{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e8852162-dd70-4b0e-940b-65dbf3b9caeb",
          "code": "CYCLOIONONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4484",
          "code_system": "JECFA EVALUATION",
          "references": [
            "a99316dc-cfc1-456a-bb46-466dfb211662"
          ]
        },
        {
          "uuid": "e84a1eca-0513-480c-b26b-9d90c515fa23",
          "code": "5552-30-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5552-30-7",
          "code_system": "CAS",
          "references": [
            "a99316dc-cfc1-456a-bb46-466dfb211662",
            "1d415516-065f-406b-972e-c0adeff3a477"
          ]
        },
        {
          "uuid": "c3ab827a-501d-418f-951f-494946a406c6",
          "code": "226-916-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.470",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a99316dc-cfc1-456a-bb46-466dfb211662"
          ]
        },
        {
          "uuid": "f8ce1719-42d7-4233-ac79-e81b57c5d7b6",
          "code": "110664",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/110664",
          "code_system": "PUBCHEM",
          "references": [
            "a99316dc-cfc1-456a-bb46-466dfb211662"
          ]
        },
        {
          "uuid": "3484625e-9c51-084b-285c-72a3a6b01942",
          "code": "DTXSID20863558",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20863558",
          "code_system": "EPA CompTox",
          "references": [
            "d6ccd22e-96bc-4b8e-de8c-221a3854a068"
          ]
        },
        {
          "uuid": "1d51f4eb-9117-4f66-8b1c-1d672c2c557b",
          "code": "9Q35X5W89M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "04fcb8da-e204-61c2-2f47-f00038f91f21",
          "code": "1248",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1248/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "55ded205-31b0-638e-3c7a-9fa9deba1b2d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e70af5f9-57a6-4bcd-bf32-2a1653c1355f",
          "name": "(±)-CYCLOIONONE",
          "stdName": "(+/-)-CYCLOIONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e95daad0-719c-474d-80d2-4a1fa3309914",
            "f18141be-a081-4d37-811e-63732994ec2f"
          ],
          "display_name": false
        },
        {
          "uuid": "65dc0f16-7fae-4adf-81e7-b8c05a766832",
          "name": "5H-1-BENZOPYRAN, 6,7,8,8A-TETRAHYDRO-2,5,5,8A-TETRAMETHYL-",
          "stdName": "5H-1-BENZOPYRAN, 6,7,8,8A-TETRAHYDRO-2,5,5,8A-TETRAMETHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f18141be-a081-4d37-811e-63732994ec2f",
            "aa1dd6f5-540f-4eef-9f44-dee0efc52970"
          ],
          "display_name": false
        },
        {
          "uuid": "e7b405e9-7cb9-472b-be67-4ce81782c6f8",
          "name": "6,7,8,8A-TETRAHYDRO-2,5,5,8A-TETRAMETHYL-5H-1-BENZOPYRAN",
          "stdName": "6,7,8,8A-TETRAHYDRO-2,5,5,8A-TETRAMETHYL-5H-1-BENZOPYRAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddf670fa-06fa-47c5-88fe-dc4ec6e26863",
            "f18141be-a081-4d37-811e-63732994ec2f"
          ],
          "display_name": false
        },
        {
          "uuid": "26b834e9-8989-48cb-b83b-c1acdace4461",
          "name": "CYCLOIONONE",
          "stdName": "CYCLOIONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f18141be-a081-4d37-811e-63732994ec2f",
            "53643135-d3c2-4e86-9e3e-abc6b9e1b76b",
            "391b4121-1ae0-416e-a094-b69c04e20f9e",
            "1fb637a6-c1e6-49aa-8ce2-6c318520beb6"
          ],
          "display_name": true
        },
        {
          "uuid": "2b6d1001-03d7-40f4-8b81-28ee05a821ce",
          "name": "CYCLOIONONE [FHFI]",
          "stdName": "CYCLOIONONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f18141be-a081-4d37-811e-63732994ec2f",
            "1fb637a6-c1e6-49aa-8ce2-6c318520beb6"
          ],
          "display_name": false
        },
        {
          "uuid": "db394da1-cd9d-470a-8b66-f4349459f9d2",
          "name": "CYCLOIONONE, (±)-",
          "stdName": "CYCLOIONONE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e95daad0-719c-474d-80d2-4a1fa3309914",
            "f18141be-a081-4d37-811e-63732994ec2f"
          ],
          "display_name": false
        },
        {
          "uuid": "d18f03de-442e-4c2d-93e5-596245e7b75b",
          "name": "FEMA NO. 3822",
          "stdName": "FEMA NO. 3822",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f18141be-a081-4d37-811e-63732994ec2f",
            "1fb637a6-c1e6-49aa-8ce2-6c318520beb6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "53643135-d3c2-4e86-9e3e-abc6b9e1b76b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f18141be-a081-4d37-811e-63732994ec2f",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fb637a6-c1e6-49aa-8ce2-6c318520beb6",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa1dd6f5-540f-4eef-9f44-dee0efc52970",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddf670fa-06fa-47c5-88fe-dc4ec6e26863",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e95daad0-719c-474d-80d2-4a1fa3309914",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a99316dc-cfc1-456a-bb46-466dfb211662",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391217000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82c7015e-2bff-44cb-8858-dece1bac3a1b",
          "citation": "SRS import [9Q35X5W89M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9Q35X5W89M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391217000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "391b4121-1ae0-416e-a094-b69c04e20f9e",
          "citation": "CYCLOIONONE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6ccd22e-96bc-4b8e-de8c-221a3854a068",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "1d415516-065f-406b-972e-c0adeff3a477",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "55ded205-31b0-638e-3c7a-9fa9deba1b2d",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8ca64f81-cd78-4ae5-b556-681b999991ea",
          "id": "8ca64f81-cd78-4ae5-b556-681b999991ea",
          "molfile": "\n  Marvin  01132107182D          \n\n 14 15  0  0  0  0            999 V2000\n    5.7755   -4.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0610   -3.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0610   -2.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3466   -2.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6321   -2.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9176   -2.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4479   -1.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3873   -1.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2031   -2.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2031   -3.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9176   -4.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6321   -3.6668    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.6321   -4.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3466   -4.0793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n 14  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n 12  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC=C2C(C)(C)CCCC2(C)O1",
          "formula": "C13H20O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8ac62ddd-e7a6-424c-aa34-63e9538d5608"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "192.2978",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "528102e0-8c66-4e69-8d65-ace980d65678",
      "version": "6",
      "structure": {
        "id": "02f9f8de-5911-40a0-8944-ee437b873ae3",
        "molfile": "\n  Marvin  01132100282D          \n\n 14 15  0  0  0  0            999 V2000\n    2.2031   -2.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9176   -2.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6321   -2.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6321   -3.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9176   -4.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2031   -3.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3466   -2.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0610   -2.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0610   -3.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3466   -4.0793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7755   -4.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6321   -4.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4479   -1.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3873   -1.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  3  7  2  0  0  0  0\n  9 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n  2 14  1  0  0  0  0\nM  END",
        "smiles": "CC1=CC=C2C(C)(C)CCCC2(C)O1",
        "formula": "C13H20O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "192.2978",
        "optical_activity": "( + / - )",
        "references": [
          "82c7015e-2bff-44cb-8858-dece1bac3a1b",
          "1fb637a6-c1e6-49aa-8ce2-6c318520beb6"
        ],
        "stereo_centers": 1
      },
      "unii": "9Q35X5W89M"
    }
  ]
}