{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "67bca696-bb01-4cf9-84ab-f9437a0cdf1d",
          "code": "56614-57-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=56614-57-4",
          "code_system": "CAS",
          "references": [
            "a60e7f91-405b-4110-875a-a873d895d7a0",
            "9a3c9735-1ffb-4d4b-960c-84cbbaac9408"
          ]
        },
        {
          "uuid": "d1d1a02e-44b6-421a-ac3b-cc28785a453a",
          "code": "11768995",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11768995",
          "code_system": "PUBCHEM",
          "references": [
            "a60e7f91-405b-4110-875a-a873d895d7a0"
          ]
        },
        {
          "uuid": "a2521953-8c3b-445f-a450-9e4217d0633c",
          "code": "9K7U161D1G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4706a554-0d27-d7fc-e79c-437d130ff7e9",
          "code": "DTXSID70205181",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70205181",
          "code_system": "EPA CompTox",
          "references": [
            "fd0edbf4-3f87-63ec-fff1-d8613143b5cf"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5fa88a10-9d00-48c9-ab25-fe8c61948a61",
          "name": "(±)-EXO,EXO-2,3-CAMPHANEDIOL",
          "stdName": "(+/-)-EXO,EXO-2,3-CAMPHANEDIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bd78f76-cd2b-4d91-ab1e-9865b6bc1523",
            "f259821e-4d4e-4587-bce1-3dc4806ae231"
          ],
          "display_name": false
        },
        {
          "uuid": "a21a983b-ed71-49e9-bbda-4d762fe55abe",
          "name": "BICYCLO(2.2.1)HEPTANE-2,3-DIOL, 1,7,7-TRIMETHYL-, (1R,2S,3R,4S)-REL-",
          "stdName": "BICYCLO(2.2.1)HEPTANE-2,3-DIOL, 1,7,7-TRIMETHYL-, (1R,2S,3R,4S)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71524f4c-a6cb-40ba-8cb6-dd7922c826c2",
            "f259821e-4d4e-4587-bce1-3dc4806ae231"
          ],
          "display_name": false
        },
        {
          "uuid": "5e9a051d-26e3-4e75-b3ec-8fcd85888543",
          "name": "BICYCLO(2.2.1)HEPTANE-2,3-DIOL, 1,7,7-TRIMETHYL-, (EXO,EXO)-",
          "stdName": "BICYCLO(2.2.1)HEPTANE-2,3-DIOL, 1,7,7-TRIMETHYL-, (EXO,EXO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71524f4c-a6cb-40ba-8cb6-dd7922c826c2",
            "f259821e-4d4e-4587-bce1-3dc4806ae231"
          ],
          "display_name": false
        },
        {
          "uuid": "a842b5f9-e883-4cae-8a51-fa24daa7db30",
          "name": "CAMPHANEDIOL",
          "stdName": "CAMPHANEDIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "542dc8fe-6d8f-47a2-901c-0c993bde887f",
            "ce586a3d-0561-4191-83f8-aa64939a2ce7",
            "f259821e-4d4e-4587-bce1-3dc4806ae231"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "21341cd0-906b-495c-9e7e-1c63817f0407",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "542dc8fe-6d8f-47a2-901c-0c993bde887f",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f259821e-4d4e-4587-bce1-3dc4806ae231",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71524f4c-a6cb-40ba-8cb6-dd7922c826c2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bd78f76-cd2b-4d91-ab1e-9865b6bc1523",
          "citation": "SIGMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a60e7f91-405b-4110-875a-a873d895d7a0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391455000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da6f7f8b-9e55-4218-8c23-3468da3e850b",
          "citation": "SRS import [9K7U161D1G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9K7U161D1G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391455000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce586a3d-0561-4191-83f8-aa64939a2ce7",
          "citation": "CAMPHANEDIOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af4fe9e5-0cdf-f09e-adb6-45f258ae26a9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=56614-57-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9a3c9735-1ffb-4d4b-960c-84cbbaac9408",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fd0edbf4-3f87-63ec-fff1-d8613143b5cf",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ee9c2d53-8b18-4ca5-bf24-1a286b3c3a74",
          "id": "ee9c2d53-8b18-4ca5-bf24-1a286b3c3a74",
          "molfile": "\n  Marvin  01132112222D          \n\n 12 13  0  0  0  0            999 V2000\n    5.5306   -3.5530    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.3579   -3.4486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3298   -3.8904    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.8278   -4.5328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5347   -3.4567    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1091   -4.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790   -3.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8199   -3.4567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7436   -3.1033    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.6151   -2.3323    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2736   -1.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9565   -1.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  9  1  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n 10  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@@H]2CC[C@@]1(C)[C@@H]([C@@H]2O)O",
          "formula": "C10H18O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "68d3acfa-79f8-41e5-ba7e-bec7659fce41"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "170.2491",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "79807646-0294-4659-b811-e980190f3f20",
      "version": "7",
      "structure": {
        "id": "dfe53195-48b0-4f6b-84b8-5c35956bb442",
        "molfile": "\n  Marvin  01132111362D          \n\n 13 14  0  0  0  0            999 V2000\n    5.2576   -2.4527    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2736   -1.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9565   -1.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1091   -4.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3579   -3.4486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8278   -4.5328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8199   -3.4567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790   -3.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5306   -3.5530    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3298   -3.8904    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7436   -3.1033    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6151   -2.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5347   -3.4567    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n  7 11  1  0  0  0  0\n 11  9  1  0  0  0  0\n 11  1  1  6  0  0  0\n  2 12  1  0  0  0  0\n  3 12  1  0  0  0  0\n 13  4  1  1  0  0  0\n  9  5  1  1  0  0  0\n 10  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@]2([H])CC[C@@]1(C)[C@@H]([C@@H]2O)O",
        "formula": "C10H18O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "170.2491",
        "optical_activity": "( + / - )",
        "references": [
          "71524f4c-a6cb-40ba-8cb6-dd7922c826c2",
          "da6f7f8b-9e55-4218-8c23-3468da3e850b"
        ],
        "stereo_centers": 4
      },
      "unii": "9K7U161D1G"
    }
  ]
}