{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8f671a10-0b03-418f-bcba-0d24e0c0a907",
          "code": "C83690",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83690",
          "code_system": "NCI_THESAURUS",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "41045c84-1f75-43bd-9c6f-aa21ea9f137f",
          "code": "27503-81-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27503-81-7",
          "code_system": "CAS",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3",
            "2e64f161-1087-4df1-b329-00bcdea8d817"
          ]
        },
        {
          "uuid": "f71f94d2-4af1-427b-85ba-c06029990537",
          "code": "C499767",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67499767",
          "code_system": "MESH",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "d05f0088-15d5-4bbb-834c-2b6259caacfb",
          "code": "21 CFR 352.10",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.10 Sunscreen active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.10",
          "code_system": "CFR",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "ca8506b5-313a-4057-8a46-73c4ee3e639a",
          "code": "21 CFR 352.20",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.20 Permitted combinations of active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.20",
          "code_system": "CFR",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "39cdb155-bbc4-4d21-8648-bdbe4e730f9c",
          "code": "SUB01893MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "44d698ba-d2f5-4a6f-ac13-23fa1035cc64",
          "code": "7995",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7995",
          "code_system": "INN",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "976c0475-6ad4-4b2c-b9c3-a23733d0cf6b",
          "code": "248-502-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.078",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "e45634c0-ac1d-44f2-929a-4be59129436f",
          "code": "13714",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/13714/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "0337bb41-1a6f-4e40-847f-b0661a4d10d0",
          "code": "m4917",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4917?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "1f1a7346-9cca-47c0-afac-a37d91604149",
          "code": "CHEMBL1987518",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1987518",
          "code_system": "ChEMBL",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "84483af9-a100-4039-90f7-4a7768535d87",
          "code": "33919",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/33919",
          "code_system": "PUBCHEM",
          "references": [
            "08dd6023-3be8-4a62-a801-f29b3507cfc3"
          ]
        },
        {
          "uuid": "416d5603-abf2-b2d8-3334-081242add951",
          "code": "DTXSID3038852",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3038852",
          "code_system": "EPA CompTox",
          "references": [
            "639f1e25-9734-88ad-361e-48de73b57a3d"
          ]
        },
        {
          "uuid": "861e4e06-3245-c6cb-3fb8-2ea759364a13",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "842aa090-c9d8-816f-6a9d-906a8cf7c3fc"
          ]
        },
        {
          "uuid": "0b4e7047-8867-46ca-9915-bcbb51a67341",
          "code": "9YQ9DI1W42",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "30277541-59d7-702f-0a7d-8325772c3ee3",
          "code": "3179",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3179",
          "code_system": "DRUG CENTRAL",
          "references": [
            "842aa090-c9d8-816f-6a9d-906a8cf7c3fc"
          ]
        },
        {
          "uuid": "0106e7d6-b376-2f2a-cdc4-ad0fa3ecf869",
          "code": "DB11115",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11115",
          "code_system": "DRUG BANK",
          "references": [
            "842aa090-c9d8-816f-6a9d-906a8cf7c3fc"
          ]
        },
        {
          "uuid": "7f5fd66a-4755-d26f-c752-da174c7fe03e",
          "code": "1530809",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1530809",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "842aa090-c9d8-816f-6a9d-906a8cf7c3fc"
          ]
        },
        {
          "uuid": "c98573fc-c68f-c8ff-49b2-c4f49a540c83",
          "code": "LL-23",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/LL-23/relevant/1/",
          "code_system": "USAN",
          "references": [
            "e3caf5db-6a90-c34d-cbf5-28c5e211aef0"
          ]
        },
        {
          "uuid": "9b58f4df-1caa-c049-5072-3923433397aa",
          "code": "Ensulizole",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ensulizole",
          "code_system": "WIKIPEDIA",
          "references": [
            "c74eef1d-4bbe-86be-57e1-4194c03faa2d"
          ]
        },
        {
          "uuid": "5ffe9c45-df9d-3b20-1e4f-e9e00d6b244e",
          "code": "100000087263",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d80a731c-e67b-3627-dd34-4eba63abff57"
          ]
        },
        {
          "uuid": "1c8dbc01-a05e-52e1-d507-ec435b3d34e0",
          "code": "9YQ9DI1W42",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9YQ9DI1W42",
          "code_system": "DAILYMED",
          "references": [
            "6d542805-def0-5342-e1dc-c99bc89256d1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5b1fe258-9342-4046-96de-db5912d98c54",
          "amount": {
            "uuid": "4ba7bc22-a913-4fd8-9d61-5d0cdcbc60bd"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "bf30535e-45f9-4da7-ba64-19f9fb4b6e88",
            "refuuid": "6aac51d6-7e63-4e9f-b50c-88f34d87a786",
            "name": "ENSULIZOLE",
            "unii": "9YQ9DI1W42",
            "linking_id": "9YQ9DI1W42",
            "ref_pname": "ENSULIZOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "682db1bb-36d2-46ed-a8b0-455ebb83a825",
          "amount": {
            "uuid": "69e943c5-5ffb-4c91-881c-34edc804e275"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "231a8236-b3ba-42ed-8558-c15cb6d9d5e6",
            "refuuid": "3fc64cc4-32f2-48b2-995d-be24d2f4f5a0",
            "name": "ENSULIZOLE SODIUM",
            "unii": "66LQ48A9BT",
            "linking_id": "66LQ48A9BT",
            "ref_pname": "ENSULIZOLE SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c39da32c-0283-46f1-a7d9-e49cbd63ee07",
          "amount": {
            "uuid": "6fe00102-3114-4f30-bcd4-2f01fd45f67d"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bf7f9d22-2a25-4846-b03c-f339aeec45b4",
            "refuuid": "00293f6f-f741-40a2-9b78-52bb2ab9be06",
            "name": "ENSULIZOLE POTASSIUM",
            "unii": "058078A0QS",
            "linking_id": "058078A0QS",
            "ref_pname": "ENSULIZOLE POTASSIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c65937a9-4718-4597-b131-fe8cb5ff617e",
          "name": "1H-BENZIMIDAZOLE-5-SULFONIC ACID-2-PHENYL-",
          "stdName": "1H-BENZIMIDAZOLE-5-SULFONIC ACID-2-PHENYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6534117-4598-42ca-b23c-de665838f25c"
          ],
          "display_name": false
        },
        {
          "uuid": "7f97d1fb-8f4f-4dd0-95e1-de7895d91179",
          "name": "2-PHENYLBENZIMIDAZOLE-5-SULFONIC ACID [VANDF]",
          "stdName": "2-PHENYLBENZIMIDAZOLE-5-SULFONIC ACID [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e83cfef1-8164-4769-b08f-60b9f5b8e998"
          ],
          "display_name": false
        },
        {
          "uuid": "2c69af0a-acba-4c10-bca8-075ff3f1c387",
          "name": "2-Phenylbenzimidazole-5-sulfonic acid",
          "stdName": "2-PHENYLBENZIMIDAZOLE-5-SULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e83cfef1-8164-4769-b08f-60b9f5b8e998",
            "a77193c1-78af-4681-a09f-f720460b6431",
            "35ca3c96-64fb-4b84-b4a9-9f575c35b9d0"
          ],
          "display_name": false
        },
        {
          "uuid": "3fe1a0ab-ba15-469c-b0e1-314f81b0946f",
          "name": "ENSULIZOLE",
          "stdName": "ENSULIZOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33c894ee-7dfe-4a5a-8ada-346b0c676d66",
            "9e038a47-6dc7-4c74-b0e5-fed785ec4f3a",
            "0871e4f8-8927-4e37-b21b-eb92d1f5282e",
            "a6534117-4598-42ca-b23c-de665838f25c",
            "fb8e34d0-abae-4afd-b376-0108a10b80d5",
            "fe15470f-8783-48c3-b531-351d37950b4d",
            "d79054bc-104b-426e-b220-09b4f76491b0",
            "7f50dbfb-c038-4f18-a210-7acc66945061",
            "5a588017-5cd6-4a22-9c4a-9a4bea5766c7",
            "36b8fbf8-d6b2-4699-8653-f3438b453293",
            "71813e0b-4db8-4c5e-9769-26b741fd56b2",
            "cf6e82dd-b915-46a4-9049-7cd0861a35ec",
            "d368affc-55f0-4ffd-acee-71ac14b4c1fd",
            "416be740-e2b4-47b0-8047-6e5eef16abb4",
            "cdb2e2df-815b-4708-8af9-a4f8a8fdd1ef"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "32b64dd0-5221-4740-a1d8-abd0e53e4634",
              "name_org": "USAN"
            },
            {
              "uuid": "7599bac2-7473-44cb-9f76-86d852a8f560",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ee654c53-e7da-4fbe-a4ae-6ce3151faa4e",
          "name": "ENSULIZOLE [MART.]",
          "stdName": "ENSULIZOLE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb8e34d0-abae-4afd-b376-0108a10b80d5"
          ],
          "display_name": false
        },
        {
          "uuid": "602cd046-8ffe-4a5e-8b28-35d9dfb66fa4",
          "name": "ENSULIZOLE [MI]",
          "stdName": "ENSULIZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f50dbfb-c038-4f18-a210-7acc66945061"
          ],
          "display_name": false
        },
        {
          "uuid": "85885c16-46e0-420d-8f8d-782215caf872",
          "name": "ENSULIZOLE [USAN]",
          "stdName": "ENSULIZOLE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "416be740-e2b4-47b0-8047-6e5eef16abb4"
          ],
          "display_name": false
        },
        {
          "uuid": "ea0c70a0-d0d9-94ed-136d-672689d5a0ed",
          "name": "ENSULIZOLE [USP MONOGRAPH]",
          "stdName": "ENSULIZOLE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1138524-8ebb-806a-7835-9f2776bee7f7"
          ],
          "display_name": false
        },
        {
          "uuid": "d17e7b73-a26c-4773-8985-feb449e99979",
          "name": "ENSULIZOLE [USP-RS]",
          "stdName": "ENSULIZOLE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0871e4f8-8927-4e37-b21b-eb92d1f5282e"
          ],
          "display_name": false
        },
        {
          "uuid": "6b507e35-dec1-6133-4e4e-879ddecd8490",
          "name": "Ensulizole [WHO-DD]",
          "stdName": "ENSULIZOLE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e1dc960-19de-4d1f-540d-b7762db12c5c"
          ],
          "display_name": false
        },
        {
          "uuid": "2ea096ce-db08-499b-a263-ffae7c936031",
          "name": "PHENYLBENZIMIDAZOLE SULFONIC ACID",
          "stdName": "PHENYLBENZIMIDAZOLE SULFONIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "8bc30429-9734-42a8-8f17-aa58141034c6",
            "3c279bf5-7469-4fc1-9151-64df8a22cfaf",
            "a6534117-4598-42ca-b23c-de665838f25c"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f5d66c9b-87b8-49da-8e58-c029f55529a0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cee7c013-c3e9-467e-a393-3574dd136377",
          "name": "ensulizole [INN]",
          "stdName": "ENSULIZOLE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e038a47-6dc7-4c74-b0e5-fed785ec4f3a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "35ca3c96-64fb-4b84-b4a9-9f575c35b9d0",
          "citation": "USP DICTIONARY 20009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a6534117-4598-42ca-b23c-de665838f25c",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "416be740-e2b4-47b0-8047-6e5eef16abb4",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e038a47-6dc7-4c74-b0e5-fed785ec4f3a",
          "citation": "INN Proposed List 83",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL83.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d368affc-55f0-4ffd-acee-71ac14b4c1fd",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb8e34d0-abae-4afd-b376-0108a10b80d5",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f50dbfb-c038-4f18-a210-7acc66945061",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bc30429-9734-42a8-8f17-aa58141034c6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0871e4f8-8927-4e37-b21b-eb92d1f5282e",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36b8fbf8-d6b2-4699-8653-f3438b453293",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e83cfef1-8164-4769-b08f-60b9f5b8e998",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08dd6023-3be8-4a62-a801-f29b3507cfc3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55070502-a84f-46d1-a08e-92956968b57f",
          "citation": "SRS import [9YQ9DI1W42]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9YQ9DI1W42",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf6e82dd-b915-46a4-9049-7cd0861a35ec",
          "citation": "ENSULIZOLE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a588017-5cd6-4a22-9c4a-9a4bea5766c7",
          "citation": "ENSULIZOLE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cdb2e2df-815b-4708-8af9-a4f8a8fdd1ef",
          "citation": "ENSULIZOLE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe15470f-8783-48c3-b531-351d37950b4d",
          "citation": "ENSULIZOLE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71813e0b-4db8-4c5e-9769-26b741fd56b2",
          "citation": "ENSULIZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c279bf5-7469-4fc1-9151-64df8a22cfaf",
          "citation": "PHENYLBENZIMIDAZOLE SULFONIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "33c894ee-7dfe-4a5a-8ada-346b0c676d66",
          "citation": "ENSULIZOLE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d79054bc-104b-426e-b220-09b4f76491b0",
          "citation": "ENSULIZOLE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a77193c1-78af-4681-a09f-f720460b6431",
          "citation": "2-PHENYLBENZIMIDAZOLE-5-SULFONIC ACID [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "639f1e25-9734-88ad-361e-48de73b57a3d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27503-81-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "842aa090-c9d8-816f-6a9d-906a8cf7c3fc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c74eef1d-4bbe-86be-57e1-4194c03faa2d",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "2e64f161-1087-4df1-b329-00bcdea8d817",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e3caf5db-6a90-c34d-cbf5-28c5e211aef0",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "f1138524-8ebb-806a-7835-9f2776bee7f7",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "6d542805-def0-5342-e1dc-c99bc89256d1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1e1dc960-19de-4d1f-540d-b7762db12c5c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d80a731c-e67b-3627-dd34-4eba63abff57",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6525bfe6-0265-49d4-825b-40afe68b717b",
          "id": "6525bfe6-0265-49d4-825b-40afe68b717b",
          "molfile": "\n  Marvin  01132105162D          \n\n 19 21  0  0  0  0            999 V2000\n    6.5195   -2.1775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8892   -1.6350    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2693   -2.2266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4704   -1.0797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1789   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1789   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4479    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7428   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9782   -0.1550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4823   -0.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9627   -1.4904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7428   -1.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4505   -1.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6531   -0.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2347   -1.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4107   -1.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4107   -0.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2321   -0.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n 13  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 12  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 14 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)-c2[nH]c3ccc(cc3n2)S(=O)(=O)O",
          "formula": "C13H10N2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "04fda6f4-7344-49f8-8fdf-2ff69bd6ea0f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "274.2967",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6aac51d6-7e63-4e9f-b50c-88f34d87a786",
      "version": "24",
      "structure": {
        "id": "931c06aa-1f04-49e6-a221-42cd055c5193",
        "molfile": "\n  Marvin  01132107372D          \n\n 19 21  0  0  0  0            999 V2000\n    5.8892   -1.6350    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4823   -0.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9782   -0.1550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9627   -1.4904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7428   -1.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1789   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7428   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4505   -1.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2693   -2.2266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4704   -1.0797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6531   -0.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5195   -2.1775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4479    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1789   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2321   -0.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2347   -1.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4107   -1.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4107   -0.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  8  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  1  2  0  0  0  0\n 10  1  2  0  0  0  0\n 11  2  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  6  2  0  0  0  0\n 15 11  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 15  1  0  0  0  0\n 19 17  1  0  0  0  0\n  7  5  1  0  0  0  0\n  3  2  2  0  0  0  0\n 19 18  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)-c2nc3ccc(cc3[nH]2)S(=O)(=O)O",
        "formula": "C13H10N2O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "274.2967",
        "optical_activity": "NONE",
        "references": [
          "55070502-a84f-46d1-a08e-92956968b57f",
          "a6534117-4598-42ca-b23c-de665838f25c",
          "9e038a47-6dc7-4c74-b0e5-fed785ec4f3a"
        ],
        "stereo_centers": 0
      },
      "unii": "9YQ9DI1W42"
    }
  ]
}