{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "215114e2-a7a8-4c6d-accf-11ca61b0e0c2",
          "code": "39267-74-8",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=39267-74-8",
          "code_system": "CAS",
          "references": [
            "a8974777-dd48-4a3b-ab4d-74cd60d94340",
            "abc41137-ddeb-4326-8279-c04fbc692ecf"
          ]
        },
        {
          "uuid": "b07f86d1-e6bd-4f36-9ae0-1760aa91d876",
          "code": "254-393-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.049.430",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a8974777-dd48-4a3b-ab4d-74cd60d94340"
          ]
        },
        {
          "uuid": "e31cb82e-f22a-4313-2f2b-d692ff75410f",
          "code": "135443549",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135443549",
          "code_system": "PUBCHEM",
          "references": [
            "c3f194a6-8c5f-f4bb-f257-78f9337b9f03"
          ]
        },
        {
          "uuid": "845b8da2-98f2-41eb-8d01-9712e2cecbb0",
          "code": "9SZ7ZX1H0L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d3217e41-87a1-4299-a98f-2cffd1024697",
          "code": "167378",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=167378",
          "code_system": "NSC",
          "references": [
            "abc41137-ddeb-4326-8279-c04fbc692ecf"
          ]
        },
        {
          "uuid": "60d42091-4268-4cdc-bf54-388734cf8067",
          "code": "35011-47-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=35011-47-3",
          "code_system": "CAS",
          "references": [
            "abc41137-ddeb-4326-8279-c04fbc692ecf"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "17f510b8-343e-48ba-831b-f439c439e628",
          "amount": {
            "uuid": "da2d5992-3faf-4b64-8b82-594cd346d9cc"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "3e6d107f-83c5-4889-b358-001814235164"
          ],
          "related_substance": {
            "uuid": "7fc57c98-4500-47b3-9fb9-5eee3adeda4b",
            "refuuid": "a7d8f3b8-915a-47d9-969f-209704a481d9",
            "name": "2,5,6-Triamino-4-Pyrimidinol sulfate hydrate",
            "unii": "JQM54X7FCZ",
            "linking_id": "JQM54X7FCZ",
            "ref_pname": "2,5,6-Triamino-4-Pyrimidinol sulfate hydrate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "80d49194-6ff6-417c-a2bd-4ec9b536c754",
          "amount": {
            "uuid": "5f027647-1700-40ad-a09b-dad553dfbc6a"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "299d19a7-87da-4c2e-9590-14a75d67d09b",
            "refuuid": "b590930c-eee3-4b5c-a8fe-3027d6519b66",
            "name": "2,5,6-Triamino-4(1H)-pyrimidinone",
            "unii": "FR001FJW89",
            "linking_id": "FR001FJW89",
            "ref_pname": "2,5,6-Triamino-4(1H)-pyrimidinone",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "85bf0552-f4f1-4047-9327-4b6eefe96dfc",
          "name": "2,5,6-Triamino-4-Pyrimidinol Sulfate",
          "stdName": "2,5,6-TRIAMINO-4-PYRIMIDINOL SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c063598-c355-48dd-8ebe-74004d4167c9",
            "0bb039a4-8567-4f6e-95d7-938964f84603",
            "5a6d4e50-198d-47eb-be03-30add0f8ee8f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2fb3b112-82a6-4d9c-b798-80ff7a981074",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b732f558-2071-40f9-a720-4ad0e3d3934e",
          "name": "4(1H)-Pyrimidinone, 2,5,6-triamino-, sulfate (1:1)",
          "stdName": "4(1H)-PYRIMIDINONE, 2,5,6-TRIAMINO-, SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abc41137-ddeb-4326-8279-c04fbc692ecf"
          ],
          "display_name": false
        },
        {
          "uuid": "73e7bff9-556a-4cce-938a-d80e22b92393",
          "name": "4(3H)-Pyrimidinone, 2,5,6-triamino-, sulfate (1:1)",
          "stdName": "4(3H)-PYRIMIDINONE, 2,5,6-TRIAMINO-, SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abc41137-ddeb-4326-8279-c04fbc692ecf"
          ],
          "display_name": false
        },
        {
          "uuid": "10b422ed-8c36-4fd8-ade6-4f0398cf4ed3",
          "name": "NSC-167378",
          "stdName": "NSC-167378",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abc41137-ddeb-4326-8279-c04fbc692ecf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1c063598-c355-48dd-8ebe-74004d4167c9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0bb039a4-8567-4f6e-95d7-938964f84603",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "997ee05e-0245-41ee-af3a-baf73f28be2e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8974777-dd48-4a3b-ab4d-74cd60d94340",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391402000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b5db151-efb3-4a50-9ff7-c694c914c7f7",
          "citation": "SRS import [9SZ7ZX1H0L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9SZ7ZX1H0L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391402000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a6d4e50-198d-47eb-be03-30add0f8ee8f",
          "citation": "2,5,6-TRIAMINO-4-PYRIMIDINOL SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74a55efe-9d3f-f8fa-6ea1-842b908b794e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=39267-74-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c3f194a6-8c5f-f4bb-f257-78f9337b9f03",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "abc41137-ddeb-4326-8279-c04fbc692ecf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3e6d107f-83c5-4889-b358-001814235164",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "532705bb-7c98-41d6-b26e-43b8f7383ac1",
          "id": "532705bb-7c98-41d6-b26e-43b8f7383ac1",
          "molfile": "\n  CDK     08092408102D\n\n  5  4  0  0  0  0  0  0  0  0999 V2000\n   29.6233   -7.2820    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6233   -5.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6233   -8.8420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   31.1833   -7.2820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0633   -7.2820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e75d33b6-0b6b-43cd-99ed-0eebd4ddcebc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f0e96cfb-f5a1-4fb6-b1ee-5e828409f97e",
          "id": "f0e96cfb-f5a1-4fb6-b1ee-5e828409f97e",
          "molfile": "\n  CDK     08092408102D\n\n 10 10  0  0  0  0  0  0  0  0999 V2000\n   19.5172   -8.3190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5172   -6.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1635   -5.9794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8622   -5.9794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2159   -6.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5694   -5.9794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2159   -8.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5694   -9.1077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8622   -9.1077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8622  -10.6677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\nM  END",
          "smiles": "c1(c(N)[nH]c(N)nc1=O)N",
          "formula": "C4H7N5O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cccf0b57-de51-4d67-832f-02007d96360c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "141.1314",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5d2eb3fe-5216-437f-ab18-4e4b1e70e8f8",
      "version": "12",
      "structure": {
        "id": "3848e1ef-3b2e-40b9-a67c-c5e7bd20d7da",
        "molfile": "\n   JSDraw208092408102D\n\n 15 14  0  0  0  0              0 V2000\n   19.5172   -8.3190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5172   -6.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1635   -5.9794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8622   -5.9794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2159   -6.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5694   -5.9794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2159   -8.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5694   -9.1077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8622   -9.1077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8622  -10.6677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6233   -7.2820    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6233   -5.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6233   -8.8420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   31.1833   -7.2820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0633   -7.2820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 11 15  1  0  0  0  0\nM  END",
        "smiles": "c1(c(N)[nH]c(N)nc1=O)N.OS(=O)(=O)O",
        "formula": "C4H7N5O.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "239.211",
        "optical_activity": "NONE",
        "references": [
          "997ee05e-0245-41ee-af3a-baf73f28be2e",
          "1b5db151-efb3-4a50-9ff7-c694c914c7f7"
        ],
        "stereo_centers": 0
      },
      "unii": "9SZ7ZX1H0L"
    }
  ]
}