{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "891e2760-88cb-6837-fc09-59dc955b42d7", "code": "9925587", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9925587", "code_system": "PUBCHEM", "references": [ "9df67419-94f2-f7f1-ef1d-8f3397831100" ] }, { "uuid": "02c1ba53-beea-41c6-87e4-fb4ac25c134d", "code": "315669-78-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=315669-78-4", "code_system": "CAS" }, { "uuid": "8f4688de-f6fe-4c99-9e4f-0fa747dcd4e9", "code": "9WV7GXM6T5", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "7a717c5f-2365-4765-83da-619296d18087", "amount": { "uuid": "96e199be-375b-4014-bd2a-fb3d28caf735" }, "type": "PARENT->SALT/SOLVATE", "references": [ "24f5dc6c-1d3d-4dd3-a1cd-1ff7adb84bf9" ], "related_substance": { "uuid": "739670d5-db70-4d81-b7be-30e8fa9a4a4d", "refuuid": "f5ca9ce5-6965-4798-94f3-fa2e6607449b", "name": "CREATINE", "unii": "MU72812GK0", "linking_id": "MU72812GK0", "ref_pname": "CREATINE", "substance_class": "reference" } }, { "uuid": "4f7f5f55-58ea-45ab-9f69-1aa00e1c0bd3", "amount": { "uuid": "421813ba-61e8-471d-93b7-50ab12d0ca11" }, "type": "PARENT->SALT/SOLVATE", "references": [ "7f5b9393-007f-b2ab-fbd6-3d32870adf67" ], "related_substance": { "uuid": "36c916ce-f9f0-4b44-b031-4b97e4be5aa5", "refuuid": "b525761f-f5fb-46ef-9177-fd01b4127ed2", "name": "OXOGLURIC ACID", "unii": "8ID597Z82X", "linking_id": "8ID597Z82X", "ref_pname": "OXOGLURIC ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "f96144f6-bcce-2c43-47aa-f8d338bef5a3", "name": "CREATINE AKG", "stdName": "CREATINE AKG", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7f5b9393-007f-b2ab-fbd6-3d32870adf67" ], "display_name": false }, { "uuid": "b8e3fce0-f71a-1967-c41a-01c36b91d609", "name": "CREATINE ALPHA-KETOGLUTARATE", "stdName": "CREATINE ALPHA-KETOGLUTARATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7f5b9393-007f-b2ab-fbd6-3d32870adf67" ], "display_name": true }, { "uuid": "a4a7aeb2-a23e-272f-c4e6-c4680cf9d945", "name": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, 2-OXOPENTANEDIOATE (1:1)", "stdName": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, 2-OXOPENTANEDIOATE (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "656c03ff-a11e-47cc-44ea-cbdfc81e9c28" ], "display_name": false }, { "uuid": "69b8ca63-e3af-f4c8-1ab8-82edd6ab7a2e", "name": "PENTANEDIOIC ACID, 2-OXO-, COMPD. WITH N-(AMINOIMINOMETHYL)-N-METHYLGLYCINE (1:1)", "stdName": "PENTANEDIOIC ACID, 2-OXO-, COMPD. WITH N-(AMINOIMINOMETHYL)-N-METHYLGLYCINE (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "656c03ff-a11e-47cc-44ea-cbdfc81e9c28" ], "display_name": false } ], "references": [ { "uuid": "24f5dc6c-1d3d-4dd3-a1cd-1ff7adb84bf9", "citation": "https://dsld.od.nih.gov/dsld/index.jsp", "url": "https://dsld.od.nih.gov/dsld/index.jsp", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "656c03ff-a11e-47cc-44ea-cbdfc81e9c28", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7f5b9393-007f-b2ab-fbd6-3d32870adf67", "citation": "https://dsld.od.nih.gov/dsld/index.jsp", "url": "https://dsld.od.nih.gov/dsld/index.jsp", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9df67419-94f2-f7f1-ef1d-8f3397831100", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "01e5fb29-4044-f22c-38d8-5c3a1b41b512", "id": "01e5fb29-4044-f22c-38d8-5c3a1b41b512", "molfile": "\n Marvin 01132100252D \n\n 9 8 0 0 0 0 999 V2000\n 16.3140 -6.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5871 -5.6401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3140 -6.8424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1612 -5.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8883 -6.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1612 -4.8437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0308 -5.6092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4677 -6.0716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5871 -4.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 2 0 0 0 0\n 7 1 1 0 0 0 0\n 5 2 1 0 0 0 0\n 9 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 2 0 0 0 0\n 8 4 1 0 0 0 0\nM END", "smiles": "CN(CC(=O)O)C(=N)N", "formula": "C4H9N3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ff032562-d464-446e-b61b-a9c698f3d193" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "131.1333", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "8ca1cf48-70b3-6e67-b2cc-333b147df652", "id": "8ca1cf48-70b3-6e67-b2cc-333b147df652", "molfile": "\n Marvin 01132107182D \n\n 10 9 0 0 0 0 999 V2000\n 13.1035 -2.5830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8202 -1.3132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6789 -1.2976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4216 -2.4999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6789 -2.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9649 -2.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2405 -2.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5550 -3.3878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5550 -2.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8202 -2.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 10 1 0 0 0 0\n 2 10 2 0 0 0 0\n 3 5 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\nM END", "smiles": "C(CC(=O)O)C(=O)C(=O)O", "formula": "C5H6O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5ff7de8b-c5d2-4193-a60a-3ab8849b346b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "146.0983", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "92f6f4ba-0dc0-4188-8811-0c5ff662ba0a", "version": "9", "structure": { "id": "3faa85de-599a-c08b-3b63-b00b235a021e", "molfile": "CREATINE\n Marvin 01132103222D \n\n 19 17 0 0 0 0 999 V2000\n 16.3140 -6.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5871 -5.6401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3140 -6.8424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1612 -5.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8883 -6.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1612 -4.8437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0308 -5.6092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4677 -6.0716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5871 -4.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1035 -2.5830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8202 -1.3132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6789 -1.2976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4216 -2.4999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6789 -2.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9649 -2.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2405 -2.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5550 -3.3878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5550 -2.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8202 -2.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 4 2 0 0 0 0\n 7 1 1 0 0 0 0\n 8 4 1 0 0 0 0\n 9 2 1 0 0 0 0\n 10 19 1 0 0 0 0\n 11 19 2 0 0 0 0\n 12 14 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "C(CC(=O)O)C(=O)C(=O)O.CN(CC(=O)O)C(=N)N", "formula": "C5H6O5.C4H9N3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "277.2317", "optical_activity": "NONE", "references": [ "7f5b9393-007f-b2ab-fbd6-3d32870adf67" ], "stereo_centers": 0 }, "unii": "9WV7GXM6T5" } ] }