{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6f149484-24ff-4a2e-963d-051e765ad21f",
          "code": "N02AC01",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Diphenylpropylamine derivatives|dextromoramide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02AC01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "36861ed7-7d4d-43da-bd4d-5553e572f163",
          "code": "QN02AC01",
          "comments": "VATC|ANALGESICS|OPIOIDS|Diphenylpropylamine derivatives|dextromoramide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AC01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "255039b9-2ec1-4af4-aa00-eb4d20f71bcd",
          "code": "C87357",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87357",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "0e89097e-51f0-4219-b303-736331121273",
          "code": "357-56-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=357-56-2",
          "code_system": "CAS",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53",
            "7a29db83-a088-4f0c-9d7d-c418643ee999"
          ]
        },
        {
          "uuid": "bad5d2b4-de70-4a18-93c6-5bb719c8d15f",
          "code": "D003916",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003916",
          "code_system": "MESH",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "db7b6375-1d67-459f-ad71-efc6b2f24ccc",
          "code": "DEXTROMORAMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dextromoramide",
          "code_system": "WIKIPEDIA",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "d2edd3fa-1e4d-44c4-91cf-e066bbe88f24",
          "code": "SUB07052MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "f0f7e813-63eb-4f59-97ce-aa7d981d695b",
          "code": "733",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=733",
          "code_system": "INN",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "e0b6bd92-2085-4224-90bc-aab43f317351",
          "code": "9613",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Opiates",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "4078e7dc-d355-4957-8e24-db15bf31243d",
          "code": "3290",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3290/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "3c15a4f8-9866-437d-9de0-3a875d90c46e",
          "code": "m4228",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4228?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "a62ac31d-03ee-4bb6-a853-2bfa573be0cd",
          "code": "206-613-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.013",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "b64145ce-e06a-4ca9-9fbf-cd7f6745c3ff",
          "code": "92943",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92943",
          "code_system": "PUBCHEM",
          "references": [
            "4a1c7681-edef-4d7d-8752-58968059fb53"
          ]
        },
        {
          "uuid": "2da8b8ff-b2f0-5673-cc0d-3cc56f0a863c",
          "code": "DTXSID8022909",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8022909",
          "code_system": "EPA CompTox",
          "references": [
            "321b68b3-71ca-b3fa-955b-f12df5d3bb67"
          ]
        },
        {
          "uuid": "eb3fe11e-1b1a-4daa-2564-9b865a10b5d3",
          "code": "C67413",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1232a9a3-bb06-5724-16af-75786ccf3117"
          ]
        },
        {
          "uuid": "86676d03-fda0-4397-b97e-d88cbac6328d",
          "code": "9S4S6CIY83",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "79b968ec-d758-2125-88ae-6ca5eb481920",
          "code": "843",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/843",
          "code_system": "DRUG CENTRAL",
          "references": [
            "1232a9a3-bb06-5724-16af-75786ccf3117"
          ]
        },
        {
          "uuid": "f838d699-a007-7c50-908d-2b4dbaadb885",
          "code": "DB01529",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01529",
          "code_system": "DRUG BANK",
          "references": [
            "1232a9a3-bb06-5724-16af-75786ccf3117"
          ]
        },
        {
          "uuid": "860fb229-6d48-879b-07fa-6ef8aa646ccf",
          "code": "74274",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:74274",
          "code_system": "CHEBI",
          "references": [
            "1232a9a3-bb06-5724-16af-75786ccf3117"
          ]
        },
        {
          "uuid": "be580cfb-aa40-d3f0-bf9b-997d85ded351",
          "code": "100000082898",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "600e4c16-6848-c2bb-b373-bd03e8dad9d5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4c7ae7a1-de01-4c05-a710-c6da9b3f1408",
          "comments": "(+)-4-[2-methyl-4-oxo-3,3-diphenyl-4-(1-pyrrolidinyl)butyl]morpholine\n(A dextro-rotatory isomer of moramide). as per INCB",
          "type": "ACTIVE MOIETY",
          "references": [
            "1ac30734-9414-4d30-8ffb-0b4235529a31"
          ],
          "related_substance": {
            "uuid": "71c9874e-5cc4-4166-8d5d-7f283b903a97",
            "refuuid": "d73ed7c7-3d20-4ced-920a-111563f9d88b",
            "name": "DEXTROMORAMIDE",
            "unii": "9S4S6CIY83",
            "linking_id": "9S4S6CIY83",
            "ref_pname": "DEXTROMORAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b554049e-99aa-4c52-a75a-fb3df00e0e91",
          "amount": {
            "uuid": "b2904981-848f-4866-b4b6-d04ac1e0c769",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 72
          },
          "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "1ac30734-9414-4d30-8ffb-0b4235529a31"
          ],
          "related_substance": {
            "uuid": "42d11d44-d3b6-4c05-b1c2-88c1cc1effc1",
            "refuuid": "80cbaf5e-3c0c-4382-88d3-bd7d2b48198c",
            "name": "DEXTROMORAMIDE TARTRATE",
            "unii": "J778U505W5",
            "linking_id": "J778U505W5",
            "ref_pname": "DEXTROMORAMIDE TARTRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "68a01826-9184-4e46-9878-14291a70ef97",
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "6db4531c-03eb-40cc-8c55-65c78befdb31",
            "refuuid": "4d7ee91f-699c-4a5b-8b32-39c3d32fd1fa",
            "name": "RACEMORAMIDE",
            "unii": "L3J8QT828G",
            "linking_id": "L3J8QT828G",
            "ref_pname": "RACEMORAMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d338162e-6f7e-4e4a-af75-fedbd127bfa8",
          "name": "(+)-1-(3-METHYL-4-MORPHOLINO-2,2-DIPHENYLBUTYRYL)PYRROLIDINE",
          "stdName": "(+)-1-(3-METHYL-4-MORPHOLINO-2,2-DIPHENYLBUTYRYL)PYRROLIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd52ba5-8f7d-4be5-8476-f4eda5f33b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "05889f4d-235b-49c0-9db2-1ddfb302d8ca",
          "name": "(+)-4-(2-METHYL-4-OXO-3,3-DIPHENYL-4-(1-PYRROLIDINYL)BUTYL)MORPHOLINE",
          "stdName": "(+)-4-(2-METHYL-4-OXO-3,3-DIPHENYL-4-(1-PYRROLIDINYL)BUTYL)MORPHOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b21d9bd-86e5-4c34-b484-540198bc6658"
          ],
          "display_name": false
        },
        {
          "uuid": "6e2f8fb0-6ed1-4bda-9e80-ba170279406b",
          "name": "1-((3S)-3-METHYL-4-(4-MORPHOLINYL)-1-OXO-2,2-DIPHENYLBUTYL)PYRROLIDINE",
          "stdName": "1-((3S)-3-METHYL-4-(4-MORPHOLINYL)-1-OXO-2,2-DIPHENYLBUTYL)PYRROLIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00a1a56d-344d-414f-915a-e022bff789b9"
          ],
          "display_name": false
        },
        {
          "uuid": "76c024e1-998b-478c-b620-34b2f03d9cbb",
          "name": "1-BUTANONE, 3-METHYL-4-(4-MORPHOLINYL)-2,2-DIPHENYL-1-(1-PYRROLIDINYL)-, (3S)-",
          "stdName": "1-BUTANONE, 3-METHYL-4-(4-MORPHOLINYL)-2,2-DIPHENYL-1-(1-PYRROLIDINYL)-, (3S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49c297f1-b300-4b88-a3ae-cc5b9bab34fd"
          ],
          "display_name": false
        },
        {
          "uuid": "0e03e224-0fe2-45f6-8894-12dc4ba72a8f",
          "name": "4-(2-METHYL-4-OXO-3,3-DIPHENYL-4-(1-PYRROLIDINYL)BUTYL)MORPHOLINE",
          "stdName": "4-(2-METHYL-4-OXO-3,3-DIPHENYL-4-(1-PYRROLIDINYL)BUTYL)MORPHOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd52ba5-8f7d-4be5-8476-f4eda5f33b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "da455a13-13ab-4484-b99b-4fa990fd2239",
          "name": "ACSCN-9613",
          "stdName": "ACSCN-9613",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27b78eda-9fd2-4e5f-99ce-b56f14c8f6d8"
          ],
          "display_name": false
        },
        {
          "uuid": "2caf367f-8ab2-4476-8686-f2928bd8182f",
          "name": "ALCOID",
          "stdName": "ALCOID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d83dbe64-7c91-4245-b149-74786ab11a3a"
          ],
          "display_name": false
        },
        {
          "uuid": "d0d19ca3-645c-4983-96c2-cd31b1b52a3e",
          "name": "D-2,2-DIPHENYL-3-METHYL-4-MORPHOLINOBUTYRYLPYRROLIDINE",
          "stdName": "D-2,2-DIPHENYL-3-METHYL-4-MORPHOLINOBUTYRYLPYRROLIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd52ba5-8f7d-4be5-8476-f4eda5f33b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "86498bb4-7a3a-44bd-a36f-64f003187c85",
          "name": "DEXTROMORAMIDE",
          "stdName": "DEXTROMORAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d29ac837-fd2b-473b-b5fe-e51a78df8534",
            "ad9d8277-89db-43f4-bf3d-d20bf543541b",
            "66d32525-23de-41c9-b6e6-266ec78615a7",
            "dea46b2c-297c-4168-b9bf-b232eb6b76ce",
            "9c5be704-7337-4ae7-b475-bb4a10c670ad",
            "3d434467-f16c-4c26-bb3c-913ede8a4e0f",
            "47e4bb34-9861-4e43-b33f-d611157cb1b1",
            "33d2f0ca-c977-482d-8a5a-99f9a49c38b7",
            "7b21d9bd-86e5-4c34-b484-540198bc6658"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "0644d07c-1de4-4293-8f55-074416fc16e5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c645f513-b13f-4f95-b2dc-8b2825daca3e",
          "name": "DEXTROMORAMIDE [MART.]",
          "stdName": "DEXTROMORAMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d29ac837-fd2b-473b-b5fe-e51a78df8534"
          ],
          "display_name": false
        },
        {
          "uuid": "0b39338d-821e-42ed-b1d4-39d8f49c9ac3",
          "name": "DEXTROMORAMIDE [MI]",
          "stdName": "DEXTROMORAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33d2f0ca-c977-482d-8a5a-99f9a49c38b7"
          ],
          "display_name": false
        },
        {
          "uuid": "05929248-8d6b-91de-e968-5d0f53402c73",
          "name": "Dextromoramide [WHO-DD]",
          "stdName": "DEXTROMORAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b8d513f-29b3-4796-a388-ef7bcac74f89"
          ],
          "display_name": false
        },
        {
          "uuid": "f417071f-2a2c-4970-b7ba-6bb89f00f560",
          "name": "IDS-ND-003",
          "stdName": "IDS-ND-003",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "481118ae-0471-4028-844a-8ed54f2f85bd"
          ],
          "display_name": false
        },
        {
          "uuid": "62122306-548a-47c2-9ad7-08339e485826",
          "name": "JETRIUM",
          "stdName": "JETRIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d83dbe64-7c91-4245-b149-74786ab11a3a"
          ],
          "display_name": false
        },
        {
          "uuid": "193347c6-cf6b-4ab1-af02-e8f04b676b06",
          "name": "LINFADOL",
          "stdName": "LINFADOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49c297f1-b300-4b88-a3ae-cc5b9bab34fd"
          ],
          "display_name": false
        },
        {
          "uuid": "7c48fdf2-2cbe-4259-b832-47a33db4926b",
          "name": "MCP-875",
          "stdName": "MCP-875",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49c297f1-b300-4b88-a3ae-cc5b9bab34fd"
          ],
          "display_name": false
        },
        {
          "uuid": "caeadf09-fb0b-45e5-a19b-4a4d09926db2",
          "name": "MORAMIDE",
          "stdName": "MORAMIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49c297f1-b300-4b88-a3ae-cc5b9bab34fd"
          ],
          "display_name": false
        },
        {
          "uuid": "9817830b-903b-4fb6-8e9e-893c0be846eb",
          "name": "NARCOLO",
          "stdName": "NARCOLO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49c297f1-b300-4b88-a3ae-cc5b9bab34fd"
          ],
          "display_name": false
        },
        {
          "uuid": "d5b34663-eb12-443e-a9d1-b2bd9c50b5d0",
          "name": "PALFADONNA",
          "stdName": "PALFADONNA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d83dbe64-7c91-4245-b149-74786ab11a3a"
          ],
          "display_name": false
        },
        {
          "uuid": "4009bfd7-d4bd-487d-9306-299a9beb694e",
          "name": "PYRROLAMIDOL",
          "stdName": "PYRROLAMIDOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd52ba5-8f7d-4be5-8476-f4eda5f33b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "c1ef8bec-2607-4860-8451-22513e544a8e",
          "name": "R-875",
          "stdName": "R-875",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd52ba5-8f7d-4be5-8476-f4eda5f33b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "2f811f29-31bc-4bfa-bb86-f66bd11c0f9d",
          "name": "RACEMORAMIDE, (S)-",
          "stdName": "RACEMORAMIDE, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49c297f1-b300-4b88-a3ae-cc5b9bab34fd"
          ],
          "display_name": false
        },
        {
          "uuid": "122d6b86-79b9-4d93-a357-64ce1dbbf93d",
          "name": "SKF-5137",
          "stdName": "SKF-5137",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd52ba5-8f7d-4be5-8476-f4eda5f33b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "21d9c41b-22c8-4102-bed2-68c2580dcb25",
          "name": "TROXILAN",
          "stdName": "TROXILAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d83dbe64-7c91-4245-b149-74786ab11a3a"
          ],
          "display_name": false
        },
        {
          "uuid": "7fbb4934-4573-4262-9b54-6c3f22d71f4b",
          "name": "YETRIUM",
          "stdName": "YETRIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d83dbe64-7c91-4245-b149-74786ab11a3a"
          ],
          "display_name": false
        },
        {
          "uuid": "1f3deec6-90f0-4acc-81d3-f45dbdcd47ba",
          "name": "dextromoramide [INN]",
          "stdName": "DEXTROMORAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66d32525-23de-41c9-b6e6-266ec78615a7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7b21d9bd-86e5-4c34-b484-540198bc6658",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3cd52ba5-8f7d-4be5-8476-f4eda5f33b3d",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00a1a56d-344d-414f-915a-e022bff789b9",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66d32525-23de-41c9-b6e6-266ec78615a7",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d29ac837-fd2b-473b-b5fe-e51a78df8534",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33d2f0ca-c977-482d-8a5a-99f9a49c38b7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad9d8277-89db-43f4-bf3d-d20bf543541b",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d83dbe64-7c91-4245-b149-74786ab11a3a",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27b78eda-9fd2-4e5f-99ce-b56f14c8f6d8",
          "citation": "http://en.wikipedia.org/wiki/List_of_Schedule_I_drugs_%28US%29",
          "url": "http://en.wikipedia.org/wiki/List_of_Schedule_I_drugs_%28US%29",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "481118ae-0471-4028-844a-8ed54f2f85bd",
          "citation": "INCB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49c297f1-b300-4b88-a3ae-cc5b9bab34fd",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a1c7681-edef-4d7d-8752-58968059fb53",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ac30734-9414-4d30-8ffb-0b4235529a31",
          "citation": "INTERNATIONAL NARCOTICS CONTROL BOARD - YELLOW LIST; ANNEX TO FORMS A, B AND C; 52ND EDITION, DECEMBER 2013; HTTP://WWW.INCB.ORG/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79bd6f06-2856-41d8-9f1e-3d357554f6fc",
          "citation": "SRS import [9S4S6CIY83]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9S4S6CIY83",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47e4bb34-9861-4e43-b33f-d611157cb1b1",
          "citation": "DEXTROMORAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9c5be704-7337-4ae7-b475-bb4a10c670ad",
          "citation": "DEXTROMORAMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dea46b2c-297c-4168-b9bf-b232eb6b76ce",
          "citation": "DEXTROMORAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d434467-f16c-4c26-bb3c-913ede8a4e0f",
          "citation": "DEXTROMORAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "321b68b3-71ca-b3fa-955b-f12df5d3bb67",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=357-56-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1232a9a3-bb06-5724-16af-75786ccf3117",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7a29db83-a088-4f0c-9d7d-c418643ee999",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3b8d513f-29b3-4796-a388-ef7bcac74f89",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "600e4c16-6848-c2bb-b373-bd03e8dad9d5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "efa7cc76-7ed6-42f3-b38e-0cff76b79050",
          "id": "efa7cc76-7ed6-42f3-b38e-0cff76b79050",
          "molfile": "\n  Marvin  01132112262D          \n\n 29 32  0  0  1  0            999 V2000\n    6.3746   -4.3580    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.0251   -3.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6456   -5.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4433   -5.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8382   -5.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6746   -5.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1083   -5.1634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6901   -4.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8615   -4.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4995   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1587   -3.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4927   -3.0803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7938   -3.0570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7163   -2.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4133   -1.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9554   -2.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5140   -3.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3136   -5.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6089   -5.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6089   -6.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3214   -6.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9796   -6.3483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9796   -5.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5005   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0978   -5.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2459   -5.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8123   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2459   -3.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0746   -3.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 18 10  1  0  0  0  0\n 24 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 17 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 23 18  2  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 29 24  2  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "C[C@H](CN1CCOCC1)C(c2ccccc2)(c3ccccc3)C(=O)N4CCCC4",
          "formula": "C25H32N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b155776d-5441-410e-b737-9a5044c1fcc4"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "392.5347",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d73ed7c7-3d20-4ced-920a-111563f9d88b",
      "version": "13",
      "structure": {
        "id": "d4db1da8-9dda-434f-aa57-23b3eee2cda2",
        "molfile": "\n  Marvin  01132111022D          \n\n 29 32  0  0  1  0            999 V2000\n    5.1587   -3.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4995   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7938   -3.0570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3746   -4.3580    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4433   -5.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6456   -5.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4927   -3.0803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3136   -5.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5005   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1083   -5.1634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5140   -3.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7163   -2.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0251   -3.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8615   -4.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8382   -5.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6746   -5.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6901   -4.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9796   -5.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0978   -5.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0746   -3.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6089   -5.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4133   -1.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9554   -2.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6089   -6.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9796   -6.3483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2459   -5.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2459   -3.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3214   -6.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8123   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 18  8  1  0  0  0  0\n 19  9  1  0  0  0  0\n 20  9  2  0  0  0  0\n 21  8  2  0  0  0  0\n 22 12  1  0  0  0  0\n 23 11  1  0  0  0  0\n 24 21  1  0  0  0  0\n 25 18  2  0  0  0  0\n 26 19  2  0  0  0  0\n 27 20  1  0  0  0  0\n 28 25  1  0  0  0  0\n 29 26  1  0  0  0  0\n 22 23  1  0  0  0  0\n 27 29  2  0  0  0  0\n 24 28  2  0  0  0  0\n 10 17  1  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10 16  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  3  1  0  0  0  0\n  4 13  1  6  0  0  0\n 14  5  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 14  1  0  0  0  0\nM  END",
        "smiles": "C[C@H](CN1CCOCC1)C(c2ccccc2)(c3ccccc3)C(=O)N4CCCC4",
        "formula": "C25H32N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "392.5347",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "79bd6f06-2856-41d8-9f1e-3d357554f6fc",
          "7b21d9bd-86e5-4c34-b484-540198bc6658",
          "66d32525-23de-41c9-b6e6-266ec78615a7"
        ],
        "stereo_centers": 1
      },
      "unii": "9S4S6CIY83"
    }
  ]
}