{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "73c41573-3a1e-47b4-b9eb-ab6f08b0169e", "code": "1617-53-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1617-53-4", "code_system": "CAS", "references": [ "33c99fb3-b0ff-4a1b-a38b-b9d6124f8557", "b5a7ebf0-11e9-47fd-9531-d273fc40db92" ] }, { "uuid": "265f009a-e443-489c-bbe3-fcb07fe91302", "code": "AMENTOFLAVONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Amentoflavone", "code_system": "WIKIPEDIA", "references": [ "33c99fb3-b0ff-4a1b-a38b-b9d6124f8557" ] }, { "uuid": "152da13c-9d3e-404a-b855-4632af285eeb", "code": "5281600", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281600", "code_system": "PUBCHEM", "references": [ "33c99fb3-b0ff-4a1b-a38b-b9d6124f8557" ] }, { "uuid": "18e42da6-303d-9269-0586-0a864673cc99", "code": "DTXSID20167225", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20167225", "code_system": "EPA CompTox", "references": [ "e7bd4c8e-0493-6aaa-64e5-e6f7b46e1239" ] }, { "uuid": "17438c53-3ac7-f242-2e4b-941cb30be0aa", "code": "3991 (Number of products:2)", "comments": "Dietary Supplement Label Database|chemical|Amentoflavone", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3991&item=Amentoflavone", "code_system": "DSLD", "references": [ "c5fdfcfa-1d45-5992-e906-ac44b9653444" ] }, { "uuid": "6fd48642-d098-45a9-ac53-80b0b1837808", "code": "9I1VC79L77", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "93a94e2b-04ae-497d-812e-7ae3ec4cb606", "code": "295677", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=295677", "code_system": "NSC", "references": [ "0c879cb8-7f93-9466-6fb9-638a584de935" ] }, { "uuid": "5d830e8e-079a-7133-b0eb-96ba7626cd6b", "code": "9I1VC79L77", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(9I1VC79L77)", "code_system": "DAILYMED", "references": [ "8b327c4d-c7df-09e4-7835-446560e7661b" ] } ], "substance_class": "chemical", "names": [ { "uuid": "25f7734a-bff5-4b65-9975-2ec2a1fd0038", "name": "3''',8-BIFLAVONE, 4',4''',5,5'',7,7''-HEXAHYDROXY", "stdName": "3''',8-BIFLAVONE, 4',4''',5,5'',7,7''-HEXAHYDROXY", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8918f41b-ca1e-487d-92cd-9e8962a5024c", "99565cc1-fa36-4577-91c7-ceb7d0272ff6" ], "display_name": false }, { "uuid": "b122cf55-6fff-457e-80fd-876626411d4d", "name": "4H-1-BENZOPYRAN-4-ONE, 8-(5-(5,7-DIHYDROXY-4-OXO-4H-1-BENZOPYRAN-2-YL)-2-HYDROXYPHENYL)-5,7-DIHYDROXY-2-(4-HYDROXYPHENYL)-", "stdName": "4H-1-BENZOPYRAN-4-ONE, 8-(5-(5,7-DIHYDROXY-4-OXO-4H-1-BENZOPYRAN-2-YL)-2-HYDROXYPHENYL)-5,7-DIHYDROXY-2-(4-HYDROXYPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8cf210ab-ac98-4f56-885a-9bc7a6750a6a", "8918f41b-ca1e-487d-92cd-9e8962a5024c" ], "display_name": false }, { "uuid": "dc1a27d4-1c3b-4475-8159-c79f87b3ca45", "name": "AMENTHOFLAVONE", "stdName": "AMENTHOFLAVONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8918f41b-ca1e-487d-92cd-9e8962a5024c", "99565cc1-fa36-4577-91c7-ceb7d0272ff6" ], "display_name": false }, { "uuid": "7e662834-c27c-41ef-98d3-99894c5ec05e", "name": "AMENTOFLAVONE", "stdName": "AMENTOFLAVONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "7d7e24ca-e8e3-4ccb-9172-3c68f6e5a192", "f591663c-26d8-4dd8-93b6-7cbfcf8803fe", "8cf210ab-ac98-4f56-885a-9bc7a6750a6a", "8918f41b-ca1e-487d-92cd-9e8962a5024c" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "78ac49a9-490d-4954-8ba2-8e10c80bd8da", "name_org": "INCI" } ] }, { "uuid": "501dfe66-1d04-4c1f-b798-871ad887e220", "name": "GINKGETIN, DIDEMETHYL-", "stdName": "GINKGETIN, DIDEMETHYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8918f41b-ca1e-487d-92cd-9e8962a5024c", "99565cc1-fa36-4577-91c7-ceb7d0272ff6" ], "display_name": false }, { "uuid": "4d2e2dc7-d4e0-473d-9fbd-6bdd49a19dec", "name": "I3',II8-BIAPIGENIN", "stdName": "I3',II8-BIAPIGENIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8918f41b-ca1e-487d-92cd-9e8962a5024c", "99565cc1-fa36-4577-91c7-ceb7d0272ff6" ], "display_name": false }, { "uuid": "cc5b377f-d810-481e-87d3-1245fd6a5a9c", "name": "NSC-295677", "stdName": "NSC-295677", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "8cf210ab-ac98-4f56-885a-9bc7a6750a6a", "8918f41b-ca1e-487d-92cd-9e8962a5024c" ], "display_name": false }, { "uuid": "b03fc095-adc6-4d1f-99f5-007ba1fa9e81", "name": "TRIDEMETHYLSCIADOPITYSIN", "stdName": "TRIDEMETHYLSCIADOPITYSIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8918f41b-ca1e-487d-92cd-9e8962a5024c", "99565cc1-fa36-4577-91c7-ceb7d0272ff6" ], "display_name": false } ], "references": [ { "uuid": "f591663c-26d8-4dd8-93b6-7cbfcf8803fe", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "8918f41b-ca1e-487d-92cd-9e8962a5024c", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8cf210ab-ac98-4f56-885a-9bc7a6750a6a", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "99565cc1-fa36-4577-91c7-ceb7d0272ff6", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "33c99fb3-b0ff-4a1b-a38b-b9d6124f8557", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391317000, "tags": [ "NOMEN" ] }, { "uuid": "1a68e4d8-c374-487d-9d12-f35d70c237c2", "citation": "SRS import [9I1VC79L77]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9I1VC79L77", "doc_type": "SRS", "public_domain": true, "document_date": 1493391317000, "tags": [ "NOMEN" ] }, { "uuid": "7d7e24ca-e8e3-4ccb-9172-3c68f6e5a192", "citation": "AMENTOFLAVONE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e7bd4c8e-0493-6aaa-64e5-e6f7b46e1239", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1617-53-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c5fdfcfa-1d45-5992-e906-ac44b9653444", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "b5a7ebf0-11e9-47fd-9531-d273fc40db92", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0c879cb8-7f93-9466-6fb9-638a584de935", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "8b327c4d-c7df-09e4-7835-446560e7661b", "citation": "DAILYMED", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "01a5e911-d5c3-47e0-9f8f-b30ea9c0b8c0", "id": "01a5e911-d5c3-47e0-9f8f-b30ea9c0b8c0", "molfile": "\n Marvin 01132100242D \n\n 40 45 0 0 0 0 999 V2000\n 13.0490 -7.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7469 -7.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2606 -8.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9585 -9.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1426 -9.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6288 -8.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9309 -7.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8404 -10.1308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3541 -10.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0520 -11.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5657 -12.1895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2361 -11.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9339 -12.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4477 -13.0793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1180 -12.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6043 -11.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7884 -12.0326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9064 -11.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3927 -10.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5768 -10.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0630 -9.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3651 -9.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1810 -9.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6948 -9.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5107 -9.6075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2471 -10.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9450 -10.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1290 -10.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8269 -11.7537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6153 -10.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7994 -10.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4972 -11.2303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2856 -9.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5878 -9.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0740 -8.4040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4037 -8.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9174 -9.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7333 -9.4506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7223 -11.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0245 -10.2529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 8 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 40 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 39 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 2 0 0 0 0\n 18 19 1 0 0 0 0\n 39 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 24 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 21 26 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 38 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 37 2 0 0 0 0\n 31 32 1 0 0 0 0\n 33 31 2 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 34 2 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 39 40 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1-c2cc(=O)c3c(cc(c(-c4cc(ccc4O)-c5cc(=O)c6c(cc(cc6o5)O)O)c3o2)O)O)O", "formula": "C30H18O10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ec27df1e-eb74-47c0-8f78-d8735df4695e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "538.4591", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "fe962b1f-1b3d-45bc-b25f-749a5f9773c4", "version": "7", "structure": { "id": "04f67122-9b81-48f1-90ae-ba7c9cb08991", "molfile": "\n Marvin 01132100332D \n\n 40 45 0 0 0 0 999 V2000\n 5.8269 -11.7537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1290 -10.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9450 -10.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2471 -10.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7333 -9.4506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9174 -9.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6153 -10.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7994 -10.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2856 -9.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5878 -9.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4037 -8.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0740 -8.4040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4972 -11.2303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0630 -9.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5768 -10.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3927 -10.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9064 -11.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7223 -11.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0245 -10.2529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8404 -10.1308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3541 -10.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0520 -11.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2361 -11.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9339 -12.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4477 -13.0793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1180 -12.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6043 -11.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7884 -12.0326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5657 -12.1895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1426 -9.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9585 -9.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2606 -8.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7469 -7.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9309 -7.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6288 -8.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0490 -7.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6948 -9.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5107 -9.6075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1810 -9.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3651 -9.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 2 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 6 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 8 13 1 0 0 0 0\n 14 4 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 26 24 1 0 0 0 0\n 27 26 2 0 0 0 0\n 27 28 1 0 0 0 0\n 17 27 1 0 0 0 0\n 23 18 1 0 0 0 0\n 22 29 2 0 0 0 0\n 20 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 30 35 2 0 0 0 0\n 33 36 1 0 0 0 0\n 16 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 14 2 0 0 0 0\nM END", "smiles": "c1cc(ccc1-c2cc(=O)c3c(cc(c(-c4cc(ccc4O)-c5cc(=O)c6c(cc(cc6o5)O)O)c3o2)O)O)O", "formula": "C30H18O10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "538.4591", "optical_activity": "NONE", "references": [ "8cf210ab-ac98-4f56-885a-9bc7a6750a6a", "1a68e4d8-c374-487d-9d12-f35d70c237c2" ], "stereo_centers": 0 }, "unii": "9I1VC79L77" } ] }