{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8b6bd672-738e-45a5-ba66-4984b8d5caac",
          "code": "51576-04-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51576-04-6",
          "code_system": "CAS",
          "references": [
            "4dd19ae4-b5f7-8e29-f795-c066100f6067"
          ]
        },
        {
          "uuid": "cb672718-b7d6-4977-bdc8-63fab3e91cfa",
          "code": "854025",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/854025",
          "code_system": "PUBCHEM",
          "references": [
            "6ef391d5-23a9-b776-f590-f96520b9a986"
          ]
        },
        {
          "uuid": "a5629969-b70a-4dc4-ac07-07f99a2053b4",
          "code": "9R3ZO89OD8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1acbbcea-5962-ff17-dc0a-f5705f829dd6",
          "code": "DTXSID20357528",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20357528",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "401bc169-b6cc-ab7f-96de-b6102934ec62",
          "name": "(2S,3S)-2-HYDROXY-3-METHYLPENTANOIC ACID",
          "stdName": "(2S,3S)-2-HYDROXY-3-METHYLPENTANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dd19ae4-b5f7-8e29-f795-c066100f6067"
          ],
          "display_name": false
        },
        {
          "uuid": "76546fa7-36fe-b19f-2341-83e84461bfdc",
          "name": "L-ISOLEUCIC ACID",
          "stdName": "L-ISOLEUCIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dd19ae4-b5f7-8e29-f795-c066100f6067"
          ],
          "display_name": false
        },
        {
          "uuid": "866312cb-c478-59d7-ecfa-0352fa059006",
          "name": "PENTANOIC ACID, 2-HYDROXY-3-METHYL-, (2S,3S)-",
          "stdName": "PENTANOIC ACID, 2-HYDROXY-3-METHYL-, (2S,3S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dd19ae4-b5f7-8e29-f795-c066100f6067"
          ],
          "display_name": false
        },
        {
          "uuid": "4e0478ad-381b-3def-9214-113d8094159f",
          "name": "PENTANOIC ACID, 2-HYDROXY-3-METHYL-, (S-(R*,R*))-",
          "stdName": "PENTANOIC ACID, 2-HYDROXY-3-METHYL-, (S-(R*,R*))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dd19ae4-b5f7-8e29-f795-c066100f6067"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "44157219-760a-4dd2-bd44-8d71175aa76e",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4dd19ae4-b5f7-8e29-f795-c066100f6067",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "6ef391d5-23a9-b776-f590-f96520b9a986",
          "citation": "PUBCHEM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c5d21e15-a35b-981a-8cca-7a2fc4381b1b",
          "id": "c5d21e15-a35b-981a-8cca-7a2fc4381b1b",
          "molfile": "\n  Marvin  01132110142D          \n\n  9  8  0  0  1  0            999 V2000\n   14.9053   -3.8638    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   14.9053   -3.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1907   -4.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4763   -3.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -4.2763    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   15.6197   -5.1013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -3.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0487   -4.2763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -3.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  END",
          "smiles": "CC[C@H](C)[C@@H](C(=O)O)O",
          "formula": "C6H12O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "014fe3ff-160b-4484-868e-e997ab941ee5"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "132.1579",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "73961b63-7f74-42d2-a02b-4e18966ec0c4",
      "version": "11",
      "structure": {
        "id": "ca96e51e-5cdc-4e90-9260-97e70d737485",
        "molfile": "2-HYDROXY-3-METHYLVALERIC ACID, (2R,3R)-\n  Marvin  01132110282D          \n\n  9  8  0  0  1  0            999 V2000\n   13.4763   -3.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1907   -4.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9053   -3.8638    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.6197   -4.2763    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.3342   -3.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0487   -4.2763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -3.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -5.1013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9053   -3.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  4  8  1  1  0  0  0\n  3  9  1  6  0  0  0\nM  END",
        "smiles": "CC[C@H](C)[C@@H](C(=O)O)O",
        "formula": "C6H12O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "132.1579",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "44157219-760a-4dd2-bd44-8d71175aa76e",
          "4dd19ae4-b5f7-8e29-f795-c066100f6067"
        ],
        "stereo_centers": 2
      },
      "unii": "9R3ZO89OD8"
    }
  ]
}