{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3424a2b6-9fdb-44e1-95e4-27715972b3fe", "code": "40312-34-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=40312-34-3", "code_system": "CAS", "references": [ "9dfba42f-9cd1-4412-85ca-626c6046c839", "3bedcad7-bb58-40a2-90c8-057189277ace" ] }, { "uuid": "3d5f9ad3-a666-430a-bcff-0f163b5bb82f", "code": "855908", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/855908", "code_system": "PUBCHEM", "references": [ "9dfba42f-9cd1-4412-85ca-626c6046c839" ] }, { "uuid": "33fc600b-e788-9720-e8d9-f7eaf6ec599e", "code": "DTXSID20193322", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20193322", "code_system": "EPA CompTox", "references": [ "0940b27e-67e8-05fd-c8fe-4192808f3e3d" ] }, { "uuid": "c0176a73-6595-0d18-dd32-4ed3ad0b5d23", "code": "DB12919", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB12919", "code_system": "DRUG BANK", "references": [ "51b56ae3-984f-674a-8559-cca238d0943a" ] }, { "uuid": "cd2d510b-8db6-4a13-916d-59c5c5f01d98", "code": "9Q765ZIF8L", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "158ee92c-bf65-44a7-89ed-0785894bc505", "name": "T-62", "stdName": "T-62", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1880b346-a858-49aa-b150-06227501cc97", "28721f24-7eac-4add-b35b-a12105a6bb6e" ], "display_name": true } ], "references": [ { "uuid": "28721f24-7eac-4add-b35b-a12105a6bb6e", "citation": "CLINICAL TRIALS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "1880b346-a858-49aa-b150-06227501cc97", "citation": "CLINICALTRIALS", "doc_type": "CLINICALTRIALS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9dfba42f-9cd1-4412-85ca-626c6046c839", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389738000, "tags": [ "NOMEN" ] }, { "uuid": "eee3da49-3e58-47af-8be0-cfb4e5e88c27", "citation": "SRS import [9Q765ZIF8L]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9Q765ZIF8L", "doc_type": "SRS", "public_domain": true, "document_date": 1493389738000, "tags": [ "NOMEN" ] }, { "uuid": "3e6582aa-6027-4382-802c-56da99e9f7fb", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0940b27e-67e8-05fd-c8fe-4192808f3e3d", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=40312-34-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "51b56ae3-984f-674a-8559-cca238d0943a", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "3bedcad7-bb58-40a2-90c8-057189277ace", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d58770fd-934d-42f8-80c6-ed68bbcd0245", "id": "d58770fd-934d-42f8-80c6-ed68bbcd0245", "molfile": "\n Marvin 01132111042D \n\n 19 21 0 0 0 0 999 V2000\n 0.6955 0.9255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1295 0.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6145 1.5929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3991 1.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1136 1.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8280 1.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8280 0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1136 0.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3991 0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6145 0.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3595 -0.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9429 -1.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4374 -0.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0207 -0.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8176 -0.3702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0311 -1.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8280 -1.3807 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4478 -1.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6509 -1.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 10 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 9 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 19 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "C1CCc2c(C1)c(C(=O)c3ccc(cc3)Cl)c(N)s2", "formula": "C15H14ClNOS", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "422de7d3-08db-4e0d-8539-7254bea28abf" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "291.7973", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b516baea-f124-46ad-957f-8e9bb765a436", "version": "4", "structure": { "id": "7213a636-417f-43e3-9850-b5b8e2130db1", "molfile": "\n Marvin 01132105552D \n\n 19 21 0 0 0 0 999 V2000\n -0.3595 -0.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9429 -1.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4374 -0.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0207 -0.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8176 -0.3702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0311 -1.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4478 -1.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6509 -1.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8280 -1.3807 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3991 1.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3991 0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6145 0.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1295 0.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6145 1.5929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1136 0.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8280 0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8280 1.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1136 1.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6955 0.9255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 3 8 2 0 0 0 0\n 6 9 1 0 0 0 0\n 1 3 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 10 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 10 18 1 0 0 0 0\n 11 15 1 0 0 0 0\n 13 19 1 0 0 0 0\n 1 12 1 0 0 0 0\nM END", "smiles": "C1CCc2c(C1)c(C(=O)c3ccc(cc3)Cl)c(N)s2", "formula": "C15H14ClNOS", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "291.7973", "optical_activity": "NONE", "references": [ "3e6582aa-6027-4382-802c-56da99e9f7fb", "eee3da49-3e58-47af-8be0-cfb4e5e88c27" ], "stereo_centers": 0 }, "unii": "9Q765ZIF8L" } ] }