{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "25e1d308-373c-462b-bb4f-147ec3726080",
          "code": "962-58-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=962-58-3",
          "code_system": "CAS",
          "references": [
            "ad9fe212-825b-488a-82e5-a0698f0b7680",
            "67d7beb1-37d9-477c-9e68-92d8078e12ee"
          ]
        },
        {
          "uuid": "e62d785a-64c8-4480-9aae-35bd3ccd10fd",
          "code": "C000912",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67000912",
          "code_system": "MESH",
          "references": [
            "ad9fe212-825b-488a-82e5-a0698f0b7680"
          ]
        },
        {
          "uuid": "276c33ea-acbd-419e-a2dc-4cce78cbe923",
          "code": "657802",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2087",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ad9fe212-825b-488a-82e5-a0698f0b7680"
          ]
        },
        {
          "uuid": "c588bdf7-71ec-4e3a-b53c-9e22a0ccc1e3",
          "code": "13754",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13754",
          "code_system": "PUBCHEM",
          "references": [
            "ad9fe212-825b-488a-82e5-a0698f0b7680"
          ]
        },
        {
          "uuid": "0d80d121-28b4-ef95-a9cd-35a656a21b7b",
          "code": "DTXSID5037523",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5037523",
          "code_system": "EPA CompTox",
          "references": [
            "2dba0978-7c46-1c3d-1868-30f87f276219"
          ]
        },
        {
          "uuid": "88392fd6-bdbd-4c79-9bbb-89b0734444b6",
          "code": "9FX08D2L1U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "40f1b8e8-d9c1-4232-a60a-bbd37103e3d8",
          "name": "DIAZINON OXYGEN ANALOG",
          "stdName": "DIAZINON OXYGEN ANALOG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2181a628-0c53-4f5a-950a-a09222b32539",
            "3bba87ac-62b4-49b4-a3fa-b99dcfe42769"
          ],
          "display_name": false
        },
        {
          "uuid": "6ed3a487-8ac3-41e8-b1fc-e4c1bc754bbc",
          "name": "DIAZOXON",
          "stdName": "DIAZOXON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6443e568-73f6-487b-9a3a-7c5e006ba374"
          ],
          "display_name": true
        },
        {
          "uuid": "aa232b87-ddf8-4a61-af29-de25209df306",
          "name": "DIETHYL (6-METHYL-2-PROPAN-2-YLPYRIMIDIN-4-YL) PHOSPHATE",
          "stdName": "DIETHYL (6-METHYL-2-PROPAN-2-YLPYRIMIDIN-4-YL) PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2181a628-0c53-4f5a-950a-a09222b32539",
            "360db7b3-865f-42ad-a0be-d1cb55070061"
          ],
          "display_name": false
        },
        {
          "uuid": "9de864ea-cafd-4e5a-8d07-6d94f5b63bcd",
          "name": "PHOSPHORIC ACID, DIETHYL 6-METHYL-2-(1-METHYLETHYL)-4-PYRIMIDINYL ESTER",
          "stdName": "PHOSPHORIC ACID, DIETHYL 6-METHYL-2-(1-METHYLETHYL)-4-PYRIMIDINYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2181a628-0c53-4f5a-950a-a09222b32539",
            "360db7b3-865f-42ad-a0be-d1cb55070061"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6443e568-73f6-487b-9a3a-7c5e006ba374",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "360db7b3-865f-42ad-a0be-d1cb55070061",
          "citation": "http://chembase.com/cbid_13754.htm",
          "url": "http://chembase.com/cbid_13754.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2181a628-0c53-4f5a-950a-a09222b32539",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bba87ac-62b4-49b4-a3fa-b99dcfe42769",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad9fe212-825b-488a-82e5-a0698f0b7680",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "451329ef-363c-4778-87b6-bb1e3d7ee471",
          "citation": "SRS import [9FX08D2L1U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9FX08D2L1U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbde0d83-b155-428d-9dff-95109831d752",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2dba0978-7c46-1c3d-1868-30f87f276219",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=962-58-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67d7beb1-37d9-477c-9e68-92d8078e12ee",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e2f79303-1e74-404c-8a41-d77263c3066d",
          "id": "e2f79303-1e74-404c-8a41-d77263c3066d",
          "molfile": "\n  Marvin  01132111452D          \n\n 19 19  0  0  0  0            999 V2000\n    7.8422   -7.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8422   -6.9488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5948   -6.5112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5948   -5.6392    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4744   -5.6392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5948   -4.7813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2742   -4.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2742   -3.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6788   -5.6392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9141   -5.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1977   -5.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4850   -5.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8358   -5.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4850   -4.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1977   -3.9871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9141   -4.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1977   -3.1558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9141   -2.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4850   -2.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  9  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 16  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=O)(OCC)Oc1cc(C)nc(C(C)C)n1",
          "formula": "C12H21N2O4P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f12ee42a-5871-454a-9727-86f3ad7d5aec"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "288.2804",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2c9d399e-b6ea-45ca-b19c-5d0fde72b872",
      "version": "3",
      "structure": {
        "id": "1a6629eb-4b5d-4465-82c6-7bd13e8caadd",
        "molfile": "\n  Marvin  01132101332D          \n\n 19 19  0  0  0  0            999 V2000\n    7.6788   -5.6392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9141   -5.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9141   -4.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1977   -3.9871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4850   -4.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4850   -5.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1977   -5.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8358   -5.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1977   -3.1558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9141   -2.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4850   -2.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5948   -5.6392    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5948   -6.5112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8422   -6.9488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8422   -7.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5948   -4.7813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2742   -4.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2742   -3.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4744   -5.6392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 12 19  2  0  0  0  0\nM  END",
        "smiles": "CCOP(=O)(OCC)Oc1cc(C)nc(C(C)C)n1",
        "formula": "C12H21N2O4P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "288.2804",
        "optical_activity": "NONE",
        "references": [
          "451329ef-363c-4778-87b6-bb1e3d7ee471",
          "dbde0d83-b155-428d-9dff-95109831d752"
        ],
        "stereo_centers": 0
      },
      "unii": "9FX08D2L1U"
    }
  ]
}