{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "60e4d886-c035-4296-bca6-e8d38587fcc4",
          "code": "1499-46-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1499-46-3",
          "code_system": "CAS",
          "references": [
            "48154149-b4b1-4acc-994c-3b17d0b228af",
            "1e775400-55cb-4b4d-bec9-4bfc18137424"
          ]
        },
        {
          "uuid": "20dea581-197f-42bd-bb11-af41e4dfbfe4",
          "code": "216-109-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.014.645",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "48154149-b4b1-4acc-994c-3b17d0b228af"
          ]
        },
        {
          "uuid": "9599c117-c2d0-4399-b0df-815ad4fa0de9",
          "code": "92893",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92893",
          "code_system": "PUBCHEM",
          "references": [
            "48154149-b4b1-4acc-994c-3b17d0b228af"
          ]
        },
        {
          "uuid": "60cd3d85-45a5-4980-a5d6-f45b73ae2dd4",
          "code": "9IHZ1723UE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "96b317e0-f593-67c3-c4d2-2843b2340c50",
          "code": "70961",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:70961",
          "code_system": "CHEBI",
          "references": [
            "4b0c5b12-00b4-d364-cb3e-21b7beaeb95a"
          ]
        },
        {
          "uuid": "d85261e1-c1c6-45f1-c383-b7135417a1be",
          "code": "Histidine methyl ester",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Histidine_methyl_ester",
          "code_system": "WIKIPEDIA",
          "references": [
            "4b687b2f-61c4-e1aa-a02c-e9a4a21a2299"
          ]
        },
        {
          "uuid": "7c4422eb-a753-fd35-8f7e-aa6de84c9f02",
          "code": "DTXSID90933797",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90933797",
          "code_system": "EPA CompTox",
          "references": [
            "4b0c5b12-00b4-d364-cb3e-21b7beaeb95a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2e79f19f-e255-4214-9138-2ed91125846f",
          "name": "HISTIDINE METHYL ESTER",
          "stdName": "HISTIDINE METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "511988fa-4aca-45da-a797-0456445fac15",
            "edb3c05f-7351-4d75-ab72-0d7974cb3044"
          ],
          "display_name": true
        },
        {
          "uuid": "dcead103-0b50-4c3d-961d-ecc3c50a9dd7",
          "name": "HISTIDINE METHYL ESTER, (S)-",
          "stdName": "HISTIDINE METHYL ESTER, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "511988fa-4aca-45da-a797-0456445fac15",
            "edb3c05f-7351-4d75-ab72-0d7974cb3044"
          ],
          "display_name": false
        },
        {
          "uuid": "cb38559d-abe7-4ccd-b689-310df61642bb",
          "name": "HISTIDINE, METHYL ESTER, L-",
          "stdName": "HISTIDINE, METHYL ESTER, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "511988fa-4aca-45da-a797-0456445fac15",
            "edb3c05f-7351-4d75-ab72-0d7974cb3044"
          ],
          "display_name": false
        },
        {
          "uuid": "ae040022-3237-49cd-a2db-7a89bebe7467",
          "name": "L-HISTIDINE, METHYL ESTER",
          "stdName": "L-HISTIDINE, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "511988fa-4aca-45da-a797-0456445fac15",
            "edb3c05f-7351-4d75-ab72-0d7974cb3044"
          ],
          "display_name": false
        },
        {
          "uuid": "aecda2dc-eb18-4b3d-bc6a-58e93e8f1c4e",
          "name": "METHYL HISTIDINATE",
          "stdName": "METHYL HISTIDINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "511988fa-4aca-45da-a797-0456445fac15",
            "edb3c05f-7351-4d75-ab72-0d7974cb3044"
          ],
          "display_name": false
        },
        {
          "uuid": "2ca711ac-8371-48de-b63d-98784382a0f8",
          "name": "METHYL L-HISTIDINATE",
          "stdName": "METHYL L-HISTIDINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "511988fa-4aca-45da-a797-0456445fac15",
            "edb3c05f-7351-4d75-ab72-0d7974cb3044"
          ],
          "display_name": false
        },
        {
          "uuid": "2d412a23-f6bb-45c5-94b2-a16d7f2e29c5",
          "name": "O-METHYL-L-HISTIDINE",
          "stdName": "O-METHYL-L-HISTIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "511988fa-4aca-45da-a797-0456445fac15",
            "edb3c05f-7351-4d75-ab72-0d7974cb3044"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "511988fa-4aca-45da-a797-0456445fac15",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "edb3c05f-7351-4d75-ab72-0d7974cb3044",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48154149-b4b1-4acc-994c-3b17d0b228af",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391035000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85e3329a-36aa-4097-a24b-95ea6617c984",
          "citation": "SRS import [9IHZ1723UE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9IHZ1723UE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391035000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b80e07c7-90fd-4d2a-bf7d-2fb14954f359",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b687b2f-61c4-e1aa-a02c-e9a4a21a2299",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "1e775400-55cb-4b4d-bec9-4bfc18137424",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4b0c5b12-00b4-d364-cb3e-21b7beaeb95a",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d52e3ad9-6d45-4457-93c6-dd888daf61d8",
          "id": "d52e3ad9-6d45-4457-93c6-dd888daf61d8",
          "molfile": "\n  Marvin  01132111032D          \n\n 12 12  0  0  1  0            999 V2000\n    6.3996   -2.3812    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.3996   -1.4586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8298   -2.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0699   -2.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3916   -3.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7403   -2.6797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9845   -1.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8257   -1.9199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1323   -2.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1323   -3.5480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8921   -2.2455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7605   -2.6255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  9  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  8  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
          "smiles": "COC(=O)[C@H](Cc1c[nH]cn1)N",
          "formula": "C7H11N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "efa79300-9977-4fa8-b51d-b7925a9a6e1e"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "169.1814",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "490e39cc-07a7-4eea-b7ed-869eabad4e93",
      "version": "5",
      "structure": {
        "id": "e229c19f-adaa-4929-9299-5791b94f9362",
        "molfile": "\n  Marvin  01132111422D          \n\n 12 12  0  0  1  0            999 V2000\n    4.8257   -1.9199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0699   -2.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8298   -2.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3996   -2.3812    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1323   -2.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8921   -2.2455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7605   -2.6255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1323   -3.5480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3996   -1.4586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3916   -3.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7403   -2.6797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9845   -1.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  5  2  0  0  0  0\n  4  9  1  6  0  0  0\n 10  2  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12  1  1  0  0  0  0\nM  END",
        "smiles": "COC(=O)[C@H](Cc1cnc[nH]1)N",
        "formula": "C7H11N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "169.1814",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b80e07c7-90fd-4d2a-bf7d-2fb14954f359",
          "85e3329a-36aa-4097-a24b-95ea6617c984"
        ],
        "stereo_centers": 1
      },
      "unii": "9IHZ1723UE"
    }
  ]
}