{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "17b313b8-1228-480d-bb71-8cc6d3c79aa9",
          "code": "1361000-03-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1361000-03-4",
          "code_system": "CAS",
          "references": [
            "87bcdc09-2f44-49a9-9fa6-e6fc9ab2138e",
            "daa0326d-5b7e-49cf-835b-e54555b8e40c"
          ]
        },
        {
          "uuid": "acecdb5f-62de-6c52-f273-ed219682e82b",
          "code": "91936919",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91936919",
          "code_system": "PUBCHEM",
          "references": [
            "a246711a-a6a3-28d2-bddc-64fb1dc38060"
          ]
        },
        {
          "uuid": "d055dc37-fffb-4691-a1ed-470dfd706f0b",
          "code": "9L2QOQ6WFH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "080328e8-1e55-9bc2-eef0-d2c3a448e989",
          "code": "DTXSID401020932",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401020932",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9b520314-6f0f-4810-88c9-9348beb37f6f",
          "name": "1-HEXYL 4,5-DIAMINO PYRAZOLE HEMISULFATE",
          "stdName": "1-HEXYL 4,5-DIAMINO PYRAZOLE HEMISULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fae02197-1d69-490f-9638-267801143fcc",
            "bef30659-ce0f-45a2-ac54-4b724e7c458a"
          ],
          "display_name": false
        },
        {
          "uuid": "5a6e79c6-17f0-4658-8be5-ce6ee6e20bc2",
          "name": "1-HEXYL 4,5-DIAMINO PYRAZOLE SULFATE",
          "stdName": "1-HEXYL 4,5-DIAMINO PYRAZOLE SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c4784ff-898f-45cb-95af-999cebdbaf3c",
            "fae02197-1d69-490f-9638-267801143fcc",
            "a569a45a-82df-4d23-80ce-5e5e0954cbbe"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9091f1f9-120d-44d1-8cd1-87734a9a442d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "557243bb-db91-49e1-ad58-1782cf79889d",
          "name": "1H-PYRAZOLE-4,5-DIAMINE, 1-HEXYL-, SULFATE (2:1)",
          "stdName": "1H-PYRAZOLE-4,5-DIAMINE, 1-HEXYL-, SULFATE (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fae02197-1d69-490f-9638-267801143fcc",
            "5014ce5a-3a0c-41c7-960d-00c157e54007"
          ],
          "display_name": false
        },
        {
          "uuid": "fd649b19-53f9-40a3-899c-2c2dd4b9688b",
          "name": "4,5-DIAMINO-1-N-HEXYL-1H-PYRAZOLE HEMISULFATE",
          "stdName": "4,5-DIAMINO-1-N-HEXYL-1H-PYRAZOLE HEMISULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fae02197-1d69-490f-9638-267801143fcc",
            "5014ce5a-3a0c-41c7-960d-00c157e54007"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5014ce5a-3a0c-41c7-960d-00c157e54007",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fae02197-1d69-490f-9638-267801143fcc",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a569a45a-82df-4d23-80ce-5e5e0954cbbe",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bef30659-ce0f-45a2-ac54-4b724e7c458a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87bcdc09-2f44-49a9-9fa6-e6fc9ab2138e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392848000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bf1767d-81a7-4893-99d4-df19a5acd737",
          "citation": "SRS import [9L2QOQ6WFH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9L2QOQ6WFH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392848000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c4784ff-898f-45cb-95af-999cebdbaf3c",
          "citation": "1-HEXYL 4,5-DIAMINO PYRAZOLE SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a246711a-a6a3-28d2-bddc-64fb1dc38060",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "daa0326d-5b7e-49cf-835b-e54555b8e40c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e7bda517-99e4-4414-a967-19a667b566e2",
          "id": "e7bda517-99e4-4414-a967-19a667b566e2",
          "molfile": "\n  Marvin  01132111592D          \n\n  5  4  0  0  0  0            999 V2000\n   12.2861   -2.7629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1111   -2.7629    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9361   -2.7629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1111   -3.5879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1111   -1.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2e67ed07-e218-4fed-9df9-f622b1a08098"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "0ce58c2f-e906-4165-81f5-c00bfc152079",
          "id": "0ce58c2f-e906-4165-81f5-c00bfc152079",
          "molfile": "\n  Marvin  01132100552D          \n\n 13 13  0  0  0  0            999 V2000\n    9.3915   -2.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7784   -2.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9937   -2.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3806   -2.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -2.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9829   -1.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1982   -2.0667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5308   -1.5819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8634   -2.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1183   -2.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6334   -3.5189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9434   -2.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4282   -3.5189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCn1c(c(cn1)N)N",
          "formula": "C9H18N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "0b4bfa58-d163-42e3-ac9e-a98b249598c7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "182.2664",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "78857c83-09ea-4e35-9268-357fcc8e7c66",
      "version": "6",
      "structure": {
        "id": "dcdf42fa-19fa-461f-86df-ba318271de22",
        "molfile": "\n  Marvin  01132111272D          \n\n 31 30  0  0  0  0            999 V2000\n   13.1111   -2.7629    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2861   -2.7629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9361   -2.7629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1111   -3.5879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1111   -1.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9829   -1.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -2.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3806   -2.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9937   -2.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7784   -2.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3915   -2.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1982   -2.0667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9434   -2.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4282   -3.5189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1183   -2.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8634   -2.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5308   -1.5819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6334   -3.5189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9829   -1.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -2.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3806   -2.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9937   -2.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7784   -2.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3915   -2.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1982   -2.0667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9434   -2.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4282   -3.5189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1183   -2.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8634   -2.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5308   -1.5819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6334   -3.5189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  6 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 17 16  2  0  0  0  0\n 15 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 25  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 30  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 28 31  1  0  0  0  0\n 30 29  2  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   6   7   8   9  10  11  12  13  14  15  16  17  18  19  20\nM  SAL   1 11  21  22  23  24  25  26  27  28  29  30  31\nM  SPA   1 13   6   7   8   9  10  11  12  13  14  15  16  17  18\nM  SDI   1  4    3.2134   -3.9389    3.2134   -1.1619\nM  SDI   1  4    9.8115   -1.1619    9.8115   -3.9389\nM  SMT   1 2\nM  END",
        "smiles": "CCCCCCn1c(c(cn1)N)N.CCCCCCn1c(c(cn1)N)N.OS(=O)(=O)O",
        "formula": "2C9H18N4.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "462.6123",
        "optical_activity": "NONE",
        "references": [
          "5014ce5a-3a0c-41c7-960d-00c157e54007",
          "3bf1767d-81a7-4893-99d4-df19a5acd737"
        ],
        "stereo_centers": 0
      },
      "unii": "9L2QOQ6WFH"
    }
  ]
}