{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "86462c3a-c23d-4935-8671-1328d96cb560", "code": "76326-99-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=76326-99-3", "code_system": "CAS", "references": [ "ebec3228-a8c0-432e-8cc9-196a8fe9d828" ] }, { "uuid": "ef07c846-2859-4496-baca-707d7c1197f1", "code": "9VQ4QJC5TH", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f5274d16-7940-8ffa-d0eb-4eb5c4bc4ecc", "code": "DTXSID201015492", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201015492", "code_system": "EPA CompTox", "references": [ "1722da78-d090-ac33-fa49-af9af57e856d" ] }, { "uuid": "921580fd-6b14-3e0b-279f-d1597a03d75a", "code": "11564307", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11564307", "code_system": "PUBCHEM", "references": [ "9f59c8a3-ab36-e157-55db-f29329ef6aea" ] } ], "substance_class": "chemical", "names": [ { "uuid": "c08a51f2-dcc7-4315-9e82-4445caa808ec", "name": "1-Deoxy-1-(dimethylamino)-D-glucitol", "stdName": "1-DEOXY-1-(DIMETHYLAMINO)-D-GLUCITOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebec3228-a8c0-432e-8cc9-196a8fe9d828" ], "display_name": true }, { "uuid": "f5b04b2c-bad8-4619-ae79-6d42e8535971", "name": "Genamin Gluco 50", "stdName": "GENAMIN GLUCO 50", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ebec3228-a8c0-432e-8cc9-196a8fe9d828" ], "display_name": false }, { "uuid": "6993116a-507e-40ad-8e16-fc615b3de06d", "name": "N,N-Dimethyl-D-glucamine", "stdName": "N,N-DIMETHYL-D-GLUCAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebec3228-a8c0-432e-8cc9-196a8fe9d828" ], "display_name": false }, { "uuid": "e3a64ed0-1b08-45e4-88f1-85bf89ae828c", "name": "N,N-Dimethylglucamine", "stdName": "N,N-DIMETHYLGLUCAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebec3228-a8c0-432e-8cc9-196a8fe9d828" ], "display_name": false } ], "references": [ { "uuid": "ebec3228-a8c0-432e-8cc9-196a8fe9d828", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1722da78-d090-ac33-fa49-af9af57e856d", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "9f59c8a3-ab36-e157-55db-f29329ef6aea", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7c013fac-05ae-48ca-9bd2-fcaee78e7da6", "id": "7c013fac-05ae-48ca-9bd2-fcaee78e7da6", "molfile": "N,N-Dimethylglucamine\n CDK 12042317462D\n76326-99-3 Copyright (C) 2023 ACS\n 14 13 0 0 1 0 0 0 0 0999 V2000\n 5.3347 1.5400 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.6684 2.3100 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.0011 2.3100 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.3347 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0021 1.5400 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.6684 3.8500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6673 1.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0011 3.8500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3358 2.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0021 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3336 2.3100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6694 1.5400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3336 3.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 6 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 6 0 0 0\n 3 7 1 0 0 0 0\n 3 8 1 6 0 0 0\n 5 9 1 0 0 0 0\n 5 10 1 1 0 0 0\n 7 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\nM END", "smiles": "CN(C)C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O", "formula": "C8H19NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cf310537-0df7-48ed-bea8-9c5ad6253f2e" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "209.2405", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "4d737810-f175-40aa-b9ca-98b82d23a83d", "version": "5", "structure": { "id": "9edc6b7b-3300-4856-af44-083a7ae48874", "molfile": "N,N-Dimethylglucamine\n JSDraw212042317462D\n\n 14 13 0 0 1 0 0 V2000\n 25.1680 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8171 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -9.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8700 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -5.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4660 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8171 -5.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2211 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8700 -9.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1149 -7.3060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5720 -8.0860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1149 -5.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7640 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 6 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 6 0 0 0\n 3 7 1 0 0 0 0\n 3 8 1 6 0 0 0\n 5 9 1 0 0 0 0\n 5 10 1 1 0 0 0\n 7 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\nM END", "smiles": "CN(C)C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O", "formula": "C8H19NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "209.2405", "optical_activity": "UNSPECIFIED", "references": [ "ebec3228-a8c0-432e-8cc9-196a8fe9d828" ], "stereo_centers": 4 }, "unii": "9VQ4QJC5TH" } ] }