{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ccec6bb9-c424-4783-9683-7df852ca3134",
          "code": "3734-49-4",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3734-49-4",
          "code_system": "CAS",
          "references": [
            "8ad62d4c-d755-4111-b0bc-cedad2b6a103",
            "fbc5203e-e0eb-43bb-b18b-8536fb15ef1f"
          ]
        },
        {
          "uuid": "2b96eeef-d560-4266-acb2-92de9ac993c5",
          "code": "39765-80-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=39765-80-5",
          "code_system": "CAS",
          "references": [
            "8ad62d4c-d755-4111-b0bc-cedad2b6a103",
            "afb38413-42e7-4446-9747-cf4fc0ef497a"
          ]
        },
        {
          "uuid": "abe176ac-6364-4b3e-85e3-1c1ffd016747",
          "code": "44802",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:781",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "8ad62d4c-d755-4111-b0bc-cedad2b6a103"
          ]
        },
        {
          "uuid": "790bbb76-e62f-5be5-0ffc-b1f46f7ad6a0",
          "code": "3734-49-4",
          "type": "PRIMARY",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3734-49-4",
          "code_system": "HSDB",
          "references": [
            "1da4e4ad-af59-90f8-5aac-100e08ff421d"
          ]
        },
        {
          "uuid": "94bc059f-16fe-4ef5-ac35-92f48f49faf1",
          "code": "9LP364CK91",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ff35e35a-8ba5-94be-7ab3-ce6c4d0b42b9",
          "code": "DTXSID5052709",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5052709",
          "code_system": "EPA CompTox",
          "references": [
            "8a5ac3f2-b9d2-bc6a-1099-b790d4b436b5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e8ea1e17-8046-4b6e-a5dc-f97ee8a2cded",
          "name": "4,7-METHANO-1H-INDENE, 1,2,3,4,5,6,7,8,8-NONACHLORO-2,3,3A,4,7,7A-HEXAHYDRO-, (1.ALPHA.,2.BETA.,3.ALPHA.,3A.ALPHA.,4.BETA.,7.BETA.,7A.ALPHA.)-",
          "stdName": "4,7-METHANO-1H-INDENE, 1,2,3,4,5,6,7,8,8-NONACHLORO-2,3,3A,4,7,7A-HEXAHYDRO-, (1.ALPHA.,2.BETA.,3.ALPHA.,3A.ALPHA.,4.BETA.,7.BETA.,7A.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b80c8481-a054-47ea-8e98-0bfe03fc8111",
            "97e4a31f-985b-4fe7-b611-55c40b860eec"
          ],
          "display_name": false
        },
        {
          "uuid": "8e231a60-eceb-4486-9582-673084e9e28f",
          "name": "NONACHLOR",
          "stdName": "NONACHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5808fc4-2994-4d70-9087-081fbb474575",
            "97e4a31f-985b-4fe7-b611-55c40b860eec"
          ],
          "display_name": false
        },
        {
          "uuid": "117d7062-2c36-4379-b58b-e14df277a91d",
          "name": "NONACHLOR, TRANS-",
          "stdName": "NONACHLOR, TRANS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b80c8481-a054-47ea-8e98-0bfe03fc8111",
            "97e4a31f-985b-4fe7-b611-55c40b860eec"
          ],
          "display_name": true
        },
        {
          "uuid": "f98ae830-8a14-4507-82e7-f29eac20d379",
          "name": "T-NONACHLOR",
          "stdName": "T-NONACHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b80c8481-a054-47ea-8e98-0bfe03fc8111",
            "97e4a31f-985b-4fe7-b611-55c40b860eec"
          ],
          "display_name": false
        },
        {
          "uuid": "90415e53-d78b-4e2e-a47c-bd948f0d2523",
          "name": "TRANS-NONACHLOR",
          "stdName": "TRANS-NONACHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b80c8481-a054-47ea-8e98-0bfe03fc8111",
            "97e4a31f-985b-4fe7-b611-55c40b860eec"
          ],
          "display_name": false
        },
        {
          "uuid": "b5265cbf-ebee-429f-a724-860184187f42",
          "name": "TRANS-NONACHLORDANE",
          "stdName": "TRANS-NONACHLORDANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b80c8481-a054-47ea-8e98-0bfe03fc8111",
            "97e4a31f-985b-4fe7-b611-55c40b860eec"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f5808fc4-2994-4d70-9087-081fbb474575",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "97e4a31f-985b-4fe7-b611-55c40b860eec",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b80c8481-a054-47ea-8e98-0bfe03fc8111",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ad62d4c-d755-4111-b0bc-cedad2b6a103",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392213000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27b30991-5091-46c0-b14f-f85962d6614c",
          "citation": "SRS import [9LP364CK91]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9LP364CK91",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392213000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1da4e4ad-af59-90f8-5aac-100e08ff421d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3734-49-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fcb8132b-4c02-6771-7913-e8129aa8b6a8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3734-49-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "afb38413-42e7-4446-9747-cf4fc0ef497a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fbc5203e-e0eb-43bb-b18b-8536fb15ef1f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8a5ac3f2-b9d2-bc6a-1099-b790d4b436b5",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "00588781-bb4a-44d6-beee-35ca99d6291b",
          "id": "00588781-bb4a-44d6-beee-35ca99d6291b",
          "molfile": "\n  Marvin  01132100202D          \n\n 19 21  0  0  0  0            999 V2000\n    6.2540   -2.3251    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.0790   -2.3251    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7691   -1.6577    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.0240   -0.8731    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9845   -1.9127    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.9845   -2.7377    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7691   -2.9926    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.0240   -3.7772    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1999   -2.9926    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.1999   -3.8176    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4153   -2.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2935   -3.3099    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4153   -1.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2280   -1.1659    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1999   -1.6577    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1999   -0.8327    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.0642   -2.3034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6694   -1.0528    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.8181   -2.6807    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  3  1  1  0  0  0  0\n  1  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  6  0  0  0\n  5  6  1  0  0  0  0\n  5 15  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n  9 17  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
          "smiles": "[C@H]12[C@H]([C@H]([C@H]([C@H]1Cl)Cl)Cl)[C@@]3(C(=C([C@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl",
          "formula": "C10H5Cl9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4c10b954-0a69-4c33-9473-8550ed3bc0c3"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "444.2235",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "04b946a3-758d-403c-ac77-d1d285347702",
      "version": "6",
      "structure": {
        "id": "fe856088-a2d7-4fd0-b5b8-bc072ac38d8e",
        "molfile": "\n  Marvin  01132113102D          \n\n 21 23  0  0  1  0            999 V2000\n    4.1999   -1.6577    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1999   -0.8327    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4153   -1.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2280   -1.1659    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4153   -2.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2935   -3.3099    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1999   -2.9926    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1999   -3.8176    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.0642   -2.3034    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.6694   -1.0528    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.8181   -2.6807    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9845   -2.7377    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.9845   -3.5627    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7691   -2.9926    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2540   -2.3251    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0790   -2.3251    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7691   -1.6577    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.0240   -0.8731    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9845   -1.9127    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.9845   -1.0877    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0240   -3.7772    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  1  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  1  9  1  1  0  0  0\n 12  7  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 12  1  0  0  0  0\n  1 19  1  0  0  0  0\n 14 21  1  1  0  0  0\nM  END",
        "smiles": "[C@]12([H])[C@]([H])([C@@H]([C@H]([C@@H]1Cl)Cl)Cl)[C@@]3(C(=C([C@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl",
        "formula": "C10H5Cl9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "444.2235",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f5808fc4-2994-4d70-9087-081fbb474575",
          "27b30991-5091-46c0-b14f-f85962d6614c"
        ],
        "stereo_centers": 7
      },
      "unii": "9LP364CK91"
    }
  ]
}