{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3b4e6fc6-f87e-4579-ae27-1452c2450338",
          "code": "74016-19-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74016-19-6",
          "code_system": "CAS",
          "references": [
            "7daec13a-9359-4799-a24b-be0b01cb7e72",
            "43bfa75d-4189-4685-94e5-1a9e9be9c6f1"
          ]
        },
        {
          "uuid": "2dc02cd2-fddd-4e62-b735-f9a6d6d79320",
          "code": "268-706-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.062.442",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7daec13a-9359-4799-a24b-be0b01cb7e72"
          ]
        },
        {
          "uuid": "a7d4dba4-4a59-4df7-97ab-45673a20f541",
          "code": "6437428",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6437428",
          "code_system": "PUBCHEM",
          "references": [
            "7daec13a-9359-4799-a24b-be0b01cb7e72"
          ]
        },
        {
          "uuid": "28129334-33c1-48ab-8189-32ab126d9ce2",
          "code": "9S0375G501",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "730374f9-f762-8271-62c5-42cf5a10353d",
          "code": "DTXSID901202977",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901202977",
          "code_system": "EPA CompTox",
          "references": [
            "e56f5baa-d5bc-52df-12af-a921ed1b0a63"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "894d9963-84c7-407e-8fce-07a3e95cce22",
          "name": "(E)-2-(3,7-DIMETHYL-2,6-OCTADIENYL)CYCLOPENTANONE [FHFI]",
          "stdName": "(E)-2-(3,7-DIMETHYL-2,6-OCTADIENYL)CYCLOPENTANONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c51031cf-f152-4f14-95e6-c3caf3b2af0c",
            "8096ac26-7409-450b-bce1-8cb2c40c026d"
          ],
          "display_name": false
        },
        {
          "uuid": "035b031d-9fd0-4fca-85c8-b2756e8af041",
          "name": "2-(3,7-DIMETHYL-2,6-OCTADIENYL)CYCLOPENTANONE, (2E)-",
          "stdName": "2-(3,7-DIMETHYL-2,6-OCTADIENYL)CYCLOPENTANONE, (2E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54ddc5e3-0692-47ec-a46a-e73fbceda320",
            "8096ac26-7409-450b-bce1-8cb2c40c026d"
          ],
          "display_name": true
        },
        {
          "uuid": "528649a0-cafa-410e-9a65-bad33a0ea18e",
          "name": "CYCLOPENTANONE, 2-(3,7-DIMETHYL-2,6-OCTADIENYL)-, (E)-",
          "stdName": "CYCLOPENTANONE, 2-(3,7-DIMETHYL-2,6-OCTADIENYL)-, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1191b9e-caa6-4aed-9ae3-b15fe8809998",
            "8096ac26-7409-450b-bce1-8cb2c40c026d"
          ],
          "display_name": false
        },
        {
          "uuid": "c72a9f09-16a8-510b-5b6f-3f0bc3170d08",
          "name": "FEMA NO. 3829, E-",
          "stdName": "FEMA NO. 3829, E-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a19176f-49ce-8c88-6c72-80bad7152157"
          ],
          "display_name": false
        },
        {
          "uuid": "c15d472d-67dc-4fed-a223-c39c482d85f7",
          "name": "GERANYLCYCLOPENTANONE",
          "stdName": "GERANYLCYCLOPENTANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8f06f21-8dd5-4e35-9fac-b2cfe3239d9e",
            "8096ac26-7409-450b-bce1-8cb2c40c026d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "54ddc5e3-0692-47ec-a46a-e73fbceda320",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8096ac26-7409-450b-bce1-8cb2c40c026d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1191b9e-caa6-4aed-9ae3-b15fe8809998",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8f06f21-8dd5-4e35-9fac-b2cfe3239d9e",
          "citation": "http://books.google.com/books?id=eW20PCXIqv8C&pg=PA393&lpg=PA393&dq=apritone+fema&source=bl&ots=X6ey",
          "url": "http://books.google.com/books?id=eW20PCXIqv8C&pg=PA393&lpg=PA393&dq=apritone+fema&source=bl&ots=X6ey",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c51031cf-f152-4f14-95e6-c3caf3b2af0c",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a8c64f2-33eb-42f0-9f4c-0ab478bbf36b",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7daec13a-9359-4799-a24b-be0b01cb7e72",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391123000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5feebeb6-ec59-4957-bbad-914ff6d12efe",
          "citation": "SRS import [9S0375G501]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9S0375G501",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391123000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43bfa75d-4189-4685-94e5-1a9e9be9c6f1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4a19176f-49ce-8c88-6c72-80bad7152157",
          "citation": "FEMA",
          "doc_type": "FEMA FLAVOR",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e56f5baa-d5bc-52df-12af-a921ed1b0a63",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "abed6da3-c3e5-41ae-8fdc-9203a66494fc",
          "id": "abed6da3-c3e5-41ae-8fdc-9203a66494fc",
          "molfile": "\n  Marvin  01132108552D          \n\n 16 16  0  0  0  0            999 V2000\n    2.8352   -3.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0085   -3.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3925   -2.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8005   -2.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4138   -3.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2058   -3.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7915   -3.7569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6403   -4.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5835   -3.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1886   -4.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9806   -3.8091    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.2446   -3.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0696   -3.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3226   -3.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6488   -4.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6488   -5.1071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/CC1CCCC1=O)/C)C",
          "formula": "C15H24O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b0139241-86e6-4f4e-a6c6-518b891fbf8d"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "220.351",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ff4f3ea4-f07a-4086-a4c9-e80db6eeb92f",
      "version": "5",
      "structure": {
        "id": "05175dcf-cbdb-4f0b-9238-d3bf97d0ec24",
        "molfile": "\n  Marvin  01132100342D          \n\n 16 16  0  0  0  0            999 V2000\n    2.8352   -3.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3925   -2.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0085   -3.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8005   -2.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4138   -3.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6403   -4.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2058   -3.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7915   -3.7569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0696   -3.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5835   -3.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6488   -5.1071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3226   -3.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2446   -3.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1886   -4.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6488   -4.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9806   -3.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 12  9  1  0  0  0  0\n  3  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  8  2  0  0  0  0\n 13  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 11  2  0  0  0  0\n 15 12  1  0  0  0  0\n 16 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/CC1CCCC1=O)/C)C",
        "formula": "C15H24O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "220.351",
        "optical_activity": "( + / - )",
        "references": [
          "5feebeb6-ec59-4957-bbad-914ff6d12efe",
          "c51031cf-f152-4f14-95e6-c3caf3b2af0c"
        ],
        "stereo_centers": 1
      },
      "unii": "9S0375G501"
    }
  ]
}