{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5ca0541f-dd1e-4764-a735-ab5f82b44009",
          "code": "93-97-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=93-97-0",
          "code_system": "CAS",
          "references": [
            "2e7fe942-5016-436d-a212-ae0b5710e746",
            "d295297b-9c70-40b5-9c4a-1cdf299da63e"
          ]
        },
        {
          "uuid": "2240295b-ff56-4461-9d39-16fdb7cd4e1a",
          "code": "C102988",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67102988",
          "code_system": "MESH",
          "references": [
            "2e7fe942-5016-436d-a212-ae0b5710e746"
          ]
        },
        {
          "uuid": "331c4279-693f-46f9-b610-9d536e19f692",
          "code": "202-291-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.084",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2e7fe942-5016-436d-a212-ae0b5710e746"
          ]
        },
        {
          "uuid": "5de5dfcd-d9bc-49c0-8077-ccad360d3fea",
          "code": "m2364",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2364?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2e7fe942-5016-436d-a212-ae0b5710e746"
          ]
        },
        {
          "uuid": "28e97f81-1c79-4601-a516-81703ba48b02",
          "code": "SUB13015MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2e7fe942-5016-436d-a212-ae0b5710e746"
          ]
        },
        {
          "uuid": "65ffc28f-842c-4a52-8801-b24bfe0d9ca0",
          "code": "7167",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7167",
          "code_system": "PUBCHEM",
          "references": [
            "2e7fe942-5016-436d-a212-ae0b5710e746"
          ]
        },
        {
          "uuid": "b95c1fa1-14c3-e4df-b9c9-c71d2fdd286e",
          "code": "Benzoic anhydride",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Benzoic_anhydride",
          "code_system": "WIKIPEDIA",
          "references": [
            "e69d603e-8822-0443-cf6b-244d5c8121ea"
          ]
        },
        {
          "uuid": "801eae1a-32e0-7fd9-5324-98ee243d8af4",
          "code": "DTXSID1029122",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1029122",
          "code_system": "EPA CompTox",
          "references": [
            "9042899c-2d4c-dd3c-fd09-a9100c166a57"
          ]
        },
        {
          "uuid": "939cb0cb-8f4e-4746-c8b8-4c0717b840e3",
          "code": "1998050",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1998050/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bb29f5cb-6110-38ed-cc3f-ff8ac458ccdc"
          ]
        },
        {
          "uuid": "be0a4948-6854-4b30-9eba-2d13b538f2d9",
          "code": "9K7X34FOV2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c411916f-159d-fffa-848e-774a557a5bb7",
          "code": "38815",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38815",
          "code_system": "CHEBI",
          "references": [
            "ec896b06-4f75-f9ce-9c4f-dd22a1e77816"
          ]
        },
        {
          "uuid": "a5667e4d-a52b-9c03-feb4-dd734249b9af",
          "code": "100000077157",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "390e58e1-bca0-c2d9-70d3-fb8428d75946"
          ]
        },
        {
          "uuid": "e006b9ee-7bfd-b6f2-eb1e-efe8a28e78bc",
          "code": "37116",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=37116",
          "code_system": "NSC",
          "references": [
            "d39dd723-5ffa-1aca-f4a6-313ea066eda9"
          ]
        },
        {
          "uuid": "08104905-fe8d-30f9-5bbf-df57b462694d",
          "code": "9K7X34FOV2",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9K7X34FOV2",
          "code_system": "DAILYMED",
          "references": [
            "4619a79c-9460-89f8-e8ab-c358a16ed097"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "97dcb693-bbc1-47ed-abec-5670bcd7c7e4",
          "name": "BENZOIC ANHYDRIDE",
          "stdName": "BENZOIC ANHYDRIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "364c053f-c10d-4e1c-962e-50efa846129f",
            "0beb705c-4e77-46f8-9915-74f982d2c5e5",
            "33474b2e-8c05-4f30-90dc-c85817c88ffc",
            "ca506c34-f74f-47b3-903a-12d9e5d136a9"
          ],
          "display_name": true
        },
        {
          "uuid": "9b93aee1-c60a-429b-b596-930eb5f2fb68",
          "name": "BENZOIC ANHYDRIDE [MI]",
          "stdName": "BENZOIC ANHYDRIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33474b2e-8c05-4f30-90dc-c85817c88ffc",
            "ca506c34-f74f-47b3-903a-12d9e5d136a9"
          ],
          "display_name": false
        },
        {
          "uuid": "2d419891-8dd1-4747-ac42-5a1752aa2ad3",
          "name": "BENZOYL ANHYDRIDE",
          "stdName": "BENZOYL ANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eab5ae1-a177-4e4c-8d15-0747422886f2",
            "ca506c34-f74f-47b3-903a-12d9e5d136a9"
          ],
          "display_name": false
        },
        {
          "uuid": "d0696d4b-4f81-4d30-88e7-e28dc47e4e85",
          "name": "BENZOYL BENZOATE",
          "stdName": "BENZOYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eab5ae1-a177-4e4c-8d15-0747422886f2",
            "ca506c34-f74f-47b3-903a-12d9e5d136a9"
          ],
          "display_name": false
        },
        {
          "uuid": "69338c19-b42c-4dd6-99a4-3d9c86762594",
          "name": "BENZOYLBENZOATE",
          "stdName": "BENZOYLBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eab5ae1-a177-4e4c-8d15-0747422886f2",
            "ca506c34-f74f-47b3-903a-12d9e5d136a9"
          ],
          "display_name": false
        },
        {
          "uuid": "562b417c-f43a-44f4-88b2-2d77f6e33921",
          "name": "NSC-37116",
          "stdName": "NSC-37116",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eab5ae1-a177-4e4c-8d15-0747422886f2",
            "ca506c34-f74f-47b3-903a-12d9e5d136a9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "364c053f-c10d-4e1c-962e-50efa846129f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7eab5ae1-a177-4e4c-8d15-0747422886f2",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca506c34-f74f-47b3-903a-12d9e5d136a9",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33474b2e-8c05-4f30-90dc-c85817c88ffc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e7fe942-5016-436d-a212-ae0b5710e746",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390933000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69df8ea2-0b17-4a0f-99d7-e1b4a293a377",
          "citation": "SRS import [9K7X34FOV2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9K7X34FOV2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390933000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90e6b84c-e674-4e86-9bd9-e2ad2d4d0ccb",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0beb705c-4e77-46f8-9915-74f982d2c5e5",
          "citation": "BENZOIC ANHYDRIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e69d603e-8822-0443-cf6b-244d5c8121ea",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Benzoic_anhydride",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9042899c-2d4c-dd3c-fd09-a9100c166a57",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=93-97-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bb29f5cb-6110-38ed-cc3f-ff8ac458ccdc",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "d295297b-9c70-40b5-9c4a-1cdf299da63e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ec896b06-4f75-f9ce-9c4f-dd22a1e77816",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4619a79c-9460-89f8-e8ab-c358a16ed097",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d39dd723-5ffa-1aca-f4a6-313ea066eda9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "390e58e1-bca0-c2d9-70d3-fb8428d75946",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3e0640a9-7505-46a5-87a0-f1d5fc441890",
          "id": "3e0640a9-7505-46a5-87a0-f1d5fc441890",
          "molfile": "\n  Marvin  01132103172D          \n\n 17 18  0  0  0  0            999 V2000\n    6.3132   -3.5587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3132   -4.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0438   -4.7916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7445   -4.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7445   -3.5587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4854   -4.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2009   -4.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9121   -4.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9121   -5.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2009   -6.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4854   -5.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5893   -4.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5893   -5.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8738   -6.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1625   -5.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1625   -4.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8738   -4.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(=O)OC(=O)c2ccccc2",
          "formula": "C14H10O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3c0f06be-1960-4e7d-b8ef-99037d772119"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "226.2279",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "60c4d4cb-1d80-4c60-8b94-0118eab31628",
      "version": "11",
      "structure": {
        "id": "db41a1bb-7964-4219-8509-5d8cdb40546e",
        "molfile": "\n  Marvin  01132111222D          \n\n 17 18  0  0  0  0            999 V2000\n    8.4854   -4.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7445   -4.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0438   -4.7916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3132   -4.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5893   -4.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5893   -5.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8738   -6.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1625   -5.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1625   -4.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8738   -4.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3132   -3.5587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7445   -3.5587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2009   -4.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9121   -4.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9121   -5.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2009   -6.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4854   -5.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  4 11  2  0  0  0  0\n  2 12  2  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n  1 17  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(=O)OC(=O)c2ccccc2",
        "formula": "C14H10O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "226.2279",
        "optical_activity": "NONE",
        "references": [
          "90e6b84c-e674-4e86-9bd9-e2ad2d4d0ccb",
          "69df8ea2-0b17-4a0f-99d7-e1b4a293a377"
        ],
        "stereo_centers": 0
      },
      "unii": "9K7X34FOV2"
    }
  ]
}