 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5927 0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7678 0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3553 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0052 1.4842 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4178 2.1986 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.7197 1.0717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2908 1.8967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1178 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2928 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 2 2 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 8 11 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 18 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 19 1 0 0 0 0\n 36 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 35 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 34 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 29 2 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 2 0 0 0 0\n 27 30 1 0 0 0 0\n 29 28 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 30 2 0 0 0 0\n 33 30 2 0 0 0 0\n 35 34 1 0 0 0 0\n 37 36 1 0 0 0 0\n 52 36 2 0 0 0 0\n 38 37 2 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 39 51 2 0 0 0 0\n 41 40 1 0 0 0 0\n 42 41 1 0 0 0 0\n 46 41 2 0 0 0 0\n 43 42 2 0 0 0 0\n 44 43 1 0 0 0 0\n 44 45 2 0 0 0 0\n 47 44 1 0 0 0 0\n 45 46 1 0 0 0 0\n 48 47 1 0 0 0 0\n 49 47 2 0 0 0 0\n 50 47 2 0 0 0 0\n 51 52 1 0 0 0 0\nM CHG 2 31 -1 48 -1\nM END", "smiles": "c1cc(ccc1C(=C2C=C/C(=N/c3ccc(cc3)S(=O)(=O)O)/C=C2)c4ccc(cc4)Nc5ccc(cc5)S(=O)(=O)[O-])Nc6ccc(cc6)S(=O)(=O)[O-]", "formula": "C37H27N3O9S3", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0447f620-def4-4d7b-a3bd-717ed7f861ef" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "753.8246", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6e040483-b284-49c5-803a-62bbb382f539", "version": "9", "structure": { "id": "357cae3f-f1eb-47b9-9394-9cd0efc5c2d6", "molfile": "\n Marvin 01132102512D \n\n 54 57 0 0 0 0 999 V2000\n 0.0553 4.3421 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7698 3.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6591 4.7546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4679 5.0565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 3.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 2.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 2.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 2.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5946 1.4842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5947 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 -1.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8803 -1.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2928 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1178 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5302 -1.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3553 -1.3737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7678 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5927 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0052 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5927 0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0052 1.4842 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7197 1.0717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2908 1.8967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4178 2.1986 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.7678 0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3553 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1178 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2928 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 -2.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5947 -4.2315 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -2.4197 -4.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8322 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6572 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0697 -4.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8946 -4.2315 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8946 -5.0565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8946 -3.4065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7197 -4.2315 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -3.6572 -4.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8322 -4.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5947 -2.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5946 2.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1822 3.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3369 -0.6938 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n -4.3369 -0.6938 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 1 2 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 24 2 0 0 0 0\n 27 24 1 0 0 0 0\n 23 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 20 1 0 0 0 0\n 18 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 15 1 0 0 0 0\n 32 14 2 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 2 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 2 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 2 0 0 0 0\n 41 40 1 0 0 0 0\n 42 41 2 0 0 0 0\n 43 41 2 0 0 0 0\n 44 41 1 0 0 0 0\n 40 45 1 0 0 0 0\n 45 46 2 0 0 0 0\n 46 37 1 0 0 0 0\n 35 47 1 0 0 0 0\n 47 48 2 0 0 0 0\n 48 32 1 0 0 0 0\n 13 49 2 0 0 0 0\n 49 50 1 0 0 0 0\n 50 10 2 0 0 0 0\n 8 51 1 0 0 0 0\n 51 52 2 0 0 0 0\n 52 5 1 0 0 0 0\nM CHG 5 27 -1 36 1 44 -1 53 1 54 1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 2 53 54\nM SPA 1 1 53\nM SDI 1 4 -4.7569 -1.1138 -4.7569 -0.2738\nM SDI 1 4 -3.9169 -0.2738 -3.9169 -1.1138\nM SMT 1 2\nM END", "smiles": "c1cc(ccc1/C(=C2/C=CC(=[NH+]/c3ccc(cc3)S(=O)(=O)[O-])/C=C2)/c4ccc(cc4)Nc5ccc(cc5)S(=O)(=O)[O-])Nc6ccc(cc6)S(=O)(=O)O.[Na+].[Na+]", "formula": "C37H28N3O9S3.2Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "800.8121", "optical_activity": "NONE", "references": [ "5586d118-7ab1-4dbb-8c88-12c3a225370e", "434c782f-881e-4ded-9152-b742145fbf68" ], "stereo_centers": 0 }, "unii": "9ZI2A1BMBB" } ] }