{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "818b6240-6200-4b08-9125-023132a1cc83", "code": "151728-40-4", "type": "NON-SPECIFIC STOICHIOMETRY", "url": "https://commonchemistry.cas.org/detail?cas_rn=151728-40-4", "code_system": "CAS", "references": [ "686b80a5-be0e-4870-bc56-f6e22bc369ce", "737368c5-e4e6-4369-9b80-0456d3892688" ] }, { "uuid": "f87c90ca-8770-4ca5-b493-5078660f0dd7", "code": "331242-75-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=331242-75-2", "code_system": "CAS", "references": [ "686b80a5-be0e-4870-bc56-f6e22bc369ce", "3a5970ab-99e6-4baa-8271-f20aede8a413" ] }, { "uuid": "0bc91ebc-58ab-44d7-b8fa-7ea28769cec1", "code": "1549114", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1549114/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "686b80a5-be0e-4870-bc56-f6e22bc369ce" ] }, { "uuid": "c4c371fb-959c-4806-ba23-b777c72032ae", "code": "SUB66732", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "686b80a5-be0e-4870-bc56-f6e22bc369ce" ] }, { "uuid": "edb4f521-350f-4a8d-8740-980a1b084305", "code": "91667835", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91667835", "code_system": "PUBCHEM", "references": [ "686b80a5-be0e-4870-bc56-f6e22bc369ce" ] }, { "uuid": "71c4fd7e-521e-5364-1b2e-7d1902a2bc3e", "code": "DB14485", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB14485", "code_system": "DRUG BANK", "references": [ "b2006ff8-db72-5cf7-18a2-90f9a58ffe61" ] }, { "uuid": "036533b9-0a6d-46a4-a297-35894f5c2900", "code": "9TI35313XW", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "92b87279-d338-e8b8-bf9c-f09b28d1ce08", "code": "2524 (Number of products:13)", "comments": "Dietary Supplement Label Database|chemical|Zinc Ascorbate", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2524&item=Zinc Ascorbate", "code_system": "DSLD", "references": [ "b2006ff8-db72-5cf7-18a2-90f9a58ffe61" ] }, { "uuid": "5e7b7e85-f600-8599-a139-724ae4fe32dc", "code": "DTXSID50164863", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50164863", "code_system": "EPA CompTox", "references": [ "dae88468-7ccf-5c1b-8779-9e59c8ee2406" ] }, { "uuid": "3f576b7a-b170-39d9-254c-82a1b3338d95", "code": "9TI35313XW", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9TI35313XW", "code_system": "DAILYMED", "references": [ "25c061d5-d61b-8133-c939-02609d8e838a" ] }, { "uuid": "7c317499-da7a-5f6d-ed26-a0066523087a", "code": "100000134838", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "2bc6a759-3d9b-8135-eab6-ee7b33bd5977" ] } ], "relationships": [ { "uuid": "9d9b8da4-2bb4-451f-afb6-b852f6c8ab99", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "d4ed25bc-bf21-4940-b358-049067422a49", "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c", "name": "ZINC CATION", "unii": "13S1S8SF37", "linking_id": "13S1S8SF37", "ref_pname": "ZINC CATION", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "95ab06af-cfb2-4b2a-9894-1a831a3e61d6", "name": "(-)-ASCORBIC ACID, ZINC SALT", "stdName": "(-)-ASCORBIC ACID, ZINC SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "81af23bf-26e8-4dcc-aa5f-cf19612842cc", "0263682e-371f-4f33-bd97-b2ebff11e845" ], "display_name": false }, { "uuid": "901eff13-7d52-4248-b041-e3f169c9d042", "name": "L-ASCORBIC ACID, ZINC SALT", "stdName": "L-ASCORBIC ACID, ZINC SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "81af23bf-26e8-4dcc-aa5f-cf19612842cc", "0263682e-371f-4f33-bd97-b2ebff11e845" ], "display_name": false }, { "uuid": "0920bad7-8a9c-4f18-bf22-a354357bac4e", "name": "L-ASCORBIC ACID, ZINC SALT (2:1)", "stdName": "L-ASCORBIC ACID, ZINC SALT (2:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d3befa15-0f7f-4b37-92f7-9f8cc53e931c", "0263682e-371f-4f33-bd97-b2ebff11e845" ], "display_name": false }, { "uuid": "498c90fe-b0df-4969-96e5-f95f8faaf6ef", "name": "ZINC ASCORBATE", "stdName": "ZINC ASCORBATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "b9fa3bed-cca3-4304-b137-6dc59cbc9f46", "1a5e190d-48d4-42f8-92fa-160b46e75747", "0263682e-371f-4f33-bd97-b2ebff11e845", "95f91e72-9e5c-499d-897c-c20276715310", "1a363457-3833-4c36-9e4e-894116c48881" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "85932555-8863-4d91-b5d9-38d14b204226", "name_org": "INCI" } ] }, { "uuid": "4cbeba71-a9f0-428a-f5d2-32b266cf2f37", "name": "Zinc Ascorbate [WHO-DD]", "stdName": "ZINC ASCORBATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4dbc5f10-fab7-9abf-0ad5-d5022d2487a9" ], "display_name": false } ], "references": [ { "uuid": "1a363457-3833-4c36-9e4e-894116c48881", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0263682e-371f-4f33-bd97-b2ebff11e845", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "81af23bf-26e8-4dcc-aa5f-cf19612842cc", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a5e190d-48d4-42f8-92fa-160b46e75747", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d3befa15-0f7f-4b37-92f7-9f8cc53e931c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "686b80a5-be0e-4870-bc56-f6e22bc369ce", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390919000, "tags": [ "NOMEN" ] }, { "uuid": "580fc796-e52f-4d1f-8cf3-2875f155730d", "citation": "SRS import [9TI35313XW]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9TI35313XW", "doc_type": "SRS", "public_domain": true, "document_date": 1493390919000, "tags": [ "NOMEN" ] }, { "uuid": "b9fa3bed-cca3-4304-b137-6dc59cbc9f46", "citation": "ZINC ASCORBATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "95f91e72-9e5c-499d-897c-c20276715310", "citation": "ZINC ASCORBATE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b2006ff8-db72-5cf7-18a2-90f9a58ffe61", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "737368c5-e4e6-4369-9b80-0456d3892688", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "3a5970ab-99e6-4baa-8271-f20aede8a413", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "4dbc5f10-fab7-9abf-0ad5-d5022d2487a9", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "25c061d5-d61b-8133-c939-02609d8e838a", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "dae88468-7ccf-5c1b-8779-9e59c8ee2406", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "2bc6a759-3d9b-8135-eab6-ee7b33bd5977", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f8072c79-3379-468c-bdeb-d55ad289f4ad", "id": "f8072c79-3379-468c-bdeb-d55ad289f4ad", "molfile": "\n Marvin 01132112512D \n\n 1 0 0 0 1 0 999 V2000\n 28.4392 -5.3888 0.0000 Zn 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Zn+2]", "formula": "Zn", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f72f153f-d117-442a-8f65-0a95caab260a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "65.3956", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "ec55595e-5a72-4aff-92ed-a02d8eb7f39d", "id": "ec55595e-5a72-4aff-92ed-a02d8eb7f39d", "molfile": "\n Marvin 01132112132D \n\n 12 12 0 0 1 0 999 V2000\n 23.4681 -5.4385 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 23.4681 -4.5408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1070 -5.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7983 -5.4842 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 22.6903 -5.7137 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 22.0023 -5.2502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3542 -5.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5566 -5.5180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6249 -6.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1614 -7.2147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4543 -6.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9633 -7.1591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 5 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 6 1 6 0 0 0\n 5 11 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 9 2 3 0 0 0\n 10 9 1 0 0 0 0\n 11 9 1 0 0 0 0\n 12 11 2 0 0 0 0\nM CHG 1 4 -1\nM END", "smiles": "C([C@@H]([C@@H]1C(=O)C(=C(O)O1)O)O)[O-]", "formula": "C6H7O6", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "a55e74a7-1ce5-4937-b0c1-dbca6d6d7ceb" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "175.1164", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "31056460-94db-4dc6-908a-26f9f53670c0", "version": "12", "structure": { "id": "d6b88c14-9156-4535-9f40-2c3ac2b55bf6", "molfile": "\n Marvin 01132111082D \n\n 27 26 0 0 1 0 999 V2000\n 28.4324 -5.3876 0.0000 Zn 0 2 0 0 0 0 0 0 0 0 0 0\n 21.6262 -6.5066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1627 -7.2151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4557 -6.5066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9647 -7.1595 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 22.6917 -5.7140 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 23.2799 -6.2888 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4695 -5.4388 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 23.4695 -4.5411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1085 -5.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7998 -5.4845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0036 -5.2505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3555 -5.7541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5579 -5.5183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6262 -6.5066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1627 -7.2151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4557 -6.5066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9647 -7.1595 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 22.6917 -5.7140 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 23.2799 -6.2888 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4695 -5.4388 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 23.4695 -4.5411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1085 -5.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7998 -5.4845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0036 -5.2505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3555 -5.7541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5579 -5.5183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0 0 0 0\n 4 2 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 1 0 0 0\n 8 6 1 0 0 0 0\n 8 9 1 1 0 0 0\n 10 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 6 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 13 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 15 2 0 0 0 0\n 26 15 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 17 1 0 0 0 0\n 19 20 1 1 0 0 0\n 21 19 1 0 0 0 0\n 19 25 1 0 0 0 0\n 21 22 1 1 0 0 0\n 23 21 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 2 0 0 0 0\nM CHG 3 1 2 5 -1 18 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SAL 1 11 17 18 19 20 21 22 23 24 25 26 27\nM SPA 1 13 2 3 4 5 6 7 8 9 10 11 12 13 14\nM SDI 1 4 20.1379 -7.6351 20.1379 -4.1211\nM SDI 1 4 25.2198 -4.1211 25.2198 -7.6351\nM SMT 1 2\nM END", "smiles": "C([C@@H]([C@]1([H])C(=C(C(=O)O1)O)[O-])O)O.C([C@@H]([C@]1([H])C(=C(C(=O)O1)O)[O-])O)O.[Zn+2]", "formula": "2C6H7O6.Zn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "415.6284", "optical_activity": "UNSPECIFIED", "references": [ "d3befa15-0f7f-4b37-92f7-9f8cc53e931c", "580fc796-e52f-4d1f-8cf3-2875f155730d" ], "stereo_centers": 4 }, "unii": "9TI35313XW" } ] }