{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3dd2bfae-f632-454d-bee2-3164109912fb", "code": "160535-46-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=160535-46-6", "code_system": "CAS", "references": [ "4268dbd7-6494-473f-8af5-0980903ecb44", "bdf892f1-7b7d-4afb-9840-c2f78ea49903" ] }, { "uuid": "62926bd3-5336-4caf-b120-60831217c618", "code": "850480-95-4", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=850480-95-4", "code_system": "CAS", "references": [ "4268dbd7-6494-473f-8af5-0980903ecb44", "eb165423-c187-4f5d-9879-d7d046887349" ] }, { "uuid": "69cec140-c8ab-4ec4-90bf-a5b5f60bde6f", "code": "FCN NO. 860", "comments": "FCN|CLARIFIER|POLYPROPYLENE POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=860", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "4268dbd7-6494-473f-8af5-0980903ecb44" ] }, { "uuid": "39d8341c-8bcb-40ec-a162-15b3063d7956", "code": "66687139", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66687139", "code_system": "PUBCHEM", "references": [ "4268dbd7-6494-473f-8af5-0980903ecb44" ] }, { "uuid": "a8337311-7480-41db-8dd0-4b4c27446eb2", "code": "9O7HDO4IAI", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "05d2d9b6-8e02-96f8-545a-3c6c14683a90", "code": "DTXSID60889035", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60889035", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "d5b8a239-e147-46db-b468-d51cdbae0001", "name": "1,2,3-PROPANETRICARBOXAMIDE, N,N',N''-TRIS(2-METHYLCYCLOHEXYL)-", "stdName": "1,2,3-PROPANETRICARBOXAMIDE, N,N',N''-TRIS(2-METHYLCYCLOHEXYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "98fa345f-45e1-47eb-bac1-8079457a25a9", "c46ade38-a143-4356-8619-da24746720ee" ], "display_name": false }, { "uuid": "57bd7855-ea9a-40fb-9eb0-374130414d7d", "name": "1,2,3-PROPANETRICARBOXAMIDE, N1,N2,N3-TRIS(2-METHYLCYCLOHEXYL)-", "stdName": "1,2,3-PROPANETRICARBOXAMIDE, N1,N2,N3-TRIS(2-METHYLCYCLOHEXYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "98fa345f-45e1-47eb-bac1-8079457a25a9", "c46ade38-a143-4356-8619-da24746720ee" ], "display_name": false }, { "uuid": "ffdf7056-e61d-4a3b-b350-d6df391ffcf9", "name": "1,2,3-PROPANETRICARBOXYLIC ACID TRIS(2-METHYLCYCLOHEXYLAMIDE)", "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID TRIS(2-METHYLCYCLOHEXYLAMIDE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "98fa345f-45e1-47eb-bac1-8079457a25a9", "c46ade38-a143-4356-8619-da24746720ee" ], "display_name": false }, { "uuid": "699dd0cb-9cc8-4f1b-b057-5dfc379f51cf", "name": "N,N',N''-TRIS(2-METHYLCYCLOHEXYL)-1,2,3-PROPANETRICARBOXAMIDE", "stdName": "N,N',N''-TRIS(2-METHYLCYCLOHEXYL)-1,2,3-PROPANETRICARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "98fa345f-45e1-47eb-bac1-8079457a25a9", "c46ade38-a143-4356-8619-da24746720ee" ], "display_name": false }, { "uuid": "bd998634-2367-45d2-bd35-9ef6232313a4", "name": "RIKACLEAR PC 1", "stdName": "RIKACLEAR PC 1", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "98fa345f-45e1-47eb-bac1-8079457a25a9", "c46ade38-a143-4356-8619-da24746720ee" ], "display_name": false }, { "uuid": "d3df1e62-c3e3-40e7-846a-3e798b6dc65e", "name": "TRICARBALLYLIC ACID TRIS(2-METHYLCYCLOHEXYLAMIDE)", "stdName": "TRICARBALLYLIC ACID TRIS(2-METHYLCYCLOHEXYLAMIDE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "98fa345f-45e1-47eb-bac1-8079457a25a9", "c46ade38-a143-4356-8619-da24746720ee" ], "display_name": true } ], "references": [ { "uuid": "98fa345f-45e1-47eb-bac1-8079457a25a9", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c46ade38-a143-4356-8619-da24746720ee", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4268dbd7-6494-473f-8af5-0980903ecb44", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392470000, "tags": [ "NOMEN" ] }, { "uuid": "ed380641-8843-4ee5-a922-d35e6f2acfb6", "citation": "SRS import [9O7HDO4IAI]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9O7HDO4IAI", "doc_type": "SRS", "public_domain": true, "document_date": 1493392470000, "tags": [ "NOMEN" ] }, { "uuid": "eb165423-c187-4f5d-9879-d7d046887349", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bdf892f1-7b7d-4afb-9840-c2f78ea49903", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "25efbdfd-ce87-175f-a49a-4dcee94b0c5b", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "26d99c4c-5603-4b2b-89c7-f3d9a5cd9ea7", "id": "26d99c4c-5603-4b2b-89c7-f3d9a5cd9ea7", "molfile": "\n Marvin 01132102082D \n\n 33 35 0 0 0 0 999 V2000\n 2.4631 -0.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1776 -0.8766 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.8920 -0.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6065 -0.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6065 -1.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8920 -2.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1776 -1.7016 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.1331 -2.3203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4186 -1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4186 -1.0828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7042 -2.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0103 -1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7248 -2.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4393 -1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4393 -1.0828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1537 -2.3203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1776 -1.7222 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -3.8920 -2.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6065 -1.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6065 -0.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8920 -0.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1776 -0.8972 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -2.4631 -0.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0103 -0.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7042 -0.1547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7248 -0.1547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7248 0.6703 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.0103 1.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0103 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7248 2.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4393 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4393 1.0828 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.1537 0.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 9 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 24 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 22 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 25 2 0 0 0 0\n 24 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 32 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 32 33 1 0 0 0 0\nM END", "smiles": "CC1CCCCC1NC(=O)CC(CC(=O)NC2CCCCC2C)C(=O)NC3CCCCC3C", "formula": "C27H47N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "16fe0b3f-d7c9-4fa8-9900-7d852bbce573" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "461.6814", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "144fc7f9-93ca-41b9-8e49-9a37c20630a9", "version": "4", "structure": { "id": "906229b7-e40c-4d28-a91a-0b2fade239a1", "molfile": "\n Marvin 01132107292D \n\n 33 35 0 0 0 0 999 V2000\n -0.7248 -2.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0103 -1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7042 -2.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4393 -1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4393 -1.0828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1537 -2.3203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0103 -0.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7042 -0.1547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7248 -0.1547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4186 -1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4186 -1.0828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1331 -2.3203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1776 -1.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1776 -0.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8920 -0.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6065 -0.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6065 -1.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8920 -2.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4631 -0.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7248 0.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4393 1.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4393 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7248 2.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0103 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0103 1.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1537 0.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1776 -1.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1776 -0.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8920 -0.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6065 -0.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6065 -1.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8920 -2.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4631 -0.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 1 4 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 2 7 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 3 10 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 13 18 1 0 0 0 0\n 14 19 1 0 0 0 0\n 12 13 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 20 25 1 0 0 0 0\n 21 26 1 0 0 0 0\n 9 20 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 27 32 1 0 0 0 0\n 28 33 1 0 0 0 0\n 6 27 1 0 0 0 0\nM END", "smiles": "CC1CCCCC1NC(=O)CC(CC(=O)NC2CCCCC2C)C(=O)NC3CCCCC3C", "formula": "C27H47N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "461.6814", "optical_activity": "UNSPECIFIED", "references": [ "98fa345f-45e1-47eb-bac1-8079457a25a9", "ed380641-8843-4ee5-a922-d35e6f2acfb6" ], "stereo_centers": 7 }, "unii": "9O7HDO4IAI" } ] }