{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0ee214f8-0a24-471b-b2f3-4fb771c56059",
          "code": "134098-61-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=134098-61-6",
          "code_system": "CAS",
          "references": [
            "5a9f7155-a40d-41a8-bc6a-53a20082d284",
            "1b77d90b-abc4-4e7d-860b-abd7d5166a92"
          ]
        },
        {
          "uuid": "7be4b107-db0a-4d38-96c7-e7f4daa342eb",
          "code": "C415144",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67415144",
          "code_system": "MESH",
          "references": [
            "5a9f7155-a40d-41a8-bc6a-53a20082d284"
          ]
        },
        {
          "uuid": "723bc491-7a5b-48af-8f26-7cf28dea1d64",
          "code": "129131",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2362",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5a9f7155-a40d-41a8-bc6a-53a20082d284"
          ]
        },
        {
          "uuid": "83cb2340-2f7d-4344-8812-3d1719ad216a",
          "code": "111812-58-9",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=111812-58-9",
          "code_system": "CAS",
          "references": [
            "5a9f7155-a40d-41a8-bc6a-53a20082d284",
            "6a9ade21-56fc-4f50-80fe-659d7bcc5e39"
          ]
        },
        {
          "uuid": "fa1d0d34-c589-4d51-b247-ed35201eda11",
          "code": "m5294",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5294?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5a9f7155-a40d-41a8-bc6a-53a20082d284"
          ]
        },
        {
          "uuid": "32565567-7a8b-47fd-adc5-b51697b9940e",
          "code": "9576412",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9576412",
          "code_system": "PUBCHEM",
          "references": [
            "5a9f7155-a40d-41a8-bc6a-53a20082d284"
          ]
        },
        {
          "uuid": "42c1bf79-50f4-5fa5-6bcd-a27cc908724b",
          "code": "7943",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7943",
          "code_system": "HSDB",
          "references": [
            "b98e3175-101b-d266-b5a6-d0cef2836193"
          ]
        },
        {
          "uuid": "803bed7a-35ce-58d9-8ab1-7a0815d20df8",
          "code": "5011",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5011",
          "code_system": "CHEBI",
          "references": [
            "0312cb14-9caa-dbf2-7d05-e527731ac441"
          ]
        },
        {
          "uuid": "42aeb9e1-96a9-470e-9a92-9e59c4b2b82b",
          "code": "9W557V4RYA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a0dc5a9b-ebb9-2e91-6ee1-22c5bd389cf1",
          "code": "fenpyroximate",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenpyroximate.html",
          "code_system": "ALANWOOD",
          "references": [
            "e7678966-ab64-ec1d-0390-16cd29b7538a"
          ]
        },
        {
          "uuid": "61b2b385-249b-0ced-b694-ee8c3342f264",
          "code": "DTXSID7032557",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7032557",
          "code_system": "EPA CompTox",
          "references": [
            "0985001d-866c-3c1b-cdfc-690347aedcfc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b1c0c3ca-ad64-400b-a932-9f95bc7f9fd4",
          "name": "4-((((E)-((1,3-DIMETHYL-5-PHENOXY-1H-PYRAZOL-4-YL)METHYLENE)AMINO)OXY)METHYL)BENZOIC ACID 1,1-DIMETHYLETHYL ESTER",
          "stdName": "4-((((E)-((1,3-DIMETHYL-5-PHENOXY-1H-PYRAZOL-4-YL)METHYLENE)AMINO)OXY)METHYL)BENZOIC ACID 1,1-DIMETHYLETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcff79c-2244-42b1-812d-059c85b701ed",
            "20977c67-c4f9-4279-8e30-f084d12dda40"
          ],
          "display_name": false
        },
        {
          "uuid": "fba6f028-348a-4b10-96a3-d01612eec8e3",
          "name": "FENPRYROXIMATE",
          "stdName": "FENPRYROXIMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d3b9087-bcae-49ca-a69c-1535912c99ba"
          ],
          "display_name": false
        },
        {
          "uuid": "b0254433-ba3e-4c18-87ab-39c9a0aa0331",
          "name": "FENPYROXIMATE",
          "stdName": "FENPYROXIMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a1b2458-a6da-48a6-aba7-4299f5c62ec1",
            "c8f42ad5-3c63-4102-8f45-ff1766aefee2",
            "7fcff79c-2244-42b1-812d-059c85b701ed",
            "22a7b72b-861d-438d-8860-08f7e32487de",
            "d6fa5ec2-96db-4b88-b66d-5b7d1e9e442f",
            "20977c67-c4f9-4279-8e30-f084d12dda40"
          ],
          "display_name": true
        },
        {
          "uuid": "f1e0da86-93f4-4440-a4cf-1a66c2225dcd",
          "name": "FENPYROXIMATE (Z,E)",
          "stdName": "FENPYROXIMATE (Z,E)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcff79c-2244-42b1-812d-059c85b701ed",
            "19783653-525f-4784-bedb-edaded7308d8"
          ],
          "display_name": false
        },
        {
          "uuid": "b5e6cc23-2910-4243-aff6-402562b6f578",
          "name": "FENPYROXIMATE [ISO]",
          "stdName": "FENPYROXIMATE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcff79c-2244-42b1-812d-059c85b701ed",
            "22a7b72b-861d-438d-8860-08f7e32487de"
          ],
          "display_name": false
        },
        {
          "uuid": "dd82e190-eeea-4ed0-a5fb-688665cfd4f8",
          "name": "FENPYROXIMATE [MI]",
          "stdName": "FENPYROXIMATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8f42ad5-3c63-4102-8f45-ff1766aefee2",
            "7fcff79c-2244-42b1-812d-059c85b701ed"
          ],
          "display_name": false
        },
        {
          "uuid": "ef693e44-14d5-4046-9d6e-47a6e72da3d8",
          "name": "FUJIMITE",
          "stdName": "FUJIMITE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3aa809f-d678-441f-8879-9037c4aa3bc8",
            "7fcff79c-2244-42b1-812d-059c85b701ed"
          ],
          "display_name": false
        },
        {
          "uuid": "84112214-b241-42c6-a2e0-3455a3c967fa",
          "name": "HOE-555-02A",
          "stdName": "HOE-555-02A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcff79c-2244-42b1-812d-059c85b701ed",
            "20977c67-c4f9-4279-8e30-f084d12dda40"
          ],
          "display_name": false
        },
        {
          "uuid": "0112078e-1dfc-48d8-bc57-71ce87062157",
          "name": "NNI-850",
          "stdName": "NNI-850",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcff79c-2244-42b1-812d-059c85b701ed",
            "20977c67-c4f9-4279-8e30-f084d12dda40"
          ],
          "display_name": false
        },
        {
          "uuid": "d735fadd-03e7-4bff-bcab-89ad3512a987",
          "name": "SEQUEL",
          "stdName": "SEQUEL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3aa809f-d678-441f-8879-9037c4aa3bc8",
            "7fcff79c-2244-42b1-812d-059c85b701ed"
          ],
          "display_name": false
        },
        {
          "uuid": "97945b59-af39-45ba-aa65-7c695483fa3a",
          "name": "TERT-BUTYL (E)-.ALPHA.-(1,3-DIMETHYL-5-PHENOXYPYRAZOL-4-YLMETHYLENEAMINOOXY)-P-TOLUATE",
          "stdName": "TERT-BUTYL (E)-.ALPHA.-(1,3-DIMETHYL-5-PHENOXYPYRAZOL-4-YLMETHYLENEAMINOOXY)-P-TOLUATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcff79c-2244-42b1-812d-059c85b701ed",
            "20977c67-c4f9-4279-8e30-f084d12dda40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3d3b9087-bcae-49ca-a69c-1535912c99ba",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c8f42ad5-3c63-4102-8f45-ff1766aefee2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fcff79c-2244-42b1-812d-059c85b701ed",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20977c67-c4f9-4279-8e30-f084d12dda40",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3aa809f-d678-441f-8879-9037c4aa3bc8",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19783653-525f-4784-bedb-edaded7308d8",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22a7b72b-861d-438d-8860-08f7e32487de",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a9f7155-a40d-41a8-bc6a-53a20082d284",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc5e010b-633f-4e94-a156-a170ada347c8",
          "citation": "SRS import [9W557V4RYA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9W557V4RYA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecb51f87-798d-4196-b6cb-4a9db5fd96c3",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a1b2458-a6da-48a6-aba7-4299f5c62ec1",
          "citation": "FENPYROXIMATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6fa5ec2-96db-4b88-b66d-5b7d1e9e442f",
          "citation": "FENPYROXIMATE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b98e3175-101b-d266-b5a6-d0cef2836193",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+134098-61-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3373ac3b-2605-b2fa-cfd0-7b661571bfef",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=111812-58-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7678966-ab64-ec1d-0390-16cd29b7538a",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "6a9ade21-56fc-4f50-80fe-659d7bcc5e39",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1b77d90b-abc4-4e7d-860b-abd7d5166a92",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0312cb14-9caa-dbf2-7d05-e527731ac441",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0985001d-866c-3c1b-cdfc-690347aedcfc",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e8d38873-e228-45e8-ade6-6c4316dad085",
          "id": "e8d38873-e228-45e8-ade6-6c4316dad085",
          "molfile": "\n  Marvin  01132112032D          \n\n 31 33  0  0  0  0            999 V2000\n    2.5903   -6.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0787   -5.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8308   -4.7340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4950   -4.2447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4950   -3.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1685   -4.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8779   -4.3186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8779   -3.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5956   -3.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5956   -2.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8802   -1.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1672   -2.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1672   -3.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9066   -5.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6236   -5.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3358   -5.5213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0527   -5.9329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7696   -5.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4866   -5.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1949   -5.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9173   -5.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9173   -6.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2022   -7.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4866   -6.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6280   -7.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6280   -7.9865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3495   -6.7468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0709   -7.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7832   -6.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0709   -7.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8680   -7.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2 14  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 14  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 24  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 22 25  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 28 31  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(/C=N/OCc2ccc(cc2)C(=O)OC(C)(C)C)c(n(C)n1)Oc3ccccc3",
          "formula": "C24H27N3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cdc164b2-04e3-448f-a068-40cf0cfb64c5"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "421.4898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c55f8955-282f-4056-ba2c-22908c9f21f3",
      "version": "8",
      "structure": {
        "id": "0a287d77-2a66-4073-857d-1d8cec315d6a",
        "molfile": "\n  Marvin  01132100472D          \n\n 31 33  0  0  0  0            999 V2000\n    3.0787   -5.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5903   -6.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8308   -4.7340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4950   -4.2447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1685   -4.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9066   -5.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6236   -5.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3358   -5.5213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0527   -5.9329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7696   -5.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4866   -5.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1949   -5.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9173   -5.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9173   -6.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2022   -7.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4866   -6.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6280   -7.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3495   -6.7468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0709   -7.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7832   -6.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0709   -7.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8680   -7.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6280   -7.9865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8779   -4.3186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8779   -3.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5956   -3.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5956   -2.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8802   -1.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1672   -2.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1672   -3.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4950   -3.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 11 16  2  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 17 23  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 25  1  0  0  0  0\n  4 31  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(/C=N/OCc2ccc(cc2)C(=O)OC(C)(C)C)c(n(C)n1)Oc3ccccc3",
        "formula": "C24H27N3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "421.4898",
        "optical_activity": "NONE",
        "references": [
          "dc5e010b-633f-4e94-a156-a170ada347c8",
          "ecb51f87-798d-4196-b6cb-4a9db5fd96c3"
        ],
        "stereo_centers": 0
      },
      "unii": "9W557V4RYA"
    }
  ]
}