{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "320ef1e9-ef8e-4d2e-b572-689635b26525",
          "code": "847249-63-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=847249-63-2",
          "code_system": "CAS",
          "references": [
            "5615185c-716f-4278-aa89-033f26bf1113",
            "f107f365-3a68-4646-be3b-dc4e96582b50"
          ]
        },
        {
          "uuid": "26987677-7b44-4bfe-a4ca-12f973b80bd2",
          "code": "71587806",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587806",
          "code_system": "PUBCHEM",
          "references": [
            "5615185c-716f-4278-aa89-033f26bf1113"
          ]
        },
        {
          "uuid": "914522e5-07a7-42f1-aa0a-5da4416dee0e",
          "code": "9R3048OM6V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "66758982-6fc6-41cd-975e-3aa0cb8ee746",
          "name": "ADAMANTANYLCARBOXAMIDO METHYLHYDROXYLBENZAMIDE",
          "stdName": "ADAMANTANYLCARBOXAMIDO METHYLHYDROXYLBENZAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4582e3e8-7798-45bd-a51c-f07bc2f59b50",
            "58438905-bd81-47b4-8a5b-a2f56ee42609",
            "3a31c4e6-423f-44dc-85ca-94911c448c96"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "78b6c74f-c2c7-4c06-a06a-14ed90a321ea",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "94aaac08-4acd-488b-89e5-c0db858c6747",
          "name": "ECLATNOID AP153",
          "stdName": "ECLATNOID AP153",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58438905-bd81-47b4-8a5b-a2f56ee42609",
            "3a31c4e6-423f-44dc-85ca-94911c448c96"
          ],
          "display_name": false
        },
        {
          "uuid": "4e795460-67cf-47e0-b8d2-e8fa36e019e9",
          "name": "TRICYCLO(3.3.1.13,7)DECANE-1-CARBOXAMIDE, N-(4-((HYDROXYMETHYLAMINO)CARBONYL)PHENYL)-",
          "stdName": "TRICYCLO(3.3.1.13,7)DECANE-1-CARBOXAMIDE, N-(4-((HYDROXYMETHYLAMINO)CARBONYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fee0b660-14bf-43cf-9eda-af6a2d269c0b",
            "58438905-bd81-47b4-8a5b-a2f56ee42609"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3a31c4e6-423f-44dc-85ca-94911c448c96",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "58438905-bd81-47b4-8a5b-a2f56ee42609",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fee0b660-14bf-43cf-9eda-af6a2d269c0b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5615185c-716f-4278-aa89-033f26bf1113",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fbdf656-610b-4270-9596-6add69fc6e16",
          "citation": "SRS import [9R3048OM6V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9R3048OM6V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4582e3e8-7798-45bd-a51c-f07bc2f59b50",
          "citation": "ADAMANTANYLCARBOXAMIDO METHYLHYDROXYLBENZAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f107f365-3a68-4646-be3b-dc4e96582b50",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d187cb45-61cf-4391-b92d-6c0c2bc3e045",
          "id": "d187cb45-61cf-4391-b92d-6c0c2bc3e045",
          "molfile": "\n  Marvin  01132110502D          \n\n 24 27  0  0  0  0            999 V2000\n    8.3961   -3.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9903   -4.4017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4096   -5.1122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1654   -4.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7461   -3.6989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7596   -5.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9347   -5.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5289   -5.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9481   -6.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5424   -7.2828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7174   -7.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2982   -6.5800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3117   -8.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8433   -8.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3296   -9.8196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3224   -9.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7966   -8.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2769   -9.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7499   -8.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2829   -9.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2661   -8.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7906   -8.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7731   -6.5566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1789   -5.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 24  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 23  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 21  1  0  0  0  0\n 13 22  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 20 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 22 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "CN(C(=O)c1ccc(cc1)NC(=O)C23CC4CC(CC(C4)C2)C3)O",
          "formula": "C19H24N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "392e4d8d-3ea7-42ec-93bf-4e573a1043d1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "328.4062",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "3739da2b-dc15-4ba3-b340-83c34153374f",
      "version": "3",
      "structure": {
        "id": "98fd7b31-bd86-48a2-baf3-6775646bb041",
        "molfile": "\n  Marvin  01132107572D          \n\n 24 27  0  0  0  0            999 V2000\n    4.7174   -7.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2982   -6.5800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3117   -8.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7906   -8.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7966   -8.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3224   -9.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3296   -9.8196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2829   -9.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7499   -8.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2769   -9.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2661   -8.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8433   -8.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5424   -7.2828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9481   -6.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5289   -5.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9347   -5.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7596   -5.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1654   -4.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7461   -3.6989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9903   -4.4017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1789   -5.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7731   -6.5566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3961   -3.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4096   -5.1122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  5 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n  3 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n 12  3  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 17 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 14  2  0  0  0  0\n 20 23  1  0  0  0  0\n 20 24  1  0  0  0  0\nM  END",
        "smiles": "CN(C(=O)c1ccc(cc1)NC(=O)C23CC4CC(CC(C4)C2)C3)O",
        "formula": "C19H24N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "328.4062",
        "optical_activity": "NONE",
        "references": [
          "6fbdf656-610b-4270-9596-6add69fc6e16",
          "3a31c4e6-423f-44dc-85ca-94911c448c96"
        ],
        "stereo_centers": 0
      },
      "unii": "9R3048OM6V"
    }
  ]
}