{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "99ec1394-261b-4823-a981-b69b3c35fdaf", "code": "89-04-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=89-04-3", "code_system": "CAS", "references": [ "274ebe4d-0f4e-45c9-b148-6902ac90515a", "28bf3608-9f3a-4923-9280-4000790ed391" ] }, { "uuid": "3bf1095d-3083-446f-a853-3cf45bd8953b", "code": "6960", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6960", "code_system": "PUBCHEM", "references": [ "274ebe4d-0f4e-45c9-b148-6902ac90515a" ] }, { "uuid": "1f593329-6b9d-4669-b921-b00ae7c53003", "code": "201-877-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.707", "code_system": "ECHA (EC/EINECS)", "references": [ "274ebe4d-0f4e-45c9-b148-6902ac90515a" ] }, { "uuid": "9d8878a0-9976-3cd8-b58f-21b9b637161d", "code": "5263", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5263", "code_system": "HSDB", "references": [ "efdaa55b-3f6a-f45f-d9ce-305133e81607" ] }, { "uuid": "bb9688cd-4a92-551f-5de6-00262ee20c3d", "code": "DTXSID0047533", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0047533", "code_system": "EPA CompTox", "references": [ "06340eca-4876-a218-8cf8-37629c992780" ] }, { "uuid": "5c1c7678-098c-4c95-86cb-7a331abfb03c", "code": "9GPJ04URH3", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "d543b1ce-8189-4939-aed2-e4eb05e81c02", "name": "TRI-N-OCTYL TRIMELLITATE", "stdName": "TRI-N-OCTYL TRIMELLITATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2463b12b-a072-463f-9ed9-937408d97010", "5849db35-10d3-4898-974d-138b120e1483" ], "display_name": true }, { "uuid": "922b8b8e-eef4-49cb-b9f5-84805399c50f", "name": "TRIOCTYL TRIMELLITATE", "stdName": "TRIOCTYL TRIMELLITATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2463b12b-a072-463f-9ed9-937408d97010", "e7cf6501-721a-4c20-86ca-dac386288350" ], "display_name": false } ], "references": [ { "uuid": "5849db35-10d3-4898-974d-138b120e1483", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2463b12b-a072-463f-9ed9-937408d97010", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e7cf6501-721a-4c20-86ca-dac386288350", "citation": "TOX21", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "274ebe4d-0f4e-45c9-b148-6902ac90515a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391630000, "tags": [ "NOMEN" ] }, { "uuid": "c2002e9c-e249-418d-ad73-811b1b03a1c5", "citation": "SRS import [9GPJ04URH3]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9GPJ04URH3", "doc_type": "SRS", "public_domain": true, "document_date": 1493391630000, "tags": [ "NOMEN" ] }, { "uuid": "3e20f3b0-1632-4fa2-98d8-9191c044d5d9", "citation": "CHEMID RECORD 89-04-3", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "efdaa55b-3f6a-f45f-d9ce-305133e81607", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+89-04-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "06340eca-4876-a218-8cf8-37629c992780", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=89-04-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "28bf3608-9f3a-4923-9280-4000790ed391", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0b202354-4bce-41b5-8dc9-1812ab7ae7b8", "id": "0b202354-4bce-41b5-8dc9-1812ab7ae7b8", "molfile": "\n Marvin 01132100502D \n\n 39 39 0 0 0 0 999 V2000\n 8.7728 0.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0750 0.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3474 0.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6495 0.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9134 0.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2155 0.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4837 0.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7900 0.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0540 0.1904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3475 0.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3475 1.4635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5989 0.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5989 -0.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8671 -0.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1481 -0.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5754 -1.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2985 -0.6008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5754 -1.8485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2859 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0050 -1.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7198 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4305 -1.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1453 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8559 -1.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5750 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2814 -1.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1481 0.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8671 0.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5754 0.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2985 0.2495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5754 1.4846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2012 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8611 1.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5211 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1809 1.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8281 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4880 1.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1436 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7908 1.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 28 12 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 27 15 2 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\nM END", "smiles": "CCCCCCCCOC(=O)c1ccc(c(c1)C(=O)OCCCCCCCC)C(=O)OCCCCCCCC", "formula": "C33H54O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "71210552-868d-43cc-ac41-6158a726c43d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "546.7795", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "358f4c3a-9d0b-4012-bfaf-8d863ce81e3e", "version": "4", "structure": { "id": "d090ff6d-62ec-44d0-83b7-2ce6a671bf53", "molfile": "\n Marvin 01132110472D \n\n 39 39 0 0 0 0 999 V2000\n 0.1481 0.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1481 -0.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8671 0.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5754 0.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8671 -0.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5754 -1.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5989 0.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5754 1.4846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2985 0.2495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5989 -0.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5754 -1.8485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2985 -0.6008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3475 0.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2012 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2859 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0540 0.1904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3475 1.4635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8611 1.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0050 -1.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7900 0.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5211 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7198 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4837 0.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1809 1.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4305 -1.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2155 0.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8281 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1453 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9134 0.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4880 1.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8559 -1.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6495 0.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1436 1.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5750 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3474 0.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7908 1.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2814 -1.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0750 0.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7728 0.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 1 4 1 0 0 0 0\n 2 5 2 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 8 1 0 0 0 0\n 4 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 6 11 1 0 0 0 0\n 6 12 2 0 0 0 0\n 7 13 1 0 0 0 0\n 8 14 1 0 0 0 0\n 11 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 13 17 2 0 0 0 0\n 14 18 1 0 0 0 0\n 15 19 1 0 0 0 0\n 16 20 1 0 0 0 0\n 18 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 20 23 1 0 0 0 0\n 21 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 23 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 26 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 28 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 31 34 1 0 0 0 0\n 32 35 1 0 0 0 0\n 33 36 1 0 0 0 0\n 34 37 1 0 0 0 0\n 35 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 7 10 2 0 0 0 0\nM END", "smiles": "CCCCCCCCOC(=O)c1ccc(c(c1)C(=O)OCCCCCCCC)C(=O)OCCCCCCCC", "formula": "C33H54O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "546.7795", "optical_activity": "NONE", "references": [ "c2002e9c-e249-418d-ad73-811b1b03a1c5", "3e20f3b0-1632-4fa2-98d8-9191c044d5d9" ], "stereo_centers": 0 }, "unii": "9GPJ04URH3" } ] }