{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5ef409d5-ae95-4b0d-97a8-78a82b359c93",
          "code": "150114-71-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=150114-71-9",
          "code_system": "CAS",
          "references": [
            "74688d63-2dc3-4523-bdf2-d078312648f6",
            "4bcb6685-6e9b-46dd-85a6-f111f505164a"
          ]
        },
        {
          "uuid": "7fc8c1f7-c040-4f07-93f5-d27b4dceb803",
          "code": "AMINOPYRALID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Aminopyralid",
          "code_system": "WIKIPEDIA",
          "references": [
            "74688d63-2dc3-4523-bdf2-d078312648f6"
          ]
        },
        {
          "uuid": "2fc1efa5-cf31-4e56-9d5e-0acbf2de12f0",
          "code": "117408",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:801",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "74688d63-2dc3-4523-bdf2-d078312648f6"
          ]
        },
        {
          "uuid": "69dc83f2-fb51-46f3-aae6-e87639412d85",
          "code": "213012",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/213012",
          "code_system": "PUBCHEM",
          "references": [
            "74688d63-2dc3-4523-bdf2-d078312648f6"
          ]
        },
        {
          "uuid": "1f48ab20-3b91-fae4-9298-2cf66852232e",
          "code": "7939",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7939",
          "code_system": "HSDB",
          "references": [
            "e1acf22b-4d8d-ef08-1345-66e362ba4cc5"
          ]
        },
        {
          "uuid": "22de0b5a-5285-246e-9626-654a1faaad69",
          "code": "DTXSID2034330",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2034330",
          "code_system": "EPA CompTox",
          "references": [
            "bac250bc-ee88-f93c-579e-a767783e2284"
          ]
        },
        {
          "uuid": "fb771691-afd6-7c67-d67d-f45779cf9f00",
          "code": "m12121",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m12121",
          "code_system": "MERCK INDEX",
          "references": [
            "96cbebe2-a51b-b732-a169-6dcd67cccb72"
          ]
        },
        {
          "uuid": "bcb77e53-b15f-43d9-82cd-75ac207b1d0e",
          "code": "9S4EMJ60LF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f912c857-61f6-495f-bbd7-086b345fde74",
          "code": "62962",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:62962",
          "code_system": "CHEBI",
          "references": [
            "96cbebe2-a51b-b732-a169-6dcd67cccb72"
          ]
        },
        {
          "uuid": "e86f714f-1d19-0296-fcfb-561368b5fcb6",
          "code": "aminopyralid",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/aminopyralid.html",
          "code_system": "ALANWOOD",
          "references": [
            "548653a6-c669-4b3b-c580-23a6c30b255a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7808e890-3ae8-4268-9343-3796253dd94f",
          "name": "2-PYRIDINECARBOXYLIC ACID, 4-AMINO-3,6-DICHLORO-",
          "stdName": "2-PYRIDINECARBOXYLIC ACID, 4-AMINO-3,6-DICHLORO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d506c36-4983-40c9-8b4a-54bbc1877c7f",
            "2b06e384-47ed-4096-bc7c-33073cb9de7d"
          ],
          "display_name": false
        },
        {
          "uuid": "82ba423e-542a-4c98-b02c-e3d381a46592",
          "name": "4-AMINO-3,6-DICHLORO-2-PYRIDINECARBOXYLIC ACID",
          "stdName": "4-AMINO-3,6-DICHLORO-2-PYRIDINECARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fe6bca5-d317-42bd-ba4f-c849735c4bee",
            "5ca9de75-5eff-4dee-aeef-2bb2859d85c5"
          ],
          "display_name": false
        },
        {
          "uuid": "b435193c-c145-464a-b3c1-dea2e31baa4c",
          "name": "4-AMINO-3,6-DICHLOROPYRIDINE-2-CARBOXYLIC ACID",
          "stdName": "4-AMINO-3,6-DICHLOROPYRIDINE-2-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "525afbae-6925-430a-b658-d2174ef57649",
            "3fe6bca5-d317-42bd-ba4f-c849735c4bee"
          ],
          "display_name": false
        },
        {
          "uuid": "0f5e88fd-4fdf-4c11-8532-867344d16752",
          "name": "AMINOPYRALID",
          "stdName": "AMINOPYRALID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa5b1c77-6577-4a24-9a39-a2deaea9e9b4",
            "1e76f0df-8259-4501-847f-cede374c3fe8",
            "2b06e384-47ed-4096-bc7c-33073cb9de7d",
            "ba525b62-9442-4823-a607-961f76f8b014"
          ],
          "display_name": true
        },
        {
          "uuid": "fc2ce71e-3375-4eab-a92d-813dbac2c7f5",
          "name": "AMINOPYRALID [ISO]",
          "stdName": "AMINOPYRALID [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e76f0df-8259-4501-847f-cede374c3fe8",
            "2b06e384-47ed-4096-bc7c-33073cb9de7d"
          ],
          "display_name": false
        },
        {
          "uuid": "24c7fd5d-58db-94ca-26f9-c855fa215767",
          "name": "AMINOPYRALID [MI]",
          "stdName": "AMINOPYRALID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54a651f5-e86c-6335-4bfa-efa68ecc5897"
          ],
          "display_name": false
        },
        {
          "uuid": "a0a9f7a9-84e2-4037-9b6e-1e6996acc39f",
          "name": "MILESTONE (AMINOPYRALID HERBICIDE)",
          "stdName": "MILESTONE (AMINOPYRALID HERBICIDE)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d506c36-4983-40c9-8b4a-54bbc1877c7f",
            "2b06e384-47ed-4096-bc7c-33073cb9de7d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aa5b1c77-6577-4a24-9a39-a2deaea9e9b4",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3fe6bca5-d317-42bd-ba4f-c849735c4bee",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "525afbae-6925-430a-b658-d2174ef57649",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ca9de75-5eff-4dee-aeef-2bb2859d85c5",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e76f0df-8259-4501-847f-cede374c3fe8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b06e384-47ed-4096-bc7c-33073cb9de7d",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d506c36-4983-40c9-8b4a-54bbc1877c7f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74688d63-2dc3-4523-bdf2-d078312648f6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "886deeec-5fe3-47bc-ab3b-593275d97e9e",
          "citation": "SRS import [9S4EMJ60LF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9S4EMJ60LF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6f1acf6-99b8-43ba-b7e2-0200aae4d919",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba525b62-9442-4823-a607-961f76f8b014",
          "citation": "AMINOPYRALID [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1acf22b-4d8d-ef08-1345-66e362ba4cc5",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+150114-71-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bac250bc-ee88-f93c-579e-a767783e2284",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=150114-71-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4bcb6685-6e9b-46dd-85a6-f111f505164a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "96cbebe2-a51b-b732-a169-6dcd67cccb72",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "54a651f5-e86c-6335-4bfa-efa68ecc5897",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true
        },
        {
          "uuid": "548653a6-c669-4b3b-c580-23a6c30b255a",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ecd8243e-bbb1-49da-9e39-b141d7f3e42b",
          "id": "ecd8243e-bbb1-49da-9e39-b141d7f3e42b",
          "molfile": "\n  Marvin  01132112152D          \n\n 12 12  0  0  0  0            999 V2000\n    6.4541   -6.3997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4541   -5.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7404   -5.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7404   -4.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0254   -3.9260    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4521   -3.9254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1712   -4.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8764   -3.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5928   -4.3276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8764   -3.0951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1712   -5.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8820   -5.5739    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 11  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 11  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
          "smiles": "c1c(c(c(C(=O)O)nc1Cl)Cl)N",
          "formula": "C6H4Cl2N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1e0d3b56-6b09-4b2c-bc5f-d513b0a6b396"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "207.0143",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "53b8165a-6508-44a7-9fd0-4715ddfce58a",
      "version": "8",
      "structure": {
        "id": "da52625e-bdfb-46ba-b457-17b0d63149e1",
        "molfile": "\n  Marvin  01132111192D          \n\n 12 12  0  0  0  0            999 V2000\n    5.7404   -4.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4521   -3.9254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1712   -4.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1712   -5.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4541   -5.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4541   -6.3997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7404   -5.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8820   -5.5739    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.8764   -3.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5928   -4.3276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8764   -3.0951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0254   -3.9260    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  1  7  2  0  0  0  0\n  4  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  1 12  1  0  0  0  0\nM  END",
        "smiles": "c1c(c(c(C(=O)O)nc1Cl)Cl)N",
        "formula": "C6H4Cl2N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "207.0143",
        "optical_activity": "NONE",
        "references": [
          "f6f1acf6-99b8-43ba-b7e2-0200aae4d919",
          "886deeec-5fe3-47bc-ab3b-593275d97e9e"
        ],
        "stereo_centers": 0
      },
      "unii": "9S4EMJ60LF"
    }
  ]
}