{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "21f69bb3-538b-4290-9b77-37faf09a93c8", "code": "79-62-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=79-62-9", "code_system": "CAS", "references": [ "d68e0e25-73a1-4b49-bc28-499112aefa98", "d4c8563b-5474-4005-a0f2-20a028fe6b8b" ] }, { "uuid": "c14e5ff2-d25a-4c94-9ea1-0eae0447657c", "code": "C015316", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67015316", "code_system": "MESH", "references": [ "d68e0e25-73a1-4b49-bc28-499112aefa98" ] }, { "uuid": "ba8a0d94-3d27-4578-9b2a-007f8b5996b0", "code": "440560", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440560", "code_system": "PUBCHEM", "references": [ "d68e0e25-73a1-4b49-bc28-499112aefa98" ] }, { "uuid": "4255afc7-8871-4d13-8304-0245474c2b07", "code": "9H273A8B2X", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d3ca408e-1c00-8254-a45c-0e6d4b812b00", "code": "28113", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28113", "code_system": "CHEBI", "references": [ "98207d55-47f1-afa3-a6e2-1b9f1e0fd92b" ] }, { "uuid": "76a13ede-b824-213e-c88b-ad3ede13cdc8", "code": "DTXSID101000181", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101000181", "code_system": "EPA CompTox", "references": [ "98207d55-47f1-afa3-a6e2-1b9f1e0fd92b" ] }, { "uuid": "c20c863a-4478-d027-8604-5f7068ea7a4d", "code": "Dihydrolanosterol", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Dihydrolanosterol", "code_system": "WIKIPEDIA", "references": [ "ed40610a-a6aa-cbd4-101c-23affe9c562b" ] } ], "substance_class": "chemical", "names": [ { "uuid": "2ae29d14-eb71-453c-a6d6-a307e990678f", "name": "24,25-DIHYDROLANOSTEROL", "stdName": "24,25-DIHYDROLANOSTEROL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "55355b02-e3be-47db-a6ff-58ab54d70c2c", "c31dbaf3-5bc4-40df-a01d-ddb6a9898364" ], "display_name": false }, { "uuid": "99a17ba0-74c9-4e1f-bc9c-402ef33d795c", "name": "4,4,14.ALPHA.-TRIMETHYL-5.ALPHA.-CHOLEST-8-EN-3.BETA.-OL", "stdName": "4,4,14.ALPHA.-TRIMETHYL-5.ALPHA.-CHOLEST-8-EN-3.BETA.-OL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "55355b02-e3be-47db-a6ff-58ab54d70c2c", "c31dbaf3-5bc4-40df-a01d-ddb6a9898364" ], "display_name": false }, { "uuid": "bb651f3d-786c-48a6-888a-de5d0e8fe32a", "name": "5.ALPHA.-LANOST-8-EN-3.BETA.-OL", "stdName": "5.ALPHA.-LANOST-8-EN-3.BETA.-OL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "55355b02-e3be-47db-a6ff-58ab54d70c2c", "c31dbaf3-5bc4-40df-a01d-ddb6a9898364" ], "display_name": false }, { "uuid": "d2daf2c1-88b1-4a90-9be4-a98b78169c05", "name": "DIHYDROLANOSTERIN", "stdName": "DIHYDROLANOSTERIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "55355b02-e3be-47db-a6ff-58ab54d70c2c", "c31dbaf3-5bc4-40df-a01d-ddb6a9898364" ], "display_name": false }, { "uuid": "6b5667e5-17ea-42c0-88bf-88bcec72c97d", "name": "DIHYDROLANOSTEROL", "stdName": "DIHYDROLANOSTEROL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "ce46d1a4-2e3d-492a-8feb-23888fc6f3cf", "511cc5db-605f-4933-8bd9-da35a75f938d", "c31dbaf3-5bc4-40df-a01d-ddb6a9898364" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "4da331a3-1034-4323-976a-f557cd5a5e10", "name_org": "INCI" } ] }, { "uuid": "4091802c-05c3-4092-a300-4b69e43a73da", "name": "LANOST-8-EN-3-OL, (3.BETA.)-", "stdName": "LANOST-8-EN-3-OL, (3.BETA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "55355b02-e3be-47db-a6ff-58ab54d70c2c", "c31dbaf3-5bc4-40df-a01d-ddb6a9898364" ], "display_name": false }, { "uuid": "2955659d-e0f8-4336-bb79-dcb01bce7343", "name": "LANOST-8-EN-3.BETA.-OL", "stdName": "LANOST-8-EN-3.BETA.-OL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "55355b02-e3be-47db-a6ff-58ab54d70c2c", "c31dbaf3-5bc4-40df-a01d-ddb6a9898364" ], "display_name": false }, { "uuid": "40212505-c245-4552-a944-9c968f9793d5", "name": "LANOSTEROL, DIHYDRO-", "stdName": "LANOSTEROL, DIHYDRO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "55355b02-e3be-47db-a6ff-58ab54d70c2c", "c31dbaf3-5bc4-40df-a01d-ddb6a9898364" ], "display_name": false } ], "references": [ { "uuid": "511cc5db-605f-4933-8bd9-da35a75f938d", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c31dbaf3-5bc4-40df-a01d-ddb6a9898364", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "55355b02-e3be-47db-a6ff-58ab54d70c2c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d68e0e25-73a1-4b49-bc28-499112aefa98", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391490000, "tags": [ "NOMEN" ] }, { "uuid": "bd3164dc-f44c-42b2-af2e-8e323008ebec", "citation": "SRS import [9H273A8B2X]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9H273A8B2X", "doc_type": "SRS", "public_domain": true, "document_date": 1493391490000, "tags": [ "NOMEN" ] }, { "uuid": "ce46d1a4-2e3d-492a-8feb-23888fc6f3cf", "citation": "DIHYDROLANOSTEROL [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ed40610a-a6aa-cbd4-101c-23affe9c562b", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "98207d55-47f1-afa3-a6e2-1b9f1e0fd92b", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "d4c8563b-5474-4005-a0f2-20a028fe6b8b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a25a306b-2a12-495d-8970-0a2d20c878d5", "id": "a25a306b-2a12-495d-8970-0a2d20c878d5", "molfile": "\n Marvin 01132108262D \n\n 31 34 0 0 1 0 999 V2000\n 9.0697 -3.3919 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.4711 -2.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8478 -3.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4570 -3.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2352 -3.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8232 -4.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6013 -3.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6541 -4.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9007 -4.1772 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.4288 -4.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9641 -5.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1506 -5.2687 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.1506 -6.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4254 -5.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7106 -5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7106 -4.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4254 -4.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1506 -4.4553 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.1506 -3.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9888 -5.6807 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.9888 -4.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2563 -5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5416 -5.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5416 -6.5398 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.8337 -6.9658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2563 -6.9482 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.0768 -7.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4147 -7.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9888 -6.5398 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.7106 -6.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4254 -6.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 9 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 18 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 6 0 0 0\n 12 14 1 0 0 0 0\n 18 12 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 31 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 20 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 1 0 0 0\n 20 21 1 1 0 0 0\n 20 22 1 0 0 0 0\n 20 29 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 1 0 0 0\n 26 24 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 29 26 1 1 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\nM END", "smiles": "CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC3)O", "formula": "C30H52O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7dcce7fa-caad-495f-ac18-b96dbc78abef" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "428.7344", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "6fd3df49-1b93-4437-8b21-9bda257e7ee8", "version": "6", "structure": { "id": "5a57e5b8-2db7-4677-90e4-bd564b7f4eee", "molfile": "\n Marvin 01132104412D \n\n 32 35 0 0 1 0 999 V2000\n 5.9888 -7.3779 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6013 -3.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6541 -4.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8232 -4.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2352 -3.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8337 -6.9658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4570 -3.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0768 -7.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4147 -7.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5416 -6.5398 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.4711 -2.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8478 -3.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5416 -5.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2563 -6.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0697 -3.3919 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.9888 -4.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2563 -5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9888 -6.5398 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.4288 -4.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1506 -3.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4254 -4.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9007 -4.1772 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.7106 -6.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7106 -4.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9888 -5.6807 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.1506 -6.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9641 -5.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1506 -4.4553 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.4254 -6.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7106 -5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1506 -5.2687 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.4254 -5.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18 1 1 6 0 0 0\n 13 10 1 0 0 0 0\n 22 19 1 0 0 0 0\n 23 18 1 0 0 0 0\n 24 21 1 0 0 0 0\n 4 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 7 5 1 0 0 0 0\n 10 6 1 1 0 0 0\n 12 7 1 0 0 0 0\n 14 8 1 0 0 0 0\n 14 9 1 0 0 0 0\n 14 10 1 0 0 0 0\n 15 11 1 6 0 0 0\n 15 12 1 0 0 0 0\n 17 13 1 0 0 0 0\n 18 14 1 0 0 0 0\n 22 15 1 1 0 0 0\n 25 16 1 1 0 0 0\n 25 17 1 0 0 0 0\n 25 18 1 0 0 0 0\n 27 19 1 0 0 0 0\n 28 20 1 1 0 0 0\n 28 21 1 0 0 0 0\n 28 22 1 0 0 0 0\n 29 23 1 0 0 0 0\n 30 24 1 0 0 0 0\n 30 25 1 0 0 0 0\n 31 26 1 6 0 0 0\n 31 27 1 0 0 0 0\n 31 28 1 0 0 0 0\n 32 29 1 0 0 0 0\n 32 30 2 0 0 0 0\n 32 31 1 0 0 0 0\nM END", "smiles": "CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]4(C)CC[C@@H](C(C)(C)[C@]4([H])CC3)O", "formula": "C30H52O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "428.7344", "optical_activity": "UNSPECIFIED", "references": [ "bd3164dc-f44c-42b2-af2e-8e323008ebec", "55355b02-e3be-47db-a6ff-58ab54d70c2c" ], "stereo_centers": 7 }, "unii": "9H273A8B2X" } ] }