{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6944af24-3e83-4de0-acc0-86f97e4dbee6",
          "code": "107-51-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=107-51-7",
          "code_system": "CAS",
          "references": [
            "01a69bc6-2b99-4ec0-ba6a-ffb7622265cc",
            "a06ccbf4-1ed3-4f57-a5b8-006d95b43663"
          ]
        },
        {
          "uuid": "a0dde340-4e63-4681-8f15-1d93673ae0f7",
          "code": "1368190",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368190/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "01a69bc6-2b99-4ec0-ba6a-ffb7622265cc"
          ]
        },
        {
          "uuid": "7871c28a-81d9-4f16-a2d7-499a05b4d19a",
          "code": "m8107",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8107?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "01a69bc6-2b99-4ec0-ba6a-ffb7622265cc"
          ]
        },
        {
          "uuid": "8377e29f-3e67-4e02-bf75-800a033c7dbd",
          "code": "24705",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24705",
          "code_system": "PUBCHEM",
          "references": [
            "01a69bc6-2b99-4ec0-ba6a-ffb7622265cc"
          ]
        },
        {
          "uuid": "c980583e-1fa9-44d1-a52d-bf9de9bc3e92",
          "code": "203-497-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.181",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "01a69bc6-2b99-4ec0-ba6a-ffb7622265cc"
          ]
        },
        {
          "uuid": "dda1b294-c5f5-07e3-82c7-2a6cf5913e4d",
          "code": "DTXSID9040710",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9040710",
          "code_system": "EPA CompTox",
          "references": [
            "9e1f0db7-a58f-6095-af82-9c5f064fc9fe"
          ]
        },
        {
          "uuid": "277b283b-3e0d-4b8b-b611-69253cd536f6",
          "code": "9G1ZW13R0G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "62bd25ad-6e4d-7c1b-8390-c967032e1382",
          "code": "9147",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9147",
          "code_system": "CHEBI",
          "references": [
            "3805229c-84ef-0e5c-1140-a1619b9f1e6c"
          ]
        },
        {
          "uuid": "92de29c0-918c-903b-f003-4f93c1ab8d69",
          "code": "48151",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:48151",
          "code_system": "CHEBI",
          "references": [
            "3805229c-84ef-0e5c-1140-a1619b9f1e6c"
          ]
        },
        {
          "uuid": "c8ca8d85-97a8-edd3-12f8-a7ed3f3c724b",
          "code": "9G1ZW13R0G",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9G1ZW13R0G",
          "code_system": "DAILYMED",
          "references": [
            "a1e8128f-e706-035c-c5f1-99de3a4570ba"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "46cfe06d-7f39-4028-b0b5-13e565921f1e",
          "name": "1,1,1,3,3,5,5,5-OCTAMETHYLTRISILOXANE",
          "stdName": "1,1,1,3,3,5,5,5-OCTAMETHYLTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f9123b-6469-4e04-9789-6559d4f31c0a",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "03e0d28f-642d-4e74-a65b-2348313d4829",
          "name": "DIMETHYLBIS(TRIMETHYLSILOXY)SILANE",
          "stdName": "DIMETHYLBIS(TRIMETHYLSILOXY)SILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f9123b-6469-4e04-9789-6559d4f31c0a",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "d2b2254b-d35e-488d-ab90-ce20a1cdbcbf",
          "name": "DM-FLUID 1.0CS",
          "stdName": "DM-FLUID 1.0CS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8058e051-22c2-4baa-93ae-ad9b32f9dda4",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "3c2b7954-0737-4b00-88f6-6457b8bc1885",
          "name": "FRD 20",
          "stdName": "FRD 20",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f9123b-6469-4e04-9789-6559d4f31c0a",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "96ee2f9c-5dcc-4fe3-9c72-2f0285abc633",
          "name": "KF 96A1",
          "stdName": "KF 96A1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f9123b-6469-4e04-9789-6559d4f31c0a",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "fea5da4a-0edc-4c5c-8cdf-6658c389ff32",
          "name": "OCTAMETHYLTRISILOXANE",
          "stdName": "OCTAMETHYLTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd276203-ded2-4ac2-9b54-8a5f3d7c88c2",
            "9f75ade5-4729-41d1-87d0-dae36fc99fb1",
            "4cb74983-7ad9-4cd7-995e-504364c5e5f5",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "efa5020f-4964-44ef-84a7-10e6ce4d2048",
          "name": "OCTAMETHYLTRISILOXANE [MI]",
          "stdName": "OCTAMETHYLTRISILOXANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cb74983-7ad9-4cd7-995e-504364c5e5f5",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "ee7b1f2c-3db8-4f16-8ea6-3023591ae3ff",
          "name": "OS 20 (SILOXANE)",
          "stdName": "OS 20 (SILOXANE)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f9123b-6469-4e04-9789-6559d4f31c0a",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "cd727a0a-6d83-4fa8-a77b-34021fe709ef",
          "name": "PENTAMETHYL(TRIMETHYLSILOXY)DISILOXANE",
          "stdName": "PENTAMETHYL(TRIMETHYLSILOXY)DISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f9123b-6469-4e04-9789-6559d4f31c0a",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "a53869fd-aff0-404d-83ea-a8923bd78211",
          "name": "PENTAMETHYL(TRIMETHYLSILYLOXY)DISILOXANE",
          "stdName": "PENTAMETHYL(TRIMETHYLSILYLOXY)DISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f9123b-6469-4e04-9789-6559d4f31c0a",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "17ee36eb-f58b-4330-a27d-e618e21325db",
          "name": "TRISILOXANE",
          "stdName": "TRISILOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e757a86e-a8f8-42ed-86c9-bf975bc86ccd",
            "8058e051-22c2-4baa-93ae-ad9b32f9dda4",
            "35f36501-9e10-475d-854b-505aa0bdbd54",
            "b20b6f09-933a-4ad7-afee-dc77d4453c7b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ef744940-af1a-4118-ade7-049e6ee28ea2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "06c6d414-3f5e-4c30-a612-2adb5bde18e2",
          "name": "TRISILOXANE, 1,1,1,3,3,5,5,5-OCTAMETHYL-",
          "stdName": "TRISILOXANE, 1,1,1,3,3,5,5,5-OCTAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f9123b-6469-4e04-9789-6559d4f31c0a",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "8d24817c-125d-4d0c-a674-c7542cb2fbd6",
          "name": "TRISILOXANE, OCTAMETHYL-",
          "stdName": "TRISILOXANE, OCTAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8058e051-22c2-4baa-93ae-ad9b32f9dda4",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "ee8056b2-c6c6-4073-b08c-11f53c6a8705",
          "name": "VOLASIL DM-1",
          "stdName": "VOLASIL DM-1",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8058e051-22c2-4baa-93ae-ad9b32f9dda4",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        },
        {
          "uuid": "861582fd-8654-46d7-b073-f77a26bbc4a5",
          "name": "XIAMETER(R) PMX-200 SILICONE FLUID 1 CST",
          "stdName": "XIAMETER(R) PMX-200 SILICONE FLUID 1 CST",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8058e051-22c2-4baa-93ae-ad9b32f9dda4",
            "35f36501-9e10-475d-854b-505aa0bdbd54"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f1f9123b-6469-4e04-9789-6559d4f31c0a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "35f36501-9e10-475d-854b-505aa0bdbd54",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8058e051-22c2-4baa-93ae-ad9b32f9dda4",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cb74983-7ad9-4cd7-995e-504364c5e5f5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e757a86e-a8f8-42ed-86c9-bf975bc86ccd",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f75ade5-4729-41d1-87d0-dae36fc99fb1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01a69bc6-2b99-4ec0-ba6a-ffb7622265cc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f08a321-8984-4ead-bc1a-af90c74051cc",
          "citation": "SRS import [9G1ZW13R0G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9G1ZW13R0G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd276203-ded2-4ac2-9b54-8a5f3d7c88c2",
          "citation": "OCTAMETHYLTRISILOXANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b20b6f09-933a-4ad7-afee-dc77d4453c7b",
          "citation": "TRISILOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9e1f0db7-a58f-6095-af82-9c5f064fc9fe",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=107-51-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a06ccbf4-1ed3-4f57-a5b8-006d95b43663",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3805229c-84ef-0e5c-1140-a1619b9f1e6c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a1e8128f-e706-035c-c5f1-99de3a4570ba",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5c9117fe-8ac0-4cf1-8e30-7ec818ba67bd",
          "id": "5c9117fe-8ac0-4cf1-8e30-7ec818ba67bd",
          "molfile": "\n  Marvin  01132104482D          \n\n 13 12  0  0  0  0            999 V2000\n    6.8702   -6.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8749   -6.0143    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.0502   -5.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6996   -6.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0051   -5.2081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0656   -4.3995    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.3013   -4.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9506   -4.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1515   -3.4725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1515   -2.6639    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.1515   -1.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2361   -2.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0063   -2.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\nM  END",
          "smiles": "C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C",
          "formula": "C8H24O2Si3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8e7f434a-0405-4d9c-a957-6086417b04d1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "236.5314",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c76daeb9-67ea-44d1-aeb6-02b25b48bfb6",
      "version": "7",
      "structure": {
        "id": "027be0de-fce5-4c98-96d9-4d9b889dfea9",
        "molfile": "\n  Marvin  01132100272D          \n\n 13 12  0  0  0  0            999 V2000\n    6.3013   -4.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0656   -4.3995    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9506   -4.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0051   -5.2081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8749   -6.0143    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.8702   -6.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0502   -5.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6996   -6.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1515   -3.4725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1515   -2.6639    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.1515   -1.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2361   -2.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0063   -2.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\nM  END",
        "smiles": "C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C",
        "formula": "C8H24O2Si3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "236.5314",
        "optical_activity": "NONE",
        "references": [
          "9f08a321-8984-4ead-bc1a-af90c74051cc",
          "8058e051-22c2-4baa-93ae-ad9b32f9dda4"
        ],
        "stereo_centers": 0
      },
      "unii": "9G1ZW13R0G"
    }
  ]
}