{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "13672bdc-55cf-402b-b187-935d97226014", "code": "1334583-93-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1334583-93-5", "code_system": "CAS", "references": [ "5ea1b80c-da00-4adf-9481-a12fc0c0a52c", "3bb2ee47-fe8b-4075-bd24-e10e4a840339" ] }, { "uuid": "7e15dded-871f-4b92-a027-4868afc70fb1", "code": "72942020", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72942020", "code_system": "PUBCHEM", "references": [ "5ea1b80c-da00-4adf-9481-a12fc0c0a52c" ] }, { "uuid": "08c3c0bb-2def-4674-a109-14181208a3c7", "code": "9O32SH1GPH", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f9c8f565-2b75-df06-6a07-3209254bed2a", "code": "2586022", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2586022/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "64b9f477-1d04-0d74-0b4f-f241fd0128ca" ] }, { "uuid": "42dbd75f-dbd1-bc93-12c3-c3e0bc4210a1", "code": "9O32SH1GPH", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9O32SH1GPH", "code_system": "DAILYMED", "references": [ "bd9e9f9f-bc94-4883-0ffe-ce7597dde661" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7b658df9-5a70-4afa-9648-bf0a50dce8c8", "name": "ACETYLARGINYLTRYPTOPHYL DIPHENYLGLYCINE", "stdName": "ACETYLARGINYLTRYPTOPHYL DIPHENYLGLYCINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "df7ff4c4-cdd9-4951-a597-0a7534883a04", "a1d3b729-9a42-4e2f-9079-9fdd0ebeabd9", "f1430e91-c836-456d-ba2e-44700b4dcddd", "75b95a2a-3e82-4f79-bc60-5dab70727625" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "0216b058-845e-4298-8dae-57e74e93ec82", "name_org": "INCI" } ] }, { "uuid": "ca9bf6b0-6098-404d-801b-c618b6491812", "name": "GLYCINE, N2-ACETYL-L-ARGINYL-L-TRYPTOPHYL-(2S)-2-PHENYLGLYCYL-2-PHENYL-, (2S)-", "stdName": "GLYCINE, N2-ACETYL-L-ARGINYL-L-TRYPTOPHYL-(2S)-2-PHENYLGLYCYL-2-PHENYL-, (2S)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df7ff4c4-cdd9-4951-a597-0a7534883a04", "75b95a2a-3e82-4f79-bc60-5dab70727625" ], "display_name": false }, { "uuid": "509fe2ac-20fc-4c55-8595-1e1994cf8163", "name": "RELISTASE", "stdName": "RELISTASE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a1d3b729-9a42-4e2f-9079-9fdd0ebeabd9", "75b95a2a-3e82-4f79-bc60-5dab70727625" ], "display_name": false } ], "references": [ { "uuid": "df7ff4c4-cdd9-4951-a597-0a7534883a04", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "75b95a2a-3e82-4f79-bc60-5dab70727625", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a1d3b729-9a42-4e2f-9079-9fdd0ebeabd9", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5ea1b80c-da00-4adf-9481-a12fc0c0a52c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391404000, "tags": [ "NOMEN" ] }, { "uuid": "1fd7c292-b0b2-4ab1-8112-c23c1bd475c6", "citation": "SRS import [9O32SH1GPH]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9O32SH1GPH", "doc_type": "SRS", "public_domain": true, "document_date": 1493391404000, "tags": [ "NOMEN" ] }, { "uuid": "f1430e91-c836-456d-ba2e-44700b4dcddd", "citation": "ACETYLARGINYLTRYPTOPHYL DIPHENYLGLYCINE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "64b9f477-1d04-0d74-0b4f-f241fd0128ca", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "3bb2ee47-fe8b-4075-bd24-e10e4a840339", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bd9e9f9f-bc94-4883-0ffe-ce7597dde661", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "660a0ab3-1384-4473-96e9-e713e0b70c7d", "id": "660a0ab3-1384-4473-96e9-e713e0b70c7d", "molfile": "\n Marvin 01132105192D \n\n 49 52 0 0 1 0 999 V2000\n 7.2557 -8.0491 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.9635 -7.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9635 -6.8071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6715 -6.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6715 -5.5651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3794 -5.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0979 -5.5559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3794 -4.3232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5266 -7.6413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5266 -6.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2398 -6.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8126 -6.4086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2557 -8.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9741 -9.2865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5478 -9.2911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5478 -10.1206 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.8346 -10.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1160 -10.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0241 -9.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2182 -9.1388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8103 -9.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0020 -10.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7513 -10.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3090 -11.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1127 -11.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3634 -10.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2664 -10.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2664 -11.3535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9749 -10.1114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6934 -10.5192 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.4066 -10.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4066 -9.2773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1252 -10.5100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8384 -10.0930 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.5522 -10.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2655 -10.0838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5522 -11.3257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8384 -9.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1093 -8.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1093 -8.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8224 -7.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5463 -8.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5463 -8.8511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6934 -11.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4226 -11.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4226 -12.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7093 -12.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9856 -12.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9856 -11.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 9 1 1 0 0 0\n 13 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 15 13 1 0 0 0 0\n 16 15 1 6 0 0 0\n 16 17 1 0 0 0 0\n 16 27 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 26 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 26 21 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 2 0 0 0 0\n 27 29 1 0 0 0 0\n 30 29 1 6 0 0 0\n 30 31 1 0 0 0 0\n 30 44 1 0 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 34 33 1 1 0 0 0\n 34 35 1 0 0 0 0\n 34 38 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 2 0 0 0 0\n 39 38 1 0 0 0 0\n 38 43 2 0 0 0 0\n 40 39 2 0 0 0 0\n 41 40 1 0 0 0 0\n 42 41 2 0 0 0 0\n 43 42 1 0 0 0 0\n 45 44 1 0 0 0 0\n 44 49 2 0 0 0 0\n 46 45 2 0 0 0 0\n 47 46 1 0 0 0 0\n 48 47 2 0 0 0 0\n 49 48 1 0 0 0 0\nM END", "smiles": "CC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](c3ccccc3)C(=O)N[C@@H](c4ccccc4)C(=O)O", "formula": "C35H40N8O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "360cdf31-68bd-469f-98d2-b41649e5b71f" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "668.7434", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "ea844dc2-7ddb-4f88-806c-713d8cf41b32", "version": "6", "structure": { "id": "6e11f9a2-aa84-43bc-9a5f-36eaa3b25ceb", "molfile": "\n Marvin 01132105432D \n\n 49 52 0 0 1 0 999 V2000\n 2.7513 -10.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0020 -10.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8103 -9.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3634 -10.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1127 -11.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3090 -11.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1160 -10.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0241 -9.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2182 -9.1388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8346 -10.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5478 -10.1206 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.2664 -10.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9749 -10.1114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6934 -10.5192 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.4066 -10.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1252 -10.5100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8384 -10.0930 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.5522 -10.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2655 -10.0838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5522 -11.3257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8384 -9.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1093 -8.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1093 -8.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8224 -7.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5463 -8.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5463 -8.8511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4066 -9.2773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6934 -11.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4226 -11.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4226 -12.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7093 -12.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9856 -12.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9856 -11.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2664 -11.3535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5478 -9.2911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2557 -8.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2557 -8.0491 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.9635 -7.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9635 -6.8071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6715 -6.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6715 -5.5651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3794 -5.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0979 -5.5559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3794 -4.3232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5266 -7.6413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5266 -6.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2398 -6.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8126 -6.4086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9741 -9.2865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 3 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 17 21 1 1 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 21 26 1 0 0 0 0\n 15 27 2 0 0 0 0\n 14 28 1 6 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 2 0 0 0 0\n 28 33 1 0 0 0 0\n 12 34 2 0 0 0 0\n 11 35 1 6 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 2 0 0 0 0\n 42 44 1 0 0 0 0\n 37 45 1 1 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 46 48 2 0 0 0 0\n 36 49 2 0 0 0 0\nM END", "smiles": "CC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](c3ccccc3)C(=O)N[C@@H](c4ccccc4)C(=O)O", "formula": "C35H40N8O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "668.7434", "optical_activity": "UNSPECIFIED", "references": [ "df7ff4c4-cdd9-4951-a597-0a7534883a04", "1fd7c292-b0b2-4ab1-8112-c23c1bd475c6" ], "stereo_centers": 4 }, "unii": "9O32SH1GPH" } ] }