{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "29ddbefe-ee93-46f4-a660-179553794c82",
          "code": "5448-22-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5448-22-6",
          "code_system": "CAS",
          "references": [
            "d8e7dfff-f9ce-480d-a22f-fc1baed58537",
            "489e7de0-4e50-4178-adf3-7186b58d3049"
          ]
        },
        {
          "uuid": "9a0e34b0-6776-4a66-803b-0d1f016b3867",
          "code": "226-670-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.245",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d8e7dfff-f9ce-480d-a22f-fc1baed58537"
          ]
        },
        {
          "uuid": "ef5d99ef-826d-420a-a644-2de2912ba403",
          "code": "9T74YJB0Y3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "22254f31-9d69-1812-fe25-95658e158649",
          "code": "DTXSID0052201",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0052201",
          "code_system": "EPA CompTox",
          "references": [
            "c11e7e0e-5525-5569-bd73-303ed348f134"
          ]
        },
        {
          "uuid": "5320a772-fb1a-9864-afc5-16261d9c3823",
          "code": "17482",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=17482",
          "code_system": "NSC",
          "references": [
            "f47ea30d-7857-2030-adb7-c4cc9acb6b42"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f8e0de09-18ba-48a2-974b-a9fa8d528f02",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "7d84577a-55a9-4135-95b0-2d59596133c9",
            "refuuid": "58f70e40-0ab6-45c0-bd29-608e3f21e34d",
            "name": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, (1S,2R)-",
            "unii": "9429644SB5",
            "linking_id": "9429644SB5",
            "ref_pname": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, (1S,2R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "49b6b84f-f23f-4e5c-96e4-7c6ab708a6b3",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "95c84890-856e-49fe-90fb-1bbfcf2994ec",
            "refuuid": "8f6ccee1-aebc-4c8b-8b26-8b73c67d86b3",
            "name": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, (1R,2S)-",
            "unii": "7KM55MK799",
            "linking_id": "7KM55MK799",
            "ref_pname": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, (1R,2S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a4cc10ac-4b47-4d5a-b916-09c89c525d68",
          "name": "2-TERT-BUTYLCYCLOHEXANOL, TRANS-",
          "stdName": "2-TERT-BUTYLCYCLOHEXANOL, TRANS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "f4a4555a-de8f-434b-9635-c745371c030c"
          ],
          "display_name": true
        },
        {
          "uuid": "c0553883-c9a9-499c-a15b-53cae4846167",
          "name": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, (1R,2S)-REL-",
          "stdName": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, (1R,2S)-REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "fca284cb-dd6c-4fb9-b6a7-9152424271b5"
          ],
          "display_name": false
        },
        {
          "uuid": "b07a8900-ba13-4e8f-b29a-9a2e391bc10a",
          "name": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, TRANS-",
          "stdName": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, TRANS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "fca284cb-dd6c-4fb9-b6a7-9152424271b5"
          ],
          "display_name": false
        },
        {
          "uuid": "7e8bbb40-6575-4c07-8831-d154cdd45d51",
          "name": "CYCLOHEXANOL, 2-TERT-BUTYL-, TRANS-",
          "stdName": "CYCLOHEXANOL, 2-TERT-BUTYL-, TRANS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "fca284cb-dd6c-4fb9-b6a7-9152424271b5"
          ],
          "display_name": false
        },
        {
          "uuid": "e68513d5-0a2d-4c18-997b-9f9232a7b98d",
          "name": "J422.743C",
          "stdName": "J422.743C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "c39a104f-7acb-400e-9d20-94b68267623e"
          ],
          "display_name": false
        },
        {
          "uuid": "a670845b-7991-4e7a-a1e5-62fcb53e2184",
          "name": "NSC-17482",
          "stdName": "NSC-17482",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "fca284cb-dd6c-4fb9-b6a7-9152424271b5"
          ],
          "display_name": false
        },
        {
          "uuid": "23bca1eb-a9a8-401b-905e-385945ef821e",
          "name": "REL-(1R*,2S*)-2-TERT-BUTYL-1-CYCLOHEXANOL",
          "stdName": "REL-(1R*,2S*)-2-TERT-BUTYL-1-CYCLOHEXANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "c39a104f-7acb-400e-9d20-94b68267623e"
          ],
          "display_name": false
        },
        {
          "uuid": "3d606fe5-925f-4176-a2a2-7c0f4c2f61eb",
          "name": "TRANS-2-TERT-BUTYLCYCLOHEXAN-1-OL",
          "stdName": "TRANS-2-TERT-BUTYLCYCLOHEXAN-1-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "fb8b154d-bba4-4ee5-9022-f4f611a3b059"
          ],
          "display_name": false
        },
        {
          "uuid": "68b29d85-96fe-428a-8f65-4f40e837d347",
          "name": "TRANS-2-TERT-BUTYLCYCLOHEXANOL",
          "stdName": "TRANS-2-TERT-BUTYLCYCLOHEXANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
            "fca284cb-dd6c-4fb9-b6a7-9152424271b5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f4a4555a-de8f-434b-9635-c745371c030c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1a3126b3-1fb8-41a2-a0ce-b87086ce238d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fca284cb-dd6c-4fb9-b6a7-9152424271b5",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb8b154d-bba4-4ee5-9022-f4f611a3b059",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/5448-22-6",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/5448-22-6",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c39a104f-7acb-400e-9d20-94b68267623e",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J422.743C",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J422.743C",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8e7dfff-f9ce-480d-a22f-fc1baed58537",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393198000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c923d00c-f032-48d7-8b60-2c2cdd49f842",
          "citation": "SRS import [9T74YJB0Y3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9T74YJB0Y3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393198000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4919cd69-9cf3-4a19-b0b8-5b981478880b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c11e7e0e-5525-5569-bd73-303ed348f134",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5448-22-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "489e7de0-4e50-4178-adf3-7186b58d3049",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f47ea30d-7857-2030-adb7-c4cc9acb6b42",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "57af0c10-9a74-81a8-200c-30484468d157",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "62a5b3df-e5f0-4fc0-af72-02fbd8d65168",
          "id": "62a5b3df-e5f0-4fc0-af72-02fbd8d65168",
          "molfile": "\n  Marvin  01132105072D          \n\n 11 11  0  0  0  0            999 V2000\n    1.6629   -0.8718    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.6629   -0.0480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9481   -1.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9481   -2.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6629   -2.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3778   -2.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3778   -1.2836    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.0927   -0.8718    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8786   -0.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6759   -0.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8076   -1.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  6  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)[C@@H]1CCCC[C@H]1O",
          "formula": "C10H20O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "550f5a70-f992-4c46-90fe-7735f7fd4834"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "156.2656",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf59f6a5-9326-4cff-a5b7-12c322ac0932",
      "version": "9",
      "structure": {
        "id": "7d7b289c-00bd-455d-b1fa-16669eccff1c",
        "molfile": "\n  Marvin  01132106312D          \n\n 11 11  0  0  0  0            999 V2000\n    1.6629   -0.8718    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.9481   -1.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9481   -2.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6629   -2.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3778   -2.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3778   -1.2836    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.0927   -0.8718    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8786   -0.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6759   -0.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8076   -1.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6629   -0.0480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  6  7  1  6  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  1 11  1  1  0  0  0\nM  END",
        "smiles": "CC(C)(C)[C@@H]1CCCC[C@H]1O",
        "formula": "C10H20O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "156.2656",
        "optical_activity": "( + / - )",
        "references": [
          "4919cd69-9cf3-4a19-b0b8-5b981478880b",
          "c923d00c-f032-48d7-8b60-2c2cdd49f842"
        ],
        "stereo_centers": 2
      },
      "unii": "9T74YJB0Y3"
    }
  ]
}