{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4d079f4e-04d3-4379-98f0-28b64b5617d7",
          "code": "41451-28-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41451-28-9",
          "code_system": "CAS",
          "references": [
            "19eba39b-40c2-4c32-8aa5-aa3b9bbb77dd",
            "e9e74809-8509-4f68-badc-8df5181b877b"
          ]
        },
        {
          "uuid": "432ff57c-6d00-35de-06fd-4cf23b70f908",
          "code": "DTXSID70872296",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70872296",
          "code_system": "EPA CompTox",
          "references": [
            "c737b2db-c0b6-01e7-85f7-a0e667dd011b"
          ]
        },
        {
          "uuid": "8aea652e-aa7b-e3ae-c0fa-183132b5e872",
          "code": "591200",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/591200",
          "code_system": "PUBCHEM",
          "references": [
            "e167bf7f-14f9-f99f-9eb5-309f37bad933"
          ]
        },
        {
          "uuid": "04184900-6e9d-41b7-9dd9-abc73f55891e",
          "code": "9JJP9B98FG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "11733dd0-42b6-a5b1-8f65-fb21c79c00d0",
          "code": "Diisoheptyl phthalate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diisoheptyl_phthalate",
          "code_system": "WIKIPEDIA",
          "references": [
            "d09624a2-236a-7eb0-eb3b-bda2aa4af1d5"
          ]
        },
        {
          "uuid": "e838fa47-7399-84e9-fdf3-1e19fa21cbe0",
          "code": "300000053236",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "70d70256-832d-1643-701e-8cacdb919e43"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "31d6cce4-7ad2-4219-bad5-ddd557bebf55",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0fc39253-d85a-4f1f-ba1d-c4eeeb70b977",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19eba39b-40c2-4c32-8aa5-aa3b9bbb77dd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394445000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "767d57e3-29f5-49b3-8982-070f519005c0",
          "citation": "SRS import [9JJP9B98FG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9JJP9B98FG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394445000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c737b2db-c0b6-01e7-85f7-a0e667dd011b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41451-28-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d09624a2-236a-7eb0-eb3b-bda2aa4af1d5",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e167bf7f-14f9-f99f-9eb5-309f37bad933",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "e9e74809-8509-4f68-badc-8df5181b877b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "06118e96-a65e-4a4c-95f3-36bc2f58e0ab",
          "citation": "Drug Metab Dispos 1984;12(4):517",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "70d70256-832d-1643-701e-8cacdb919e43",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3d205647-54c9-4433-99d5-924799739e6c",
          "id": "3d205647-54c9-4433-99d5-924799739e6c",
          "molfile": "\n  Marvin  01132103142D          \n\n 26 26  0  0  0  0            999 V2000\n   10.6497   -4.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9353   -4.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2208   -4.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9353   -5.7978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2208   -6.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2208   -7.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5064   -7.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5064   -8.2728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7919   -8.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0774   -8.2728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7919   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5064   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5064  -10.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7919  -11.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0774  -10.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0774   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3629   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3629   -8.6853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6484   -9.9228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9339   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2195   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5050   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7906   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0761   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3616   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0761   -8.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCCOC(=O)c1ccccc1C(=O)OCCCCC(C)C",
          "formula": "C22H34O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7722b47d-543e-4862-8a35-0d725f69bc59"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "362.5038",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "7d3ef383-90a8-41c7-83f8-02f5e22a11fa",
      "version": "8",
      "structure": {
        "id": "4fdae23b-3ac2-493e-8d0c-4b61b873a2b2",
        "molfile": "\n  Marvin  01132104102D          \n\n 26 26  0  0  0  0            999 V2000\n    4.9339   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2195   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5050   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7906   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0761   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6484   -9.9228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3629   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3629   -8.6853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0774   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7919   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7919   -8.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5064   -8.2728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5064   -7.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2208   -7.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2208   -6.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9353   -5.7978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9353   -4.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0774   -8.2728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5064   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5064  -10.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7919  -11.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0774  -10.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6497   -4.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2208   -4.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3616   -9.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0761   -8.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 11 18  2  0  0  0  0\n 19 10  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n  9 22  1  0  0  0  0\n 17 23  1  0  0  0  0\n 17 24  1  0  0  0  0\n  5 25  1  0  0  0  0\n  5 26  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCCOC(=O)c1ccccc1C(=O)OCCCCC(C)C",
        "formula": "C22H34O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "362.5038",
        "optical_activity": "NONE",
        "references": [
          "767d57e3-29f5-49b3-8982-070f519005c0",
          "31d6cce4-7ad2-4219-bad5-ddd557bebf55"
        ],
        "stereo_centers": 0
      },
      "unii": "9JJP9B98FG",
      "relationships": [
        {
          "uuid": "25489c2b-76bc-4522-a409-999e4798142e",
          "amount": {
            "uuid": "9695fddd-6532-4c2d-ab57-1fa8f922743e"
          },
          "comments": "in rats",
          "type": "PARENT->METABOLITE",
          "references": [
            "06118e96-a65e-4a4c-95f3-36bc2f58e0ab"
          ],
          "related_substance": {
            "uuid": "76aa1faa-2aff-4117-b1db-17136228aee4",
            "refuuid": "6453f314-c911-476c-a65d-5dab11337a70",
            "name": "DIHEPTYL PHTHALATE",
            "unii": "IE05VO8P8P",
            "linking_id": "IE05VO8P8P",
            "ref_pname": "DIHEPTYL PHTHALATE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "05eaeffc-59e5-4944-83fb-d86e71f3d4c1",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, 1,2-DIISOHEPTYL ESTER",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, 1,2-DIISOHEPTYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fc39253-d85a-4f1f-ba1d-c4eeeb70b977",
            "31d6cce4-7ad2-4219-bad5-ddd557bebf55"
          ],
          "display_name": false
        },
        {
          "uuid": "d43c3457-7733-4d87-a576-5f32a7af1078",
          "name": "DI-(5-METHYLHEXYL)PHTHALATE",
          "stdName": "DI-(5-METHYLHEXYL)PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06118e96-a65e-4a4c-95f3-36bc2f58e0ab"
          ],
          "display_name": false
        },
        {
          "uuid": "611e6276-aee7-4dc2-8a86-ed1ecd853a44",
          "name": "DIISOHEPTYL PHTHALATE",
          "stdName": "DIISOHEPTYL PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fc39253-d85a-4f1f-ba1d-c4eeeb70b977",
            "31d6cce4-7ad2-4219-bad5-ddd557bebf55"
          ],
          "display_name": true
        },
        {
          "uuid": "6fa54ad0-7459-46b0-9b92-01eaf6279ebf",
          "name": "JAYFLEX 77",
          "stdName": "JAYFLEX 77",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fc39253-d85a-4f1f-ba1d-c4eeeb70b977",
            "31d6cce4-7ad2-4219-bad5-ddd557bebf55"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "517971e3-97a1-485e-a970-e6a3a53653f5"
      }
    }
  ]
}