{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "61d452a4-a088-4800-8b86-0e59488dd280",
          "code": "630121-95-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=630121-95-8",
          "code_system": "CAS",
          "references": [
            "03bb4a47-cb07-491c-a6b6-5bfcef519fdd",
            "af81d395-2dc3-4e74-9e7e-6e789d1207c1"
          ]
        },
        {
          "uuid": "f74bb448-93ea-4882-892c-11edb8eecbf7",
          "code": "71587774",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587774",
          "code_system": "PUBCHEM",
          "references": [
            "03bb4a47-cb07-491c-a6b6-5bfcef519fdd"
          ]
        },
        {
          "uuid": "5e0a2ac7-0946-f544-fda0-10309628ab7b",
          "code": "DTXSID10212238",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10212238",
          "code_system": "EPA CompTox",
          "references": [
            "b4ac1602-7505-7399-a521-1af59b65e5b5"
          ]
        },
        {
          "uuid": "efe65818-bb79-4337-a2cf-0c21a5cdc761",
          "code": "9O63KC5GG3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a89e9018-5404-4622-a753-b0b4e43d7685",
          "name": "L-TYROSINE, N-(1-OXODECYL)-, MONOPOTASSIUM SALT",
          "stdName": "L-TYROSINE, N-(1-OXODECYL)-, MONOPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1881f456-8a51-41a7-ba66-3254c1cfb43f",
            "f9c56ede-ce2c-46ad-98b8-673c82881d73"
          ],
          "display_name": false
        },
        {
          "uuid": "c3782a7a-a1e2-44da-be18-bd26ab64c6d0",
          "name": "L-TYROSINE, N-(1-OXODECYL)-, POTASSIUM SALT (1:1)",
          "stdName": "L-TYROSINE, N-(1-OXODECYL)-, POTASSIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1881f456-8a51-41a7-ba66-3254c1cfb43f",
            "f9c56ede-ce2c-46ad-98b8-673c82881d73"
          ],
          "display_name": false
        },
        {
          "uuid": "5a0512f2-ee13-4b1e-ab80-c3c9174f6369",
          "name": "POTASSIUM CAPROYL TYROSINE",
          "stdName": "POTASSIUM CAPROYL TYROSINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f610b123-41f6-4962-9188-bb0cabec7e2f",
            "f9c56ede-ce2c-46ad-98b8-673c82881d73",
            "5b77fb6c-708c-468e-932b-6b11e60cd242"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0109fe64-4d43-4b6f-be9b-3cf9ebac1ac4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9557cd5c-2b03-46be-b810-d0ed3ad729ac",
          "name": "TYROSTAN",
          "stdName": "TYROSTAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f610b123-41f6-4962-9188-bb0cabec7e2f",
            "f9c56ede-ce2c-46ad-98b8-673c82881d73"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f610b123-41f6-4962-9188-bb0cabec7e2f",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f9c56ede-ce2c-46ad-98b8-673c82881d73",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1881f456-8a51-41a7-ba66-3254c1cfb43f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03bb4a47-cb07-491c-a6b6-5bfcef519fdd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391547000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd07279e-4c28-4813-8e18-f62495ffdc40",
          "citation": "SRS import [9O63KC5GG3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9O63KC5GG3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391547000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b77fb6c-708c-468e-932b-6b11e60cd242",
          "citation": "POTASSIUM CAPROYL TYROSINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b4ac1602-7505-7399-a521-1af59b65e5b5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=630121-95-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "af81d395-2dc3-4e74-9e7e-6e789d1207c1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a018f754-908c-480c-8203-8e7bf18ff8a9",
          "id": "a018f754-908c-480c-8203-8e7bf18ff8a9",
          "molfile": "\n  Marvin  01132108192D          \n\n  1  0  0  0  1  0            999 V2000\n    1.4737   -2.6179    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2f8d5fd4-dadb-49c2-b091-d73da01443ff"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "11e433fa-0d65-4e8f-b67d-6bb1e7f341db",
          "id": "11e433fa-0d65-4e8f-b67d-6bb1e7f341db",
          "molfile": "\n  Marvin  01132101092D          \n\n 24 24  0  0  1  0            999 V2000\n    4.6614   -4.9004    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.9470   -4.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2325   -4.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5180   -4.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8035   -4.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8035   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0891   -6.1379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5180   -6.1379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2325   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3759   -4.4879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3759   -3.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6614   -3.2504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0904   -3.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0904   -2.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8049   -2.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8049   -1.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5193   -0.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5193    0.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2338    0.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2338    1.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9483    1.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6614   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9470   -6.1379    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.3759   -6.1379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  6  0  0  0\n  1 22  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\nM  CHG  1  23  -1\nM  END",
          "smiles": "CCCCCCCCCC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)[O-]",
          "formula": "C19H28NO4",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f7cf0403-1125-4eea-b92f-0d9e10d33635"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "334.4306",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "33588145-4353-43f7-915f-26dd9af22bde",
      "version": "5",
      "structure": {
        "id": "ce15f836-cd2d-4e69-93e9-b9aa64bcfa23",
        "molfile": "\n  Marvin  01132110392D          \n\n 25 24  0  0  1  0            999 V2000\n    1.4737   -2.6179    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n    3.9470   -4.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2325   -4.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5180   -4.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8035   -4.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8035   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0891   -6.1379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5180   -6.1379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2325   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6614   -4.9004    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3759   -4.4879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3759   -3.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6614   -3.2504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0904   -3.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0904   -2.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8049   -2.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8049   -1.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5193   -0.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5193    0.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2338    0.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2338    1.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9483    1.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6614   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9470   -6.1379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3759   -6.1379    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n  3  9  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 10 23  1  6  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\nM  CHG  2   1   1  25  -1\nM  END",
        "smiles": "CCCCCCCCCC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)[O-].[K+]",
        "formula": "C19H28NO4.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "373.5289",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "dd07279e-4c28-4813-8e18-f62495ffdc40",
          "1881f456-8a51-41a7-ba66-3254c1cfb43f"
        ],
        "stereo_centers": 1
      },
      "unii": "9O63KC5GG3"
    }
  ]
}