{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8dc96760-27eb-4718-a484-9a21d30aabdd",
          "code": "P01BE01",
          "comments": "ATC|ANTIPARASITIC PRODUCTS, INSECTICIDES AND REPELLENTS|ANTIPROTOZOALS|ANTIMALARIALS|Artemisinin and derivatives, plain|artemisinin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=P01BE01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "30dcfc92-60da-4f97-be6c-1bbc3cf0f727",
          "code": "C78093",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78093",
          "code_system": "NCI_THESAURUS",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "7f7d78c0-d104-4c14-98f1-41ef4854b2f7",
          "code": "63968-64-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=63968-64-9",
          "code_system": "CAS",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3",
            "73f14635-cad1-4751-98be-f671f66906b9"
          ]
        },
        {
          "uuid": "3bf2d765-d6e5-4a13-bd7c-f685077ac6c3",
          "code": "C031327",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67031327",
          "code_system": "MESH",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "69c1a1b4-5e03-4405-86f7-fc715bda987e",
          "code": "64",
          "comments": "LiverTox|Antimicrobial|Antimalarial|Artemisinin",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Artemisinin.htm",
          "code_system": "LIVERTOX",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "679d36b9-0320-4bee-b0ba-66978cc53df1",
          "code": "ARTEMISININ",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Artemisinin",
          "code_system": "WIKIPEDIA",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "d629d56e-d375-4f64-b051-d6845de367e9",
          "code": "SUB05575MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "624aaac1-7afa-479d-99fa-46bee5bb0a55",
          "code": "5954",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5954",
          "code_system": "INN",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "1c879b02-e6c1-41e1-9fc9-94384636d876",
          "code": "ARTEMISININ",
          "comments": "Description: Colourless needles or white crystalline powder. Solubility: Practically insoluble in water; very soluble in dichloromethane R; freely soluble in acetone R and ethyl acetate R; soluble in glacial acetic acid R, methanol R and ethanol (~750 g/L) TS. Category: Antimalarial. Storage: Artemisinin should be kept in a well-closed container and protected from light. Requirement: Artemisinin contains not less than 97.0% and not more than 102.0% of C15H22O5, calculated with reference to the dried substance.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.31.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "7fe2fc5f-843b-42bf-a952-4bb4a938a466",
          "code": "m2077",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2077?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "e3bcbf18-ac44-49f1-a193-ff3c2df5b377",
          "code": "CHEMBL567597",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL567597",
          "code_system": "ChEMBL",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "8cf49f56-f5c0-41df-bdd3-4cb62ae4922c",
          "code": "68827",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68827",
          "code_system": "PUBCHEM",
          "references": [
            "16cf43a6-ad36-4c70-9348-33690edef7b3"
          ]
        },
        {
          "uuid": "1d989dc3-c758-f599-0af8-4ee6cadca49b",
          "code": "DTXSID2040652",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2040652",
          "code_system": "EPA CompTox",
          "references": [
            "64f34579-16e7-23ea-d69d-bf9cd788c741"
          ]
        },
        {
          "uuid": "f6cc6952-11ce-d6b8-4151-de3f16a19edd",
          "code": "C277",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiparasitic Agent[C276]|Antiprotozoal Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C277",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e1d35020-b6d0-9392-a71c-82e8653accba"
          ]
        },
        {
          "uuid": "8a30f7e5-ba5c-4714-a68d-f49c70e078a8",
          "code": "9RMU91N5K2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3779341d-e641-7300-7ddd-1f8b27463043",
          "code": "2508 (Number of products:21)",
          "comments": "Dietary Supplement Label Database|chemical|Artemisinin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2508&item=Artemisinin",
          "code_system": "DSLD",
          "references": [
            "e1d35020-b6d0-9392-a71c-82e8653accba"
          ]
        },
        {
          "uuid": "25a266d1-c4c3-bf1a-0592-d95016b16c3e",
          "code": "2367409",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2367409/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "83e5a168-02ed-d513-13f3-2877d8d90b9b"
          ]
        },
        {
          "uuid": "2324e48a-d37d-8eb5-e12d-589ac57c9554",
          "code": "3871",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3871",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e1d35020-b6d0-9392-a71c-82e8653accba"
          ]
        },
        {
          "uuid": "2b64ee1f-dd81-a37b-f3ff-2311fc94f403",
          "code": "DB13132",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB13132",
          "code_system": "DRUG BANK",
          "references": [
            "e1d35020-b6d0-9392-a71c-82e8653accba"
          ]
        },
        {
          "uuid": "fddd8903-3ab7-6529-e853-0b785fca4007",
          "code": "1042747",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1042747",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e1d35020-b6d0-9392-a71c-82e8653accba"
          ]
        },
        {
          "uuid": "b4086a40-b6d2-7cba-5a1c-73f1f2d66513",
          "code": "223316",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:223316",
          "code_system": "CHEBI",
          "references": [
            "e1d35020-b6d0-9392-a71c-82e8653accba"
          ]
        },
        {
          "uuid": "aa2aacec-af5d-f413-cccd-896994fdc876",
          "code": "100000086624",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "104854d9-bd3b-ae49-d677-ea843ae23953"
          ]
        },
        {
          "uuid": "06d021b2-04dd-8798-057b-260a1d80a195",
          "code": "9RMU91N5K2",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9RMU91N5K2",
          "code_system": "DAILYMED",
          "references": [
            "751a0464-7b93-2a4b-d48f-8b6e31be64e3"
          ]
        },
        {
          "uuid": "0551314a-6cb9-d653-6fa9-310db8a5e359",
          "code": "369397",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=369397",
          "code_system": "NSC",
          "references": [
            "94fce1b0-d631-0982-bf1b-e24f691a0cfe"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a9572145-a223-4465-a277-dab56fcc9654",
          "amount": {
            "uuid": "7aee113f-1087-42f4-a39b-4043e030eab9"
          },
          "type": "DERIVATIVE->PARENT",
          "related_substance": {
            "uuid": "d6fc1948-c965-4115-a97c-33d14791f62f",
            "refuuid": "a6fba669-d19f-403b-ac10-1ab71ed0f4e3",
            "name": "Artenimol",
            "unii": "6A9O50735X",
            "linking_id": "6A9O50735X",
            "ref_pname": "Artenimol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "05edcdd4-2345-4409-ac11-e04ef5e03774",
          "amount": {
            "uuid": "6b6ad023-0d11-463a-8b60-a8d411d8f04f"
          },
          "type": "PARENT->IMPURITY",
          "references": [
            "69719026-c909-4c24-99e1-7eb7b8c3ee62"
          ],
          "related_substance": {
            "uuid": "b01369be-fab9-47c6-8f6c-2e7051b06d42",
            "refuuid": "a6fba669-d19f-403b-ac10-1ab71ed0f4e3",
            "name": "Artenimol",
            "unii": "6A9O50735X",
            "linking_id": "6A9O50735X",
            "ref_pname": "Artenimol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1dd84886-61cd-4786-b2a9-7f1bec652599",
          "amount": {
            "uuid": "9e338850-bdb2-4d20-ab02-70f1c8f55ed7"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "35c8a42e-97cc-2ea7-b77f-d92dba576fdb"
          ],
          "related_substance": {
            "uuid": "f6b242e2-09fe-4802-856e-4479c4863983",
            "refuuid": "b2eb8625-76cf-47e5-8f8b-ce9e1e29c6be",
            "name": "ARTEMISITENE",
            "unii": "2VXA86C8WY",
            "linking_id": "2VXA86C8WY",
            "ref_pname": "ARTEMISITENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "47a7aa8f-5bd2-4395-af24-a85633ede705",
          "amount": {
            "uuid": "ee468ed9-22c0-4dc6-8726-078fd3fb99bf"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "35c8a42e-97cc-2ea7-b77f-d92dba576fdb"
          ],
          "related_substance": {
            "uuid": "4fc1f64a-542e-4441-a1a7-5f2769168a8b",
            "refuuid": "89bd2c66-a9a8-4a4b-b064-3999a37e3232",
            "name": "9-EPIARTEMISININ",
            "unii": "0474Z7MDH1",
            "linking_id": "0474Z7MDH1",
            "ref_pname": "9-EPIARTEMISININ",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "171b3454-bf56-4cd3-9a11-fd40fb76b19a",
          "amount": {
            "uuid": "7947c499-39db-45a2-b352-a853613da0e1",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.5,
            "non_numeric_value": "peak area"
          },
          "comments": "In the chromatogram obtained with solution (1): the area of any peak corresponding to impurity B (artemisinin) is not greater than 0.5 times the area of the principal peak obtained with solution (4) (0.5%).",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "1d69a934-78bd-49f4-aefa-7cdb2c9cb0ee"
          ],
          "related_substance": {
            "uuid": "72f1041a-6b95-4be1-90e4-39839544dba1",
            "refuuid": "b53c36e8-a290-4eb4-b375-3d0c99f37c29",
            "name": "ARTESUNATE",
            "unii": "60W3249T9M",
            "linking_id": "60W3249T9M",
            "ref_pname": "ARTESUNATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8cf629d6-0b65-4d28-bf03-2f25f772f624",
          "amount": {
            "uuid": "890bda89-cede-415e-9677-8a1550505c6a"
          },
          "type": "METABOLITE ACTIVE->PRODRUG",
          "related_substance": {
            "uuid": "a3e3614d-4e1f-4101-929f-67fdc7911d66",
            "refuuid": "a6fba669-d19f-403b-ac10-1ab71ed0f4e3",
            "name": "Artenimol",
            "unii": "6A9O50735X",
            "linking_id": "6A9O50735X",
            "ref_pname": "Artenimol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "43e8a6de-1275-4d74-bb56-d87952c08b4f",
          "amount": {
            "uuid": "ee144319-9e07-4442-8db4-258ed686495e"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "30c4b126-fa66-4fc9-8260-1b730d8ef9a7",
            "refuuid": "a6fba669-d19f-403b-ac10-1ab71ed0f4e3",
            "name": "Artenimol",
            "unii": "6A9O50735X",
            "linking_id": "6A9O50735X",
            "ref_pname": "Artenimol",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d3e14e6b-091b-c6e2-a6c8-380de06a1d1d",
          "name": "(3R,5AS,6R,8AS,9R,12S,12AR)-3,6,9-TRIMETHYLOCTAHYDRO-3,12-EPOXYPYRANO(4,3-J )-1,2-BENZODIOXEPIN-10(3H)-ONE",
          "stdName": "(3R,5AS,6R,8AS,9R,12S,12AR)-3,6,9-TRIMETHYLOCTAHYDRO-3,12-EPOXYPYRANO(4,3-J )-1,2-BENZODIOXEPIN-10(3H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c8a42e-97cc-2ea7-b77f-d92dba576fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "eece13e5-c7ba-4d74-a551-3281db029d4a",
          "name": "(3R,5AS,6R,8AS,9R,12S,12AR)-OCTAHYDRO-3,6,9-TRIMETHYL-3,12-EPOXY-12H-PYRANO(4,3-J)-1,2-BENZODIOXEPIN-10(3H)-ONE",
          "stdName": "(3R,5AS,6R,8AS,9R,12S,12AR)-OCTAHYDRO-3,6,9-TRIMETHYL-3,12-EPOXY-12H-PYRANO(4,3-J)-1,2-BENZODIOXEPIN-10(3H)-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4253d54-cc64-43b3-9e5f-976d2ac5f835"
          ],
          "display_name": false
        },
        {
          "uuid": "0fe2fb0f-0b52-46d4-a045-411f6c9af764",
          "name": "ARTEMISININ",
          "stdName": "ARTEMISININ",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42486aca-4b82-42f1-8353-6611dcfd13b3",
            "d3638df5-7c85-4e19-ab54-22dc49cdb619",
            "11eee6b3-207a-4946-af4d-89d86d02b5de",
            "8cfbc455-fff3-4267-bb42-f4b2049b19d9",
            "abb27e2f-641e-46c3-bd59-85fb70d47c51",
            "c55cbe9f-cdff-42da-a44c-03c1b306895a",
            "a1122ead-f155-42bb-9de3-e6b1ca18977d",
            "18b972c1-22d2-4f82-b154-84b573742985",
            "2ada5458-5abd-40b1-9139-d984f3acc1f9",
            "dca93c8c-a464-4723-b290-9fa00dfbc729",
            "76862787-e624-4b9a-89c7-753ad6882347",
            "8e57d5e4-05e0-478b-a708-da4b644dfb67",
            "d4253d54-cc64-43b3-9e5f-976d2ac5f835",
            "d7d8639b-f0fd-47fc-ad7a-6cdeeec4f4c4",
            "378675e1-e3f0-41a1-ad78-08c4ec1fabdb",
            "7f7c7eba-ac10-4ee9-839e-f50640cf23b0"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "14ca5530-d42c-4465-8531-333e56b84de9",
              "name_org": "INN"
            },
            {
              "uuid": "515be5a1-52af-45df-bedd-77dde8d2d37f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5a5d9b2f-2496-4e71-b715-e9b818afb085",
          "name": "ARTEMISININ [MART.]",
          "stdName": "ARTEMISININ [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18b972c1-22d2-4f82-b154-84b573742985"
          ],
          "display_name": false
        },
        {
          "uuid": "c167fe90-ca0e-49ca-920d-38944fe40f84",
          "name": "ARTEMISININ [MI]",
          "stdName": "ARTEMISININ [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42486aca-4b82-42f1-8353-6611dcfd13b3",
            "11eee6b3-207a-4946-af4d-89d86d02b5de"
          ],
          "display_name": false
        },
        {
          "uuid": "d334014a-f548-4769-94c2-e76d33c42b5b",
          "name": "ARTEMISININ [USP-RS]",
          "stdName": "ARTEMISININ [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11eee6b3-207a-4946-af4d-89d86d02b5de",
            "c55cbe9f-cdff-42da-a44c-03c1b306895a"
          ],
          "display_name": false
        },
        {
          "uuid": "ab092a1c-aa50-4be4-a3d2-f49268731991",
          "name": "ARTEMISININ [WHO-IP]",
          "stdName": "ARTEMISININ [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11eee6b3-207a-4946-af4d-89d86d02b5de",
            "7f7c7eba-ac10-4ee9-839e-f50640cf23b0"
          ],
          "display_name": false
        },
        {
          "uuid": "384ebefa-4614-4bd6-a425-03c2a86b6a8b",
          "name": "ARTEMISININUM [WHO-IP LATIN]",
          "stdName": "ARTEMISININUM [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11eee6b3-207a-4946-af4d-89d86d02b5de",
            "7f7c7eba-ac10-4ee9-839e-f50640cf23b0"
          ],
          "display_name": false
        },
        {
          "uuid": "93181d7a-2cc9-8359-0b66-c31f8e7119fc",
          "name": "Artemisinin [WHO-DD]",
          "stdName": "ARTEMISININ [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed3df2d8-7e0f-88a4-3d98-7605f5601b21"
          ],
          "display_name": false
        },
        {
          "uuid": "33ec953a-8a94-4c54-9d7b-8a0587ed7955",
          "name": "GNF-PF-5341",
          "stdName": "GNF-PF-5341",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11eee6b3-207a-4946-af4d-89d86d02b5de",
            "df8a76d3-0cea-4b51-bb55-0101f3ca7531"
          ],
          "display_name": false
        },
        {
          "uuid": "7329eb89-b46b-428b-91b6-b8e0e236313a",
          "name": "HUANGHUAHAOSU",
          "stdName": "HUANGHUAHAOSU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f02f5b01-6898-4c10-ac9e-58a1c7d4f8bb",
            "11eee6b3-207a-4946-af4d-89d86d02b5de"
          ],
          "display_name": false
        },
        {
          "uuid": "b0378689-e0c1-4858-b398-7085d6321980",
          "name": "NSC-369397",
          "stdName": "NSC-369397",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f02f5b01-6898-4c10-ac9e-58a1c7d4f8bb",
            "11eee6b3-207a-4946-af4d-89d86d02b5de"
          ],
          "display_name": false
        },
        {
          "uuid": "124fe9e6-5c63-4a27-9101-d6b33eb606de",
          "name": "QING HAU SAU",
          "stdName": "QING HAU SAU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f02f5b01-6898-4c10-ac9e-58a1c7d4f8bb",
            "11eee6b3-207a-4946-af4d-89d86d02b5de"
          ],
          "display_name": false
        },
        {
          "uuid": "7919cec7-ca69-4fd6-920c-2430554752b8",
          "name": "artemisinin [INN]",
          "stdName": "ARTEMISININ [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7d8639b-f0fd-47fc-ad7a-6cdeeec4f4c4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d4253d54-cc64-43b3-9e5f-976d2ac5f835",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d7d8639b-f0fd-47fc-ad7a-6cdeeec4f4c4",
          "citation": "INN Proposed List 56",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL56.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "18b972c1-22d2-4f82-b154-84b573742985",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42486aca-4b82-42f1-8353-6611dcfd13b3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11eee6b3-207a-4946-af4d-89d86d02b5de",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e57d5e4-05e0-478b-a708-da4b644dfb67",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c55cbe9f-cdff-42da-a44c-03c1b306895a",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1122ead-f155-42bb-9de3-e6b1ca18977d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f02f5b01-6898-4c10-ac9e-58a1c7d4f8bb",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f7c7eba-ac10-4ee9-839e-f50640cf23b0",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df8a76d3-0cea-4b51-bb55-0101f3ca7531",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16cf43a6-ad36-4c70-9348-33690edef7b3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390760000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69719026-c909-4c24-99e1-7eb7b8c3ee62",
          "citation": "USP-MC",
          "url": "https://mc.usp.org/monographs/dihydroartemisinin-1-0",
          "doc_type": "USP-MC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d69a934-78bd-49f4-aefa-7cdb2c9cb0ee",
          "citation": "THE INTERNATIONAL PHARMACOPOEIA FIFTH EDITION",
          "url": "http://apps.who.int/phint/en/p/docf/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c35123c-9d4c-418c-a1c7-3618c99cc1a2",
          "citation": "SRS import [9RMU91N5K2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9RMU91N5K2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390760000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ada5458-5abd-40b1-9139-d984f3acc1f9",
          "citation": "ARTEMISININ [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "378675e1-e3f0-41a1-ad78-08c4ec1fabdb",
          "citation": "ARTEMISININ [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dca93c8c-a464-4723-b290-9fa00dfbc729",
          "citation": "ARTEMISININ [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8cfbc455-fff3-4267-bb42-f4b2049b19d9",
          "citation": "ARTEMISININ [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "abb27e2f-641e-46c3-bd59-85fb70d47c51",
          "citation": "ARTEMISININ [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "76862787-e624-4b9a-89c7-753ad6882347",
          "citation": "ARTEMISININ [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d3638df5-7c85-4e19-ab54-22dc49cdb619",
          "citation": "ARTEMISININ [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64f34579-16e7-23ea-d69d-bf9cd788c741",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=63968-64-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "35c8a42e-97cc-2ea7-b77f-d92dba576fdb",
          "citation": "THE INTERNATIONAL PHARMACOPOEIA - SEVENTH EDITION, 2017",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "e1d35020-b6d0-9392-a71c-82e8653accba",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "73f14635-cad1-4751-98be-f671f66906b9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "83e5a168-02ed-d513-13f3-2877d8d90b9b",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "751a0464-7b93-2a4b-d48f-8b6e31be64e3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "94fce1b0-d631-0982-bf1b-e24f691a0cfe",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ed3df2d8-7e0f-88a4-3d98-7605f5601b21",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "104854d9-bd3b-ae49-d677-ea843ae23953",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0d18bc8e-9993-432d-819e-49165aed2abc",
          "id": "0d18bc8e-9993-432d-819e-49165aed2abc",
          "molfile": "\n  Marvin  01132100552D          \n\n 20 23  0  0  1  0            999 V2000\n    7.4153   -0.4812    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.1261   -0.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4153   -1.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7023   -1.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0480   -1.3078    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.2813   -1.7119    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.2772   -2.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5691   -1.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8527   -1.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5662   -0.4788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2844   -0.0688    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.0670    0.6048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5569    1.2789    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.1398    1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3861    1.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9301    0.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7836   -0.0024    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.0503   -0.3971    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.6396    0.3791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3268    0.6872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 17  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  1  0  0  0\n  5  6  1  0  0  0  0\n 18  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 18  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 13 20  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  1  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@H]3[C@]42[C@H]1CC[C@](C)(O3)OO4",
          "formula": "C15H22O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7fbe9dbc-dc8a-4ce8-8945-fe0da07ef0d2"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "282.3328",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bc7ee851-955d-4470-be22-6bcbac342d0e",
      "version": "27",
      "structure": {
        "id": "a40cc26c-c29c-4327-a098-8348c193ce76",
        "molfile": "\n  Marvin  01132108312D          \n\n 23 26  0  0  1  0            999 V2000\n    5.2844   -0.0688    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0670    0.6048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5569    1.2789    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.0503   -0.3971    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.3861    1.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7836   -0.0024    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9301    0.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5691   -1.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2813   -1.7119    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.5662   -0.4788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0480   -1.3078    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7023   -1.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4153   -1.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4153   -0.4812    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.2772   -0.8914    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2772   -2.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0477   -2.0575    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7932   -0.8705    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1261   -0.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8527   -1.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1398    1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3268    0.6872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6396    0.3791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  1 10  1  0  0  0  0\n  1 15  1  1  0  0  0\n 11 12  1  0  0  0  0\n  9 16  1  1  0  0  0\n 12 13  1  0  0  0  0\n 11 17  1  6  0  0  0\n 13 14  1  0  0  0  0\n  6 18  1  6  0  0  0\n 14  6  1  0  0  0  0\n 14 19  1  6  0  0  0\n  4 11  1  0  0  0  0\n  8 20  2  0  0  0  0\n  1  2  1  0  0  0  0\n  3 21  1  0  0  0  0\n  5  7  1  0  0  0  0\n  3 22  1  6  0  0  0\n  6  7  1  0  0  0  0\n 22 23  1  0  0  0  0\n  4 23  1  6  0  0  0\nM  END",
        "smiles": "C[C@@H]1CC[C@@]2([H])[C@@H](C)C(=O)O[C@@]3([H])[C@]42[C@@]1([H])CC[C@](C)(O3)OO4",
        "formula": "C15H22O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "282.3328",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "1c35123c-9d4c-418c-a1c7-3618c99cc1a2",
          "d4253d54-cc64-43b3-9e5f-976d2ac5f835",
          "d7d8639b-f0fd-47fc-ad7a-6cdeeec4f4c4"
        ],
        "stereo_centers": 7
      },
      "unii": "9RMU91N5K2"
    }
  ]
}