{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2cd62554-063d-4369-8f3e-2d20393a9406", "code": "109350-12-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=109350-12-1", "code_system": "CAS", "references": [ "7e57b3a4-78b5-4fcc-be36-a2a090b16a00", "ba2173ba-ff43-441e-9271-f3861386ac0f" ] }, { "uuid": "454e8ff7-ba55-4cbc-bb34-30a5e0fa9255", "code": "3033853", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3033853", "code_system": "PUBCHEM", "references": [ "7e57b3a4-78b5-4fcc-be36-a2a090b16a00" ] }, { "uuid": "d345c4fd-b089-46fd-a5e3-1f66aca86160", "code": "9KXW8132HH", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "6c9c8398-1e3c-42a2-91f5-f9ba62cb8463", "name": "1,1'-MONOGLYCERIDE CITRATE", "stdName": "1,1'-MONOGLYCERIDE CITRATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "15f31736-7a05-4cc7-a10f-f6274006c44c" ], "display_name": true }, { "uuid": "c60b2ef4-d279-4742-9773-a27e7b7be45f", "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, 1-(2,3-DIHYDROXYPROPYL) ESTER", "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, 1-(2,3-DIHYDROXYPROPYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3cfc0423-e2ed-4637-a80a-fd6c6bf96b2d" ], "display_name": false } ], "references": [ { "uuid": "15f31736-7a05-4cc7-a10f-f6274006c44c", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3cfc0423-e2ed-4637-a80a-fd6c6bf96b2d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7e57b3a4-78b5-4fcc-be36-a2a090b16a00", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389704000, "tags": [ "NOMEN" ] }, { "uuid": "ab2c3103-8860-4592-9643-2fdbe8655eb4", "citation": "SRS import [9KXW8132HH]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9KXW8132HH", "doc_type": "SRS", "public_domain": true, "document_date": 1493389704000, "tags": [ "NOMEN" ] }, { "uuid": "ba2173ba-ff43-441e-9271-f3861386ac0f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "eb1ca63a-428e-43f8-a54d-8a8cbb40b142", "id": "eb1ca63a-428e-43f8-a54d-8a8cbb40b142", "molfile": "\n Marvin 01132112102D \n\n 18 17 0 0 0 0 999 V2000\n 5.3110 -6.3548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5970 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8830 -6.3632 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.8747 -7.1899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1691 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4509 -6.3632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7411 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7286 -5.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0271 -6.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3131 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.3048 -5.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4008 -6.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1148 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1231 -5.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8288 -6.3632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3048 -6.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4134 -7.1773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0188 -7.1899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 1 0 0 0 0\n 16 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 13 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 16 2 0 0 0 0\nM END", "smiles": "C(C(=O)O)C(CC(=O)OCC(CO)O)(C(=O)O)O", "formula": "C9H14O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2aec886e-d94b-47a2-b4a4-7fb067655425" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "266.2024", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "bf81d581-e5f0-4890-a4e8-60bb127031dc", "version": "2", "structure": { "id": "817d08fc-da7d-437d-844c-1b2ae0712119", "molfile": "\n Marvin 01132106432D \n\n 18 17 0 0 0 0 999 V2000\n 0.3131 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0271 -6.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4008 -6.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3048 -6.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7411 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1148 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4134 -7.1773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7286 -5.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1231 -5.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4509 -6.3632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3048 -5.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0188 -7.1899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8830 -6.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8288 -6.3632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1691 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8747 -7.1899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3110 -6.3548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5970 -5.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 3 1 0 0 0 0\n 7 4 2 0 0 0 0\n 8 5 2 0 0 0 0\n 9 6 2 0 0 0 0\n 10 5 1 0 0 0 0\n 11 1 1 0 0 0 0\n 12 4 1 0 0 0 0\n 13 15 1 0 0 0 0\n 14 6 1 0 0 0 0\n 15 10 1 0 0 0 0\n 16 13 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 13 1 0 0 0 0\nM END", "smiles": "C(C(=O)O)C(CC(=O)OCC(CO)O)(C(=O)O)O", "formula": "C9H14O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "266.2024", "optical_activity": "UNSPECIFIED", "references": [ "ab2c3103-8860-4592-9643-2fdbe8655eb4", "15f31736-7a05-4cc7-a10f-f6274006c44c" ], "stereo_centers": 2 }, "unii": "9KXW8132HH" } ] }