{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2c7bc6f7-baf3-2128-19cf-7620ca140587",
          "code": "1536",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1536",
          "code_system": "DRUG CENTRAL",
          "references": [
            "2d959554-1ce0-8ef0-5220-b7d6deafa150"
          ]
        },
        {
          "uuid": "294acf8d-31b2-5775-4a6b-71809bbc41ab",
          "code": "74900-2",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Lactulose/Creatinine [Molar ratio] in 5 hour Urine --post XXX g sugar solution PO",
          "type": "PRIMARY",
          "url": "https://loinc.org/74900-2/",
          "code_system": "LOINC",
          "references": [
            "2d959554-1ce0-8ef0-5220-b7d6deafa150"
          ]
        },
        {
          "uuid": "d2b44764-d026-7316-6ef9-7a9187eda7f0",
          "code": "74899-6",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Lactulose/Mannitol [Molar ratio] in 5 hour Urine --post XXX g sugar solution PO",
          "type": "PRIMARY",
          "url": "https://loinc.org/74899-6/",
          "code_system": "LOINC",
          "references": [
            "2d959554-1ce0-8ef0-5220-b7d6deafa150"
          ]
        },
        {
          "uuid": "66bb523d-af82-641e-34d4-89a96f3eb923",
          "code": "C68472",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Carbohydrate[C68470]|Disaccharide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68472",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2d959554-1ce0-8ef0-5220-b7d6deafa150"
          ]
        },
        {
          "uuid": "ae8096a2-7f40-d022-83f8-8de351ec316d",
          "code": "C29697",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Laxative",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29697",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2d959554-1ce0-8ef0-5220-b7d6deafa150"
          ]
        },
        {
          "uuid": "ee9f4ca2-6c8e-4507-af8b-15defb4acd16",
          "code": "CHEMBL296306",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL296306",
          "code_system": "ChEMBL",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "4264a610-4d91-4486-8e11-6e0127fb15d4",
          "code": "SUB08386MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "3d0608ab-a575-4acd-9175-e86de79d79c8",
          "code": "A06AD61",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Osmotically acting laxatives|lactulose, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A06AD61&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "a5eb0e87-3700-41fd-b198-65f64658b5b4",
          "code": "N0000175811",
          "comments": "Established Pharmacologic Class [EPC]|Osmotic Laxative [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175811",
          "code_system": "NDF-RT",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "e2b51297-d7df-4c19-8d32-f536aeed9d7f",
          "code": "LACTULOSE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lactulose",
          "code_system": "WIKIPEDIA",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "47b1088b-5895-4f8a-ba71-9061bb37ba24",
          "code": "D007792",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68007792",
          "code_system": "MESH",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "cf26de45-4328-468b-84e0-3ec7e9bfadf9",
          "code": "QA06AD61",
          "comments": "VATC|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Osmotically acting laxatives|lactulose, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA06AD61&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "26cd5725-d696-4727-9cfc-0ecb4bc13ca3",
          "code": "QA06AD11",
          "comments": "VATC|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Osmotically acting laxatives|lactulose",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA06AD11&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "6b44efdc-274c-44c2-8ca4-9951d044196f",
          "code": "m6665",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6665?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "05b6dac4-10de-47d9-b4d5-5bb8b203c1c0",
          "code": "6218",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6218/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "e18d477e-af12-4ee7-89ba-a99de27182ac",
          "code": "225-027-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.752",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "e28e6fb6-c56a-47c5-a229-fe739e67a5ec",
          "code": "9U7D5QH5AE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2a38237e-fa10-9008-9231-bf2db9f946f3",
          "code": "DTXSID5045833",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5045833",
          "code_system": "EPA CompTox",
          "references": [
            "80205b0d-d988-b3bb-764a-44bb4d6d4446"
          ]
        },
        {
          "uuid": "749497fb-7882-4417-9a92-951ec8efaaf5",
          "code": "DB00581",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00581",
          "code_system": "DRUG BANK",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "0cb00c35-bdd2-4951-94ae-3149ca5888da",
          "code": "C29148",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29148",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "852d25ce-0bcc-4654-9bd3-9954e6d82159",
          "code": "A06AD11",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|LAXATIVES|LAXATIVES|Osmotically acting laxatives|lactulose",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A06AD11&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "f6748362-ade1-4aea-9615-01513ff8ca0d",
          "code": "4618-18-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4618-18-2",
          "code_system": "CAS",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b",
            "5a5c169a-7c56-47ad-9f32-360b2def51fb"
          ]
        },
        {
          "uuid": "25099bc5-68f8-4464-b58a-81c93c545918",
          "code": "2137",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2137",
          "code_system": "INN",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "eca6365f-f00c-4746-9b75-3069fe26099c",
          "code": "SUB12100MIG",
          "type": "ALTERNATIVE",
          "code_system": "EVMPD"
        },
        {
          "uuid": "ba93b6c4-59fc-4899-8782-212cfbd7a78c",
          "code": "8.4",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Antineoplastic, immunosuppressives and medicines used in Palliative care|Medicines used in palliative care",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/195/?section=81#type489",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "6e38a73c-ece0-4278-a593-9e299c76d32b"
          ]
        },
        {
          "uuid": "e4065201-ba56-4610-cea5-dd893b669f01",
          "code": "1356803",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1356803",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "2d959554-1ce0-8ef0-5220-b7d6deafa150"
          ]
        },
        {
          "uuid": "473f0845-7637-429c-d51d-dc13899c028b",
          "code": "3037557",
          "comments": "PUBCHEM",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3037557",
          "code_system": "PUBCHEM",
          "references": [
            "f590d18f-b127-bbda-7779-667dbbaf1d66"
          ]
        },
        {
          "uuid": "a602fbbc-50c2-5c55-3929-aac6bbc1b22e",
          "code": "6359",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6359",
          "code_system": "CHEBI",
          "references": [
            "2d959554-1ce0-8ef0-5220-b7d6deafa150"
          ]
        },
        {
          "uuid": "c8d5802d-004f-084c-0c60-86b1c12525e2",
          "code": "100000091634",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8dd61513-7e47-b707-7bdc-58f34825894e"
          ]
        },
        {
          "uuid": "dd4a3718-7987-dd81-b947-923f6029a056",
          "code": "9U7D5QH5AE",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9U7D5QH5AE",
          "code_system": "DAILYMED",
          "references": [
            "b6703049-3090-426e-3ab1-c6dceafdd644"
          ]
        },
        {
          "uuid": "8754380a-1aad-8ed5-ca3e-b9cbb6783415",
          "code": "757082",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757082",
          "code_system": "NSC",
          "references": [
            "c160c1ef-8958-1397-df37-11b5fe09d954"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "a7ca7577-7716-4683-7504-b9e4ebe05f9b",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "2d959554-1ce0-8ef0-5220-b7d6deafa150",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "88e33107-21ab-4a02-b171-163182c94362",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "03a8727f-d824-4b35-93b4-1ca93101ec57",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6e25b7a0-1013-49d0-90f4-11fd423bf3e0",
          "citation": "LACTULOSE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b5488eec-09d2-47f3-b546-d5e34e8a73e0",
          "citation": "LACTULOSE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93b5b80d-6678-4a39-9a5e-487290fbecfc",
          "citation": "LACTULOSE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4dcae2cd-cb32-4bb4-aa4a-2309c5d06543",
          "citation": "LACTULOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0320e0b7-7f64-46b3-a866-98248f973e49",
          "citation": "LACTULOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f9f6ce81-314a-410e-a446-3c8b914817b7",
          "citation": "LACTULOSE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5310aa6f-8e68-4754-bf4a-bfc5dc67beff",
          "citation": "LACTULOSE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1fd5649b-80b5-493e-a474-5bb0e5d3dbbd",
          "citation": "LACTULOSE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a39ff33f-a7b7-4eb7-a988-2192b19d1fcc",
          "citation": "LACTULOSE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "efab8eca-2416-4aa8-ad5f-859bcc5e2df3",
          "citation": "LACTULOSE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71fc5c6f-7f86-4cf9-b410-125b4f4f6dd6",
          "citation": "LACTULOSE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "969e330e-5473-4372-a61a-ab4e63ce8573",
          "citation": "SRS import [9U7D5QH5AE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9U7D5QH5AE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390589000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e38a73c-ece0-4278-a593-9e299c76d32b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390589000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83301ac2-6919-4d47-9b17-44251cbe3e18",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c675ea4c-78f4-450e-ac4e-0218e44380c0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b67025f5-55d1-4593-93cd-26c7c4ee46b8",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "878e3d2a-63b4-4dec-abba-2e1de112f9c1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3acc0b31-e90e-4dcf-b711-c3c4bfdbdb88",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bea4abd4-29ad-4c73-9c97-868ec17013ae",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34fbec3c-576e-4d83-9a42-722b9966927e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43d20a45-30ea-4273-9e4c-f27f28a5d1b5",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e298db71-048c-4c96-9575-87dd09b43655",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63f0ba49-7604-440c-afbf-bb6c51f2b591",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c32d5c45-256c-4f62-ba98-45c8f3b20aca",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b73f406d-f439-4cf3-8134-933a6192ad1e",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c949c2e4-16cf-430e-b666-d343cc12b115",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3577e6b4-ca7a-4820-b59a-a5c966a9997e",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03edc67b-de17-49f4-8d61-90d5a615309a",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95eb8a44-7020-433b-a6ca-33bdce60af07",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "80205b0d-d988-b3bb-764a-44bb4d6d4446",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4618-18-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a5c169a-7c56-47ad-9f32-360b2def51fb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "645abbf5-e425-7974-a522-df9ba09be57f",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "7dfe104e-f8d5-4913-8cc5-e84a7e571cd6",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "06724607-49a7-4a3a-ba00-3cc9a0434858",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fd1a2050-e1cf-4512-8eca-84acc0f6eaa3",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0261ddbe-7e08-4cc3-95f6-e5496dc2dbe1",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8438297e-8ddd-4dec-ba07-34de5bd3c791",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "173184e2-1a5b-43bc-a8a6-cf47e4d5a3ff",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b4c67408-6245-4b56-af40-373c9c65dc16",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f590d18f-b127-bbda-7779-667dbbaf1d66",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "c160c1ef-8958-1397-df37-11b5fe09d954",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c4b8f50f-ba4d-c9cc-0639-5dd53da1466e",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "b6703049-3090-426e-3ab1-c6dceafdd644",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ec15b08f-fd7f-2d97-acdf-4df5b41ce6a7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8dd61513-7e47-b707-7bdc-58f34825894e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ec0f39d-1074-491a-9a70-d819371b31b1",
          "id": "5ec0f39d-1074-491a-9a70-d819371b31b1",
          "molfile": "\n  Marvin  02162108242D          \n\n 24 24  0  0  0  0            999 V2000\n    7.8463   -6.7232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5608   -6.3107    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2752   -6.7232    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.9897   -6.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7041   -6.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4186   -6.3107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9897   -5.4857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2752   -7.5482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5607   -5.4857    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8463   -5.0732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8463   -4.2482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2752   -5.0732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8463   -5.8982    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8463   -7.5482    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5608   -7.9608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5608   -8.7858    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2752   -9.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9897   -8.7858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8463   -9.1982    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1318   -8.7858    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1318   -7.9607    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4173   -7.5482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4173   -9.1982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8463  -10.0232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 14  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  2  9  1  0  0  0  0\n  2 13  1  1  0  0  0\n  3  4  1  0  0  0  0\n  3  8  1  1  0  0  0\n  4  5  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 12  1  1  0  0  0\n 10 11  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 21  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 19  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 24  1  6  0  0  0\n 21 20  1  0  0  0  0\n 20 23  1  6  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "C(C(=O)[C@H]([C@@]([H])([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O",
          "formula": "C12H22O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e23a60f5-7932-4f70-a198-09ac9c9c9ff3"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "342.297",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "49d00b2c-998a-41f0-84c7-02a9a8324597",
      "version": "50",
      "structure": {
        "id": "272fa032-655e-4d7e-b823-b8a1baa38e28",
        "molfile": "D-Fructose, 4-O-.beta.-D-galactopyranosyl-\n   JSDraw202162108242D\n\n 24 24  0  0  1  0              0 V2000\n   23.1415   -6.9160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4925   -6.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8435   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1945   -6.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5454   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8964   -6.1359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1945   -4.5760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8435   -8.4760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4924   -4.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1415   -3.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1415   -2.2360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8435   -3.7960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1415   -5.3560    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1415   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4925   -9.2561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4925  -10.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8435  -11.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1945  -10.8160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1415  -11.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7905  -10.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7905   -9.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4396   -8.4760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4396  -11.5960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1415  -13.1560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  3  8  1  1  0  0  0\n  2  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  9 12  1  1  0  0  0\n  2 13  1  1  0  0  0\n 14  1  1  6  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  6  0  0  0\n 17 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 14 21  1  0  0  0  0\n 21 22  1  1  0  0  0\n 20 23  1  6  0  0  0\n 19 24  1  6  0  0  0\nM  END",
        "smiles": "C(C(=O)[C@H]([C@@]([H])([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O",
        "formula": "C12H22O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "342.297",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8438297e-8ddd-4dec-ba07-34de5bd3c791"
        ],
        "stereo_centers": 8
      },
      "unii": "9U7D5QH5AE",
      "relationships": [
        {
          "uuid": "3388d479-5a53-44b0-aa6b-0e9933063625",
          "amount": {
            "uuid": "4b64e357-8f58-43c0-b5e0-d8b450ffd6c9",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 3
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b4c67408-6245-4b56-af40-373c9c65dc16"
          ],
          "related_substance": {
            "uuid": "8f4e8bd3-09a8-49f6-898d-9e0488c05f18",
            "refuuid": "a2e05e3b-d29c-4fb1-9f26-71513ae863f4",
            "name": "ANHYDROUS LACTOSE",
            "unii": "3SY5LH9PMK",
            "linking_id": "3SY5LH9PMK",
            "ref_pname": "ANHYDROUS LACTOSE"
          }
        },
        {
          "uuid": "0739a7c2-885e-45d4-9778-484fe61a708c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c9e5fd47-4a5a-4aa2-9839-323175709e75",
            "refuuid": "49d00b2c-998a-41f0-84c7-02a9a8324597",
            "name": "LACTULOSE",
            "unii": "9U7D5QH5AE",
            "linking_id": "9U7D5QH5AE",
            "ref_pname": "LACTULOSE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7e849c3c-5f9b-40ba-81bc-6fa2f9a975ba",
          "amount": {
            "uuid": "c3d0c19b-73fc-4f36-9d61-2aec0d8f56d2",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7dfe104e-f8d5-4913-8cc5-e84a7e571cd6"
          ],
          "related_substance": {
            "uuid": "b7b191d2-611f-4dde-bd8c-529886d5be2e",
            "refuuid": "ec3d5653-4c06-4434-b6ca-7f97ad890190",
            "name": "EPILACTOSE",
            "unii": "3515BNP809",
            "linking_id": "3515BNP809",
            "ref_pname": "EPILACTOSE"
          }
        },
        {
          "uuid": "d8692ee7-289c-4796-947d-e468dde9309f",
          "amount": {
            "uuid": "f526d3de-5dce-489e-83a3-8dabc34e9fde",
            "type": "WEIGHT RATIO",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "fd1a2050-e1cf-4512-8eca-84acc0f6eaa3"
          ],
          "related_substance": {
            "uuid": "c8e4f0f1-234f-40bb-88be-a1483aaa0a66",
            "refuuid": "c01ce8ff-a141-4538-83d8-077edd38e770",
            "name": "GALACTOSE",
            "unii": "X2RN3Q8DNE",
            "linking_id": "X2RN3Q8DNE",
            "ref_pname": "GALACTOSE"
          }
        },
        {
          "uuid": "66fd43c8-daf0-4674-b37e-d6c2adbc4692",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "e28be75a-b953-4826-9e63-6e18be745375",
            "refuuid": "3fa9f96f-8ab7-44e9-ad9e-bcdf79d53518",
            "name": "ALTERNATIVE DEFINITION for [LACTULOSE]",
            "linking_id": "3fa9f96f-8ab7-44e9-ad9e-bcdf79d53518",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "e2dcdcb2-3fd9-4ed2-b2ab-9ef073ee4447",
          "amount": {
            "uuid": "c36cbe6d-c6db-4d9c-9426-719ddd8310d3",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "88e33107-21ab-4a02-b171-163182c94362"
          ],
          "related_substance": {
            "uuid": "0127a7ea-69b0-41f6-ba4e-eaae52fb6ca2",
            "refuuid": "a1cb2be2-b57b-40b4-b972-d1e5d1bbcf3d",
            "name": "FRUCTOSE",
            "unii": "6YSS42VSEV",
            "linking_id": "6YSS42VSEV",
            "ref_pname": "FRUCTOSE"
          }
        }
      ],
      "names": [
        {
          "uuid": "8d8e5031-7096-4129-9421-99087b56541a",
          "name": "4-GALACTOSYL FRUCTOSE",
          "stdName": "4-GALACTOSYL FRUCTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "878e3d2a-63b4-4dec-abba-2e1de112f9c1"
          ],
          "display_name": false
        },
        {
          "uuid": "3d08d5c3-929e-4183-a395-faab0aa6c3da",
          "name": "4-O-.BETA.-D-GALACTOPYRANOSYL-D-FRUCTOFURANOSE",
          "stdName": "4-O-.BETA.-D-GALACTOPYRANOSYL-D-FRUCTOFURANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3577e6b4-ca7a-4820-b59a-a5c966a9997e"
          ],
          "display_name": false
        },
        {
          "uuid": "45accef1-92a3-4973-ba3f-82478e981362",
          "name": "ACILAC",
          "stdName": "ACILAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3577e6b4-ca7a-4820-b59a-a5c966a9997e"
          ],
          "display_name": false
        },
        {
          "uuid": "72ebdd30-d2fc-4faf-a9ba-1c8b70bc819c",
          "name": "CEPHULAC",
          "stdName": "CEPHULAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c949c2e4-16cf-430e-b666-d343cc12b115"
          ],
          "display_name": false
        },
        {
          "uuid": "eae46999-733b-49f3-9484-2809fabcc089",
          "name": "CHOLAC",
          "stdName": "CHOLAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3577e6b4-ca7a-4820-b59a-a5c966a9997e"
          ],
          "display_name": false
        },
        {
          "uuid": "bb11de56-e4d3-4e63-a911-3224d2661290",
          "name": "CHRONULAC",
          "stdName": "CHRONULAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c949c2e4-16cf-430e-b666-d343cc12b115"
          ],
          "display_name": false
        },
        {
          "uuid": "1f6e2e89-0232-45fa-a253-8916ce8cf98e",
          "name": "CONSTILAC",
          "stdName": "CONSTILAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3577e6b4-ca7a-4820-b59a-a5c966a9997e"
          ],
          "display_name": false
        },
        {
          "uuid": "6be6b1a0-2a0a-4fa3-85e4-ba769a366be9",
          "name": "CONSTULOSE",
          "stdName": "CONSTULOSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3577e6b4-ca7a-4820-b59a-a5c966a9997e"
          ],
          "display_name": false
        },
        {
          "uuid": "f5baa542-bc18-4a33-9d6e-e5d4689c2066",
          "name": "D-FRUCTOSE, 4-O-.BETA.-D-GALACTOPYRANOSYL-",
          "stdName": "D-FRUCTOSE, 4-O-.BETA.-D-GALACTOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03edc67b-de17-49f4-8d61-90d5a615309a"
          ],
          "display_name": false
        },
        {
          "uuid": "e38d2d22-325f-47a0-84a2-65805e5a349b",
          "name": "DUPHALAC",
          "stdName": "DUPHALAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c949c2e4-16cf-430e-b666-d343cc12b115"
          ],
          "display_name": false
        },
        {
          "uuid": "2fe53a6e-992b-40ed-8da0-b42e8e18a261",
          "name": "ENULOSE",
          "stdName": "ENULOSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3577e6b4-ca7a-4820-b59a-a5c966a9997e"
          ],
          "display_name": false
        },
        {
          "uuid": "7a2a6fba-2713-4784-9496-88814af3f983",
          "name": "EVALOSE",
          "stdName": "EVALOSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c949c2e4-16cf-430e-b666-d343cc12b115"
          ],
          "display_name": false
        },
        {
          "uuid": "a7ce7c18-40a2-42ad-b0fd-3372972451cc",
          "name": "GENERLAC",
          "stdName": "GENERLAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3577e6b4-ca7a-4820-b59a-a5c966a9997e"
          ],
          "display_name": false
        },
        {
          "uuid": "f41432f4-54da-4165-a4be-e3d5c9ad82aa",
          "name": "HEPTALAC",
          "stdName": "HEPTALAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c949c2e4-16cf-430e-b666-d343cc12b115"
          ],
          "display_name": false
        },
        {
          "uuid": "8fb8c95e-3671-40ef-8deb-7f5e5900a4b5",
          "name": "LACTULOSE",
          "stdName": "LACTULOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b73f406d-f439-4cf3-8134-933a6192ad1e",
            "95eb8a44-7020-433b-a6ca-33bdce60af07",
            "f9f6ce81-314a-410e-a446-3c8b914817b7",
            "71fc5c6f-7f86-4cf9-b410-125b4f4f6dd6",
            "bea4abd4-29ad-4c73-9c97-868ec17013ae",
            "34fbec3c-576e-4d83-9a42-722b9966927e",
            "c675ea4c-78f4-450e-ac4e-0218e44380c0",
            "c32d5c45-256c-4f62-ba98-45c8f3b20aca",
            "5310aa6f-8e68-4754-bf4a-bfc5dc67beff",
            "1fd5649b-80b5-493e-a474-5bb0e5d3dbbd",
            "63f0ba49-7604-440c-afbf-bb6c51f2b591",
            "83301ac2-6919-4d47-9b17-44251cbe3e18",
            "43d20a45-30ea-4273-9e4c-f27f28a5d1b5",
            "b5488eec-09d2-47f3-b546-d5e34e8a73e0",
            "b67025f5-55d1-4593-93cd-26c7c4ee46b8",
            "93b5b80d-6678-4a39-9a5e-487290fbecfc",
            "6e25b7a0-1013-49d0-90f4-11fd423bf3e0",
            "0320e0b7-7f64-46b3-a866-98248f973e49",
            "efab8eca-2416-4aa8-ad5f-859bcc5e2df3",
            "a39ff33f-a7b7-4eb7-a988-2192b19d1fcc",
            "3acc0b31-e90e-4dcf-b711-c3c4bfdbdb88",
            "e298db71-048c-4c96-9575-87dd09b43655",
            "4dcae2cd-cb32-4bb4-aa4a-2309c5d06543"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4ec5a051-3f07-4e27-8c96-23dee59a271d",
              "name_org": "INN"
            },
            {
              "uuid": "1574d703-bca3-4b3b-a2bd-666d284a7d79",
              "name_org": "USAN"
            },
            {
              "uuid": "a744f59a-94d1-4fe3-bcc0-4852640fb05c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cd3bd4ab-6814-4576-af4f-47502b62382a",
          "name": "LACTULOSE JP17 [JAN]",
          "stdName": "LACTULOSE JP17 [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645abbf5-e425-7974-a522-df9ba09be57f"
          ],
          "display_name": false
        },
        {
          "uuid": "1987d562-98a3-d33a-a3bf-2cb4a841179a",
          "name": "LACTULOSE [EP IMPURITY]",
          "stdName": "LACTULOSE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63f0ba49-7604-440c-afbf-bb6c51f2b591"
          ],
          "display_name": false
        },
        {
          "uuid": "069f2e74-5f6c-93d6-bb13-aaa564a4396a",
          "name": "LACTULOSE [EP MONOGRAPH]",
          "stdName": "LACTULOSE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4b8f50f-ba4d-c9cc-0639-5dd53da1466e"
          ],
          "display_name": false
        },
        {
          "uuid": "1fc437e2-d53a-9b04-a6cc-eacedc6e3311",
          "name": "LACTULOSE [JAN]",
          "stdName": "LACTULOSE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7ca7577-7716-4683-7504-b9e4ebe05f9b"
          ],
          "display_name": false
        },
        {
          "uuid": "ce02c08f-4530-4687-aecd-2cebc8fc3d2d",
          "name": "LACTULOSE [MART.]",
          "stdName": "LACTULOSE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34fbec3c-576e-4d83-9a42-722b9966927e"
          ],
          "display_name": false
        },
        {
          "uuid": "99b5e17b-e736-48c7-b472-981d61a97924",
          "name": "LACTULOSE [MI]",
          "stdName": "LACTULOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bea4abd4-29ad-4c73-9c97-868ec17013ae"
          ],
          "display_name": false
        },
        {
          "uuid": "07d013fe-c5b1-4272-8061-fb73541b187a",
          "name": "LACTULOSE [ORANGE BOOK]",
          "stdName": "LACTULOSE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43d20a45-30ea-4273-9e4c-f27f28a5d1b5"
          ],
          "display_name": false
        },
        {
          "uuid": "81292ae9-fd34-432f-b568-546e4ec0e2ed",
          "name": "LACTULOSE [USAN]",
          "stdName": "LACTULOSE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c32d5c45-256c-4f62-ba98-45c8f3b20aca"
          ],
          "display_name": false
        },
        {
          "uuid": "1ac8cdbf-bc83-73bf-3f4e-8738e072e083",
          "name": "LACTULOSE [USP IMPURITY]",
          "stdName": "LACTULOSE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e298db71-048c-4c96-9575-87dd09b43655"
          ],
          "display_name": false
        },
        {
          "uuid": "7128ecad-fb60-44cc-8782-7898562c81ad",
          "name": "LACTULOSE [VANDF]",
          "stdName": "LACTULOSE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83301ac2-6919-4d47-9b17-44251cbe3e18"
          ],
          "display_name": false
        },
        {
          "uuid": "5181e04f-8b3f-4da7-9ef5-e15c1c7847b1",
          "name": "LAXILOSE",
          "stdName": "LAXILOSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3577e6b4-ca7a-4820-b59a-a5c966a9997e"
          ],
          "display_name": false
        },
        {
          "uuid": "d83f1f0b-8ace-a6b5-57d6-3e637170dfa3",
          "name": "Lactulose [WHO-DD]",
          "stdName": "LACTULOSE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec15b08f-fd7f-2d97-acdf-4df5b41ce6a7"
          ],
          "display_name": false
        },
        {
          "uuid": "c14ddddf-95f1-e321-20ec-bd6c2a088bc1",
          "name": "NSC-757082",
          "stdName": "NSC-757082",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c160c1ef-8958-1397-df37-11b5fe09d954"
          ],
          "display_name": false
        },
        {
          "uuid": "d585d154-71ee-4427-b2f8-52869edcead6",
          "name": "PORTALAC",
          "stdName": "PORTALAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c949c2e4-16cf-430e-b666-d343cc12b115"
          ],
          "display_name": false
        },
        {
          "uuid": "3775ebd3-f982-41fc-9650-f1e301338149",
          "name": "lactulose [INN]",
          "stdName": "LACTULOSE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b73f406d-f439-4cf3-8134-933a6192ad1e"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "253d9770-d981-43eb-a916-07d81ba9da22"
      }
    }
  ]
}