{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "62ee63e2-b4c0-46c9-bbf9-bce8e4a6b02d",
          "code": "N05BC01",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANXIOLYTICS|Carbamates|meprobamate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05BC01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "fc488cc8-124c-43a0-8b36-2049d809a0fd",
          "code": "QN05BC01",
          "comments": "VATC|PSYCHOLEPTICS|ANXIOLYTICS|Carbamates|meprobamate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05BC01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "fe78260d-7c63-4c23-88be-b5b4dcb5e3a6",
          "code": "QN05BC51",
          "comments": "VATC|PSYCHOLEPTICS|ANXIOLYTICS|Carbamates|meprobamate, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05BC51&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "1be5f944-7192-4c07-b7df-f7be1207f2b0",
          "code": "QN05CX01",
          "comments": "VATC|PSYCHOLEPTICS|HYPNOTICS AND SEDATIVES|Hypnotics and sedatives in combination, excl. barbiturates|meprobamate, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05CX01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "43623ff9-fba1-4617-9ed5-3b29f366a8d8",
          "code": "57-53-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57-53-4",
          "code_system": "CAS",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5",
            "2004320f-c5cd-4dd7-adf5-b779f3198a01"
          ]
        },
        {
          "uuid": "c5625c74-2187-47f9-b6ab-771ffe262db5",
          "code": "C47603",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47603",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "df2532a0-2e21-4c48-8495-7f076510cc6a",
          "code": "D008620",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008620",
          "code_system": "MESH",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "bd7ddc5e-765b-4fe0-becb-13f7eaa5d7fd",
          "code": "NBK548721",
          "comments": "LiverTox|CNS|Sedative/Hypnotic|Carbamate",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548721/",
          "code_system": "LIVERTOX",
          "references": [
            "ed14a6f0-1c30-ca18-9327-b8d44338f660"
          ]
        },
        {
          "uuid": "f66891a6-eee7-43f9-8502-3ad575db696e",
          "code": "MEPROBAMATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Meprobamate",
          "code_system": "WIKIPEDIA",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "a3b264dc-ac93-42f2-a7bd-777b32ecb615",
          "code": "N05BC51",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANXIOLYTICS|Carbamates|meprobamate, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05BC51&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "623271b7-6a07-4665-b5d3-ad344d24378c",
          "code": "N05CX01",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|HYPNOTICS AND SEDATIVES|Hypnotics and sedatives in combination, excl. barbiturates|meprobamate, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05CX01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "de86e015-dc10-4e1b-8e2e-63e1eae979d0",
          "code": "SUB08757MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "bab0ed7b-f3df-4e4d-a77b-6b25e9a34cc7",
          "code": "533",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=533",
          "code_system": "INN",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "e05d4b5f-f073-497f-997c-543e482ff57f",
          "code": "200-337-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.306",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "2aaa84d4-3325-4a31-9b6e-f2122291695d",
          "code": "2820",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "4552e604-6aed-4a76-8d5b-048dd1bb23e0",
          "code": "7225",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7225",
          "code_system": "IUPHAR",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "22766bc4-2171-4e2a-a15e-839b72c67829",
          "code": "6760",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6760/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "3bc14d1e-4bcd-4fe4-89dd-b056d69357d7",
          "code": "m7199",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7199?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "74a43702-287e-4236-8fcf-8fe85b95473f",
          "code": "DB00371",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00371",
          "code_system": "DRUG BANK",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "c06e5b53-e819-4ee7-b0da-5d60b11cbf9a",
          "code": "CHEMBL979",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL979",
          "code_system": "ChEMBL",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "1c1ae806-c1ed-4c9c-aaea-6567197168e5",
          "code": "4064",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4064",
          "code_system": "PUBCHEM",
          "references": [
            "8b140ef1-a56b-46f7-89ca-8ca16288b9a5"
          ]
        },
        {
          "uuid": "d9e59b72-7b0f-bd18-4989-b7d5dab29b62",
          "code": "3117",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3117",
          "code_system": "HSDB",
          "references": [
            "890786c6-fe46-59af-456b-01c3b8533234"
          ]
        },
        {
          "uuid": "73af540a-dd78-e6fb-39c9-3ca28a5c8741",
          "code": "DTXSID3023261",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3023261",
          "code_system": "EPA CompTox",
          "references": [
            "829ad2aa-5488-96f8-625e-5badfae5935c"
          ]
        },
        {
          "uuid": "b1052b2e-2bb7-fd85-d7a7-74d8b280eaff",
          "code": "C264",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticonvulsant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C264",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ed14a6f0-1c30-ca18-9327-b8d44338f660"
          ]
        },
        {
          "uuid": "92b17e44-7c5a-2287-37cf-a177b0ec7043",
          "code": "C29756",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Sedative and Hypnotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29756",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ed14a6f0-1c30-ca18-9327-b8d44338f660"
          ]
        },
        {
          "uuid": "fec1676e-fb70-40e3-812f-f79a0f554b03",
          "code": "9I7LNY769Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9e88849c-6321-96af-74c6-4bdae49d7cb9",
          "code": "Meprobamate",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM593/",
          "code_system": "LACTMED",
          "references": [
            "ed14a6f0-1c30-ca18-9327-b8d44338f660"
          ]
        },
        {
          "uuid": "7e52efe5-3726-3f97-b83a-e93c600b32bf",
          "code": "Atovaquone and Proquanil",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM592/",
          "code_system": "LACTMED",
          "references": [
            "ed14a6f0-1c30-ca18-9327-b8d44338f660"
          ]
        },
        {
          "uuid": "7df90cf8-1fcd-a57c-16f5-11b32e63d9f9",
          "code": "1704",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1704",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ed14a6f0-1c30-ca18-9327-b8d44338f660"
          ]
        },
        {
          "uuid": "3d8adb7d-3574-5d77-c7f9-7bd6337bf57b",
          "code": "1389008",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1389008",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "ed14a6f0-1c30-ca18-9327-b8d44338f660"
          ]
        },
        {
          "uuid": "c4041dd6-b17c-f902-9c0e-134be30de248",
          "code": "9I7LNY769Q",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9I7LNY769Q",
          "code_system": "DAILYMED",
          "references": [
            "0dd30d90-c158-3a09-9348-1a82f02fe118"
          ]
        },
        {
          "uuid": "9276a8f5-52d0-3e5e-2eab-d9c0181863dc",
          "code": "100000092826",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6b1c830b-ffa9-fefd-f5ef-3dd6b55ad515"
          ]
        },
        {
          "uuid": "c3a1e6d1-b526-e0bc-a11c-9142e112b396",
          "code": "30418",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=30418",
          "code_system": "NSC",
          "references": [
            "3afd9b8c-2533-ab90-43db-a1691f625354"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "547b172d-392d-4b3c-a90d-bc6ba218f1ff",
          "amount": {
            "uuid": "14dd8aae-72bc-4b4f-ad34-810c3273264e"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "08139433-7079-40a0-a376-206bc35c2022",
            "refuuid": "6a25837a-09f4-4d26-81bf-fcc562fc1a4b",
            "name": "MEPROBAMATE",
            "unii": "9I7LNY769Q",
            "linking_id": "9I7LNY769Q",
            "ref_pname": "MEPROBAMATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8d188436-291f-4fe6-9c28-88121f624cd8",
          "amount": {
            "uuid": "da5755e1-c0f6-49ea-9d6c-3d942cd93c3e",
            "average": 24,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "references": [
            "34537cda-c4fe-f329-9455-683da68cd526"
          ],
          "related_substance": {
            "uuid": "809dfb85-193a-4928-832b-f35da049e75b",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c0b7e722-ae7d-4b1f-97e0-d594ebdc19b5",
          "name": "1,3-PROPANEDIOL, 2-METHYL-2-PROPYL-, DICARBAMATE",
          "stdName": "1,3-PROPANEDIOL, 2-METHYL-2-PROPYL-, DICARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27341ec5-6431-46c2-9650-4fa8095670cb"
          ],
          "display_name": false
        },
        {
          "uuid": "bb8a3907-2bd6-4b5d-94e5-a721d4b65222",
          "name": "2-Methyl-2-propyl-1,3-propanediol dicarbamate",
          "stdName": "2-METHYL-2-PROPYL-1,3-PROPANEDIOL DICARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27341ec5-6431-46c2-9650-4fa8095670cb"
          ],
          "display_name": false
        },
        {
          "uuid": "84d9b981-81d1-425c-97d3-0e88d91094c3",
          "name": "AMOSENE",
          "stdName": "AMOSENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd9e289b-f474-4922-b29b-e9e6bad6d22b"
          ],
          "display_name": false
        },
        {
          "uuid": "546c4ece-0c09-46d6-8d66-2584ac6c3b6f",
          "name": "BAMATE",
          "stdName": "BAMATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd9e289b-f474-4922-b29b-e9e6bad6d22b"
          ],
          "display_name": false
        },
        {
          "uuid": "2a6f6791-55df-4c4c-81fc-247cba42f26e",
          "name": "EQUAGESIC COMPONENT MEPROBAMATE",
          "stdName": "EQUAGESIC COMPONENT MEPROBAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a235977-5e85-478f-89db-ba2b25a8f8ef",
            "f0dc33fc-1eca-44ec-9e23-d14d47e5d79b"
          ],
          "display_name": false
        },
        {
          "uuid": "5f879482-d811-41e8-8a73-dbc8fc9fb96c",
          "name": "EQUANIL",
          "stdName": "EQUANIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f4f9ed6-2aca-4b48-bc7e-2231ec436bb0"
          ],
          "display_name": false
        },
        {
          "uuid": "05bb91b4-58ae-4f7c-8157-f4952fefe7a3",
          "name": "MEPRIAM",
          "stdName": "MEPRIAM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd9e289b-f474-4922-b29b-e9e6bad6d22b"
          ],
          "display_name": false
        },
        {
          "uuid": "d97f7b9f-e381-44c1-b081-7c9282969a16",
          "name": "MEPRO-ASPIRIN COMPONENT MEPROBAMATE",
          "stdName": "MEPRO-ASPIRIN COMPONENT MEPROBAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a235977-5e85-478f-89db-ba2b25a8f8ef",
            "f0dc33fc-1eca-44ec-9e23-d14d47e5d79b"
          ],
          "display_name": false
        },
        {
          "uuid": "68ae3459-4503-4067-a5e8-80089bf37b69",
          "name": "MEPROBAMATE",
          "stdName": "MEPROBAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718dd761-bda5-4b63-b9e5-0184e6c60623",
            "b7541324-750b-46b4-8a48-0f06ec46a121",
            "a7bc6999-240e-4190-ab3c-618e527d6141",
            "2bb96b63-f187-4874-9d88-347a5e5c1c4e",
            "58529343-6085-4789-80e5-f8dd0219c237",
            "79fc8934-302b-4288-8f0c-84ef85aa53c6",
            "9491d764-531f-4e2b-8b4a-e1193911b226",
            "af321fd0-48fb-4778-a309-877d71193c56",
            "07b70fa4-0f12-46fd-a8c7-f74f4ca4c6da",
            "2c89b59f-4877-4b9f-8c79-89a1224b4d5e",
            "995893f8-4abf-48e0-95f3-0b1dd3e33077",
            "53722146-6e03-460a-830c-6df52253e5fc",
            "3547b6cf-acda-4ac8-a4c9-2081e5bd82a6",
            "09ff59f7-39fe-45a7-9cd6-be472fde644a",
            "9844ba24-9600-4d81-a01f-41611328ae90",
            "0650e89f-6cc2-4830-bab5-a6c060c51554",
            "f5998b35-113d-4d89-886a-ddd3ef580875",
            "b8cc8c72-70f0-4f7e-8e36-7139ddcc7f6b",
            "2791176e-ee2d-4d8f-864a-843a728566a5",
            "27341ec5-6431-46c2-9650-4fa8095670cb",
            "075aa496-d444-40e3-adf0-056e605cf5ba"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "eb15ad2c-5289-4ac3-97ec-3cfa8878b74b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e5d1bb9c-218a-426c-8b6b-31d3337de538",
          "name": "MEPROBAMATE CIV",
          "stdName": "MEPROBAMATE CIV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a35edbf9-6b65-482e-a9f8-c0fc35548486",
            "dbccaad7-89dc-461e-acac-ce883f9ba832"
          ],
          "display_name": false
        },
        {
          "uuid": "9d5323c4-ad79-4f26-8bff-0d70a84b0840",
          "name": "MEPROBAMATE CIV [USP-RS]",
          "stdName": "MEPROBAMATE CIV [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a35edbf9-6b65-482e-a9f8-c0fc35548486"
          ],
          "display_name": false
        },
        {
          "uuid": "cfb03b54-5fa3-6276-5165-2d6c90d0ec78",
          "name": "MEPROBAMATE [EP IMPURITY]",
          "stdName": "MEPROBAMATE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cc8c72-70f0-4f7e-8e36-7139ddcc7f6b"
          ],
          "display_name": false
        },
        {
          "uuid": "a8f91a57-259b-4eb3-9fda-c71f630f936f",
          "name": "MEPROBAMATE [HSDB]",
          "stdName": "MEPROBAMATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "075aa496-d444-40e3-adf0-056e605cf5ba"
          ],
          "display_name": false
        },
        {
          "uuid": "1e848e56-1686-46e0-af8d-2cb5c194ab3d",
          "name": "MEPROBAMATE [JAN]",
          "stdName": "MEPROBAMATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9491d764-531f-4e2b-8b4a-e1193911b226"
          ],
          "display_name": false
        },
        {
          "uuid": "d82d3399-ae3b-48e7-bb94-486b4436d551",
          "name": "MEPROBAMATE [MART.]",
          "stdName": "MEPROBAMATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07b70fa4-0f12-46fd-a8c7-f74f4ca4c6da"
          ],
          "display_name": false
        },
        {
          "uuid": "a53b5f08-fe7b-43a1-a466-63a724ddeaa8",
          "name": "MEPROBAMATE [MI]",
          "stdName": "MEPROBAMATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7bc6999-240e-4190-ab3c-618e527d6141"
          ],
          "display_name": false
        },
        {
          "uuid": "b9e08649-8c75-4553-b2a2-7058f832b72b",
          "name": "MEPROBAMATE [ORANGE BOOK]",
          "stdName": "MEPROBAMATE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718dd761-bda5-4b63-b9e5-0184e6c60623"
          ],
          "display_name": false
        },
        {
          "uuid": "71ce1058-1fdd-0187-fc7b-d0b1cb6205ad",
          "name": "MEPROBAMATE [USP MONOGRAPH]",
          "stdName": "MEPROBAMATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "052f2ced-65a3-1ec0-b709-c5d727010c2e"
          ],
          "display_name": false
        },
        {
          "uuid": "8062ecb1-232a-4aa9-a2fe-1794039c9d8a",
          "name": "MEPROBAMATE [VANDF]",
          "stdName": "MEPROBAMATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2791176e-ee2d-4d8f-864a-843a728566a5"
          ],
          "display_name": false
        },
        {
          "uuid": "9890a351-4f77-4bb8-b2e1-4f812e101941",
          "name": "MEPROSPAN",
          "stdName": "MEPROSPAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd9e289b-f474-4922-b29b-e9e6bad6d22b"
          ],
          "display_name": false
        },
        {
          "uuid": "647c89bb-79db-400a-8c44-056ffee4face",
          "name": "MICRAININ COMPONENT MEPROBAMATE",
          "stdName": "MICRAININ COMPONENT MEPROBAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a235977-5e85-478f-89db-ba2b25a8f8ef",
            "f0dc33fc-1eca-44ec-9e23-d14d47e5d79b"
          ],
          "display_name": false
        },
        {
          "uuid": "b419bbb7-8ecd-4305-b8a0-d3d0bfc84f1d",
          "name": "MILTOWN",
          "stdName": "MILTOWN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f4f9ed6-2aca-4b48-bc7e-2231ec436bb0"
          ],
          "display_name": false
        },
        {
          "uuid": "777cc542-f19c-3a39-6ed4-27de5f670fb7",
          "name": "Meprobamate [WHO-DD]",
          "stdName": "MEPROBAMATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a28763d8-c964-abfa-2d8c-ac8e3c5fa2b0"
          ],
          "display_name": false
        },
        {
          "uuid": "d9e61708-366f-40d1-b24d-a6ec3fc937ac",
          "name": "NEURAMATE",
          "stdName": "NEURAMATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd9e289b-f474-4922-b29b-e9e6bad6d22b"
          ],
          "display_name": false
        },
        {
          "uuid": "86a81bfb-6745-209e-f88c-6757dc0d94cd",
          "name": "NSC-30418",
          "stdName": "NSC-30418",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3afd9b8c-2533-ab90-43db-a1691f625354"
          ],
          "display_name": false
        },
        {
          "uuid": "09d3cff6-66ee-49a3-adc1-90652e355d50",
          "name": "Q-GESIC COMPONENT MEPROBAMATE",
          "stdName": "Q-GESIC COMPONENT MEPROBAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a235977-5e85-478f-89db-ba2b25a8f8ef",
            "f0dc33fc-1eca-44ec-9e23-d14d47e5d79b"
          ],
          "display_name": false
        },
        {
          "uuid": "6983ea76-041d-4c84-89a6-60865e0e5f00",
          "name": "TRANMEP",
          "stdName": "TRANMEP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd9e289b-f474-4922-b29b-e9e6bad6d22b"
          ],
          "display_name": false
        },
        {
          "uuid": "cddaf1ce-418e-4899-a48a-3dbf034409d8",
          "name": "meprobamate [INN]",
          "stdName": "MEPROBAMATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c89b59f-4877-4b9f-8c79-89a1224b4d5e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "27341ec5-6431-46c2-9650-4fa8095670cb",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8f4f9ed6-2aca-4b48-bc7e-2231ec436bb0",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd9e289b-f474-4922-b29b-e9e6bad6d22b",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c89b59f-4877-4b9f-8c79-89a1224b4d5e",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8cc8c72-70f0-4f7e-8e36-7139ddcc7f6b",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "995893f8-4abf-48e0-95f3-0b1dd3e33077",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9491d764-531f-4e2b-8b4a-e1193911b226",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0dc33fc-1eca-44ec-9e23-d14d47e5d79b",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a235977-5e85-478f-89db-ba2b25a8f8ef",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "718dd761-bda5-4b63-b9e5-0184e6c60623",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07b70fa4-0f12-46fd-a8c7-f74f4ca4c6da",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7bc6999-240e-4190-ab3c-618e527d6141",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "075aa496-d444-40e3-adf0-056e605cf5ba",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5998b35-113d-4d89-886a-ddd3ef580875",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2791176e-ee2d-4d8f-864a-843a728566a5",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a35edbf9-6b65-482e-a9f8-c0fc35548486",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b140ef1-a56b-46f7-89ca-8ca16288b9a5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07768ba7-00b8-4ac2-b0ea-b249d78d000d",
          "citation": "SRS import [9I7LNY769Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9I7LNY769Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af321fd0-48fb-4778-a309-877d71193c56",
          "citation": "MEPROBAMATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2bb96b63-f187-4874-9d88-347a5e5c1c4e",
          "citation": "MEPROBAMATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "58529343-6085-4789-80e5-f8dd0219c237",
          "citation": "MEPROBAMATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53722146-6e03-460a-830c-6df52253e5fc",
          "citation": "MEPROBAMATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9844ba24-9600-4d81-a01f-41611328ae90",
          "citation": "MEPROBAMATE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7541324-750b-46b4-8a48-0f06ec46a121",
          "citation": "MEPROBAMATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3547b6cf-acda-4ac8-a4c9-2081e5bd82a6",
          "citation": "MEPROBAMATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79fc8934-302b-4288-8f0c-84ef85aa53c6",
          "citation": "MEPROBAMATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0650e89f-6cc2-4830-bab5-a6c060c51554",
          "citation": "MEPROBAMATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09ff59f7-39fe-45a7-9cd6-be472fde644a",
          "citation": "MEPROBAMATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dbccaad7-89dc-461e-acac-ce883f9ba832",
          "citation": "MEPROBAMATE CIV [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "34537cda-c4fe-f329-9455-683da68cd526",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "890786c6-fe46-59af-456b-01c3b8533234",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+57-53-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "829ad2aa-5488-96f8-625e-5badfae5935c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57-53-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "878fb5c9-4a6a-dd9e-7dcf-317cf3597fcd",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+57-53-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ed14a6f0-1c30-ca18-9327-b8d44338f660",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2004320f-c5cd-4dd7-adf5-b779f3198a01",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "052f2ced-65a3-1ec0-b709-c5d727010c2e",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "3afd9b8c-2533-ab90-43db-a1691f625354",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0dd30d90-c158-3a09-9348-1a82f02fe118",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a28763d8-c964-abfa-2d8c-ac8e3c5fa2b0",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6b1c830b-ffa9-fefd-f5ef-3dd6b55ad515",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cd9c2440-7dc6-4e8e-9335-42562a84a2ac",
          "id": "cd9c2440-7dc6-4e8e-9335-42562a84a2ac",
          "molfile": "\n  Marvin  01132110372D          \n\n 15 14  0  0  0  0            999 V2000\n    2.0866   -5.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5583   -6.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3852   -6.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8647   -7.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3416   -7.8097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6371   -6.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2825   -7.3276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0031   -6.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0212   -6.0912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7211   -7.3431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1570   -7.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4287   -7.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7133   -7.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7211   -8.3540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9979   -7.1228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n 11  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\nM  END",
          "smiles": "CCCC(C)(COC(=O)N)COC(=O)N",
          "formula": "C9H18N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "acde8af6-8db6-4b5b-9258-c7a15a362714"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "218.2506",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6a25837a-09f4-4d26-81bf-fcc562fc1a4b",
      "version": "38",
      "structure": {
        "id": "476ee9a7-d096-4fe8-be07-66d8124800b3",
        "molfile": "\n  Marvin  01132103452D          \n\n 15 14  0  0  0  0            999 V2000\n    6.0031   -6.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7133   -7.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8647   -7.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9979   -7.1228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7211   -7.3431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2825   -7.3276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4287   -7.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0212   -6.0912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7211   -8.3540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6371   -6.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1570   -7.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3852   -6.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3416   -7.8097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5583   -6.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0866   -5.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3 10  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7 11  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
        "smiles": "CCCC(C)(COC(=O)N)COC(=O)N",
        "formula": "C9H18N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "218.2506",
        "optical_activity": "NONE",
        "references": [
          "07768ba7-00b8-4ac2-b0ea-b249d78d000d",
          "27341ec5-6431-46c2-9650-4fa8095670cb",
          "2c89b59f-4877-4b9f-8c79-89a1224b4d5e"
        ],
        "stereo_centers": 0
      },
      "unii": "9I7LNY769Q"
    }
  ]
}