{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8cb98d95-e333-4f2d-b6ff-5ebe25a9b288",
          "code": "3704-09-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3704-09-4",
          "code_system": "CAS",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf",
            "40c4af6f-f877-4e29-9f6d-617820dedbcf"
          ]
        },
        {
          "uuid": "688d04ea-762c-42f6-86c4-510cc9042753",
          "code": "C100075",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67100075",
          "code_system": "MESH",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "f064e483-9697-4187-ac01-8648d9e3846b",
          "code": "MIBOLERONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mibolerone",
          "code_system": "WIKIPEDIA",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "051d2bba-588a-4007-90c9-bb741a7b11c3",
          "code": "SUB08941MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "27056f00-d198-4a38-a7a0-9d9dd26fab4d",
          "code": "3203",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3203",
          "code_system": "INN",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "cdbd7375-ef62-46dc-b24c-8e1265da4358",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "ab4e8fc9-c091-440d-8ea7-13fae7ca21b6",
          "code": "C72100",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72100",
          "code_system": "NCI_THESAURUS",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "fee7726d-4e95-4f60-80f0-268c53777061",
          "code": "m7523",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7523?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "450da6a7-c5be-4e71-82be-02f95198b71a",
          "code": "21 CFR 520.1430",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.1430 Mibolerone.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.1430",
          "code_system": "CFR",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "76b0160a-e2d6-4676-a1fb-d5b036b8d5d0",
          "code": "CHEMBL425863",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL425863",
          "code_system": "ChEMBL",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "d4ed328e-556b-4c20-81f1-b920d46963b9",
          "code": "223-046-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.951",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "3603f094-1c12-4cee-8e45-18138e6c0c49",
          "code": "251636",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/251636",
          "code_system": "PUBCHEM",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "d01753da-d101-453c-a891-0138a3df8fed",
          "code": "21 CFR 558.348",
          "comments": "PART 558--NEW ANIMAL DRUGS FOR USE IN ANIMAL FEEDS|Subpart B--Specific New Animal Drugs for Use in Animal Feeds|Sec. 558.348 Mibolerone.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=558.348",
          "code_system": "CFR",
          "references": [
            "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf"
          ]
        },
        {
          "uuid": "91a38617-9bfc-31a4-c1e6-1ec47b5feccf",
          "code": "DTXSID4036489",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4036489",
          "code_system": "EPA CompTox",
          "references": [
            "64ca5b6d-c92e-f55c-019c-bf8677c0a357"
          ]
        },
        {
          "uuid": "17348325-a2b1-2ab3-7eb6-4b74b2752ca4",
          "code": "C243",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Therapeutic Androgen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C243",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8661472f-88de-7e6d-6941-5200e0d3fa1a"
          ]
        },
        {
          "uuid": "e6a19106-5ab9-4cae-aee0-d9a788670597",
          "code": "9OGY4BOR8D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4309c72b-67d5-f275-8add-185465e7b404",
          "code": "DB11429",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11429",
          "code_system": "DRUG BANK",
          "references": [
            "8661472f-88de-7e6d-6941-5200e0d3fa1a"
          ]
        },
        {
          "uuid": "90dc593f-5999-3cc4-c948-82a3602c0ed7",
          "code": "34849",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34849",
          "code_system": "CHEBI",
          "references": [
            "8661472f-88de-7e6d-6941-5200e0d3fa1a"
          ]
        },
        {
          "uuid": "74965385-149f-e50d-4559-7b202c9ec3c8",
          "code": "Designer-drugs-Mibolerone",
          "comments": "Wikipedia|List of designer drugs|Androgens|Estranes",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "8661472f-88de-7e6d-6941-5200e0d3fa1a"
          ]
        },
        {
          "uuid": "a8f45bd8-e91c-72ae-d6fb-1626198e519b",
          "code": "1443362",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1443362",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "8661472f-88de-7e6d-6941-5200e0d3fa1a"
          ]
        },
        {
          "uuid": "85ae2a81-75aa-b5b8-6f7c-d6561330792b",
          "code": "72260",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=72260",
          "code_system": "NSC",
          "references": [
            "4e951334-511f-4790-181c-7f9d717a7fa0"
          ]
        },
        {
          "uuid": "7b6bdcac-87de-1986-6fef-e013a3ac4721",
          "code": "100000081184",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "169724e3-940a-8ab7-c8f6-9f7b0d41e18c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "53bca4e5-c3c3-4649-a766-deca56796487",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "dd3f2186-7c50-4eb8-822e-22286aeb1ea1",
            "refuuid": "598134c2-1d79-46cb-acd2-0d232978cf0f",
            "name": "MIBOLERONE",
            "unii": "9OGY4BOR8D",
            "linking_id": "9OGY4BOR8D",
            "ref_pname": "MIBOLERONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "44e6b654-7e0f-4776-a087-2e50a5f62376",
          "name": "17β-Hydroxy-7α,17-dimethylestr-4-en-3-one",
          "stdName": "17.BETA.-HYDROXY-7.ALPHA.,17-DIMETHYLESTR-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27f99ab0-8dde-462d-b1f9-df6d28ddf5e9"
          ],
          "display_name": false
        },
        {
          "uuid": "ef044fbd-ec35-4a17-b5d7-67bc1e7a7c64",
          "name": "CHEQUE",
          "stdName": "CHEQUE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca6ca531-bb80-4d37-b705-147e37e4b6c6"
          ],
          "display_name": false
        },
        {
          "uuid": "bf6957c6-f8ec-4de5-b864-f4fc168116d5",
          "name": "CHEQUE DROPS",
          "stdName": "CHEQUE DROPS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce4844a4-ddf1-44d7-8edf-6fbfb720b369"
          ],
          "display_name": false
        },
        {
          "uuid": "9df29448-2420-470d-9971-fe843d0124e0",
          "name": "DIHYDROLONE",
          "stdName": "DIHYDROLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72a60b48-919f-4af9-889f-5859e14c5ab0"
          ],
          "display_name": false
        },
        {
          "uuid": "964f40f8-cf29-4ea9-a52a-fed9ce76e5f9",
          "name": "ESTR-4-EN-3-ONE, 17-HYDROXY-7,17-DIMETHYL-, (7.ALPHA.,17.BETA.)-",
          "stdName": "ESTR-4-EN-3-ONE, 17-HYDROXY-7,17-DIMETHYL-, (7.ALPHA.,17.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27f99ab0-8dde-462d-b1f9-df6d28ddf5e9"
          ],
          "display_name": false
        },
        {
          "uuid": "927c7a93-dc4d-4ba3-a538-70e42aad7585",
          "name": "MATENON",
          "stdName": "MATENON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca6ca531-bb80-4d37-b705-147e37e4b6c6"
          ],
          "display_name": false
        },
        {
          "uuid": "3ff1a431-0f97-43aa-addb-2a12899a7817",
          "name": "MIBOLERONE",
          "stdName": "MIBOLERONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1da248f-0092-42a1-97db-075178424c80",
            "f6f2504b-05b0-4f07-948c-8875c5da42ca",
            "779579e4-3c66-451d-adb8-1eea3ad6446f",
            "f8d548ff-b977-4aa4-8b0b-ae12aa90faeb",
            "04e3a4c8-c0dc-4564-a4a4-ae3cfaec3b11",
            "e52c718e-823c-4194-b30f-17076179751d",
            "e372b68e-0e28-4279-803c-9e6191585d60",
            "3a2d9032-da02-47b6-b04c-8879cb18e523",
            "142e15de-8d74-43e2-8f5b-4ac231df1f4a",
            "7edf7123-4f2a-456d-815c-76f8e1f08b2d",
            "dcfd4d59-2be4-46de-87f9-d81459902454",
            "85eeb9ab-a1c8-4d9b-89f1-4a18a46b0039",
            "cddbd722-becb-4f5d-a2e7-513e8ca62392"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "59a8f67b-3966-475d-992d-159715ff7a3c",
              "name_org": "INN"
            },
            {
              "uuid": "b12ba533-de56-4dd4-a0ba-56c4e647e274",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "0d9f27b5-e2d1-4892-8511-8ebdf875364f",
          "name": "MIBOLERONE CIII",
          "stdName": "MIBOLERONE CIII",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59b5f3e0-9ce3-4103-80cb-2fe3a73c4b22",
            "bb965c8e-858c-42ce-8755-95516560f268"
          ],
          "display_name": false
        },
        {
          "uuid": "6dd59a67-0483-4763-89b2-57962b86d28e",
          "name": "MIBOLERONE CIII [USP-RS]",
          "stdName": "MIBOLERONE CIII [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb965c8e-858c-42ce-8755-95516560f268"
          ],
          "display_name": false
        },
        {
          "uuid": "01ee5917-6ee5-45c4-9050-056d7e32ae1f",
          "name": "MIBOLERONE [GREEN BOOK]",
          "stdName": "MIBOLERONE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8d548ff-b977-4aa4-8b0b-ae12aa90faeb"
          ],
          "display_name": false
        },
        {
          "uuid": "57d2d46f-d9aa-4289-b4ed-96ea68b03389",
          "name": "MIBOLERONE [MART.]",
          "stdName": "MIBOLERONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cddbd722-becb-4f5d-a2e7-513e8ca62392"
          ],
          "display_name": false
        },
        {
          "uuid": "1df6d541-ba6f-47c8-974e-eff0e75bed72",
          "name": "MIBOLERONE [MI]",
          "stdName": "MIBOLERONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e372b68e-0e28-4279-803c-9e6191585d60"
          ],
          "display_name": false
        },
        {
          "uuid": "4da39481-47c9-43cb-a663-c18ece8a3b36",
          "name": "MIBOLERONE [USAN]",
          "stdName": "MIBOLERONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dcfd4d59-2be4-46de-87f9-d81459902454"
          ],
          "display_name": false
        },
        {
          "uuid": "45dbdac9-e879-9355-99c2-9d8f0d852f3d",
          "name": "MIBOLERONE [USP MONOGRAPH]",
          "stdName": "MIBOLERONE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d57e7b78-1882-f0ab-9c25-6c08a4d53cb8"
          ],
          "display_name": false
        },
        {
          "uuid": "013d96de-c5ed-44d5-9cc9-1072c710a951",
          "name": "NSC-72260",
          "stdName": "NSC-72260",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1766633b-423e-418a-b2c3-7288e59bd80c"
          ],
          "display_name": false
        },
        {
          "uuid": "23c0feb7-10af-4018-a1e7-5b602cb7fc7f",
          "name": "U-10,997",
          "stdName": "U-10,997",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1da248f-0092-42a1-97db-075178424c80"
          ],
          "display_name": false
        },
        {
          "uuid": "912b361b-79ac-4045-82ab-8e93da0f8e9e",
          "name": "U-10-997",
          "stdName": "U-10-997",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1da248f-0092-42a1-97db-075178424c80"
          ],
          "display_name": false
        },
        {
          "uuid": "3cabf30e-abc6-4340-a614-c0938e84f1da",
          "name": "U-10997",
          "stdName": "U-10997",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca6ca531-bb80-4d37-b705-147e37e4b6c6"
          ],
          "display_name": false
        },
        {
          "uuid": "f2ebf393-d226-4cef-9cde-c1d7c6a85161",
          "name": "mibolerone [INN]",
          "stdName": "MIBOLERONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6f2504b-05b0-4f07-948c-8875c5da42ca"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1da248f-0092-42a1-97db-075178424c80",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "27f99ab0-8dde-462d-b1f9-df6d28ddf5e9",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6f2504b-05b0-4f07-948c-8875c5da42ca",
          "citation": "INN Proposed List 27",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL27.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dcfd4d59-2be4-46de-87f9-d81459902454",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85eeb9ab-a1c8-4d9b-89f1-4a18a46b0039",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cddbd722-becb-4f5d-a2e7-513e8ca62392",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e372b68e-0e28-4279-803c-9e6191585d60",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8d548ff-b977-4aa4-8b0b-ae12aa90faeb",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce4844a4-ddf1-44d7-8edf-6fbfb720b369",
          "citation": "http://en.wikipedia.org/wiki/Mibolerone",
          "url": "http://en.wikipedia.org/wiki/Mibolerone",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72a60b48-919f-4af9-889f-5859e14c5ab0",
          "citation": "http://www.anasci.org/ebooks/USH%20II.pdf",
          "url": "http://www.anasci.org/ebooks/USH%20II.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca6ca531-bb80-4d37-b705-147e37e4b6c6",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb965c8e-858c-42ce-8755-95516560f268",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1766633b-423e-418a-b2c3-7288e59bd80c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "320e46b9-a4d0-41a9-ac4d-fb0fcb0ce9cf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18cb775d-53dc-4fd2-bb8e-9008bc3a3ce3",
          "citation": "SRS import [9OGY4BOR8D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9OGY4BOR8D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e52c718e-823c-4194-b30f-17076179751d",
          "citation": "MIBOLERONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "779579e4-3c66-451d-adb8-1eea3ad6446f",
          "citation": "MIBOLERONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a2d9032-da02-47b6-b04c-8879cb18e523",
          "citation": "MIBOLERONE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "142e15de-8d74-43e2-8f5b-4ac231df1f4a",
          "citation": "MIBOLERONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7edf7123-4f2a-456d-815c-76f8e1f08b2d",
          "citation": "MIBOLERONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "04e3a4c8-c0dc-4564-a4a4-ae3cfaec3b11",
          "citation": "MIBOLERONE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "59b5f3e0-9ce3-4103-80cb-2fe3a73c4b22",
          "citation": "MIBOLERONE CIII [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64ca5b6d-c92e-f55c-019c-bf8677c0a357",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3704-09-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8661472f-88de-7e6d-6941-5200e0d3fa1a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "40c4af6f-f877-4e29-9f6d-617820dedbcf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d57e7b78-1882-f0ab-9c25-6c08a4d53cb8",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "4e951334-511f-4790-181c-7f9d717a7fa0",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5a391ada-b4ae-ad58-73c1-7b252299cdd0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "169724e3-940a-8ab7-c8f6-9f7b0d41e18c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "da98245b-997a-4907-ba5b-68288e5d3a5b",
          "id": "da98245b-997a-4907-ba5b-68288e5d3a5b",
          "molfile": "\n  Marvin  01132111202D          \n\n 22 25  0  0  1  0            999 V2000\n    6.0519   -1.8592    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.8434   -2.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3176   -1.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8434   -0.7798    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.6667   -0.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8521    0.0436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0519   -1.0125    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8365   -0.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3361   -0.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6204   -1.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6204   -1.8592    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.9134   -2.2724    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.1918   -1.8592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4674   -2.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4674   -3.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7546   -3.5118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1918   -3.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9134   -3.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6204   -3.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3361   -3.0958    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.0491   -3.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3361   -2.2724    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n 22  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  1  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 22 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 18  1  6  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  6  0  0  0\n 22 20  1  6  0  0  0\nM  END",
          "smiles": "C[C@@H]1CC2=CC(=O)CC[C@@H]2[C@H]3CC[C@@]4(C)[C@@H](CC[C@]4(C)O)[C@H]13",
          "formula": "C20H30O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "282d0ef3-8fcd-401f-8881-99ad4707ba71"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "302.4518",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "598134c2-1d79-46cb-acd2-0d232978cf0f",
      "version": "20",
      "structure": {
        "id": "5fc35d57-9e3f-45a4-8297-f74564ba1458",
        "molfile": "\n  Marvin  01132104572D          \n\n 26 29  0  0  1  0            999 V2000\n    6.0554   -1.8603    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9156   -3.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0554   -1.0131    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6231   -1.8603    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3393   -2.2738    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.9156   -2.2738    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3393   -3.0976    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.1937   -3.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8474   -0.7802    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6231   -3.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3393   -0.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6231   -1.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8474   -2.1107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1937   -1.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4688   -3.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3218   -1.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7556   -3.5139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4688   -2.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8561    0.0436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8399   -0.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0526   -3.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6712   -0.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6231   -2.6842    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9127   -1.4498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0525   -2.6842    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3364   -1.4498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2 10  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 14  1  0  0  0  0\n  9 19  1  1  0  0  0\n  3 20  1  1  0  0  0\n  7 21  1  6  0  0  0\n  9 22  1  6  0  0  0\n  4 23  1  6  0  0  0\n  6 24  1  1  0  0  0\n  1 25  1  6  0  0  0\n  5 26  1  1  0  0  0\n 16  9  1  0  0  0  0\n  4 12  1  0  0  0  0\n  6  2  1  0  0  0  0\n 18 15  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1CC2=CC(=O)CC[C@]2([H])[C@@]3([H])CC[C@@]4(C)[C@@]([H])(CC[C@]4(C)O)[C@]13[H]",
        "formula": "C20H30O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "302.4518",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a1da248f-0092-42a1-97db-075178424c80",
          "18cb775d-53dc-4fd2-bb8e-9008bc3a3ce3",
          "f6f2504b-05b0-4f07-948c-8875c5da42ca"
        ],
        "stereo_centers": 7
      },
      "unii": "9OGY4BOR8D"
    }
  ]
}