{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "afc3358c-6f2b-4446-b660-1ba95d1a2fde",
          "code": "52009-14-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=52009-14-0",
          "code_system": "CAS",
          "references": [
            "77d5edd7-f0f3-43e7-8b28-bde7c906992b",
            "b20f7b2a-80cb-4f58-9c13-8e381b8be10a"
          ]
        },
        {
          "uuid": "55ce85c7-2a27-44cc-b3fc-3880288fce2c",
          "code": "884629",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/884629/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "77d5edd7-f0f3-43e7-8b28-bde7c906992b"
          ]
        },
        {
          "uuid": "0deeec17-58c0-46c7-b9a5-6b9d3ba4be74",
          "code": "SUB13198MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "77d5edd7-f0f3-43e7-8b28-bde7c906992b"
          ]
        },
        {
          "uuid": "1dfc8fce-b9fa-4624-b6df-8719f5b2c7eb",
          "code": "257-599-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.052.346",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "77d5edd7-f0f3-43e7-8b28-bde7c906992b"
          ]
        },
        {
          "uuid": "e9024062-4e4c-4e46-fad3-bb672bfc185a",
          "code": "DTXSID30199976",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30199976",
          "code_system": "EPA CompTox",
          "references": [
            "0ca07cc0-b084-ff69-bf6a-a2737f19ad00"
          ]
        },
        {
          "uuid": "c80bb895-87b8-73f4-791e-172f35bacfa7",
          "code": "9859191",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9859191",
          "code_system": "PUBCHEM",
          "references": [
            "20776558-cbad-6e5a-aaa4-74f65ed9a2f8"
          ]
        },
        {
          "uuid": "1e061ef2-5f3f-c6d2-5270-7ed273ee62ec",
          "code": "3664 (Number of products:22)",
          "comments": "Dietary Supplement Label Database|chemical|Calcium pyruvate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3664&item=Calcium pyruvate",
          "code_system": "DSLD",
          "references": [
            "1a83a6ad-81f7-c559-d42e-9de4e25b13c9"
          ]
        },
        {
          "uuid": "33358cd9-57f4-8c29-36ec-505ae1a97a19",
          "code": "DBSALT002377",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT002377",
          "code_system": "DRUG BANK",
          "references": [
            "1a83a6ad-81f7-c559-d42e-9de4e25b13c9"
          ]
        },
        {
          "uuid": "daa11e7f-63ea-4852-8dd5-952212762554",
          "code": "9V2CQZ19N4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "476a437e-42cd-bdf6-75a7-96d8911f30c4",
          "code": "100000076595",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "61b881fb-8b90-f250-2342-462b070cb331"
          ]
        },
        {
          "uuid": "a4c11e81-af88-1fcb-dcb3-ae90c2a1ec86",
          "code": "9V2CQZ19N4",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9V2CQZ19N4",
          "code_system": "DAILYMED",
          "references": [
            "97666b1a-31c8-d573-2be1-da822e2f5440"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5117fdda-e89d-4c63-8e75-0cd9d8b4febc",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "3ac212f2-4294-425a-8713-273bdb9d9303",
            "refuuid": "aae86518-2374-444f-bdf3-5bc722eca0a2",
            "name": "PYRUVIC ACID",
            "unii": "8558G7RUTR",
            "linking_id": "8558G7RUTR",
            "ref_pname": "PYRUVIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7d18e22b-aeb0-4b67-b9b7-fb2dcb6367db",
          "name": "CALCIUM 2-OXOPROPANOATE",
          "stdName": "CALCIUM 2-OXOPROPANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55938749-eaae-4c64-b58d-accb2b26def7"
          ],
          "display_name": false
        },
        {
          "uuid": "51b8b68c-cc16-4c10-aa50-46930055868f",
          "name": "CALCIUM PYRUVATE",
          "stdName": "CALCIUM PYRUVATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3c5ea86-4740-4261-9f51-2b5ad8910b77",
            "62bc1958-1e26-4ff8-a2a4-266d4bf3e962",
            "0f80ae5f-23ea-4dca-8ea3-47444c735d94"
          ],
          "display_name": true
        },
        {
          "uuid": "849d22a0-3c8d-08a9-480f-d5d6edb42057",
          "name": "Calcium pyruvate [WHO-DD]",
          "stdName": "CALCIUM PYRUVATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bdebf72d-8922-08ad-f164-1ad1a4940e60"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "62bc1958-1e26-4ff8-a2a4-266d4bf3e962",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "55938749-eaae-4c64-b58d-accb2b26def7",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f80ae5f-23ea-4dca-8ea3-47444c735d94",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77d5edd7-f0f3-43e7-8b28-bde7c906992b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390099000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d458d89-8028-48ce-8ff8-696a9a11b5f1",
          "citation": "SRS import [9V2CQZ19N4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9V2CQZ19N4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390099000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "714755da-f82a-4db3-bcb9-678201626236",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3c5ea86-4740-4261-9f51-2b5ad8910b77",
          "citation": "CALCIUM PYRUVATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0ca07cc0-b084-ff69-bf6a-a2737f19ad00",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52009-14-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "20776558-cbad-6e5a-aaa4-74f65ed9a2f8",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "b20f7b2a-80cb-4f58-9c13-8e381b8be10a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1a83a6ad-81f7-c559-d42e-9de4e25b13c9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "97666b1a-31c8-d573-2be1-da822e2f5440",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "bdebf72d-8922-08ad-f164-1ad1a4940e60",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "61b881fb-8b90-f250-2342-462b070cb331",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bd2b1317-2a81-47c7-844e-27796b40e6bf",
          "id": "bd2b1317-2a81-47c7-844e-27796b40e6bf",
          "molfile": "\n  Marvin  01132109472D          \n\n  1  0  0  0  0  0            999 V2000\n    9.8454  -14.2169    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e57dadb4-e3b1-4287-9fbd-95fb4c6f9f37"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "7e62bd49-04bd-4077-b9de-89461627db5d",
          "id": "7e62bd49-04bd-4077-b9de-89461627db5d",
          "molfile": "\n  Marvin  01132106342D          \n\n  6  5  0  0  0  0            999 V2000\n    6.0500  -14.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7640  -13.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7598  -13.1605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4780  -14.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1919  -13.9831    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.4738  -15.2232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\nM  CHG  1   5  -1\nM  END",
          "smiles": "CC(=O)C(=O)[O-]",
          "formula": "C3H3O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "2ec9647d-8f8a-48bc-9c81-5afe9b178149"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "87.0542",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "592af801-666e-41d6-ba6b-1c3a726e3e0c",
      "version": "10",
      "structure": {
        "id": "1266899c-ad69-44b1-a04d-e1ffd5214db9",
        "molfile": "\n  Marvin  01132101102D          \n\n 13 10  0  0  0  0            999 V2000\n    6.0500  -14.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7640  -13.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4780  -14.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1919  -13.9831    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7598  -13.1605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4738  -15.2232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8454  -14.2169    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    6.0500  -14.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7640  -13.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4780  -14.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1919  -13.9831    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7598  -13.1605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4738  -15.2232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  1  2  1  0  0  0  0\n  3  6  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 12  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 13  2  0  0  0  0\nM  CHG  3   4  -1   7   2  11  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 12   1   2   3   4   5   6   8   9  10  11  12  13\nM  SPA   1  6   1   2   3   4   5   6\nM  SDI   1  4    5.6300  -15.6432    5.6300  -12.7405\nM  SDI   1  4    8.6119  -12.7405    8.6119  -15.6432\nM  SMT   1 2\nM  END",
        "smiles": "CC(=O)C(=O)[O-].CC(=O)C(=O)[O-].[Ca+2]",
        "formula": "2C3H3O3.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "214.1865",
        "optical_activity": "NONE",
        "references": [
          "714755da-f82a-4db3-bcb9-678201626236",
          "7d458d89-8028-48ce-8ff8-696a9a11b5f1"
        ],
        "stereo_centers": 0
      },
      "unii": "9V2CQZ19N4"
    }
  ]
}