{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "af590e39-f54b-4007-bee1-904e891e4d81", "code": "9NVN8M73TB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "238c6e5b-f056-4a62-81b0-1487a9774d94", "code": "13418-49-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=13418-49-0", "code_system": "CAS", "references": [ "9fcee22f-9ac0-4f16-b9d5-176ebc2a5af7", "9aa29a15-48a4-4459-bfc9-4f27f4f5a9dd" ] }, { "uuid": "36bc071c-fead-4ad8-924e-63c6d6029113", "code": "236-518-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.184", "code_system": "ECHA (EC/EINECS)", "references": [ "9fcee22f-9ac0-4f16-b9d5-176ebc2a5af7" ] }, { "uuid": "480daaaf-1586-483f-8617-59b898c36e0b", "code": "83424", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/83424", "code_system": "PUBCHEM", "references": [ "9fcee22f-9ac0-4f16-b9d5-176ebc2a5af7" ] }, { "uuid": "0f0fce4c-9bae-c06d-1bd0-330ae7776440", "code": "DTXSID4065444", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4065444", "code_system": "EPA CompTox", "references": [ "d765e9d0-ec56-9d58-c949-cc4ca5bd8aa2" ] } ], "substance_class": "chemical", "names": [ { "uuid": "780f6bb8-98e2-4525-992e-1619fada9f39", "name": "1H-Naphth[2,3-f]isoindole-1,5,10-trione, 4,11-diamino-2,3-dihydro-3-imino-2-(3-methoxypropyl)-", "stdName": "1H-NAPHTH(2,3-F)ISOINDOLE-1,5,10-TRIONE, 4,11-DIAMINO-2,3-DIHYDRO-3-IMINO-2-(3-METHOXYPROPYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "09ec2b1e-3c41-4bb3-b450-b2b46a4231da", "6b097869-05da-4eb5-9b64-d8cbbea147dc" ], "display_name": false }, { "uuid": "4fc37ecc-3f1a-4c19-82bd-de821bd669ef", "name": "4,11-Diamino-2,3-dihydro-3-imino-2-(3-methoxypropyl)-1H-naphth[2,3-f]isoindole-1,5,10-trione", "stdName": "4,11-DIAMINO-2,3-DIHYDRO-3-IMINO-2-(3-METHOXYPROPYL)-1H-NAPHTH(2,3-F)ISOINDOLE-1,5,10-TRIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9aa29a15-48a4-4459-bfc9-4f27f4f5a9dd" ], "display_name": false }, { "uuid": "1a71196a-7c9b-47e1-89fe-0e83fb508502", "name": "Disperse Blue 87", "stdName": "DISPERSE BLUE 87", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9aa29a15-48a4-4459-bfc9-4f27f4f5a9dd" ], "display_name": true } ], "references": [ { "uuid": "6b097869-05da-4eb5-9b64-d8cbbea147dc", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "09ec2b1e-3c41-4bb3-b450-b2b46a4231da", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9fcee22f-9ac0-4f16-b9d5-176ebc2a5af7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394049000, "tags": [ "NOMEN" ] }, { "uuid": "d765e9d0-ec56-9d58-c949-cc4ca5bd8aa2", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13418-49-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9aa29a15-48a4-4459-bfc9-4f27f4f5a9dd", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9245fc9d-d52b-46cb-98c1-0b333554eb8a", "id": "9245fc9d-d52b-46cb-98c1-0b333554eb8a", "molfile": "\n Marvin 01132107352D \n\n 28 31 0 0 0 0 999 V2000\n 8.8414 1.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0207 1.4537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6113 0.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7906 0.7300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3811 0.0106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5561 0.0054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0672 0.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3191 1.4518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2843 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2843 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5666 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5645 -1.6500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8571 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8571 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5666 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5645 1.6500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1438 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1467 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4306 0.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7153 0.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7111 -0.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4264 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1396 -0.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1371 -1.6485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0694 -0.6697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3248 -1.4541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 27 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 9 15 1 0 0 0 0\n 11 10 2 0 0 0 0\n 10 27 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 11 1 0 0 0 0\n 14 13 2 0 0 0 0\n 13 25 1 0 0 0 0\n 15 14 1 0 0 0 0\n 17 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 18 2 0 0 0 0\n 19 17 1 0 0 0 0\n 19 20 1 0 0 0 0\n 24 19 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 2 0 0 0 0\n 28 27 2 0 0 0 0\nM END", "smiles": "COCCCn1c(c2-c(c(c3=c(c2=N)c(=O)c4ccccc4c3=O)N)c1=O)N", "formula": "C20H18N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2ec1cc5a-5398-4e2a-8f2f-265a4e6c6e2a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "378.3821", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9d16b00f-e580-4b05-9a93-1dd8ca299f41", "version": "7", "structure": { "id": "d01209b9-da22-4edd-857c-946c726c4fe8", "molfile": "\n JSDraw211172316492D\n\n 28 31 0 0 0 0 0 V2000\n 12.7388 -10.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2988 -10.3980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0788 -9.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6388 -9.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4188 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9788 -7.6960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8956 -8.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4136 -10.4417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3793 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3793 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7303 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0813 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0813 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7303 -9.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7303 -10.8160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4323 -9.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4323 -10.8160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7833 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1343 -9.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4852 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4852 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1343 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7833 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4323 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4323 -4.5760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7303 -4.5760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8956 -6.4340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4136 -4.9503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 9 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 18 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 12 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 11 26 1 0 0 0 0\n 10 27 1 0 0 0 0\n 6 27 1 0 0 0 0\n 27 28 2 0 0 0 0\nM END", "smiles": "COCCCn1c(=N)c2c(c(c3c(c2N)c(=O)c4ccccc4c3=O)N)c1=O", "formula": "C20H18N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "378.3821", "optical_activity": "NONE", "references": [ "6b097869-05da-4eb5-9b64-d8cbbea147dc" ], "stereo_centers": 0 }, "unii": "9NVN8M73TB" } ] }