{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "37a6ba09-09c1-41fc-9be1-d8598eca1c45",
          "code": "3696-28-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3696-28-4",
          "code_system": "CAS",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c",
            "cac6f010-b486-4174-b19f-e102eee57196"
          ]
        },
        {
          "uuid": "a5e662ee-2a6a-4769-8b91-59b7fb36ccb9",
          "code": "C80853",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80853",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "f4d886e2-4601-4d9c-b84e-744389229a6d",
          "code": "C032196",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67032196",
          "code_system": "MESH",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "39a0923f-7c9d-45ca-adab-fad3556aa4a6",
          "code": "88006",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3666",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "ce3b56c8-8fd6-4472-81a6-46bdb5ae514a",
          "code": "3330",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3330",
          "code_system": "INN",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "7f28a776-a41f-4b8d-9ed8-8318986d23af",
          "code": "223-024-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.931",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "f8fe255f-90a3-491e-9d14-a3b4b064dedc",
          "code": "1362743",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362743/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "ee0a8e4f-a1e3-4dc2-a8f7-1600a989c583",
          "code": "SUB07230MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "ba5fcde0-7c25-459a-8bcd-8d843b70d57d",
          "code": "CHEMBL549473",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL549473",
          "code_system": "ChEMBL",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "c1572bf0-69f9-40a6-b27e-cae9b5a4b61b",
          "code": "3109",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3109",
          "code_system": "PUBCHEM",
          "references": [
            "2e25da75-d64d-426d-8378-33dc64fbf84c"
          ]
        },
        {
          "uuid": "44029a60-63c6-6626-3e79-bdb887c2cf88",
          "code": "DTXSID1041897",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1041897",
          "code_system": "EPA CompTox",
          "references": [
            "c2dc2cd3-2bec-0850-6f9d-808286f071b6"
          ]
        },
        {
          "uuid": "69dc4d36-808b-dd37-6963-d1e4bea76a1a",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "ALTERNATIVE",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4f6a72c9-b2ba-37e5-324b-23e67fb50466"
          ]
        },
        {
          "uuid": "204a06c9-d5a9-4d82-b69b-9b210e6a121e",
          "code": "9L87N86R9A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "110b62a2-b31d-28ec-0091-caad75cd484c",
          "code": "4649",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4649",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4f6a72c9-b2ba-37e5-324b-23e67fb50466"
          ]
        },
        {
          "uuid": "238270c4-42a0-7033-0264-493b37dcd368",
          "code": "DB11327",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11327",
          "code_system": "DRUG BANK",
          "references": [
            "4f6a72c9-b2ba-37e5-324b-23e67fb50466"
          ]
        },
        {
          "uuid": "169f8ab2-9a45-c212-91b6-7dc3102bd659",
          "code": "84740",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=84740",
          "code_system": "NSC",
          "references": [
            "1ae55233-271c-9778-9169-bd141d1612e1"
          ]
        },
        {
          "uuid": "362c5fab-d1ee-892e-3311-80462a254574",
          "code": "100000082375",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b827f4b9-b612-c4c0-cb91-d22a3cd28d19"
          ]
        },
        {
          "uuid": "1c748699-81dd-d1df-ead3-d0bf602b3480",
          "code": "9L87N86R9A",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9L87N86R9A",
          "code_system": "DAILYMED",
          "references": [
            "6f52c2aa-ac4a-d28e-7ebe-56b6e6100984"
          ]
        },
        {
          "uuid": "4342b49a-dc1a-b046-a413-b586d39005f4",
          "code": "dipyrithione",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/dipyrithione.html",
          "code_system": "ALANWOOD",
          "references": [
            "9e9d4192-c257-cf2b-f53a-5e42e83498dc"
          ]
        },
        {
          "uuid": "c3e2191c-886a-a48d-4474-60a3c24d2093",
          "code": "241716",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=241716",
          "code_system": "NSC",
          "references": [
            "1ae55233-271c-9778-9169-bd141d1612e1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "bbbf2e74-c8e1-4df1-a5b4-99077df11df6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "10415324-edcc-4ba5-a9b0-fa91ed6bf8c0",
            "refuuid": "e7d9a78f-3bbd-4fe2-bb91-32d07d8c81a8",
            "name": "DIPYRITHIONE",
            "unii": "9L87N86R9A",
            "linking_id": "9L87N86R9A",
            "ref_pname": "DIPYRITHIONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "38d32773-068f-418b-951a-51cbff4a930a",
          "name": "2,2'-DITHIOBIS(PYRIDINE) 1,1'-DIOXIDE",
          "stdName": "2,2'-DITHIOBIS(PYRIDINE) 1,1'-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc53cd89-1e10-4d2a-b1a9-26ebed36f7ec",
            "0b26c320-f39f-4282-b476-357ffab95c1c"
          ],
          "display_name": false
        },
        {
          "uuid": "ed6ee450-32c2-4187-ac53-62d46370a911",
          "name": "2,2'-DITHIODIPYRIDINE 1,1'-DIOXIDE",
          "stdName": "2,2'-DITHIODIPYRIDINE 1,1'-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feef4f47-1a0e-4586-af49-39af8bef24ef",
            "950be6f2-34c5-4dcc-8ea4-3471901730bf"
          ],
          "display_name": false
        },
        {
          "uuid": "30084e36-b339-4c7d-a73f-3ed8ddedfae6",
          "name": "BISPYRITHIONE",
          "stdName": "BISPYRITHIONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "950be6f2-34c5-4dcc-8ea4-3471901730bf",
            "18408985-25f7-4551-9c12-6a911d53b485",
            "1227b7d3-3ecf-4d11-bf0d-c211ca5f115a",
            "b9e6d8e0-2b55-4701-a0a7-2585e66f27db"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b47a4b59-af2c-4bca-81c1-a7f1ac0ec515",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "543a42f7-5bde-4b4a-bbb8-70d72729143b",
          "name": "DI-2-PYRIDYL DISULFIDE 1,1'-DIOXIDE",
          "stdName": "DI-2-PYRIDYL DISULFIDE 1,1'-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc53cd89-1e10-4d2a-b1a9-26ebed36f7ec",
            "debcdb87-992d-4c44-a6a2-f14fd3cb52dc"
          ],
          "display_name": false
        },
        {
          "uuid": "5d91b337-2cfa-40c0-bfa2-6b32af726abf",
          "name": "DIPYRITHIONE",
          "stdName": "DIPYRITHIONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feef4f47-1a0e-4586-af49-39af8bef24ef",
            "0c0178cc-613a-4ce7-8831-1547eef1614b",
            "9983882d-ad5c-4d13-8b48-abb8b089474a",
            "346190f5-d4df-4e53-9b7f-728ed641f3a4",
            "88469109-0c26-4016-a849-f2ce44151cae",
            "0cb05bb2-d7b4-4b46-8fd0-1bb0e31472e3",
            "a2f930ae-ed39-4f67-a0e6-37f7d8ba19fe"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a91867d7-cc6b-420b-aef2-660f8bb4b26f",
              "name_org": "INN"
            },
            {
              "uuid": "395bb358-6cab-48ba-b94d-da3e40ece820",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "52c5a760-33f0-4704-b30b-c8efda40890a",
          "name": "DIPYRITHIONE [MART.]",
          "stdName": "DIPYRITHIONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88469109-0c26-4016-a849-f2ce44151cae"
          ],
          "display_name": false
        },
        {
          "uuid": "9f193bb1-cfcb-4e06-b909-3471eebf9e1c",
          "name": "DIPYRITHIONE [USAN]",
          "stdName": "DIPYRITHIONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "346190f5-d4df-4e53-9b7f-728ed641f3a4"
          ],
          "display_name": false
        },
        {
          "uuid": "035f6b7d-f926-49dc-9f8b-734a444a3b6e",
          "name": "NSC-241716",
          "stdName": "NSC-241716",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3186c26b-80b6-4c89-a4b5-c96c39302eae",
            "950be6f2-34c5-4dcc-8ea4-3471901730bf"
          ],
          "display_name": false
        },
        {
          "uuid": "28549061-1816-4c84-9760-cdf8c29727c6",
          "name": "NSC-84740",
          "stdName": "NSC-84740",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3186c26b-80b6-4c89-a4b5-c96c39302eae",
            "950be6f2-34c5-4dcc-8ea4-3471901730bf"
          ],
          "display_name": false
        },
        {
          "uuid": "0669ff06-9043-4c10-87d1-44f58595fc8c",
          "name": "OMADINE DISULFIDE",
          "stdName": "OMADINE DISULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "950be6f2-34c5-4dcc-8ea4-3471901730bf",
            "49ac4bec-60a2-4ec1-bcff-559d4d305deb"
          ],
          "display_name": false
        },
        {
          "uuid": "e6b80bdd-97c6-4509-b414-bf4a7b56ff27",
          "name": "OMDS",
          "stdName": "OMDS",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feef4f47-1a0e-4586-af49-39af8bef24ef",
            "950be6f2-34c5-4dcc-8ea4-3471901730bf"
          ],
          "display_name": false
        },
        {
          "uuid": "e012bbf6-c962-4161-a037-f9c8c814c70a",
          "name": "PYRIDINE, 2,2'-DITHIOBIS- 1,1'-DIOXIDE",
          "stdName": "PYRIDINE, 2,2'-DITHIOBIS- 1,1'-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feef4f47-1a0e-4586-af49-39af8bef24ef",
            "950be6f2-34c5-4dcc-8ea4-3471901730bf"
          ],
          "display_name": false
        },
        {
          "uuid": "12395774-ddca-4a55-86b7-07f63286c500",
          "name": "PYRITHIONE DISULFIDE",
          "stdName": "PYRITHIONE DISULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be96fb98-66ad-43f6-9f86-f112cea88d4d",
            "950be6f2-34c5-4dcc-8ea4-3471901730bf"
          ],
          "display_name": false
        },
        {
          "uuid": "a29039f9-72b1-4e8b-b094-38702cd5f968",
          "name": "PYRITHIONE DISULPHIDE",
          "stdName": "PYRITHIONE DISULPHIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43738670-55cd-40f5-873b-626a8084a867"
          ],
          "display_name": false
        },
        {
          "uuid": "96e08da4-fe59-4662-b45b-fc317c109851",
          "name": "dipyrithione [INN]",
          "stdName": "DIPYRITHIONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9983882d-ad5c-4d13-8b48-abb8b089474a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "be96fb98-66ad-43f6-9f86-f112cea88d4d",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "950be6f2-34c5-4dcc-8ea4-3471901730bf",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "feef4f47-1a0e-4586-af49-39af8bef24ef",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc53cd89-1e10-4d2a-b1a9-26ebed36f7ec",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "debcdb87-992d-4c44-a6a2-f14fd3cb52dc",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43738670-55cd-40f5-873b-626a8084a867",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b26c320-f39f-4282-b476-357ffab95c1c",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9983882d-ad5c-4d13-8b48-abb8b089474a",
          "citation": "INN Proposed List 29",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL29.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "346190f5-d4df-4e53-9b7f-728ed641f3a4",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1227b7d3-3ecf-4d11-bf0d-c211ca5f115a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88469109-0c26-4016-a849-f2ce44151cae",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18408985-25f7-4551-9c12-6a911d53b485",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49ac4bec-60a2-4ec1-bcff-559d4d305deb",
          "citation": "http://www.chemicaldictionary.org/dic/O/Omadine-disulfide_127.html",
          "url": "http://www.chemicaldictionary.org/dic/O/Omadine-disulfide_127.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3186c26b-80b6-4c89-a4b5-c96c39302eae",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e25da75-d64d-426d-8378-33dc64fbf84c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b13d8bf-dc0d-4912-be07-7af92914c0b8",
          "citation": "SRS import [9L87N86R9A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9L87N86R9A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2f930ae-ed39-4f67-a0e6-37f7d8ba19fe",
          "citation": "DIPYRITHIONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c0178cc-613a-4ce7-8831-1547eef1614b",
          "citation": "DIPYRITHIONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0cb05bb2-d7b4-4b46-8fd0-1bb0e31472e3",
          "citation": "DIPYRITHIONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b9e6d8e0-2b55-4701-a0a7-2585e66f27db",
          "citation": "BISPYRITHIONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2dc2cd3-2bec-0850-6f9d-808286f071b6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3696-28-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b827f4b9-b612-c4c0-cb91-d22a3cd28d19",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4f6a72c9-b2ba-37e5-324b-23e67fb50466",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cac6f010-b486-4174-b19f-e102eee57196",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9e9d4192-c257-cf2b-f53a-5e42e83498dc",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "1ae55233-271c-9778-9169-bd141d1612e1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6f52c2aa-ac4a-d28e-7ebe-56b6e6100984",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b23ce850-2cba-47c0-978f-2035a71ca01a",
          "id": "b23ce850-2cba-47c0-978f-2035a71ca01a",
          "molfile": "\n  Marvin  01132109142D          \n\n 16 17  0  0  0  0            999 V2000\n    5.3519   -5.1080    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.3596   -5.9304    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.0679   -6.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0731   -7.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3519   -7.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6463   -7.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6385   -6.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9225   -5.9200    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1831   -6.3403    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4775   -5.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7563   -6.3091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0533   -5.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0636   -5.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7796   -4.6670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4853   -5.0821    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.2169   -4.6826    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  CHG  4   1  -1   2   1  15   1  16  -1\nM  END",
          "smiles": "c1cc[n+](c(c1)SSc2cccc[n+]2[O-])[O-]",
          "formula": "C10H8N2O2S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "926a01ec-8fcc-426c-8203-2be9b9c685fb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "252.3153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e7d9a78f-3bbd-4fe2-bb91-32d07d8c81a8",
      "version": "15",
      "structure": {
        "id": "0fb8106e-4596-4218-98a1-f4cf96132936",
        "molfile": "\n  Marvin  01132101032D          \n\n 16 17  0  0  0  0            999 V2000\n    5.3596   -5.9304    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.4853   -5.0821    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.6385   -6.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4775   -5.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1831   -6.3403    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9225   -5.9200    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3519   -5.1080    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.2169   -4.6826    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.7796   -4.6670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0679   -6.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6463   -7.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7563   -6.3091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0731   -7.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0636   -5.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0533   -5.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3519   -7.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  2  2  0  0  0  0\n 10  1  2  0  0  0  0\n 11  3  2  0  0  0  0\n 12  4  2  0  0  0  0\n 13 10  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 12  1  0  0  0  0\n 16 13  2  0  0  0  0\n 16 11  1  0  0  0  0\n 14  9  1  0  0  0  0\nM  CHG  4   1   1   2   1   7  -1   8  -1\nM  END",
        "smiles": "c1cc[n+](c(c1)SSc2cccc[n+]2[O-])[O-]",
        "formula": "C10H8N2O2S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "252.3153",
        "optical_activity": "NONE",
        "references": [
          "feef4f47-1a0e-4586-af49-39af8bef24ef",
          "2b13d8bf-dc0d-4912-be07-7af92914c0b8",
          "9983882d-ad5c-4d13-8b48-abb8b089474a"
        ],
        "stereo_centers": 0
      },
      "unii": "9L87N86R9A"
    }
  ]
}