{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "758fe4ac-3d5e-4365-9850-22040ef343e2",
          "code": "22595-45-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22595-45-5",
          "code_system": "CAS",
          "references": [
            "0334b297-ff18-45ac-ae0c-019a3da8a450",
            "099a2e39-4918-42f9-9c79-ebfb35bb9e78"
          ]
        },
        {
          "uuid": "859b65d8-7e92-45a5-9566-3172e981f9b4",
          "code": "C508520",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67508520",
          "code_system": "MESH",
          "references": [
            "0334b297-ff18-45ac-ae0c-019a3da8a450"
          ]
        },
        {
          "uuid": "60345f42-4323-4970-81a9-6037de6899ff",
          "code": "15800949",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15800949",
          "code_system": "PUBCHEM",
          "references": [
            "0334b297-ff18-45ac-ae0c-019a3da8a450"
          ]
        },
        {
          "uuid": "e3561768-685a-8957-4035-be74d584d344",
          "code": "DTXSID10177116",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10177116",
          "code_system": "EPA CompTox",
          "references": [
            "052b3eba-cf40-9eb6-2924-1694ed5bfe66"
          ]
        },
        {
          "uuid": "3c3f45ff-6311-4615-8028-cad14b2c8db1",
          "code": "9X167ZSG8Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7ca0a702-20b1-4f24-ae15-070a9ff80ae2",
          "name": "1,3,5-CYCLOHEXANETRIONE, 2,2,4,4,-TETRAMETHYL-6-(2-METHYL-1-OXOPROPYL)-",
          "stdName": "1,3,5-CYCLOHEXANETRIONE, 2,2,4,4,-TETRAMETHYL-6-(2-METHYL-1-OXOPROPYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46c37ffc-157d-4d9e-baa2-6af4cc2869c6",
            "2bc39a67-3171-4b81-989b-e8cfdd8f8dd5"
          ],
          "display_name": false
        },
        {
          "uuid": "d47f9519-8c53-484b-946c-bf52ab6d07a8",
          "name": "1,3,5-CYCLOHEXANETRIONE, 6-ISOBUTYRYL-2,2,4,4-TETRAMETHYL-",
          "stdName": "1,3,5-CYCLOHEXANETRIONE, 6-ISOBUTYRYL-2,2,4,4-TETRAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9ebb7fb-0c10-440a-b872-f41316e1bd4f",
            "46c37ffc-157d-4d9e-baa2-6af4cc2869c6"
          ],
          "display_name": false
        },
        {
          "uuid": "3fe43fbf-a796-4201-88f3-e90902c330de",
          "name": "FLAVESONE",
          "stdName": "FLAVESONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46c37ffc-157d-4d9e-baa2-6af4cc2869c6",
            "2bc39a67-3171-4b81-989b-e8cfdd8f8dd5",
            "c24964e7-9439-4491-bf6f-a7c393ededb7"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2dea036d-7083-4fce-8fe2-a87866a8ecf1",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "2bc39a67-3171-4b81-989b-e8cfdd8f8dd5",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "46c37ffc-157d-4d9e-baa2-6af4cc2869c6",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9ebb7fb-0c10-440a-b872-f41316e1bd4f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0334b297-ff18-45ac-ae0c-019a3da8a450",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea3cf22e-c1b7-41a5-9c2b-8e4ce69aba67",
          "citation": "SRS import [9X167ZSG8Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9X167ZSG8Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c24964e7-9439-4491-bf6f-a7c393ededb7",
          "citation": "FLAVESONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "052b3eba-cf40-9eb6-2924-1694ed5bfe66",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22595-45-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "099a2e39-4918-42f9-9c79-ebfb35bb9e78",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4569a992-46bb-604a-cf1c-3695382b4b69",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7f03818b-6959-43c1-9665-16597b00e527",
          "id": "7f03818b-6959-43c1-9665-16597b00e527",
          "molfile": "\n  Marvin  01132106362D          \n\n 18 18  0  0  0  0            999 V2000\n    9.5329   -6.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8185   -6.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8185   -5.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1040   -6.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1040   -7.5899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3895   -6.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3895   -5.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1040   -5.1150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6750   -5.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2053   -4.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1447   -4.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9606   -5.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2461   -5.1150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9606   -6.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1481   -6.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6784   -7.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6750   -6.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6750   -7.5899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 17  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12  9  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
          "smiles": "CC(C)C(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O",
          "formula": "C14H20O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4fb78097-ef95-4ccc-baf6-4c5eb0c5c3fe"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "252.3067",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "11356ad0-6871-4ca3-8869-a88afa3a0205",
      "version": "6",
      "structure": {
        "id": "c67ac83b-06bc-4196-b100-5d353261b8d4",
        "molfile": "\n  Marvin  01132110162D          \n\n 18 18  0  0  0  0            999 V2000\n    5.9606   -5.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6750   -5.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3895   -5.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3895   -6.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6750   -6.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9606   -6.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2053   -4.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1447   -4.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1481   -6.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6784   -7.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1040   -6.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8185   -6.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5329   -6.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8185   -5.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1040   -7.5899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1040   -5.1150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6750   -7.5899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2461   -5.1150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 11 15  2  0  0  0  0\n  3 16  2  0  0  0  0\n  5 17  2  0  0  0  0\n  1 18  2  0  0  0  0\nM  END",
        "smiles": "CC(C)C(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O",
        "formula": "C14H20O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "252.3067",
        "optical_activity": "NONE",
        "references": [
          "c9ebb7fb-0c10-440a-b872-f41316e1bd4f",
          "ea3cf22e-c1b7-41a5-9c2b-8e4ce69aba67"
        ],
        "stereo_centers": 0
      },
      "unii": "9X167ZSG8Z"
    }
  ]
}