{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c0f82da9-35a4-42ff-9c96-2bc03126fe1e",
          "code": "101205-02-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101205-02-1",
          "code_system": "CAS",
          "references": [
            "b55711bd-b415-47bb-9483-f18a5c6c0065",
            "5d9dfdb4-9189-4740-a752-6be02c5aa441"
          ]
        },
        {
          "uuid": "f0be6b97-692a-cfb0-1f9e-7dc4c29e072d",
          "code": "DTXSID0057918",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0057918",
          "code_system": "EPA CompTox",
          "references": [
            "a06b499c-f3b5-e70a-df23-288d87066cf1"
          ]
        },
        {
          "uuid": "4ef8ffb0-0f53-965a-729c-52a359cdfb43",
          "code": "m11915",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11915",
          "code_system": "MERCK INDEX",
          "references": [
            "70cb08c7-de6a-335b-7bd6-fb6809a4dd5c"
          ]
        },
        {
          "uuid": "e3f43d0d-aa80-4084-824e-0034d644d2e6",
          "code": "9NJ0YM991I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7b7a3b7d-7edb-7cf6-a675-afd7a21eb26f",
          "code": "4033",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4033",
          "code_system": "CHEBI",
          "references": [
            "20d5f782-7d73-e7cf-56a8-0425ccd27354"
          ]
        },
        {
          "uuid": "af29819b-25a2-be7f-2066-5412116ca978",
          "code": "155491168",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/155491168",
          "code_system": "PUBCHEM",
          "references": [
            "dd8cff32-a52a-e5d4-7625-167824068b9c"
          ]
        },
        {
          "uuid": "31876a70-1230-bd87-cf3f-d8eefe32cb49",
          "code": "cycloxydim",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/cycloxydim.html",
          "code_system": "ALANWOOD",
          "references": [
            "521e673b-fe5e-37a4-97ec-c6b46c17129a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8fc4755d-3035-b48e-1622-c0ecab4ac8c5",
          "name": "2-CYCLOHEXEN-1-ONE, 2-(1-(ETHOXYIMINO)BUTYL)-3-HYDROXY-5-(TETRAHYDRO-2H-THIOPYRAN-3-YL)-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 2-(1-(ETHOXYIMINO)BUTYL)-3-HYDROXY-5-(TETRAHYDRO-2H-THIOPYRAN-3-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21fbb18b-4475-d855-c96f-d26d074a7f07"
          ],
          "display_name": false
        },
        {
          "uuid": "6d869153-cd16-269b-24de-2b3354e23a13",
          "name": "BAS 517 01H",
          "stdName": "BAS 517 01H",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70cb08c7-de6a-335b-7bd6-fb6809a4dd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "5c8af4a8-ef70-f80d-5370-59a6a03f3ff3",
          "name": "BAS 517 02H",
          "stdName": "BAS 517 02H",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70cb08c7-de6a-335b-7bd6-fb6809a4dd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "43b28ed7-c5c0-d090-44c7-b4f3490a926a",
          "name": "BAS 517H",
          "stdName": "BAS 517H",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70cb08c7-de6a-335b-7bd6-fb6809a4dd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "1aa27e33-ba2a-4794-9bc4-bfb77c588497",
          "name": "CYCLOXYDIM",
          "stdName": "CYCLOXYDIM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d551cc9-5faa-4b0a-9b82-4b803fbaa61c",
            "41d48a96-22aa-4ee3-a749-a8be0aba1fcc",
            "1423a7f7-fc90-44a1-a948-d198d25c280c",
            "30fe6e8b-fe3d-47c9-936d-e6434559b85d"
          ],
          "display_name": true
        },
        {
          "uuid": "fdb76bec-af94-4083-ae17-f1446709f87c",
          "name": "CYCLOXYDIM [ISO]",
          "stdName": "CYCLOXYDIM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1423a7f7-fc90-44a1-a948-d198d25c280c",
            "30fe6e8b-fe3d-47c9-936d-e6434559b85d"
          ],
          "display_name": false
        },
        {
          "uuid": "4a717351-175f-778c-0b82-8bc259a87ae8",
          "name": "CYCLOXYDIM [MI]",
          "stdName": "CYCLOXYDIM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89bb0c55-668d-2cde-bf2d-017eb59f8181"
          ],
          "display_name": false
        },
        {
          "uuid": "50e93b70-658a-37d9-772f-9d8feb2716ab",
          "name": "FOCUS",
          "stdName": "FOCUS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70cb08c7-de6a-335b-7bd6-fb6809a4dd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "ec91e92c-4cce-bb56-fccb-745055ee83e4",
          "name": "LASER",
          "stdName": "LASER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70cb08c7-de6a-335b-7bd6-fb6809a4dd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "944bbd85-d386-48d7-dd15-7023706d2111",
          "name": "STRATOS",
          "stdName": "STRATOS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70cb08c7-de6a-335b-7bd6-fb6809a4dd5c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "30fe6e8b-fe3d-47c9-936d-e6434559b85d",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1423a7f7-fc90-44a1-a948-d198d25c280c",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41d48a96-22aa-4ee3-a749-a8be0aba1fcc",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b55711bd-b415-47bb-9483-f18a5c6c0065",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392033000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d551cc9-5faa-4b0a-9b82-4b803fbaa61c",
          "citation": "CYCLOXYDIM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a06b499c-f3b5-e70a-df23-288d87066cf1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101205-02-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "70cb08c7-de6a-335b-7bd6-fb6809a4dd5c",
          "citation": "MERCK",
          "doc_type": "MERCK INDEX",
          "public_domain": true
        },
        {
          "uuid": "5d9dfdb4-9189-4740-a752-6be02c5aa441",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "21fbb18b-4475-d855-c96f-d26d074a7f07",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "89bb0c55-668d-2cde-bf2d-017eb59f8181",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true
        },
        {
          "uuid": "521e673b-fe5e-37a4-97ec-c6b46c17129a",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "dd8cff32-a52a-e5d4-7625-167824068b9c",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "20d5f782-7d73-e7cf-56a8-0425ccd27354",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5fa1a0a6-9791-3961-25bf-01f8de4a150d",
          "id": "5fa1a0a6-9791-3961-25bf-01f8de4a150d",
          "molfile": "\n  Marvin  01132104572D          \n\n 22 23  0  0  0  0            999 V2000\n   15.2650   -2.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5485   -3.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9766   -3.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9766   -4.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8369   -2.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6931   -2.8352    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6931   -4.4808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5485   -4.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8369   -2.0002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2551   -3.6556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2650   -2.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6881   -5.3060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2600   -4.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6980   -2.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1302   -3.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8369   -4.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3997   -5.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2551   -5.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9814   -1.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1302   -4.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3997   -6.5414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5337   -5.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  8  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  2  3  0  0  0\n  4 13  1  0  0  0  0\n  5  9  2  0  0  0  0\n  5 15  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8 16  1  0  0  0  0\n 11 19  1  0  0  0  0\n 12 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 18 22  1  0  0  0  0\nM  END",
          "smiles": "CCCC(=NOCC)C1C(CCCS1)(C2=CCCCC2=O)O",
          "formula": "C17H27NO3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "12c883a9-07a3-4295-8293-7f9e2fa12fe6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "325.4679",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a0751178-561f-4e74-aae4-485514c76893",
      "version": "13",
      "structure": {
        "id": "763e9170-a041-4e50-b5a3-4487e70d81b2",
        "molfile": "\n  Marvin  01132106082D          \n\n 22 23  0  0  0  0            999 V2000\n   15.2650   -2.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5485   -3.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9766   -3.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9766   -4.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8369   -2.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6931   -2.8352    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6931   -4.4808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5485   -4.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8369   -2.0002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2551   -3.6556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2650   -2.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3757   -4.8935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2600   -4.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6980   -2.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1302   -3.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8369   -4.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1698   -4.8635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2551   -5.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9814   -1.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1302   -4.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4449   -5.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5337   -5.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  8  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  2  3  0  0  0\n  4 13  1  0  0  0  0\n  5  9  2  0  0  0  0\n  5 15  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8 16  1  0  0  0  0\n 11 19  1  0  0  0  0\n 12 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 18 22  1  0  0  0  0\nM  END",
        "smiles": "CCCC(=NOCC)C1C(CCCS1)(C2=CCCCC2=O)O",
        "formula": "C17H27NO3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "325.4679",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "41d48a96-22aa-4ee3-a749-a8be0aba1fcc"
        ],
        "stereo_centers": 2
      },
      "unii": "9NJ0YM991I"
    }
  ]
}