{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3075e7fc-e2be-4061-98cd-c8500c4c5da4",
          "code": "65-82-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=65-82-7",
          "code_system": "CAS",
          "references": [
            "b024bb80-555b-4738-b3b8-5744ca324f87",
            "cf6a66c6-3399-4ab5-b48a-c28d2ecd3a14"
          ]
        },
        {
          "uuid": "a84bb537-9861-430d-bfc9-196114f8f109",
          "code": "C006379",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67006379",
          "code_system": "MESH",
          "references": [
            "b024bb80-555b-4738-b3b8-5744ca324f87"
          ]
        },
        {
          "uuid": "3426e2ee-7e7a-4352-97ab-ece1ab28c05e",
          "code": "21 CFR 172.372",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart D--Special Dietary and Nutritional Additives|Sec. 172.372 N-Acetyl-L-methionine.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.372",
          "code_system": "CFR",
          "references": [
            "b024bb80-555b-4738-b3b8-5744ca324f87"
          ]
        },
        {
          "uuid": "6882faba-431a-437e-bc42-2d34238ea420",
          "code": "1426463",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426463/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b024bb80-555b-4738-b3b8-5744ca324f87"
          ]
        },
        {
          "uuid": "4d7e08e7-9453-40c3-ae12-8c6ffe95f080",
          "code": "m1362",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1362?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b024bb80-555b-4738-b3b8-5744ca324f87"
          ]
        },
        {
          "uuid": "51218985-3d18-45a8-89da-0e15525abc0a",
          "code": "SUB12722MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b024bb80-555b-4738-b3b8-5744ca324f87"
          ]
        },
        {
          "uuid": "26f11f53-eb6f-4b6f-890f-2cc6159ebd57",
          "code": "200-617-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.561",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b024bb80-555b-4738-b3b8-5744ca324f87"
          ]
        },
        {
          "uuid": "1209adc0-0770-480c-97c1-e10b99a218ce",
          "code": "448580",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/448580",
          "code_system": "PUBCHEM",
          "references": [
            "b024bb80-555b-4738-b3b8-5744ca324f87"
          ]
        },
        {
          "uuid": "38a63dfd-2fc8-b4c9-bc34-d06130b0108f",
          "code": "DB01646",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01646",
          "code_system": "DRUG BANK",
          "references": [
            "d050d398-d7e5-5d70-571e-be8a1c8cd161"
          ]
        },
        {
          "uuid": "fd10df1d-e414-4e06-86f0-6bc59b96de66",
          "code": "9J12WX5B6A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f83465ca-cd3b-e0d7-8aa5-0e0f5890ac43",
          "code": "21557",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:21557",
          "code_system": "CHEBI",
          "references": [
            "d050d398-d7e5-5d70-571e-be8a1c8cd161"
          ]
        },
        {
          "uuid": "ac2871bf-d096-477a-ec6e-980761ff9b63",
          "code": "16811",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16811",
          "code_system": "CHEBI",
          "references": [
            "d050d398-d7e5-5d70-571e-be8a1c8cd161"
          ]
        },
        {
          "uuid": "b433de58-1af1-7dcf-3e96-df3b0f05fe77",
          "code": "DTXSID00883214",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00883214",
          "code_system": "EPA CompTox",
          "references": [
            "d050d398-d7e5-5d70-571e-be8a1c8cd161"
          ]
        },
        {
          "uuid": "07d8f940-7ef3-59ae-9643-c7cbfd2fe395",
          "code": "118514",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=118514",
          "code_system": "NSC",
          "references": [
            "6c125f1e-ec59-0f22-2a55-97f2b7c80243"
          ]
        },
        {
          "uuid": "f5540f09-428a-8cbe-98c1-0e90cd13a8f6",
          "code": "9J12WX5B6A",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9J12WX5B6A",
          "code_system": "DAILYMED",
          "references": [
            "27849de7-7fdf-9668-bb64-008313d7c1f5"
          ]
        },
        {
          "uuid": "12634707-d8d5-4b29-ab7d-56c4585be433",
          "code": "100000077932",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4d378f15-6369-78d9-d64b-dde945795211"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c5466d1e-b7d0-49ec-90ee-1b159b08e3d4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4bd64a3e-9256-4eb8-bdeb-91d665fd7e20",
            "refuuid": "7b184e92-2789-4361-a1e0-6ebb329cb23f",
            "name": "N-ACETYLMETHIONINE",
            "unii": "9J12WX5B6A",
            "linking_id": "9J12WX5B6A",
            "ref_pname": "N-ACETYLMETHIONINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f008c5b5-0210-4323-b439-4a8b79ac7d93",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2cf41e74-ee10-4b15-a76b-9de991ccf99e",
            "refuuid": "62e3ae8a-d10e-4c1c-966e-3f8524f01808",
            "name": "MAGNESIUM ACETYLMETHIONATE",
            "unii": "6W5T59494V",
            "linking_id": "6W5T59494V",
            "ref_pname": "MAGNESIUM ACETYLMETHIONATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c030bd7a-2c25-46b5-8c17-1052a2f83661",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "51a33990-3978-4a42-978f-68fc9b554c6c",
            "refuuid": "606f1007-1e3b-4957-94db-4a014cff8ca6",
            "name": "MANGANESE ACETYLMETHIONATE",
            "unii": "DTP8912DTL",
            "linking_id": "DTP8912DTL",
            "ref_pname": "MANGANESE ACETYLMETHIONATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ce6082d3-032a-4cfd-bb1e-c47ea2f626ea",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "d7d5db68-c1b1-46cc-8c95-a2d65c75f3ec",
            "refuuid": "1ae58bea-e88c-4de2-a311-af0b8cd16e94",
            "name": "COBALT ACETYLMETHIONATE",
            "unii": "S33L2XCP9S",
            "linking_id": "S33L2XCP9S",
            "ref_pname": "COBALT ACETYLMETHIONATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fe15e49f-9b8f-46d3-a280-42d12db05848",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "beb828d5-2afa-4a62-986c-8b16a1007075",
            "refuuid": "dace18cf-e823-4e18-8aee-e341739daca7",
            "name": "GOLD ACETYLMETHIONATE",
            "unii": "RDA9X022TH",
            "linking_id": "RDA9X022TH",
            "ref_pname": "GOLD ACETYLMETHIONATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6e6d0f54-6582-45b1-8273-58d2b49e7d75",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "3b415999-5078-4cef-8946-9e25f9f5c254",
            "refuuid": "a2f67f19-af14-4cda-a7d3-ce4337004f74",
            "name": "ACETYLMETHIONINE CALCIUM",
            "unii": "VKK65T8A9U",
            "linking_id": "VKK65T8A9U",
            "ref_pname": "ACETYLMETHIONINE CALCIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "905d23fc-1fb8-4580-a43a-43253605dbe4",
          "amount": {
            "uuid": "0986d8b5-7b08-424e-8dc0-0e28f39b8c45"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "afd0e838-386f-449e-b539-af76812f3d76",
            "refuuid": "398c7dd0-bc1f-4350-88c9-a2a3eb475898",
            "name": "Acetylmethionine choline",
            "unii": "45S4J3NW6G",
            "linking_id": "45S4J3NW6G",
            "ref_pname": "Acetylmethionine choline",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d9260141-dc54-4d92-973d-b4424f255f3f",
          "name": "ACETYL METHIONINE",
          "stdName": "ACETYL METHIONINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "801b7814-811f-435f-b53f-2da2a6ed8b96",
            "e48a1ceb-2c12-430b-8cd1-d44a9a415d24"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "efb134a9-d52f-40df-8217-c3f20aabf7c1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5d72cda9-cde6-4922-8273-20677e7bb669",
          "name": "ACETYL-L-METHIONINE",
          "stdName": "ACETYL-L-METHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "b4eba084-ff54-4ae5-81d7-ea76a72a7594"
          ],
          "display_name": false
        },
        {
          "uuid": "79beeb9f-28d6-40cf-8c4b-e2b88bbb723a",
          "name": "ACETYLMETHIONINE",
          "stdName": "ACETYLMETHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d2cbfdb-4ada-4fd5-bcb8-e03a422878be",
            "a3c098d6-295f-41e8-949b-628fa8ba3740",
            "e3b7b6e5-ff8f-4b0c-a381-97aa4ccba914",
            "30a8d338-67b9-462a-aa45-4fa57dfa983a"
          ],
          "display_name": false
        },
        {
          "uuid": "2599ab6e-1867-eb37-98c2-a328102abb61",
          "name": "Acetylmethionine [WHO-DD]",
          "stdName": "ACETYLMETHIONINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8e411fb-12f9-8a3a-9469-fe3e6d99068d"
          ],
          "display_name": false
        },
        {
          "uuid": "9142b8df-6a23-4809-82a4-515edf824ce9",
          "name": "FOLLICUSAN",
          "stdName": "FOLLICUSAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "e48a1ceb-2c12-430b-8cd1-d44a9a415d24"
          ],
          "display_name": false
        },
        {
          "uuid": "aa913288-f309-4188-aaf3-4986d0a8bbc3",
          "name": "L-(N-ACETYL)METHIONINE",
          "stdName": "L-(N-ACETYL)METHIONINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "b4eba084-ff54-4ae5-81d7-ea76a72a7594"
          ],
          "display_name": false
        },
        {
          "uuid": "ac05eaa8-aed9-4679-8589-75bf0ffe5c3a",
          "name": "L-METHIONINE, N-ACETYL-",
          "stdName": "L-METHIONINE, N-ACETYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "8e1b1f31-cc7f-453c-8824-62ab753765e4"
          ],
          "display_name": false
        },
        {
          "uuid": "f3805105-c8fb-43a4-aec7-645f9a9aeed7",
          "name": "METHIONAMINE",
          "stdName": "METHIONAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "b4eba084-ff54-4ae5-81d7-ea76a72a7594"
          ],
          "display_name": false
        },
        {
          "uuid": "1167f091-94f5-450d-b840-eb45d58d8b35",
          "name": "METHIONIN",
          "stdName": "METHIONIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "b4eba084-ff54-4ae5-81d7-ea76a72a7594"
          ],
          "display_name": false
        },
        {
          "uuid": "cb8a05a6-e397-4729-bf85-fcc77db577c3",
          "name": "METHIONINE, N-ACETYL-, L",
          "stdName": "METHIONINE, N-ACETYL-, L",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "b4eba084-ff54-4ae5-81d7-ea76a72a7594"
          ],
          "display_name": false
        },
        {
          "uuid": "89e45fb8-8f1b-463a-8c94-7ca7b1def366",
          "name": "METHIONINE, N-ACETYL-, L-",
          "stdName": "METHIONINE, N-ACETYL-, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "8e1b1f31-cc7f-453c-8824-62ab753765e4"
          ],
          "display_name": false
        },
        {
          "uuid": "c329d22f-e9f5-4cf4-9c76-96c382a3f2ed",
          "name": "N-ACETYL-L-2-AMINO-4-(METHYLTHIO)BUTYRIC ACID",
          "stdName": "N-ACETYL-L-2-AMINO-4-(METHYLTHIO)BUTYRIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e198715e-fadc-4644-8d59-3eaa79445468",
            "30a8d338-67b9-462a-aa45-4fa57dfa983a"
          ],
          "display_name": false
        },
        {
          "uuid": "d3ade0ec-94e1-43db-a56f-6851f0261f22",
          "name": "N-ACETYL-L-METHIONINE",
          "stdName": "N-ACETYL-L-METHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c717f73f-797d-4a1c-89cf-481da6ae0e35",
            "e198715e-fadc-4644-8d59-3eaa79445468",
            "30a8d338-67b9-462a-aa45-4fa57dfa983a"
          ],
          "display_name": false
        },
        {
          "uuid": "817163db-cdeb-4f6e-9d18-8389a351e337",
          "name": "N-ACETYL-L-METHIONINE [FCC]",
          "stdName": "N-ACETYL-L-METHIONINE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e198715e-fadc-4644-8d59-3eaa79445468",
            "30a8d338-67b9-462a-aa45-4fa57dfa983a"
          ],
          "display_name": false
        },
        {
          "uuid": "0790f17b-468d-420b-9c3b-ae0fa9a3e3ba",
          "name": "N-ACETYLMETHIONINE",
          "stdName": "N-ACETYLMETHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7963d1de-7b69-4e25-bef2-e7827f7fd21a",
            "78cc6f17-4b5f-443e-ac5a-c8f972c367d0",
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "78668d55-be23-4c46-b90a-8f5cdc203465"
          ],
          "display_name": true
        },
        {
          "uuid": "74e94936-ed93-4193-bb01-a65ea64310a9",
          "name": "N-ACETYLMETHIONINE [MI]",
          "stdName": "N-ACETYLMETHIONINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "78668d55-be23-4c46-b90a-8f5cdc203465"
          ],
          "display_name": false
        },
        {
          "uuid": "6a478965-61bc-4741-a94b-476fbca6d476",
          "name": "NSC-118514",
          "stdName": "NSC-118514",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "3ed84119-5226-420d-a33b-21275292c63c"
          ],
          "display_name": false
        },
        {
          "uuid": "4e03bfd5-708b-45b9-86e8-b00504b21126",
          "name": "THIOMEDON",
          "stdName": "THIOMEDON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a8d338-67b9-462a-aa45-4fa57dfa983a",
            "b4eba084-ff54-4ae5-81d7-ea76a72a7594"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7963d1de-7b69-4e25-bef2-e7827f7fd21a",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "30a8d338-67b9-462a-aa45-4fa57dfa983a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e198715e-fadc-4644-8d59-3eaa79445468",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e1b1f31-cc7f-453c-8824-62ab753765e4",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78668d55-be23-4c46-b90a-8f5cdc203465",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e48a1ceb-2c12-430b-8cd1-d44a9a415d24",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4eba084-ff54-4ae5-81d7-ea76a72a7594",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3c098d6-295f-41e8-949b-628fa8ba3740",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3b7b6e5-ff8f-4b0c-a381-97aa4ccba914",
          "citation": "who-dd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ed84119-5226-420d-a33b-21275292c63c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b024bb80-555b-4738-b3b8-5744ca324f87",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c08496f2-d244-4968-bc37-6c521178b1bd",
          "citation": "SRS import [9J12WX5B6A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9J12WX5B6A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78cc6f17-4b5f-443e-ac5a-c8f972c367d0",
          "citation": "N-ACETYLMETHIONINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c717f73f-797d-4a1c-89cf-481da6ae0e35",
          "citation": "N-ACETYL-L-METHIONINE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "801b7814-811f-435f-b53f-2da2a6ed8b96",
          "citation": "ACETYL METHIONINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d2cbfdb-4ada-4fd5-bcb8-e03a422878be",
          "citation": "ACETYLMETHIONINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d050d398-d7e5-5d70-571e-be8a1c8cd161",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cf6a66c6-3399-4ab5-b48a-c28d2ecd3a14",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6c125f1e-ec59-0f22-2a55-97f2b7c80243",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d8e411fb-12f9-8a3a-9469-fe3e6d99068d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "27849de7-7fdf-9668-bb64-008313d7c1f5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4d378f15-6369-78d9-d64b-dde945795211",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bff71e4a-9dc8-4c11-9420-ad3c5dc2bf70",
          "id": "bff71e4a-9dc8-4c11-9420-ad3c5dc2bf70",
          "molfile": "\n  Marvin  01132109552D          \n\n 12 11  0  0  1  0            999 V2000\n    7.3677   -3.6484    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.3677   -4.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0736   -4.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7839   -4.4642    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4989   -4.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6527   -3.2405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9332   -3.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2182   -3.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9332   -4.4734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0781   -3.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0781   -2.4109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7931   -3.6392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  6  0  0  0\n  1 10  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H](CCSC)C(=O)O",
          "formula": "C7H13NO3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "be9d24ab-462f-4bb1-ab2f-2fef4ee464db"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "191.2494",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7b184e92-2789-4361-a1e0-6ebb329cb23f",
      "version": "13",
      "structure": {
        "id": "53917076-f2d2-4599-8fe1-f3853eae0d8b",
        "molfile": "\n  Marvin  01132104212D          \n\n 12 11  0  0  1  0            999 V2000\n    8.0781   -3.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3677   -3.6484    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6527   -3.2405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9332   -3.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9332   -4.4734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2182   -3.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3677   -4.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0736   -4.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7839   -4.4642    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4989   -4.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0781   -2.4109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7931   -3.6392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  2  7  1  6  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  1  2  0  0  0  0\n 12  1  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H](CCSC)C(=O)O",
        "formula": "C7H13NO3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "191.2494",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e198715e-fadc-4644-8d59-3eaa79445468",
          "c08496f2-d244-4968-bc37-6c521178b1bd"
        ],
        "stereo_centers": 1
      },
      "unii": "9J12WX5B6A"
    }
  ]
}